{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "80563d7d-c89d-4a0f-a00b-1ed59be382b1",
          "code": "239110-15-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=239110-15-7",
          "code_system": "CAS",
          "references": [
            "bbd75c89-612a-40cf-b3b8-0fb111d0c518",
            "961ef69c-4d78-49fb-8e9a-ab6daf297a82"
          ]
        },
        {
          "uuid": "6d78add7-8b66-4809-9b79-6bf42098118f",
          "code": "27412",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2399",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "bbd75c89-612a-40cf-b3b8-0fb111d0c518"
          ]
        },
        {
          "uuid": "28474e35-f3cf-4dfd-bac7-7c5803f53a2d",
          "code": "m5456",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5456?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bbd75c89-612a-40cf-b3b8-0fb111d0c518"
          ]
        },
        {
          "uuid": "218b6b31-ff9c-412e-bddc-15455375147a",
          "code": "11159021",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11159021",
          "code_system": "PUBCHEM",
          "references": [
            "bbd75c89-612a-40cf-b3b8-0fb111d0c518"
          ]
        },
        {
          "uuid": "d0ffaacf-ce08-c575-0784-cb783596264d",
          "code": "7886",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7886",
          "code_system": "HSDB",
          "references": [
            "37043e94-4fba-8d80-db10-20b3ec72c3dc"
          ]
        },
        {
          "uuid": "1e6f7e68-e648-3adb-b077-94a4b7d81d7c",
          "code": "DTXSID7034624",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7034624",
          "code_system": "EPA CompTox",
          "references": [
            "a55766a3-97a5-6a7a-b6cc-75c24356f8dc"
          ]
        },
        {
          "uuid": "35cd1506-676e-4cc1-ac48-9f2d8bde3fef",
          "code": "6TRO75M67P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3394d11b-360e-2f3a-3d0d-cbe8cd39c6b5",
          "code": "Fluopicolide",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fluopicolide",
          "code_system": "WIKIPEDIA",
          "references": [
            "4cff5501-46a4-f6a6-c76e-153cf315ba02"
          ]
        },
        {
          "uuid": "2b7ff370-af05-7cc7-942c-ed98ce331407",
          "code": "fluopicolide",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fluopicolide.html",
          "code_system": "ALANWOOD",
          "references": [
            "ccc0d22f-fee6-36be-ac46-a9535f3c2fb2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7335a961-b9c0-4527-b93c-8290f818f3e9",
          "name": "2,6-DICHLORO-N-((3-CHLORO-5-(TRIFLUOROMETHYL)-2-PYRIDINYL)METHYL)BENZAMIDE",
          "stdName": "2,6-DICHLORO-N-((3-CHLORO-5-(TRIFLUOROMETHYL)-2-PYRIDINYL)METHYL)BENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3629ddf-6964-41d5-8386-867da421fadc",
            "0c493a02-e42b-4513-90bb-99213fc7e66f"
          ],
          "display_name": false
        },
        {
          "uuid": "264356eb-9c12-41d8-9cdb-4ee5fb6e370e",
          "name": "2,6-DICHLORO-N-(3-CHLORO-5-(TRIFLUOROMETHYL)-2-PYRIDYLMETHYL)BENZAMIDE",
          "stdName": "2,6-DICHLORO-N-(3-CHLORO-5-(TRIFLUOROMETHYL)-2-PYRIDYLMETHYL)BENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78d4b222-cf2a-4dbd-a214-796767141dad",
            "a3629ddf-6964-41d5-8386-867da421fadc"
          ],
          "display_name": false
        },
        {
          "uuid": "50f84a8e-59be-4950-8b05-c10e7b3be4bf",
          "name": "FLUOPICOLIDE",
          "stdName": "FLUOPICOLIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8d63b52-e312-4047-8755-e42e25b78009",
            "05eb6e3b-144f-4786-8b36-1aafadb136f3",
            "562bec04-be20-4e76-99b1-66860cf399fa",
            "94b95694-87b8-4341-9c6b-505a874a3805",
            "4ef35eb4-9f8b-4ebc-91bd-ea393349c8b7",
            "bfdd4fb8-11df-4ec1-818d-cc97bd41c827"
          ],
          "display_name": true
        },
        {
          "uuid": "3e79184b-9f25-4d6a-82b1-e47dd339929e",
          "name": "FLUOPICOLIDE [ISO]",
          "stdName": "FLUOPICOLIDE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8d63b52-e312-4047-8755-e42e25b78009",
            "94b95694-87b8-4341-9c6b-505a874a3805"
          ],
          "display_name": false
        },
        {
          "uuid": "8fb43eaa-d15d-448b-a2d9-bcf4f36d2f63",
          "name": "FLUOPICOLIDE [MI]",
          "stdName": "FLUOPICOLIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94b95694-87b8-4341-9c6b-505a874a3805",
            "bfdd4fb8-11df-4ec1-818d-cc97bd41c827"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "562bec04-be20-4e76-99b1-66860cf399fa",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a3629ddf-6964-41d5-8386-867da421fadc",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78d4b222-cf2a-4dbd-a214-796767141dad",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c493a02-e42b-4513-90bb-99213fc7e66f",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8d63b52-e312-4047-8755-e42e25b78009",
          "citation": "http://www.alanwood.net/pesticides/fluopicolide.html",
          "url": "http://www.alanwood.net/pesticides/fluopicolide.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94b95694-87b8-4341-9c6b-505a874a3805",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfdd4fb8-11df-4ec1-818d-cc97bd41c827",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbd75c89-612a-40cf-b3b8-0fb111d0c518",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a15b83af-40bf-4bdc-b1a6-22925444e97c",
