{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3ad7112d-5399-420d-b9e0-7283623cc17c",
          "code": "2,4-DIFURFURYLFURAN",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4878",
          "code_system": "JECFA EVALUATION",
          "references": [
            "dcfa5ed4-15af-4ef7-83fc-a9115007e027"
          ]
        },
        {
          "uuid": "33316ddd-236d-4c3f-905b-5ca623b975b7",
          "code": "64280-32-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=64280-32-6",
          "code_system": "CAS",
          "references": [
            "dcfa5ed4-15af-4ef7-83fc-a9115007e027",
            "3d287aa1-baba-4b40-b174-e1f83c80637a"
          ]
        },
        {
          "uuid": "9bcc6c95-6989-4908-8a98-644d1419cf6c",
          "code": "53423642",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/53423642",
          "code_system": "PUBCHEM",
          "references": [
            "dcfa5ed4-15af-4ef7-83fc-a9115007e027"
          ]
        },
        {
          "uuid": "ff4d8c22-f099-165f-7409-5d5b9ce093ee",
          "code": "DTXSID90214497",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90214497",
          "code_system": "EPA CompTox",
          "references": [
            "debc9135-1384-6420-e12a-4f3210a00889"
          ]
        },
        {
          "uuid": "b5b1d388-3301-4f51-a345-67b42c4c1098",
          "code": "6Z65LJV61M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "af596f2f-9e09-9213-d174-cfd0cdbbf325",
          "code": "1487",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1487/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "5be667bc-4efd-fc94-f74a-54649b6bb876"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "acf9da80-aade-445f-95d4-57e7e9360bf8",
          "name": "2,4-BIS(2-FURYLMETHYL)FURAN",
          "stdName": "2,4-BIS(2-FURYLMETHYL)FURAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6196f9ff-ce96-4283-8b60-a106a98851a9",
            "78d2aaf9-a6ed-4c47-b47f-8a5ba3f1bd9c"
          ],
          "display_name": false
        },
        {
          "uuid": "db22f2f8-e392-42a4-91e4-06c0bc3942a5",
          "name": "2,4-DIFURFURYLFURAN",
          "stdName": "2,4-DIFURFURYLFURAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6196f9ff-ce96-4283-8b60-a106a98851a9",
            "78d2aaf9-a6ed-4c47-b47f-8a5ba3f1bd9c",
            "5d2e42b4-3778-458c-866f-246515192a20",
            "83a69e41-4dbe-403d-a4cc-bcabd4f0f254"
          ],
          "display_name": true
        },
        {
          "uuid": "9a2c4270-9f3e-48ea-a779-308157500ac0",
          "name": "2,4-DIFURFURYLFURAN [FHFI]",
          "stdName": "2,4-DIFURFURYLFURAN [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6196f9ff-ce96-4283-8b60-a106a98851a9",
            "78d2aaf9-a6ed-4c47-b47f-8a5ba3f1bd9c"
          ],
          "display_name": false
        },
        {
          "uuid": "0e4dad35-3b7b-42ce-baa5-650bb15fe186",
          "name": "FEMA NO. 4095",
          "stdName": "FEMA NO. 4095",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6196f9ff-ce96-4283-8b60-a106a98851a9",
            "78d2aaf9-a6ed-4c47-b47f-8a5ba3f1bd9c"
          ],
          "display_name": false
        },
        {
          "uuid": "9f3c9c51-9036-4de6-ad07-3f066550bf24",
          "name": "FURAN, 2,4-BIS(2-FURANYLMETHYL)-",
          "stdName": "FURAN, 2,4-BIS(2-FURANYLMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6196f9ff-ce96-4283-8b60-a106a98851a9",
            "78d2aaf9-a6ed-4c47-b47f-8a5ba3f1bd9c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5d2e42b4-3778-458c-866f-246515192a20",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "78d2aaf9-a6ed-4c47-b47f-8a5ba3f1bd9c",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6196f9ff-ce96-4283-8b60-a106a98851a9",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcfa5ed4-15af-4ef7-83fc-a9115007e027",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391211000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b28163c-8e20-4a0d-93bd-d9c58d90d1e3",
          "citation": "SRS import [6Z65LJV61M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6Z65LJV61M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391211000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47eb0efb-8780-4daf-8b2c-8a598aad2174",
          "citation": "http://www.thegoodscentscompany.com/data/rw1583241.html",
          "url": "http://www.thegoodscentscompany.com/data/rw1583241.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83a69e41-4dbe-403d-a4cc-bcabd4f0f254",
          "citation": "2,4-DIFURFURYLFURAN [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "debc9135-1384-6420-e12a-4f3210a00889",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=64280-32-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3d287aa1-baba-4b40-b174-e1f83c80637a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5be667bc-4efd-fc94-f74a-54649b6bb876",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "487e87b7-f8b2-44ed-8476-fa5e21a2980b",
          "id": "487e87b7-f8b2-44ed-8476-fa5e21a2980b",
          "molfile": "\n  Marvin  01132103482D          \n\n 17 19  0  0  0  0            999 V2000\n    6.0780   -5.6308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8644   -4.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4477   -4.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0732   -3.5151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2584   -3.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6748   -3.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8775   -3.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2102   -3.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5427   -3.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7977   -2.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6226   -2.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1293   -4.4589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8753   -5.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5164   -5.3252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2082   -5.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9948   -6.5714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1709   -6.6145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1 13  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2 12  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n 12  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n 11  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 14 13  2  0  0  0  0\n 17 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "c1cc(Cc2cc(Cc3ccco3)oc2)oc1",
          "formula": "C14H12O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4db2856d-30d2-4168-86b6-927b9eb7c6c2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "228.2438",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "97c3108b-4cf6-45fd-bf2f-b23e0322c750",
      "version": "4",
      "structure": {
        "id": "404f2678-dbb0-4b9a-a1d8-225f96a7f12b",
        "molfile": "\n  Marvin  01132103242D          \n\n 17 19  0  0  0  0            999 V2000\n    3.2102   -3.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5427   -3.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7977   -2.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6226   -2.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8775   -3.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6748   -3.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2584   -3.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0732   -3.5151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4477   -4.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8644   -4.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1293   -4.4589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0780   -5.6308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8753   -5.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5164   -5.3252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2082   -5.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9948   -6.5714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1709   -6.6145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  5  1  2  0  0  0  0\n  4  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 10 11  1  0  0  0  0\n  9 10  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8  7  1  0  0  0  0\n 11  7  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 16 17  1  0  0  0  0\n 15 16  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 13  2  0  0  0  0\n 17 13  1  0  0  0  0\nM  END",
        "smiles": "c1cc(Cc2cc(Cc3ccco3)oc2)oc1",
        "formula": "C14H12O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "228.2438",
        "optical_activity": "NONE",
        "references": [
          "1b28163c-8e20-4a0d-93bd-d9c58d90d1e3",
          "47eb0efb-8780-4daf-8b2c-8a598aad2174"
        ],
        "stereo_centers": 0
      },
      "unii": "6Z65LJV61M"
    }
  ]
}