{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "489b7479-06f5-49a0-825c-7aec67496587", "code": "473-98-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=473-98-3", "code_system": "CAS", "references": [ "d0286851-83f4-4865-bfee-2183a371bd69", "8c9758c8-26e4-4215-81da-a9528347abee" ] }, { "uuid": "655c20c8-3441-45c5-84ac-00ff10d1c78a", "code": "C002503", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67002503", "code_system": "MESH", "references": [ "d0286851-83f4-4865-bfee-2183a371bd69" ] }, { "uuid": "b41f6872-2b1f-4c7e-a5a3-37ed0cbbe1f1", "code": "207-475-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.797", "code_system": "ECHA (EC/EINECS)", "references": [ "d0286851-83f4-4865-bfee-2183a371bd69" ] }, { "uuid": "1602f963-f2e6-410e-9e7b-60c46518bac7", "code": "m2462", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m2462?q=authorize", "code_system": "MERCK INDEX", "references": [ "d0286851-83f4-4865-bfee-2183a371bd69" ] }, { "uuid": "2ee9b034-2d60-4b5b-b1b2-1d12118bafb4", "code": "72326", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72326", "code_system": "PUBCHEM", "references": [ "d0286851-83f4-4865-bfee-2183a371bd69" ] }, { "uuid": "7785f3de-b1e0-435b-34cd-81417036f167", "code": "Betulin", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Betulin", "code_system": "WIKIPEDIA", "references": [ "55812b49-cd0a-3119-1cd3-16e1068c93c5" ] }, { "uuid": "e8eacd83-9389-4867-a920-e55a842ae98d", "code": "6W70HN7X7O", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "383c2123-39c4-9ffa-9f37-9713a9a6f333", "code": "3086", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3086", "code_system": "CHEBI", "references": [ "d91df72c-4b12-e385-b42f-0407eb54eb88" ] }, { "uuid": "137b8f44-f0b1-36ff-682e-3d66820ae445", "code": "2467840", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2467840/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "93a6ae9d-cd85-3f51-e83e-be2182965d7b" ] }, { "uuid": "e82fe6a8-f450-9ca2-8beb-154d829ad6eb", "code": "DTXSID101019934", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID101019934", "code_system": "EPA CompTox", "references": [ "d91df72c-4b12-e385-b42f-0407eb54eb88" ] }, { "uuid": "ec0cf7bd-749e-532c-f5e2-27e835b6cbdf", "code": "4644", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4644", "code_system": "NSC", "references": [ "3fe38e77-552b-eb13-4885-b16ca52c6ebd" ] }, { "uuid": "0a0778e5-85ad-efc8-34a4-5349b8504030", "code": "6W70HN7X7O", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6W70HN7X7O", "code_system": "DAILYMED", "references": [ "217a6746-b9c2-4482-0f60-2f9e8d149520" ] } ], "substance_class": "chemical", "references": [ { "uuid": "0bde9ceb-1218-4360-af02-79cb0ad82d0b", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "f4c38b48-fd67-4bdb-890d-c6049e805df7", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "12699f1d-81f2-4c9a-afbd-af620a01928c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "346cf296-d388-4315-afca-86ffd318e32a", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0a10ced2-89f0-47a6-8d00-c46f8478853b", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d0286851-83f4-4865-bfee-2183a371bd69", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391418000, "tags": [ "NOMEN" ] }, { "uuid": "6375d640-72a5-4412-8122-171435f89702", "citation": "SRS import [6W70HN7X7O]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6W70HN7X7O", "doc_type": "SRS", "public_domain": true, "document_date": 1493391418000, "tags": [ "NOMEN" ] }, { "uuid": "e72127da-bf1b-4d93-9206-87cc220696e4", "citation": "BETULIN [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6108769e-475e-419f-8b74-3ec94e0db932", "citation": "BETULIN [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "55812b49-cd0a-3119-1cd3-16e1068c93c5", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Betulin", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8c9758c8-26e4-4215-81da-a9528347abee", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "93a6ae9d-cd85-3f51-e83e-be2182965d7b", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "d91df72c-4b12-e385-b42f-0407eb54eb88", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "3fe38e77-552b-eb13-4885-b16ca52c6ebd", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "217a6746-b9c2-4482-0f60-2f9e8d149520", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "4b20140d-832e-4037-b75e-6103ccaa4db4", "citation": "NDA 215064", "url": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2024/215064Orig1s000MultidisciplineR.pdf", "doc_type": "NDA PUBLIC REVIEW", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6c21fbeb-a097-49e5-977f-cbcaff383998", "citation": "Adepoju, Feyisayo O., et al. \"Pharmacological potential of betulin as a multitarget compound.