          "citation": "SRS import [6TRO75M67P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6TRO75M67P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "058c2696-2a07-4a7c-a787-70db8071a85b",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ef35eb4-9f8b-4ebc-91bd-ea393349c8b7",
          "citation": "FLUOPICOLIDE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "05eb6e3b-144f-4786-8b36-1aafadb136f3",
          "citation": "FLUOPICOLIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37043e94-4fba-8d80-db10-20b3ec72c3dc",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+239110-15-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a55766a3-97a5-6a7a-b6cc-75c24356f8dc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=239110-15-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4cff5501-46a4-f6a6-c76e-153cf315ba02",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "ccc0d22f-fee6-36be-ac46-a9535f3c2fb2",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "961ef69c-4d78-49fb-8e9a-ab6daf297a82",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a71a8897-b72e-4e39-971f-aa48d9efb209",
          "id": "a71a8897-b72e-4e39-971f-aa48d9efb209",
          "molfile": "\n  Marvin  01132108412D          \n\n 23 24  0  0  0  0            999 V2000\n   10.6712   -6.2024    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8538   -6.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3341   -6.7371    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5670   -5.2894    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0288   -6.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5943   -6.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7716   -6.7023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3795   -5.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5546   -5.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1662   -5.1809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3412   -5.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9046   -5.8802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9530   -4.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1302   -4.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6927   -5.1269    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7399   -3.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1813   -3.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0073   -3.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3948   -3.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2197   -3.7526    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.8230   -5.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4361   -4.5382    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.6470   -5.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 23  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 21  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 19  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 21  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(c(c1)Cl)C(=O)NCc2c(cc(cn2)C(F)(F)F)Cl)Cl",
          "formula": "C14H8Cl3F3N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e1b1b2ab-bc7c-4024-b872-073dd83d7358"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "383.5807",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f75ac8b9-056a-4fd3-934d-02f7e5becd4b",
      "version": "7",
      "structure": {
        "id": "72667584-d0e1-452b-bc05-6e5824066613",
        "molfile": "\n  Marvin  01132105562D          \n\n 23 24  0  0  0  0            999 V2000\n    9.8538   -6.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6712   -6.2024    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3341   -6.7371    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0288   -6.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6470   -5.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8230   -5.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3795   -5.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5546   -5.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1662   -5.1809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3412   -5.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9530   -4.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3948   -3.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0073   -3.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1813   -3.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7399   -3.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1302   -4.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6927   -5.1269    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.2197   -3.7526    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9046   -5.8802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7716   -6.7023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5943   -6.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4361   -4.5382    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5670   -5.2894    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 11  1  0  0  0  0\n 16 17  1  0  0  0  0\n 12 18  1  0  0  0  0\n 10 19  2  0  0  0  0\n  7 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21  4  1  0  0  0  0\n  6 22  1  0  0  0  0\n  1 23  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(c(c1)Cl)C(=O)NCc2c(cc(cn2)C(F)(F)F)Cl)Cl",
        "formula": "C14H8Cl3F3N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "383.5807",
        "optical_activity": "NONE",
        "references": [
          "058c2696-2a07-4a7c-a787-70db8071a85b",
          "a15b83af-40bf-4bdc-b1a6-22925444e97c"
        ],
        "stereo_centers": 0
      },
      "unii": "6TRO75M67P"
    }
  ]
}