{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0943fc21-073c-447c-8652-3726a94e07cb", "code": "1700", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1700", "code_system": "INN", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "75a458bb-9be8-47dd-9cd0-9e188a428baf", "code": "9193", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.12 Schedule II.|Substances, vegetable origin or chemical synthesis", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "228ef14f-ef67-48ac-bfab-bc42047b9149", "code": "204-733-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.304", "code_system": "ECHA (EC/EINECS)", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "7d073e7f-910d-41d6-a711-60935c9ce0f4", "code": "7081", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7081", "code_system": "IUPHAR", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "cda8c7d8-04c2-4807-9ea7-f39e06a7a234", "code": "C62033", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C62033", "code_system": "NCI_THESAURUS", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "1bf5ace9-99d6-43fe-9861-b619489f669b", "code": "m6093", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m6093?q=authorize", "code_system": "MERCK INDEX", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "561e80b3-58ca-439c-bfeb-206dd8d66787", "code": "5489", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/5489/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "45a8e464-1e3d-48c9-ab89-88a7fa155e97", "code": "DB00956", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00956", "code_system": "DRUG BANK", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "93c78db5-17fa-4654-9990-abe76f437363", "code": "CHEMBL1457", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1457", "code_system": "ChEMBL", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "f16627cf-dd15-4bee-904b-6cd1dae561ef", "code": "5284569", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5284569", "code_system": "PUBCHEM", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "11259f56-f7b1-447b-82c8-a2621515307e", "code": "R05DA03", "comments": "ATC|RESPIRATORY SYSTEM|COUGH AND COLD PREPARATIONS|COUGH SUPPRESSANTS, EXCL. COMBINATIONS WITH EXPECTORANTS|Opium alkaloids and derivatives|hydrocodone", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=R05DA03&showdescription=yes", "code_system": "WHO-ATC", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "ab9d539c-32b3-4ba5-81e4-2e0c66206d8c", "code": "N0000000174", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Opioid Receptor Interactions [MoA]|Opioid Agonists [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000174", "code_system": "NDF-RT", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "f832422c-ce83-4120-b326-203b9ccb2842", "code": "N0000175690", "comments": "Established Pharmacologic Class [EPC]|Opioid Agonist [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175690", "code_system": "NDF-RT", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "1ad6c8d1-77ad-4088-bced-6feff023c864", "code": "QR05DA03", "comments": "VATC|COUGH AND COLD PREPARATIONS|COUGH SUPPRESSANTS, EXCL. COMBINATIONS WITH EXPECTORANTS|Opium alkaloids and derivatives|hydrocodone", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR05DA03&showdescription=yes", "code_system": "WHO-VATC", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "be5467d6-1d10-4993-a625-1e45ee72e583", "code": "125-29-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=125-29-1", "code_system": "CAS", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a", "2392eb0d-3ad5-47ee-b741-a5569f824249" ] }, { "uuid": "a97f6659-7bc5-400d-8380-23810f1a1cce", "code": "D006853", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68006853", "code_system": "MESH", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "79e2d186-fedd-4e80-93d7-d641d9355549", "code": "NBK548700", "comments": "LiverTox|Analgesic|Moderate