\" Biomolecules 13.7 (2023): 1105.", "url": "https://www.mdpi.com/2218-273X/13/7/1105", "doc_type": "JA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d5ac1f9c-5726-4afd-89c4-89ac0ac9ba12", "id": "d5ac1f9c-5726-4afd-89c4-89ac0ac9ba12", "molfile": "\n Marvin 01132111042D \n\n 32 36 0 0 1 0 999 V2000\n 14.3657 -7.6844 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 15.1867 -7.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5054 -8.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8846 -8.9066 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 15.5841 -9.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2925 -8.9262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8846 -9.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1662 -10.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4696 -9.7173 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 14.3508 -10.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4696 -8.8987 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 12.7581 -8.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0421 -8.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0421 -9.6939 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 11.3169 -10.1088 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 10.8477 -9.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6266 -9.6964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8966 -10.0830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8966 -10.9080 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.1899 -11.3070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6002 -11.3228 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.0088 -12.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1785 -12.0380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3169 -10.9243 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 12.0284 -11.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7536 -10.9475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7536 -10.1133 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.2777 -10.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1928 -8.4988 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.3498 -6.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3235 -6.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8609 -6.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 29 1 1 0 0 0 0\n 1 30 1 6 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 1 0 0 0\n 4 7 1 0 0 0 0\n 29 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 6 0 0 0\n 11 9 1 0 0 0 0\n 9 27 1 0 0 0 0\n 11 12 1 0 0 0 0\n 29 11 1 1 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 1 0 0 0\n 14 15 1 0 0 0 0\n 27 14 1 0 0 0 0\n 15 16 1 1 0 0 0\n 15 17 1 0 0 0 0\n 15 24 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 1 0 0 0\n 19 21 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 21 1 0 0 0 0\n 24 21 1 1 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 1 0 0 0\n 31 30 1 0 0 0 0\n 32 30 2 0 0 0 0\nM END", "smiles": "C=C(C)[C@@H]1CC[C@@]2(CC[C@]3(C)C(CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@]43C)O)[C@@H]12)CO", "formula": "C30H50O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2107386a-3187-4f60-a256-ccd71eae115d" }, "defined_stereo": 9, "ez_centers": 0, "molecular_weight": "442.7179", "optical_activity": "UNSPECIFIED", "stereo_centers": 10 } ], "definition_level": "COMPLETE", "uuid": "e99e6e46-3fc2-46aa-a89e-510576a66c93", "version": "13", "structure": { "id": "c03a8bd5-800d-44b3-8304-147fd17dcf08", "molfile": "\n Marvin 01132109562D \n\n 36 40 0 0 1 0 999 V2000\n 14.3508 -10.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4696 -8.8987 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.0262 -8.0073 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1928 -8.4988 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.6022 -7.8587 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3657 -7.6844 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.3498 -6.