{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "72f53796-a328-454f-8ca7-8b18d3dcc8c4",
          "code": "87-51-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87-51-4",
          "code_system": "CAS",
          "references": [
            "d1a0ea00-57fc-4a5f-aed5-152908000f01",
            "78a908a1-cf80-4781-8fc0-393388046804"
          ]
        },
        {
          "uuid": "60633586-3b85-43e2-a0f5-c4d13f61a580",
          "code": "C030737",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67030737",
          "code_system": "MESH",
          "references": [
            "d1a0ea00-57fc-4a5f-aed5-152908000f01"
          ]
        },
        {
          "uuid": "5c8eb798-d0b3-40f5-9f3c-0e9ec90f7435",
          "code": "128915",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2582",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "d1a0ea00-57fc-4a5f-aed5-152908000f01"
          ]
        },
        {
          "uuid": "a958ffbc-8e6b-494b-adf5-048a6f7027d5",
          "code": "m6274",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6274?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d1a0ea00-57fc-4a5f-aed5-152908000f01"
          ]
        },
        {
          "uuid": "934494e5-6999-4c24-aebf-5679499ab620",
          "code": "SUB89591",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d1a0ea00-57fc-4a5f-aed5-152908000f01"
          ]
        },
        {
          "uuid": "238468e7-b15f-4121-8087-9973d963f98c",
          "code": "201-748-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.590",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d1a0ea00-57fc-4a5f-aed5-152908000f01"
          ]
        },
        {
          "uuid": "b45d4fef-e5ed-4ae4-96d9-5340d635af9d",
          "code": "802",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/802",
          "code_system": "PUBCHEM",
          "references": [
            "d1a0ea00-57fc-4a5f-aed5-152908000f01"
          ]
        },
        {
          "uuid": "fa2c82e4-33b4-0102-37b9-7ede31b58ce3",
          "code": "Indoleacetic acid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Indoleacetic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "ea30c9fd-0738-56c8-767c-1f01b62747a4"
          ]
        },
        {
          "uuid": "12e4f825-d8a5-7199-097c-f378cb7c47b2",
          "code": "DTXSID5020738",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5020738",
          "code_system": "EPA CompTox",
          "references": [
            "15ac17d3-1d32-5a13-38c0-68a623da8260"
          ]
        },
        {
          "uuid": "1bf219eb-ec98-a1de-2f53-dcd9c1b212ff",
          "code": "DB07950",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB07950",
          "code_system": "DRUG BANK",
          "references": [
            "7a05d8e6-f7af-a852-99c8-5657147aeb15"
          ]
        },
        {
          "uuid": "4fae3655-d13c-44b1-983e-e94730613233",
          "code": "6U1S09C61L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5a3ff1ed-0744-4957-fdd5-37c406b01fd3",
          "code": "16411",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16411",
          "code_system": "CHEBI",
          "references": [
            "7a05d8e6-f7af-a852-99c8-5657147aeb15"
          ]
        },
        {
          "uuid": "c220c8cf-c789-3e80-d3c9-97c9f3658a5e",
          "code": "100000140216",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6a446bf5-f55d-272c-8e18-5a0de955e72f"
          ]
        },
        {
          "uuid": "b52a8eaf-5e3f-c7bf-ecfd-c9de44d4283f",
          "code": "3787",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3787",
          "code_system": "NSC",
          "references": [
            "10f62b3c-6585-8f49-b0f1-dcf7701d03f2"
          ]
        },
        {
          "uuid": "e370ab55-a73e-d226-19ac-5c2166ac4243",
          "code": "IAA",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/IAA.html",
          "code_system": "ALANWOOD",
          "references": [
            "9ad31394-0fc2-354c-2f60-95942e5c00a4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a08f0150-811e-4ba6-b799-6542cb5d9d83",
          "amount": {
            "uuid": "d1a64be6-ab62-44a4-b13d-5fc24fbdbfb1"
          },
          "type": "PARENT->METABOLITE INACTIVE",
          "mediator_substance": {
            "uuid": "c6f11bb2-c8aa-4db4-9266-f8f7756711c1",
            "refuuid": "89214dde-05ee-41e8-89fa-6cbf73bf9fcc",
            "name": "AMINE OXIDASE (FLAVIN-CONTAINING) A",
