{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8d60fbc8-a65e-4dfa-b175-97bdb4273899", "code": "429-67-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=429-67-4", "code_system": "CAS", "references": [ "9104c31b-fa3b-4409-abe0-8cc9b516eec7", "57fa5a9c-7f46-48e9-aa40-e0f7cc482298" ] }, { "uuid": "9b0a9edd-4f5e-488e-af29-c7a866157c9d", "code": "207-060-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.420", "code_system": "ECHA (EC/EINECS)", "references": [ "9104c31b-fa3b-4409-abe0-8cc9b516eec7" ] }, { "uuid": "c2f69134-8222-49d5-a17d-309b5c9726ec", "code": "67934", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67934", "code_system": "PUBCHEM", "references": [ "9104c31b-fa3b-4409-abe0-8cc9b516eec7" ] }, { "uuid": "aae445a8-49f7-420e-e3aa-46d49fbd8a3d", "code": "DTXSID7059985", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7059985", "code_system": "EPA CompTox", "references": [ "269ee4c2-73a0-6080-8106-e78e1c3430cc" ] }, { "uuid": "cb0b1348-d596-4777-9dc5-9401afc420ea", "code": "6UZH4CP48X", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "4811be55-fc7d-4098-ba69-b8dd8842ecf0", "name": "(3,3,3-TRIFLUOROPROPYL)METHYLSILOXANE CYCLIC TETRAMER", "stdName": "(3,3,3-TRIFLUOROPROPYL)METHYLSILOXANE CYCLIC TETRAMER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0b0ad9c0-ab3d-4d07-b1dd-b9adee9f25e0" ], "display_name": true }, { "uuid": "5eb9c185-0994-482c-9f3a-f59dd519fd02", "name": "1,3,5,7-TETRAKIS(3,3,3-TRIFLUOROPROPYL)-1,3,5,7-TETRAMETHYLCYCLOTETRASILOXANE", "stdName": "1,3,5,7-TETRAKIS(3,3,3-TRIFLUOROPROPYL)-1,3,5,7-TETRAMETHYLCYCLOTETRASILOXANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0b0ad9c0-ab3d-4d07-b1dd-b9adee9f25e0" ], "display_name": false }, { "uuid": "b4f8ae81-d3b9-4d90-9fe8-d13d98199215", "name": "2,4,6,8-TETRAMETHYL-2,4,6,8-TETRAKIS(3,3,3-TRIFLUOROPROPYL)CYCLOTETRASILOXANE", "stdName": "2,4,6,8-TETRAMETHYL-2,4,6,8-TETRAKIS(3,3,3-TRIFLUOROPROPYL)CYCLOTETRASILOXANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0b0ad9c0-ab3d-4d07-b1dd-b9adee9f25e0" ], "display_name": false }, { "uuid": "f07d5176-3f8f-4c7c-afb7-68ee70edd2b4", "name": "CYCLOTETRASILOXANE, 2,4,6,8-TETRAMETHYL-2,4,6,8-TETRAKIS(3,3,3-TRIFLUOROPROPYL)-", "stdName": "CYCLOTETRASILOXANE, 2,4,6,8-TETRAMETHYL-2,4,6,8-TETRAKIS(3,3,3-TRIFLUOROPROPYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "07eb20b0-099e-4cec-86db-9d3815512e3d" ], "display_name": false } ], "references": [ { "uuid": "07eb20b0-099e-4cec-86db-9d3815512e3d", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0b0ad9c0-ab3d-4d07-b1dd-b9adee9f25e0", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9104c31b-fa3b-4409-abe0-8cc9b516eec7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392137000, "tags": [ "NOMEN" ] }, { "uuid": "19d3f870-1219-47fe-9f19-64f8d9db7fa2", "citation": "SRS import [6UZH4CP48X]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6UZH4CP48X", "doc_type": "SRS", "public_domain": true, "document_date": 1493392137000, "tags": [ "NOMEN" ] }, { "uuid": "269ee4c2-73a0-6080-8106-e78e1c3430cc", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=429-67-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "57fa5a9c-7f46-48e9-aa40-e0f7cc482298", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "684569c8-0c5d-4a44-b745-4398af28acca", "id": "684569c8-0c5d-4a44-b745-4398af28acca", "molfile": "\n Marvin 01132105252D \n\n 36 36 0 0 0 0 999 V2000\n 4.2314 -3.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5158 -3.4846 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0914 -2.9013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8813 -2.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4725 -1.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8891 -0.9412 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0481 -2.0924 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0481 -0.9412 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5158 -4.3014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9324 -4.8770 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7647 -4.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9324 -5.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6480 -6.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6480 -6.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4803 -6.9537 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6480 -7.7782 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8235 -6.9537 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -4.8770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5323 -4.3014 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8634 -3.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9567 -4.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1667 -5.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5834 -6.