pain|Opiate", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548700/", "code_system": "LIVERTOX", "references": [ "7758b2ed-cd0f-5031-e433-e38950bf4565" ] }, { "uuid": "0c7a9368-63d6-4467-85c1-ce358ebb590f", "code": "HYDROCODONE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Hydrocodone", "code_system": "WIKIPEDIA", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "a0ca92ad-17fa-479d-bec1-bb8c6443f2ee", "code": "SUB08063MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "9a8075b6-1afd-4126-a8fd-ddaef849ab9a" ] }, { "uuid": "1320ae54-f0f3-9fff-72c5-bf7f5cc046e3", "code": "3097", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3097", "code_system": "HSDB", "references": [ "76e641af-1392-6bd9-31cb-7e9e0b650ff5" ] }, { "uuid": "2dc7b1a8-a467-31d7-1f26-367c8c17c51d", "code": "DTXSID8023131", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8023131", "code_system": "EPA CompTox", "references": [ "2b47959c-1978-2ede-6430-539640e34924" ] }, { "uuid": "e216a840-33f1-0e63-30d1-0786c3fb5da5", "code": "C67413", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413", "code_system": "NCI_THESAURUS", "references": [ "7758b2ed-cd0f-5031-e433-e38950bf4565" ] }, { "uuid": "cc4800d9-9ec7-55ed-9bf9-3d80d3cd0820", "code": "C1506", "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Alkaloid[C221]|Opioid", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1506", "code_system": "NCI_THESAURUS", "references": [ "7758b2ed-cd0f-5031-e433-e38950bf4565" ] }, { "uuid": "4bca5e40-5dd4-8c05-7710-bba23fa531f2", "code": "C66917", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Respiratory System[C78273]|Antitussive Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66917", "code_system": "NCI_THESAURUS", "references": [ "7758b2ed-cd0f-5031-e433-e38950bf4565" ] }, { "uuid": "05b8448a-1679-44a2-a106-a74390a2c8fd", "code": "6YKS4Y3WQ7", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "3923bb2a-4a42-a525-d82e-c3121b64c3e1", "code": "Hydrocodone", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM359/", "code_system": "LACTMED", "references": [ "7758b2ed-cd0f-5031-e433-e38950bf4565" ] }, { "uuid": "1881e2a3-3aa7-0f07-5e95-8c5af17d1ec8", "code": "1386", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/1386", "code_system": "DRUG CENTRAL", "references": [ "7758b2ed-cd0f-5031-e433-e38950bf4565" ] }, { "uuid": "6a374b46-50a9-5f7e-0f0f-ff68420ea63e", "code": "1314960", "type": "PRIMARY", "url": "https://store.usp.org/product/1314960", "code_system": "RS_ITEM_NUM", "references": [ "7758b2ed-cd0f-5031-e433-e38950bf4565" ] }, { "uuid": "6f3327a2-de44-6577-9ccd-3e7433d5c819", "code": "5779", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5779", "code_system": "CHEBI", "references": [ "7758b2ed-cd0f-5031-e433-e38950bf4565" ] }, { "uuid": "2270f8e6-1558-873c-f766-4ff474d7f2a1", "code": "100000084214", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "6153a386-646d-0b9e-dcee-19ebc69b5bf7" ] }, { "uuid": "47a0e588-886c-257f-20ec-47eaf040b577", "code": "19044", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=19044", "code_system": "NSC", "references": [ "bbfc6e9c-c808-0e35-c69f-48ca70217b6f" ] }, { "uuid": "53cf5555-9851-7d59-1be1-6bc0aafb90cb", "code": "6YKS4Y3WQ7", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6YKS4Y3WQ7", "code_system": "DAILYMED", "references": [ "b3e25895-6795-2966-3bea-aff6f363ef81" ] } ], "substance_class": "chemical", "references": [ { "uuid": "d3528e17-e610-4c9c-bf44-d097ab4ca0fb", "citation": "USP