            "unii": "B5QXZ49C7Y",
            "linking_id": "B5QXZ49C7Y",
            "ref_pname": "AMINE OXIDASE (FLAVIN-CONTAINING) A",
            "substance_class": "reference"
          },
          "references": [
            "ac139029-2df7-4a31-a496-0df00f5e8521"
          ],
          "related_substance": {
            "uuid": "f274f2fe-0fc5-4d32-a5eb-14da716da499",
            "refuuid": "f616e0a9-d1a2-4d91-ac3d-a45bf528c6a5",
            "name": "Dimethyltryptamine",
            "unii": "WUB601BHAA",
            "linking_id": "WUB601BHAA",
            "ref_pname": "Dimethyltryptamine",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "98ee19a0-c770-496e-9804-6c14eca7343a",
          "name": "1H-INDOLE-3-ACETIC ACID",
          "stdName": "1H-INDOLE-3-ACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad57e8d0-10d5-49b7-90eb-34e757d9e56d",
            "9584b463-b6e7-4e04-b9a0-24c660e3d4df"
          ],
          "display_name": false
        },
        {
          "uuid": "aef49cc7-49c1-4027-a492-62c91238c7e3",
          "name": "3-(CARBOXYMETHYL)INDOLE",
          "stdName": "3-(CARBOXYMETHYL)INDOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad57e8d0-10d5-49b7-90eb-34e757d9e56d",
            "9584b463-b6e7-4e04-b9a0-24c660e3d4df"
          ],
          "display_name": false
        },
        {
          "uuid": "548839e1-92f8-4653-ba7f-526e007e818b",
          "name": "HETEROAUXIN",
          "stdName": "HETEROAUXIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad57e8d0-10d5-49b7-90eb-34e757d9e56d",
            "9584b463-b6e7-4e04-b9a0-24c660e3d4df"
          ],
          "display_name": false
        },
        {
          "uuid": "ba78ae1b-847c-43d0-9813-fff413f68b9f",
          "name": "IAA",
          "stdName": "IAA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad57e8d0-10d5-49b7-90eb-34e757d9e56d",
            "9584b463-b6e7-4e04-b9a0-24c660e3d4df"
          ],
          "display_name": false
        },
        {
          "uuid": "7a12363a-b8ce-4eae-827b-c415f1f65d9c",
          "name": "INDOLE ACETIC ACID",
          "stdName": "INDOLE ACETIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "ad57e8d0-10d5-49b7-90eb-34e757d9e56d",
            "f415a267-291c-4867-8e98-26319953da15",
            "08790525-cc39-48a7-8810-99f63b384072",
            "f0ea8c69-005f-444d-961f-de12a945bdae"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a7af0f6f-677e-49e0-8b07-105133af4331",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "3166d77c-89fe-4cc9-8b4a-08742a5eeb4a",
          "name": "INDOLE-3-ACETIC ACID",
          "stdName": "INDOLE-3-ACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad57e8d0-10d5-49b7-90eb-34e757d9e56d",
            "61e058c2-f6ad-4bed-8547-8213dc79e06a"
          ],
          "display_name": false
        },
        {
          "uuid": "f866e412-78bb-47ac-ae43-5e1fe9fbf060",
          "name": "INDOLEACETIC ACID",
          "stdName": "INDOLEACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad57e8d0-10d5-49b7-90eb-34e757d9e56d",
            "e6905b0b-9f6d-4858-bb7d-fcbbc5e422a3",
            "1779b203-9612-4cf0-ab8b-04647f9e33f9",
            "9584b463-b6e7-4e04-b9a0-24c660e3d4df"
          ],
          "display_name": true
        },
        {
          "uuid": "9291d57d-8e3a-4323-8235-08de25c172c5",
          "name": "INDOLEACETIC ACID [MI]",
          "stdName": "INDOLEACETIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad57e8d0-10d5-49b7-90eb-34e757d9e56d",
            "1779b203-9612-4cf0-ab8b-04647f9e33f9"
          ],
          "display_name": false
        },
        {
          "uuid": "17ab1761-a431-4230-ac63-a520216bece9",
          "name": "NSC-3787",
          "stdName": "NSC-3787",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad57e8d0-10d5-49b7-90eb-34e757d9e56d",
            "a7d4b6dd-c32c-4a68-b009-9bf636924289"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1779b203-9612-4cf0-ab8b-04647f9e33f9",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ad57e8d0-10d5-49b7-90eb-34e757d9e56d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9584b463-b6e7-4e04-b9a0-24c660e3d4df",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08790525-cc39-48a7-8810-99f63b384072",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f415a267-291c-4867-8e98-26319953da15",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61e058c2-f6ad-4bed-8547-8213dc79e06a",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7d4b6dd-c32c-4a68-b009-9bf636924289",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1a0ea00-57fc-4a5f-aed5-152908000f01",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2085082-4b91-463a-924a-66c50e30c8ec",