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3235 -6.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8609 -6.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1867 -7.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5054 -8.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8846 -8.9066 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.8846 -9.7306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5841 -9.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2925 -8.9262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7581 -8.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0421 -8.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0421 -9.6939 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.3169 -10.1088 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.8477 -9.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3169 -10.9243 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.5194 -11.7217 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0284 -11.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7536 -10.9475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7536 -10.1133 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.2777 -10.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6002 -11.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0088 -12.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1785 -12.0380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8966 -10.9080 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.1899 -11.3070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8966 -10.0830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6266 -9.6964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4696 -9.7173 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.1662 -10.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6116 -8.9938 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 34 1 1 6 0 0 0\n 2 34 1 0 0 0 0\n 2 3 1 1 0 0 0\n 4 2 1 0 0 0 0\n 4 5 1 6 0 0 0\n 6 4 1 0 0 0 0\n 6 7 1 6 0 0 0\n 8 7 1 0 0 0 0\n 9 7 2 0 0 0 0\n 10 6 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 35 1 0 0 0 0\n 35 34 1 0 0 0 0\n 12 14 1 1 0 0 0\n 15 14 1 0 0 0 0\n 12 4 1 0 0 0 0\n 16 2 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 36 1 6 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 1 0 0 0\n 21 19 1 0 0 0 0\n 21 22 1 6 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 1 0 0 0\n 18 25 1 0 0 0 0\n 25 34 1 0 0 0 0\n 27 21 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 27 1 0 0 0 0\n 30 27 1 0 0 0 0\n 30 31 1 1 0 0 0\n 32 30 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 19 1 0 0 0 0\nM END", "smiles": "C=C(C)[C@@H]1CC[C@@]2(CC[C@]3(C)[C@]([H])(CC[C@]4([H])[C@@]5(C)CC[C@@H](C(C)(C)[C@]5([H])CC[C@]43C)O)[C@@]12[H])CO", "formula": "C30H50O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "442.7179", "optical_activity": "UNSPECIFIED", "references": [ "6375d640-72a5-4412-8122-171435f89702", "12699f1d-81f2-4c9a-afbd-af620a01928c" ], "stereo_centers": 10 }, "unii": "6W70HN7X7O", "relationships": [ { "uuid": "7f89b807-cab8-4ff5-854b-9c3ed0e0ea7a", "amount": { "uuid": "67ad7abf-0b2e-4806-a715-8e9f5a56519e", "low": 99.9 }, "type": "BINDER->LIGAND", "references": [ "4b20140d-832e-4037-b75e-6103ccaa4db4" ], "related_substance": { "uuid": "5f37455b-f0f1-420b-ae2a-7292409e2111", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "1f0ffb11-7231-464c-b3b6-2365bff49a31", "amount": { "uuid": "ec77672d-eea0-4955-9a71-8be583f9d9fa" }, "type": "TARGET->INHIBITOR", "references": [ "6c21fbeb-a097-49e5-977f-cbcaff383998" ], "related_substance": { "uuid": "e83fe955-b989-41a5-b24c-f0fa9fca06cb", "refuuid": "4d711601-05a5-4ce1-a28d-cf3f6a536ec4", "name": "MITOGEN-ACTIVATED PROTEIN KINASE 1", "unii": "C56NPO4XPD", "linking_id": "C56NPO4XPD", "ref_pname": "MITOGEN-ACTIVATED PROTEIN KINASE 1", "substance_class": "reference" } }, { "uuid": "07f2f93e-e62a-4974-a6a0-895f1a28b3e5", "amount": { "uuid": "4ffaae40-57f4-4b31-bcfb-d24e013bf5ec" }, "type": "TARGET->INHIBITOR", "related_substance": { "uuid": "27480351-0b33-4f44-845e-a7b7744c93f1", "refuuid": "81920650-963f-423d-9ab6-dd1caacab861", "name": "NUCLEAR FACTOR ERYTHROID 2-RELATED FACTOR 2", "unii": "P93F057EMS", "linking_id": "P93F057EMS", "ref_pname": "NUCLEAR FACTOR ERYTHROID 2-RELATED FACTOR 