Dictionary", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "093fe10b-119f-4326-ae0d-cd89143059ee", "citation": "INN Proposed List 1", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8ffde577-e5b2-4b27-9ec0-5931eea30218", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "82dae3e0-7f75-4318-ae22-3a24bcea45a6", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ad2835a1-7dd5-451f-bff3-bd32ee52317c", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6c9555d4-1461-4e5c-b4d4-f5d5cc2f8c99", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "99405e7e-c5f0-41de-a075-ceb5c857f20e", "citation": "EP", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0c9b7eea-efaa-4d12-8e91-aebb0511c2da", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "569b3c29-8c49-4da9-bf47-f6faf3428ee8", "citation": "EP 7.8", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e4dc3812-9ad6-4177-bb5e-3405fcd175f8", "citation": "USP/NF", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "91b24ff8-84d5-41f3-860e-6dca9cea58ea", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "495e45f4-8b30-4588-b32e-df624eee6d51", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e0d3f700-e0f4-4aa7-b32f-dc28cab4883d", "citation": "USP-RS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9a8075b6-1afd-4126-a8fd-ddaef849ab9a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389675000, "tags": [ "NOMEN" ] }, { "uuid": "8a7a753a-d80b-4421-8d29-e331b6c8e124", "citation": "INTERNATIONAL NARCOTICS CONTROL BOARD - YELLOW LIST; ANNEX TO FORMS A, B AND C; 52ND EDITION, DECEMBER 2013; HTTP://WWW.INCB.ORG/", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3c8a0aaf-de5e-4799-a43c-16a4f99bfae8", "citation": "DMD, JULY 1978 VOL. 6 NO. 4 488-493", "url": "http://dmd.aspetjournals.org/content/6/4/488.full.pdf+html", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "df9cccd3-0212-4d74-bcf2-160c35c72305", "citation": "SRS import [6YKS4Y3WQ7]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6YKS4Y3WQ7", "doc_type": "SRS", "public_domain": true, "document_date": 1493389675000, "tags": [ "NOMEN" ] }, { "uuid": "ccb2d68f-2d14-4fd0-9ca9-dac47d85e478", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9daecd7a-7ac9-4084-8473-452287b395a1", "citation": "HYDROCODONE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f039d56d-89db-4f06-8ec1-d830ae539716", "citation": "HYDROCODONE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6411a2ff-56b5-46b4-9ebe-6450630511d3", "citation": "HYDROCODONE [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f11e6242-1f11-4434-b13a-cb285dacea74", "citation": "HYDROCODONE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6371e21b-dd8f-4f6d-95db-c1b5025e3c6b", "citation": "HYDROCODONE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "791a9991-1cae-443a-8d75-196c7a314459", "citation": "HYDROCODONE CII [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "76e641af-1392-6bd9-31cb-7e9e0b650ff5", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+125-29-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2b47959c-1978-2ede-6430-539640e34924", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=125-29-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c17bb94e-220b-a6ed-986d-f56348c89179", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+125-29-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6153a386-646d-0b9e-dcee-19ebc69b5bf7", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "7758b2ed-cd0f-5031-e433-e38950bf4565", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "2392eb0d-3ad5-47ee-b741-a5569f824249", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "94c1eae7-3b08-fd54-7fe3-d3c91237a2f3", "citation": "USP43-NF38 - 1386, Dihydrocodeine