{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4c48446d-3c94-4d47-a408-146fa43bd91c",
          "code": "CHEMBL2110826",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110826",
          "code_system": "ChEMBL",
          "references": [
            "a4470f87-9ea9-48f5-9deb-8a4638f6118f"
          ]
        },
        {
          "uuid": "e5748bfb-c6c2-43ac-82be-e8b3c7aded1c",
          "code": "23675742",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23675742",
          "code_system": "PUBCHEM",
          "references": [
            "a4470f87-9ea9-48f5-9deb-8a4638f6118f"
          ]
        },
        {
          "uuid": "ad200883-ad17-4ba1-af57-f479f8ec657b",
          "code": "7009-49-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7009-49-6",
          "code_system": "CAS",
          "references": [
            "a4470f87-9ea9-48f5-9deb-8a4638f6118f",
            "35be5052-f2ba-41c2-8182-f80f90007e12"
          ]
        },
        {
          "uuid": "df23c5a9-fb4a-4881-9816-2fe1197b3c08",
          "code": "C83746",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83746",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a4470f87-9ea9-48f5-9deb-8a4638f6118f"
          ]
        },
        {
          "uuid": "71049993-84d4-4d69-92df-1ea39b155a0d",
          "code": "C082676",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67082676",
          "code_system": "MESH",
          "references": [
            "a4470f87-9ea9-48f5-9deb-8a4638f6118f"
          ]
        },
        {
          "uuid": "f23aa138-0454-4c19-a673-fdb9505284d8",
          "code": "SUB10564MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a4470f87-9ea9-48f5-9deb-8a4638f6118f"
          ]
        },
        {
          "uuid": "c5401b8f-b5d6-4d71-ae06-034617b86d66",
          "code": "947",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=947",
          "code_system": "INN",
          "references": [
            "a4470f87-9ea9-48f5-9deb-8a4638f6118f"
          ]
        },
        {
          "uuid": "669fd8ce-b095-4400-8ffd-eaa45a8a09a5",
          "code": "m233",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m233?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a4470f87-9ea9-48f5-9deb-8a4638f6118f"
          ]
        },
        {
          "uuid": "977f924e-f958-61b3-2608-8e940d6cc5cd",
          "code": "DTXSID60220363",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60220363",
          "code_system": "EPA CompTox",
          "references": [
            "61618260-86f6-a261-2045-7d840656ca0f"
          ]
        },
        {
          "uuid": "5e9923fc-2043-2aa1-65df-3f90d66c4e6e",
          "code": "C47795",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|CNS Stimulant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47795",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5dfaf2c4-7484-87a7-6cd5-1d6e76feb4cc"
          ]
        },
        {
          "uuid": "c3977e96-b3d8-48f4-86f2-12a8fbf17649",
          "code": "6XI46H39BZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7488fb5f-1455-0f07-d081-681fc82435f9",
          "code": "3459",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3459",
          "code_system": "DRUG CENTRAL",
          "references": [
            "5dfaf2c4-7484-87a7-6cd5-1d6e76feb4cc"
          ]
        },
        {
          "uuid": "4766cf0e-6e6b-5937-1733-dd5f6fee71f0",
          "code": "134805",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:134805",
          "code_system": "CHEBI",
          "references": [
            "5dfaf2c4-7484-87a7-6cd5-1d6e76feb4cc"
          ]
        },
        {
          "uuid": "b0246254-590f-34ed-356e-0add0c594fe9",
          "code": "100000083531",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5031ff4a-e373-02c9-9438-2f9f67ef4537"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ee076622-0f31-4568-b47c-2b79fb96a343",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "0b831779-1981-4407-9595-8cc9aafdb15d",
            "refuuid": "155418e1-5dbd-42b1-9920-894348366c59",
            "name": "HEXACYCLONIC ACID",
            "unii": "2K0FP9UB6A",
            "linking_id": "2K0FP9UB6A",
            "ref_pname": "HEXACYCLONIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "38ec5304-2a62-4474-a675-419e781049c6",
          "name": "1-(HYDROXYMETHYL)CYCLOHEXANEACETATE SODIUM SALT",
          "stdName": "1-(HYDROXYMETHYL)CYCLOHEXANEACETATE SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00bb34b2-7863-41d9-a401-2574620c63cf"
          ],
          "display_name": false
        },
        {
          "uuid": "e1c9dc23-089e-4bbf-9ebb-fad9eb4c1076",
          "name": "HEXACYCLONATE SODIUM",
          "stdName": "HEXACYCLONATE SODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00bb34b2-7863-41d9-a401-2574620c63cf",
            "5a7069e4-aa28-427c-b95f-32236c4aece6",
            "4e330e52-c140-44d7-979d-a7863273deb1"
          ],
          "display_name": true
        },
        {
          "uuid": "882e25c9-c931-401d-be89-52923df1d75b",
          "name": "HEXACYCLONATE SODIUM [MI]",
          "stdName": "HEXACYCLONATE SODIUM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a7069e4-aa28-427c-b95f-32236c4aece6"
          ],
          "display_name": false
        },
        {
          "uuid": "1da3a8ef-e0b5-4450-a31a-5a7649ced55f",
          "name": "SODIUM 1-(HYDROXYMETHYL)CYCLOHEXANEACETATE",
          "stdName": "SODIUM 1-(HYDROXYMETHYL)CYCLOHEXANEACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48a02ee5-66e4-4d3b-a62e-a2abd00e71c2"
          ],
          "display_name": false
        },
        {