2", "substance_class": "reference" } }, { "uuid": "8b02b6ef-bc27-444b-9cbd-99f3f6da03b0", "amount": { "uuid": "14fd0837-06e4-479e-a484-ca6967dfd928" }, "type": "TARGET->INHIBITOR", "references": [ "6c21fbeb-a097-49e5-977f-cbcaff383998" ], "related_substance": { "uuid": "5a3bf8f2-b654-418d-bf55-48b805010e21", "refuuid": "346aa21b-6b8d-42e9-bfac-cac7374fba0e", "name": "NF-κB", "unii": "7V91R4MWD2", "linking_id": "7V91R4MWD2", "ref_pname": "NF-κB", "substance_class": "reference" } }, { "uuid": "680838a6-79ff-4ef2-b1b5-798bb2fa0c8c", "amount": { "uuid": "c70aa6a9-dcdd-4c36-b9b3-3ff5b9684e4c" }, "type": "ACTIVE MOIETY", "references": [ "6c21fbeb-a097-49e5-977f-cbcaff383998" ], "related_substance": { "uuid": "97d22ddc-8986-449b-9b9e-aec15f626c6b", "refuuid": "e99e6e46-3fc2-46aa-a89e-510576a66c93", "name": "BETULIN", "unii": "6W70HN7X7O", "linking_id": "6W70HN7X7O", "ref_pname": "BETULIN", "substance_class": "reference" } } ], "names": [ { "uuid": "2536822e-6a9d-4838-b222-e308cb504a13", "name": "(+)-BETULIN", "stdName": "(+)-BETULIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12699f1d-81f2-4c9a-afbd-af620a01928c", "f4c38b48-fd67-4bdb-890d-c6049e805df7" ], "display_name": false }, { "uuid": "72910002-e56d-445a-ad6c-319f28ac331a", "name": "BETULIN", "stdName": "BETULIN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e72127da-bf1b-4d93-9206-87cc220696e4", "6108769e-475e-419f-8b74-3ec94e0db932", "f4c38b48-fd67-4bdb-890d-c6049e805df7", "0bde9ceb-1218-4360-af02-79cb0ad82d0b", "346cf296-d388-4315-afca-86ffd318e32a" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "59ff3636-a2c2-4ea2-9976-e4048c43b645", "name_org": "INCI" } ] }, { "uuid": "4d8ec7cf-d528-4f89-97b3-fde970abdfb4", "name": "BETULIN [MI]", "stdName": "BETULIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f4c38b48-fd67-4bdb-890d-c6049e805df7", "346cf296-d388-4315-afca-86ffd318e32a" ], "display_name": false }, { "uuid": "49e802ef-ff24-439d-a8fc-51c1a39dec1c", "name": "BETULINE", "stdName": "BETULINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12699f1d-81f2-4c9a-afbd-af620a01928c", "f4c38b48-fd67-4bdb-890d-c6049e805df7" ], "display_name": false }, { "uuid": "1df058bb-b83b-4e71-ba61-eaeca6cb5109", "name": "BETULINIC ALCOHOL", "stdName": "BETULINIC ALCOHOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12699f1d-81f2-4c9a-afbd-af620a01928c", "f4c38b48-fd67-4bdb-890d-c6049e805df7" ], "display_name": false }, { "uuid": "edc4226d-31f1-41de-afa6-81ddc8b44ad6", "name": "BETULINOL", "stdName": "BETULINOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12699f1d-81f2-4c9a-afbd-af620a01928c", "f4c38b48-fd67-4bdb-890d-c6049e805df7" ], "display_name": false }, { "uuid": "67ccfc36-ccb5-4cef-b1d5-928023da241b", "name": "CP BETULIN", "stdName": "CP BETULIN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "f4c38b48-fd67-4bdb-890d-c6049e805df7", "0bde9ceb-1218-4360-af02-79cb0ad82d0b" ], "display_name": false }, { "uuid": "161ee6c4-522c-4eb0-afec-921a12880103", "name": "LUP-20(29)-ENE-3,28-DIOL, (3.BETA.)-", "stdName": "LUP-20(29)-ENE-3,28-DIOL, (3.BETA.)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12699f1d-81f2-4c9a-afbd-af620a01928c", "f4c38b48-fd67-4bdb-890d-c6049e805df7" ], "display_name": false }, { "uuid": "ac5692d3-a0cc-480a-bb0c-c743d128396a", "name": "LUP-20(29)-ENE-3.BETA.,28-DIOL", "stdName": "LUP-20(29)-ENE-3.BETA.,28-DIOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12699f1d-81f2-4c9a-afbd-af620a01928c", "f4c38b48-fd67-4bdb-890d-c6049e805df7" ], "display_name": false }, { "uuid": "23029a7a-4a57-40c9-a62e-ffed635662c0", "name": "LUP-20(30)-ENE-3.BETA.,28-DIOL", "stdName": "LUP-20(30)-ENE-3.BETA.,28-DIOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12699f1d-81f2-4c9a-afbd-af620a01928c", "f4c38b48-fd67-4bdb-890d-c6049e805df7" ], "display_name": false }, { "uuid": "82c89b97-ddcd-4b04-8a8b-0288a99fea8f", "name": "NSC-4644", "stdName": "NSC-4644", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "0a10ced2-89f0-47a6-8d00-c46f8478853b", "f4c38b48-fd67-4bdb-890d-c6049e805df7" ], "display_name": false }, { "uuid": "b6865847-b0a7-44dc-90bf-ba089ee074cd", "name": "ORISTRACT BTL", "stdName": "ORISTRACT BTL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "f4c38b48-fd67-4bdb-890d-c6049e805df7", "0bde9ceb-1218-4360-af02-79cb0ad82d0b" ], "display_name": false } ], "modifications": { "uuid": "9fb49682-f404-4141-a6a5-d9f07a309de5" } } ] }