Bitartrate Monograph", "doc_type": "USPNF", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "96a75826-9bcc-4873-ac57-816229a4ac4e", "citation": "J Chromatogr B Analyt Technol Biomed Life Sci. 2003 Feb 25;785(1):81-8.", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c87bee62-d7a0-4096-a1f3-914eea738e78", "citation": "EP 10.6", "doc_type": "EP", "public_domain": true }, { "uuid": "8fd3089e-f947-b63f-1217-5b8c1adfe6af", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "bbfc6e9c-c808-0e35-c69f-48ca70217b6f", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "b3e25895-6795-2966-3bea-aff6f363ef81", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9a929c79-fc7c-4b5b-a62b-c746f11b148a", "id": "9a929c79-fc7c-4b5b-a62b-c746f11b148a", "molfile": "\n Marvin 01132108022D \n\n 22 26 0 0 1 0 999 V2000\n 3.7089 -5.4274 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 2.8848 -5.9219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0441 -5.4274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4520 -4.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0441 -4.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4520 -3.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2927 -3.2680 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 3.6884 -2.6251 0.0000 N 0 0 1 0 0 0 0 0 0 0 0 0\n 3.6718 -1.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8106 -2.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8106 -3.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2927 -4.7103 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 3.7089 -4.0098 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.5496 -4.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9452 -4.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5291 -5.4274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0071 -6.0085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2239 -4.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8078 -4.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2239 -5.4274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6800 -5.9590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0247 -5.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 12 1 1 0 0 0 0\n 1 16 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 20 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 12 4 1 6 0 0 0\n 5 6 1 0 0 0 0\n 18 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 1 0 0 0\n 13 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 6 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\nM END", "smiles": "CN1CC[C@@]23[C@H]4CCC(=O)[C@@H]2Oc5c(ccc(C[C@H]41)c53)OC", "formula": "C18H21NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "eb88ec8d-4360-4215-9bd7-8d7aba3b89ca" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "299.3649", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "ca71f0c3-65e5-476e-aaa3-9b32f6406472", "version": "39", "structure": { "id": "2a25adaf-9cf1-4e47-a4f2-e2d4abd2423c", "molfile": "\n Marvin 01132102182D \n\n 24 28 0 0 1 0 999 V2000\n 3.2927 -4.7103 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.4520 -4.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7089 -5.4274 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.0441 -5.4274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7089 -4.0098 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.8848 -5.9219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2927 -3.2680 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.0441 -4.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4520 -3.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6884 -2.6251 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 2.8106 -3.