          "citation": "SRS import [6U1S09C61L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6U1S09C61L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6905b0b-9f6d-4858-bb7d-fcbbc5e422a3",
          "citation": "INDOLEACETIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f0ea8c69-005f-444d-961f-de12a945bdae",
          "citation": "INDOLE ACETIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ea30c9fd-0738-56c8-767c-1f01b62747a4",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Indoleacetic_acid",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "15ac17d3-1d32-5a13-38c0-68a623da8260",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=87-51-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6a446bf5-f55d-272c-8e18-5a0de955e72f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "9ad31394-0fc2-354c-2f60-95942e5c00a4",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "7a05d8e6-f7af-a852-99c8-5657147aeb15",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "78a908a1-cf80-4781-8fc0-393388046804",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "10f62b3c-6585-8f49-b0f1-dcf7701d03f2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ac139029-2df7-4a31-a496-0df00f5e8521",
          "citation": "Riba, Jordi, et al. \"Metabolism and urinary disposition of N, N‐dimethyltryptamine after oral and smoked administration: a comparative study.\" Drug testing and analysis 7.5 (2015): 401-406.",
          "url": "https://analyticalsciencejournals.onlinelibrary.wiley.com/doi/full/10.1002/dta.1685",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c1b543a4-29b9-4135-b941-56748379cd32",
          "id": "c1b543a4-29b9-4135-b941-56748379cd32",
          "molfile": "\n  Marvin  01132110012D          \n\n 13 14  0  0  0  0            999 V2000\n    3.5166    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2703   -0.7861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7813   -1.4334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4606   -0.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2038   -1.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7620   -2.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2274   -3.1157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4177   -2.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7180   -3.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7102   -1.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4255   -1.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n 13  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(CC(=O)O)c[nH]2",
          "formula": "C10H9NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5e019388-c6e3-48cf-8eed-33db15b1ca8b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "175.1843",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0416268f-b254-45c2-bfc0-1d61990dafa3",
      "version": "11",
      "structure": {
        "id": "dc23096b-d6f8-45df-bd6d-051e5479ad4e",
        "molfile": "\n  Marvin  01132111252D          \n\n 13 14  0  0  0  0            999 V2000\n    2.2038   -1.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2274   -3.1157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7620   -2.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4255   -1.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4606   -0.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4177   -2.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2703   -0.7861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5166    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7813   -1.4334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7102   -1.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7180   -3.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  4  1  0  0  0  0\n 11  6  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 12  1  0  0  0  0\n  2  6  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(CC(=O)O)c[nH]2",
        "formula": "C10H9NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "175.1843",
        "optical_activity": "NONE",
        "references": [
          "9584b463-b6e7-4e04-b9a0-24c660e3d4df",
          "e2085082-4b91-463a-924a-66c50e30c8ec"
        ],
        "stereo_centers": 0
      },
      "unii": "6U1S09C61L"
    }
  ]
}