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1590 -6.8371 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0078 -6.8449 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -5.6859 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5323 -3.4846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -2.9013 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4701 -2.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4001 -1.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4001 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2246 -0.8245 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5678 -0.8245 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4001 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9324 -2.9013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 9 1 0 0 0 0\n 2 36 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 18 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 19 27 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 23 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 28 36 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 1 0 0 0 0\n 32 35 1 0 0 0 0\nM END", "smiles": "C[Si]1(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O1", "formula": "C16H28F12O4Si4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "93e8377c-7a3c-4d66-b552-d22721ee5d42" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "624.7141", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "73b7fab0-6587-4cfb-b84f-f9115446f44f", "version": "3", "structure": { "id": "552b0445-a19b-445e-b63f-90db0cf04a1b", "molfile": "\n Marvin 01132104262D \n\n 36 36 0 0 0 0 999 V2000\n 1.5323 -4.3014 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -2.9013 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5158 -3.4846 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9324 -4.8770 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5323 -3.4846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5158 -4.3014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9324 -2.9013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -4.8770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4001 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4725 -1.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6480 -6.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5834 -6.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4001 -1.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8813 -2.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1667 -5.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6480 -6.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9324 -5.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0914 -2.9013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9567 -4.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1157 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8891 -0.9412 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0481 -2.0924 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0481 -0.9412 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2246 -0.8245 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4803 -6.9537 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6480 -7.7782 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8235 -6.9537 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5678 -0.8245 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1590 -6.8371 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0078 -6.8449 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -5.6859 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4001 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2314 -3.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7647 -4.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8634 -3.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4701 -2.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 5 1 0 0 0 0\n 1 8 1 0 0 0 0\n 1 19 1 0 0 0 0\n 1 35 1 0 0 0 0\n 2 5 1 0 0 0 0\n 2 7 1 0 0 0 0\n 2 20 1 0 0 0 0\n 2 36 1 0 0 0 0\n 3 6 1 0 0 0 0\n 3 18 1 0 0 0 0\n 3 33 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 8 1 0 0 0 0\n 4 6 1 0 0 0 0\n 4 17 1 0 0 0 0\n 4 34 1 0 0 0 0\n 9 13 1 0 0 0 0\n 9 24 1 0 0 0 0\n 9 28 1 0 0 0 0\n 9 32 1 0 0 0 0\n 10 14 1 0 0 0 0\n 10 21 1 0 0 0 0\n 10 22 1 0 0 0 0\n 10 23 1 0 0 0 0\n 11 16 1 0 0 0 0\n 11 25 1 0 0 0 0\n 11 26 1 0 0 0 0\n 11 27 1 0 0 0 0\n 12 15 1 0 0 0 0\n 12 29 1 0 0 0 0\n 12 30 1 0 0 0 0\n 12 31 1 0 0 0 0\n 13 20 1 0 0 0 0\n 14 18 1 0 0 0 0\n 15 19 1 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "C[Si]1(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O1", "formula": "C16H28F12O4Si4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "624.7141", "optical_activity": "NONE", "references": [ "19d3f870-1219-47fe-9f19-64f8d9db7fa2", "07eb20b0-099e-4cec-86db-9d3815512e3d" ], "stereo_centers": 0 }, "unii": "6UZH4CP48X" } ] }