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5291 -5.4274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5496 -4.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2239 -5.4274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8106 -2.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2239 -4.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9452 -4.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0071 -6.0085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8078 -4.7103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6800 -5.9590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6718 -1.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0247 -5.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7213 -6.2228 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1087 -3.3051 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 3 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 2 2 0 0 0 0\n 9 7 1 0 0 0 0\n 10 15 1 0 0 0 0\n 1 11 1 1 0 0 0\n 12 3 1 0 0 0 0\n 13 5 1 0 0 0 0\n 14 4 2 0 0 0 0\n 15 11 1 0 0 0 0\n 16 8 1 0 0 0 0\n 17 13 1 0 0 0 0\n 18 12 2 0 0 0 0\n 19 16 2 0 0 0 0\n 20 14 1 0 0 0 0\n 21 10 1 0 0 0 0\n 22 20 1 0 0 0 0\n 3 23 1 1 0 0 0\n 5 24 1 1 0 0 0\n 6 4 1 0 0 0 0\n 7 10 1 1 0 0 0\n 12 17 1 0 0 0 0\n 8 9 1 0 0 0 0\n 14 19 1 0 0 0 0\nM END", "smiles": "CN1CC[C@@]23[C@@]4([H])CCC(=O)[C@]2([H])Oc5c(ccc(C[C@H]41)c53)OC", "formula": "C18H21NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "299.3649", "optical_activity": "( - )", "references": [ "df9cccd3-0212-4d74-bcf2-160c35c72305", "ccb2d68f-2d14-4fd0-9ca9-dac47d85e478", "093fe10b-119f-4326-ae0d-cd89143059ee" ], "stereo_centers": 4 }, "unii": "6YKS4Y3WQ7", "relationships": [ { "uuid": "d3879b71-e226-43bf-b4ad-68ecd0e5cc04", "amount": { "uuid": "7efd362e-e836-466d-aaca-c1aa40cfff91" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "5bf7dfcf-81e0-4dfa-8cb1-dc99ec85c5de", "refuuid": "ca71f0c3-65e5-476e-aaa3-9b32f6406472", "name": "HYDROCODONE", "unii": "6YKS4Y3WQ7", "linking_id": "6YKS4Y3WQ7", "ref_pname": "HYDROCODONE", "substance_class": "reference" } }, { "uuid": "fbf2c0c2-2d06-45b9-9d6d-d4339f55f78d", "amount": { "uuid": "bb2f91ac-d00c-4db4-9a68-21b10b92c663" }, "type": "METABOLITE ACTIVE->PARENT", "references": [ "96a75826-9bcc-4873-ac57-816229a4ac4e" ], "related_substance": { "uuid": "ad211d78-3e2b-49c0-b9e1-c00b5faa345e", "refuuid": "34f3dfeb-f0af-4718-a619-9f5d0b1259d4", "name": "NORHYDROCODONE", "unii": "18NB5F1JT4", "linking_id": "18NB5F1JT4", "ref_pname": "NORHYDROCODONE", "substance_class": "reference" } }, { "uuid": "6887051f-31a5-442e-a534-048a0a1f94dd", "amount": { "uuid": "06b1e33e-59ba-4919-ae3d-e6f0ca397f5d", "type": "RELATIONSHIP_AMOUNT", "average": 61 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "SALT/SOLVATE->PARENT", "references": [ "8a7a753a-d80b-4421-8d29-e331b6c8e124" ], "related_substance": { "uuid": "75767c81-8891-4604-92e7-1106128f9004", "refuuid": "bbec055a-32f1-414c-850f-5e9a82b35256", "name": "HYDROCODONE BITARTRATE", "unii": "NO70W886KK", "linking_id": "NO70W886KK", "ref_pname": "HYDROCODONE BITARTRATE", "substance_class": "reference" } }, { "uuid": "786013ce-9bbe-4ceb-a7eb-bc2ff71102e1", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "fa29fe48-cfe8-4913-9617-cba1be8d82eb", "refuuid": "9f88e184-225d-48a5-9f4c-12268f75dfea", "name": "HYDROCODONE BITARTRATE ANHYDROUS", "unii": "9GU1G05Y03", "linking_id": "9GU1G05Y03", "ref_pname": "HYDROCODONE BITARTRATE ANHYDROUS", "substance_class": "reference" } }, { "uuid": "bc6401a4-32e4-4efe-a176-2d3c35755e06", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "5900ee89-7406-45e3-becb-f330e93c7cf8", "refuuid": "2ff6fb3a-c570-4a4d-8abb-ab7f502796c3", "name": "HYDROCODONE