          "uuid": "a6f758d3-6ae3-4bad-93f8-cc14eaf1803f",
          "name": "SODIUM HEXACYCLONATE",
          "stdName": "SODIUM HEXACYCLONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fa562b4-611d-40ff-9ccc-aae60c3901f5",
            "425ddffe-329c-4c01-b7ff-892682f97a2c",
            "4f8b528b-f2da-4c7a-bc16-2e31290d2478"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "bf930fb9-3193-4a8d-91ce-5f467528fefc",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d9252ff2-668d-438f-bb7b-40ab5fadd358",
          "name": "sodium hexacyclonate [INN]",
          "stdName": "SODIUM HEXACYCLONATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f8b528b-f2da-4c7a-bc16-2e31290d2478"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "00bb34b2-7863-41d9-a401-2574620c63cf",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "425ddffe-329c-4c01-b7ff-892682f97a2c",
          "citation": "EMEA 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f8b528b-f2da-4c7a-bc16-2e31290d2478",
          "citation": "INN Proposed List 10",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL10.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "48a02ee5-66e4-4d3b-a62e-a2abd00e71c2",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a7069e4-aa28-427c-b95f-32236c4aece6",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4470f87-9ea9-48f5-9deb-8a4638f6118f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a279bb1d-fc91-47d8-9d59-0644daf1bcd5",
          "citation": "SRS import [6XI46H39BZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6XI46H39BZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fa562b4-611d-40ff-9ccc-aae60c3901f5",
          "citation": "SODIUM HEXACYCLONATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4e330e52-c140-44d7-979d-a7863273deb1",
          "citation": "HEXACYCLONATE SODIUM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "61618260-86f6-a261-2045-7d840656ca0f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7009-49-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5031ff4a-e373-02c9-9438-2f9f67ef4537",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "5dfaf2c4-7484-87a7-6cd5-1d6e76feb4cc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "35be5052-f2ba-41c2-8182-f80f90007e12",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "89870445-3306-45a6-9c58-3518123578d5",
          "id": "89870445-3306-45a6-9c58-3518123578d5",
          "molfile": "\n  Marvin  01132107092D          \n\n  1  0  0  0  0  0            999 V2000\n    2.8535   -2.3397    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "93425159-ec83-499b-892a-5e59e41f5655"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b1704e36-719d-40fb-b60e-df8a41ca6efb",
          "id": "b1704e36-719d-40fb-b60e-df8a41ca6efb",
          "molfile": "\n  Marvin  01132109122D          \n\n 12 12  0  0  0  0            999 V2000\n    1.6901   -2.7774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7251   -1.9563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4895   -1.6888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0873   -1.4314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3305   -1.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1874   -0.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5821   -0.6281    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.4971   -1.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8983   -2.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4957   -3.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3293   -3.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7458   -2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  8  5  1  0  0  0  0\n 12  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  CHG  1   7  -1\nM  END",
          "smiles": "C1CCC(CC1)(CC(=O)O)C[O-]",
          "formula": "C9H15O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "94428f52-afd5-4b00-af6d-b924b3ec6f7d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "171.2139",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1a75e9e1-858d-4dff-b233-dc1114121b9e",
      "version": "8",
      "structure": {
        "id": "8f968147-8ff1-4d82-8661-80368fd52c90",
        "molfile": "\n  Marvin  01132107272D          \n\n 13 12  0  0  0  0            999 V2000\n    1.7251   -1.9563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6901   -2.7774    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.3305   -1.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4895   -1.6888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0873   -1.4314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5821   -0.6281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1874   -0.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7458   -2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4971   -1.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8983   -2.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3293   -3.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4957   -3.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8535   -2.3397    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12 11  1  0  0  0  0\n 10 12  1  0  0  0  0\nM  CHG  2   2  -1  13   1\nM  END",
        "smiles": "C1CCC(CC1)(CC(=O)[O-])CO.[Na+]",
        "formula": "C9H15O3.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "194.2037",
        "optical_activity": "NONE",
        "references": [
          "00bb34b2-7863-41d9-a401-2574620c63cf",
          "a279bb1d-fc91-47d8-9d59-0644daf1bcd5",
          "4f8b528b-f2da-4c7a-bc16-2e31290d2478"
        ],
        "stereo_centers": 0
      },
      "unii": "6XI46H39BZ"
    }
  ]
}