HYDROCHLORIDE", "unii": "QKZ0920OV3", "linking_id": "QKZ0920OV3", "ref_pname": "HYDROCODONE HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "5909c4b4-bfc6-4257-8af2-c6cad7ab0f72", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "e1a00356-f794-43d2-b6bc-524ff30a8a07", "refuuid": "1d6467b0-7422-4c9d-8a16-a9446dcc6264", "name": "HYDROCODONE TANNATE", "unii": "68T7388F5H", "linking_id": "68T7388F5H", "ref_pname": "HYDROCODONE TANNATE", "substance_class": "reference" } }, { "uuid": "331139a4-ecb1-4e26-af58-599185dafe34", "amount": { "uuid": "37171edb-6138-4755-98b8-736aaddbcc30", "type": "RELATIONSHIP_AMOUNT", "average": 64 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "SALT/SOLVATE->PARENT", "references": [ "8a7a753a-d80b-4421-8d29-e331b6c8e124" ], "related_substance": { "uuid": "6642fb2d-5572-4e32-93aa-d6aa48eaceef", "refuuid": "96ceff16-6489-4dc4-9900-1b20b24d41c7", "name": "HYDROCODONE TEREPHTHALATE", "unii": "DC7N64C409", "linking_id": "DC7N64C409", "ref_pname": "HYDROCODONE TEREPHTHALATE", "substance_class": "reference" } }, { "uuid": "09f2ee99-a8f0-48bc-b67e-8ca3751c3420", "amount": { "uuid": "8ea6bfdb-453f-4a0e-bb85-0311c9a54bfc", "type": "RELATIONSHIP_AMOUNT", "average": 70 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "SALT/SOLVATE->PARENT", "references": [ "8a7a753a-d80b-4421-8d29-e331b6c8e124" ], "related_substance": { "uuid": "40a9604c-0415-4b5e-ba70-5271113e41f9", "refuuid": "d4ed5f38-4e70-433c-b29f-7fd022c79596", "name": "HYDROCODONE HYDROIODIDE", "unii": "6D04Y0152T", "linking_id": "6D04Y0152T", "ref_pname": "HYDROCODONE HYDROIODIDE", "substance_class": "reference" } }, { "uuid": "b766632a-c0d3-459d-a70f-920eff71c81b", "amount": { "uuid": "42a6a4cc-d678-421e-8b65-04b5638a9af8", "type": "RELATIONSHIP_AMOUNT", "average": 81 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "SALT/SOLVATE->PARENT", "references": [ "8a7a753a-d80b-4421-8d29-e331b6c8e124" ], "related_substance": { "uuid": "307f5fec-c97d-429c-835d-469b627c4f3d", "refuuid": "ad3b19d5-e317-4153-a988-d5b5d15f7cae", "name": "HYDROCODONE HYDROCHLORIDE DIHYDRATE", "unii": "PPK4BVC0DX", "linking_id": "PPK4BVC0DX", "ref_pname": "HYDROCODONE HYDROCHLORIDE DIHYDRATE", "substance_class": "reference" } }, { "uuid": "9543be21-7c89-4b2f-9f6c-2a9614eec62e", "amount": { "uuid": "5bdb4ca0-18be-48ec-8262-6037372941b6", "type": "RELATIONSHIP_AMOUNT", "average": 63 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "DERIVATIVE->PARENT", "references": [ "8a7a753a-d80b-4421-8d29-e331b6c8e124" ], "related_substance": { "uuid": "43912a77-0632-4e62-b554-a9e4e1c20469", "refuuid": "96ceff16-6489-4dc4-9900-1b20b24d41c7", "name": "HYDROCODONE TEREPHTHALATE", "unii": "DC7N64C409", "linking_id": "DC7N64C409", "ref_pname": "HYDROCODONE TEREPHTHALATE", "substance_class": "reference" } }, { "uuid": "664ee23e-56f5-4021-af2b-685fb58edeba", "amount": { "uuid": "646cab98-5dfd-4b0d-a346-56614c97c7a4", "type": "RELATIONSHIP_AMOUNT", "average": 85 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "SALT/SOLVATE->PARENT", "references": [ "8a7a753a-d80b-4421-8d29-e331b6c8e124" ], "related_substance": { "uuid": "8fc42d6b-55be-4dda-8c85-b9c6787c2d02", "refuuid": "9b21e743-d9f2-49e8-bd82-71effb3b9d26", "name": "HYDROCODONE HYDROCHLORIDE MONOHYDRATE", "unii": "229E1EUY20", "linking_id": "229E1EUY20", "ref_pname": "HYDROCODONE HYDROCHLORIDE MONOHYDRATE", "substance_class": "reference" } }, { "uuid": "25ce6bb0-8ea1-4a5c-ab93-c555faa10378", "comments": "trace amount", "qualification": "URINE", "type": "METABOLITE->PARENT", "interaction_type": "MINOR", "references": [ "3c8a0aaf-de5e-4799-a43c-16a4f99bfae8" ], "related_substance": { "uuid": "218a0d56-c092-4451-a87b-02688d772675", "refuuid": "fcd21810-8a14-4d84-9635-09821c844bda", "name": "DIHYDROMORPHINE", "unii": "C3S5FRP6JW", "linking_id": "C3S5FRP6JW", "ref_pname": "DIHYDROMORPHINE", "substance_class": "reference" } }, { "uuid": "a3a0a865-e8e3-4103-acae-e86c5c5b5d46", "comments": "Trace amount", "qualification": "URINE", "type": "METABOLITE->PARENT", "interaction_type": "MINOR", "references": [ "3c8a0aaf-de5e-4799-a43c-16a4f99bfae8" ], "related_substance": { "uuid": "eb1db555-eb65-48c5-8a3e-0b42535f778b", "refuuid": "c07c60be-345e-4792-8425-7811c31f02d7", "name": "HYDROMORPHOL, 6.BETA.-", "unii": "5U0JDQ5Z5U", "linking_id": "5U0JDQ5Z5U", "ref_pname": "HYDROMORPHOL, 6.BETA.-", "substance_class": "reference" } }, { "uuid": "ba21ba7d-0613-4686-98f8-a4b7f35cf060", "type": "SUB_CONCEPT->SUBSTANCE", "related_substance": { "uuid": "7b1d61dd-8e2f-4cb1-af5e-2c62f9a866e5", "refuuid": "e3266745-10cb-4ad3-a329-c28e49034651", "name": "HYDROCODONE POLISTIREX", "linking_id": "e3266745-10cb-4ad3-a329-c28e49034651", "ref_pname": "HYDROCODONE POLISTIREX", "substance_class": "reference" } }, { "uuid": "c164d580-2c19-41df-8397-3ad2e26963ca", "type": "SUB_CONCEPT->SUBSTANCE", "related_substance": { "uuid": "240b1cb5-4600-414e-8d50-348cdd95ca83", "refuuid": "4cdc54f7-b1fd-47d7-bbda-2764b1abbb30", "name": "HYDROCODONE RESIN COMPLEX", "linking_id": "4cdc54f7-b1fd-47d7-bbda-2764b1abbb30", "ref_pname": "HYDROCODONE RESIN COMPLEX", "substance_class": "reference" } }, { "uuid": "7abb7b7d-1106-4fce-bef0-30772b6beb91", "amount": { "uuid": "3843bf91-5a20-4fbd-8b37-98e90e58caeb", "units": "PERCENT PEAK AREA", "high_limit": 0.5 }, "qualification": "USP", "type": "PARENT->IMPURITY", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "94c1eae7-3b08-fd54-7fe3-d3c91237a2f3" ], "related_substance": { "uuid": "45476f0f-46c6-4082-b2f2-c144a62793ca", "refuuid": "ee6bb6e3-ed89-4666-8512-9e03078c3f87", "name": "DIHYDROCODEINE BITARTRATE", "unii": "8LXS95BSA9", "linking_id": "8LXS95BSA9", "ref_pname": "DIHYDROCODEINE BITARTRATE", "substance_class": "reference" } }, { "uuid": "a7999c2e-28ed-4af6-9717-b9174a4d7f8f", "amount": { "uuid": "f42c13ba-973b-42f8-b402-6a40225b5774" }, "type": "PRODRUG->METABOLITE ACTIVE", "related_substance": { "uuid": "82b04dcf-3d70-488b-8bde-e4e4cf510c7c", "refuuid": "ff07a5dc-0d44-4dc7-b145-ae3833b54903", "name": "BENZHYDROCODONE", "unii": "75MS0AAZ9I", "linking_id": "75MS0AAZ9I", "ref_pname": "BENZHYDROCODONE", "substance_class": "reference" } } ], "names": [ { "uuid": "e44fd290-c677-46c8-8321-07d4b486e0d1", "name": "(-)-DIHYDROCODEINONE", "stdName": "(-)-DIHYDROCODEINONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0c9b7eea-efaa-4d12-8e91-aebb0511c2da", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "dc5d6edd-9bd6-4fce-8b2e-d3d307699e76", "name": "(5.ALPHA.)-3-METHOXY-17-METHYL-4,5-EPOXYMORPHINAN-6-ONE", "stdName": "(5.ALPHA.)-3-METHOXY-17-METHYL-4,5-EPOXYMORPHINAN-6-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2392eb0d-3ad5-47ee-b741-a5569f824249" ], "display_name": false }, { "uuid": "f99f436f-078b-4378-9e3a-4f99a2c6b2ef", "name": "BEKADID", "stdName": "BEKADID", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "495e45f4-8b30-4588-b32e-df624eee6d51", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "edede853-ef12-e757-94c4-9590113b9d19", "name": "DIHYDROCODEINE HYDROGEN TARTRATE IMPURITY C [EP IMPURITY]", "stdName": "DIHYDROCODEINE HYDROGEN TARTRATE IMPURITY C [EP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "99405e7e-c5f0-41de-a075-ceb5c857f20e", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "72854a24-399a-4eb6-b81e-af8c1c1dab17", "name": "DIHYDROCODEINONE", "stdName": "DIHYDROCODEINONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "57631782-fcc7-4c57-9228-a418926b84ae", "name": "HYDROCODON", "stdName": "HYDROCODON", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "495e45f4-8b30-4588-b32e-df624eee6d51", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "3d87f5aa-c0c5-4aa8-bd90-a85747d4aa49", "name": "HYDROCODONE", "stdName": "HYDROCODONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "6411a2ff-56b5-46b4-9ebe-6450630511d3", "ad2835a1-7dd5-451f-bff3-bd32ee52317c", "f039d56d-89db-4f06-8ec1-d830ae539716", "9daecd7a-7ac9-4084-8473-452287b395a1", "6c9555d4-1461-4e5c-b4d4-f5d5cc2f8c99", "91b24ff8-84d5-41f3-860e-6dca9cea58ea", "f11e6242-1f11-4434-b13a-cb285dacea74", "d3528e17-e610-4c9c-bf44-d097ab4ca0fb", "8ffde577-e5b2-4b27-9ec0-5931eea30218", "093fe10b-119f-4326-ae0d-cd89143059ee", "82dae3e0-7f75-4318-ae22-3a24bcea45a6", "6371e21b-dd8f-4f6d-95db-c1b5025e3c6b" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "0c535671-5dde-454a-9308-3f16f113a17b", "name_org": "INN" } ] }, { "uuid": "c4e91a8d-70e5-46ba-b585-4dc6653f0cd4", "name": "HYDROCODONE CII [USP-RS]", "stdName": "HYDROCODONE CII [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e0d3f700-e0f4-4aa7-b32f-dc28cab4883d", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "52068f4d-cf6d-472e-9969-9dd59d9a2d46", "name": "HYDROCODONE [HSDB]", "stdName": "HYDROCODONE [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ad2835a1-7dd5-451f-bff3-bd32ee52317c", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "5d70b4e9-4e2d-413a-a5ec-99f75380bee7", "name": "HYDROCODONE [MI]", "stdName": "HYDROCODONE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8ffde577-e5b2-4b27-9ec0-5931eea30218", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "687effd6-c3c6-4bdd-bdfd-322e9dd2aba1", "name": "HYDROCODONE [VANDF]", "stdName": "HYDROCODONE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6c9555d4-1461-4e5c-b4d4-f5d5cc2f8c99", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "c988412c-9dca-4eae-8f1f-2ca91768edad", "name": "HYDROCODONE-", "stdName": "HYDROCODONE-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "495e45f4-8b30-4588-b32e-df624eee6d51", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "0d58a2b8-6451-320e-6c6c-b2e7999698cc", "name": "Hydrocodone [WHO-DD]", "stdName": "HYDROCODONE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fd3089e-f947-b63f-1217-5b8c1adfe6af" ], "display_name": false }, { "uuid": "d0f2a215-415a-476c-82d1-827494acc495", "name": "MULTACODIN", "stdName": "MULTACODIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "495e45f4-8b30-4588-b32e-df624eee6d51", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "939388e8-2599-4d77-abe8-2079119c538b", "name": "NSC-19044", "stdName": "NSC-19044", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "0c9b7eea-efaa-4d12-8e91-aebb0511c2da", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "cbff4b99-d4e1-bc0b-ba14-5447724f4d04", "name": "OXYCODONE HYDROCHLORIDE IMPURITY E [EP IMPURITY]", "stdName": "OXYCODONE HYDROCHLORIDE IMPURITY E [EP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c87bee62-d7a0-4096-a1f3-914eea738e78" ], "display_name": false }, { "uuid": "00935e0a-48b4-686f-794b-5b98696334e8", "name": "OXYCODONE HYDROCHLORIDE, HYDROCODONE- [USP IMPURITY]", "stdName": "OXYCODONE HYDROCHLORIDE, HYDROCODONE- [USP IMPURITY]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e4dc3812-9ad6-4177-bb5e-3405fcd175f8", "82dae3e0-7f75-4318-ae22-3a24bcea45a6" ], "display_name": false }, { "uuid": "531b8410-f706-4f9e-9885-94d4aa85031a", "name": "hydrocodone [INN]", "stdName": "HYDROCODONE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "093fe10b-119f-4326-ae0d-cd89143059ee" ], "display_name": false } ], "modifications": { "uuid": "1052c2d2-7a7c-4f2a-89cd-dbf60b4ab0ad" } } ] }