{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "050811c7-92b0-4469-aaa2-87d6e6a1a2d9", "code": "N0000008217", "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, 1-Ring [Chemical/Ingredient]|Azoles [Chemical/Ingredient]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000008217", "code_system": "NDF-RT", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "11e0de8b-4f23-43d9-8b99-613d80fc6831", "code": "J02AC04", "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIMYCOTICS FOR SYSTEMIC USE|ANTIMYCOTICS FOR SYSTEMIC USE|Triazole derivatives|posaconazole", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=J02AC04&showdescription=yes", "code_system": "WHO-ATC", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "8ed4ad8a-9c14-4408-aa50-7a9d056bffe1", "code": "N0000175487", "comments": "Established Pharmacologic Class [EPC]|Azole Antifungal [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175487", "code_system": "NDF-RT", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "6405b3f7-6f70-4e98-a637-74ed880f5f5c", "code": "QJ02AC04", "comments": "VATC|ANTIMYCOTICS FOR SYSTEMIC USE|ANTIMYCOTICS FOR SYSTEMIC USE|Triazole derivatives|posaconazole", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ02AC04&showdescription=yes", "code_system": "WHO-VATC", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "48bc34cd-dd76-48b6-8472-902c12c36f67", "code": "171228-49-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=171228-49-2", "code_system": "CAS", "references": [ "aae222be-2723-4955-9940-0faae860f72b", "84f1b83e-31d9-4a34-94d1-80fc8ac82661" ] }, { "uuid": "eae7dd08-9c94-43e5-9214-f6ad09b54572", "code": "C101425", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67101425", "code_system": "MESH", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "fdcf4044-90fa-4def-8cbd-69ad6d91e39d", "code": "NBK548934", "comments": "LiverTox|Antimicrobial|Antifungal|Triazole", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548934/", "code_system": "LIVERTOX", "references": [ "c7191faf-239c-8b57-2642-200694adf5a9" ] }, { "uuid": "ac5ac23f-4f46-40bf-9396-520a55591d5e", "code": "POSACONAZOLE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Posaconazole", "code_system": "WIKIPEDIA", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "3f82d23f-9674-475d-81e1-ff7399bb2909", "code": "SUB20322", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "c8293420-7f60-4cae-abcc-771f5dff0a19", "code": "7713", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7713", "code_system": "INN", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "0e3a4327-b950-4699-9345-7156d0c800ab", "code": "C61500", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61500", "code_system": "NCI_THESAURUS", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "23ce0649-ddc2-4281-aa33-58c63aab256a", "code": "282446", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/282446/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "5cc3d1ca-edb8-4a5e-b242-3f8e55a60127", "code": "m8993", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m8993?q=authorize", "code_system": "MERCK INDEX", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "da53da8c-9bfe-46de-9a15-9ea8661037bc", "code": "DB01263", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB01263", "code_system": "DRUG BANK", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "b137b478-7bfb-479e-a3d0-54c00f165a7b", "code": "21 CFR 524.1610", "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 524 OPHTHALMIC AND TOPICAL DOSAGE FORM NEW ANIMAL DRUGS|SEC. 524.1610 Orbifloxacin, mometasone furoate monohydrate, and posaconazole suspension.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=524.1610", "code_system": "CFR", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "77ca2674-774e-4c55-b658-b2009ab97244", "code": "CHEMBL1397", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1397", "code_system": "ChEMBL", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "ccc9ce69-5d97-4fc9-9f70-cb7af9d1a1ba", "code": "468595", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/468595", "code_system": "PUBCHEM", "references": [ "aae222be-2723-4955-9940-0faae860f72b" ] }, { "uuid": "6a192bd3-d746-ee30-f391-854fe9065315", "code": "7421", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7421", "code_system": "HSDB", "references": [ "4711738b-6b27-b280-465b-7e91036a43a4" ] }, { "uuid": "cf7a3c56-6323-6a91-5999-a1d91687ed14", "code": "DTXSID6049066", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6049066", "code_system": "EPA CompTox", "references": [ "8d864d02-f52d-e21d-2160-f3e9c97317f1" ] }, { "uuid": "d01ba8cf-eed1-b709-fecf-3c1d05bd9fd1", "code": "187604", "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of zygomycosis", "codeText": "ORPHAN DRUG|Designated/Withdrawn|Treatment of zygomycosis", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=187604", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "699067cc-5139-e0bb-b70b-d732bf7964f6", "code": "C514", "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antifungal Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C514", "code_system": "NCI_THESAURUS", "references": [ "c7191faf-239c-8b57-2642-200694adf5a9" ] }, { "uuid": "c9470445-f059-4406-b405-f3243d24252c", "code": "6TK1G07BHZ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "bcd481c2-c4d5-7c0b-732a-961859e1cbd2", "code": "3483", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/3483", "code_system": "DRUG CENTRAL", "references": [ "c7191faf-239c-8b57-2642-200694adf5a9" ] }, { "uuid": "62b0b6d2-8022-2826-2bd7-f4d5fc02a80e", "code": "64355", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:64355", "code_system": "CHEBI", "references": [ "c7191faf-239c-8b57-2642-200694adf5a9" ] }, { "uuid": "ba9074f7-2e1c-78fb-9300-89378e8d4b49", "code": "850521", "comments": "ORPHAN DRUG|Designated|Treatment of Mucormycosis (previously called zygomycosis)", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=850521", "code_system": "FDA ORPHAN DRUG", "references": [ "c7191faf-239c-8b57-2642-200694adf5a9" ] }, { "uuid": "0d046b15-17e5-2ffc-eddd-be5ba36747cd", "code": "6TK1G07BHZ", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6TK1G07BHZ", "code_system": "DAILYMED", "references": [ "bdf3a0d4-a9c2-3ddb-fe30-9e69f05cbd35" ] }, { "uuid": "432d84c7-a0e6-18cb-d0f6-a266b6d3a90f", "code": "100000089529", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "3775b51d-34d4-ff75-fd53-8bac5f9838f9" ] }, { "uuid": "1e6fa2dc-531e-6a6f-7b0d-e67617fa0c1c", "code": "JJ-48", "type": "PRIMARY", "url": "https://searchusan.ama-assn.org/finder/usan/search/JJ-48/relevant/1/", "code_system": "USAN", "references": [ "bdcfdd4d-83fc-4b8f-6c5d-09c87b0ae7a6" ] }, { "uuid": "f81ed7ad-198b-e1cd-025a-7a516c8ffbcc", "code": "539016", "comments": "ORPHAN DRUG|Designated/Approved|Treatment of invasive aspergillosis", "codeText": "ORPHAN DRUG|Designated/Approved|Treatment of invasive aspergillosis", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=539016", "code_system": "FDA ORPHAN DRUG" } ], "substance_class": "chemical", "references": [ { "uuid": "7cb3dbae-7217-48ac-9760-0ce732c19300", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "72aa68ab-a232-49d8-8d9c-646c38ec617f", "citation": "ORANGE BOOK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f7f24c9c-9ab3-4b66-ba6b-6cdb506cc619", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7e0bfbcb-19c7-430d-818a-3fdaa726e04f", "citation": "INN Proposed List 86", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL86.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f87087e7-2a2a-4d1e-918d-c62da8b90a17", "citation": "ORANGE BOOK 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "60bd1cbb-83c9-48e7-8cac-3f631eaad038", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8cf85a84-812a-452e-b8cd-91efb3b3c5d1", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b237cbf4-2390-485d-b4a2-05e875f20310", "citation": "EMA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8036affa-8f83-4423-97c9-df8301fd5445", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5ca94ff7-cca5-4ad3-9174-04c2777da406", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4bdf318a-9b5c-4f24-bf28-0566ce723647", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6281b89a-7fe3-4424-860c-36d655a27df8", "citation": "USP DICTIONARY", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aae222be-2723-4955-9940-0faae860f72b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390172000, "tags": [ "NOMEN" ] }, { "uuid": "dfd5bda7-fc7c-4ff6-9fda-958d898aab24", "citation": "ANTIMICROB. AGENTS CHEMOTHER. SEPTEMBER 2004 VOL. 48 NO. 9 3543-3551", "url": "http://aac.asm.org/content/48/9/3543.full.pdf", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e3d33490-6b9d-42fc-a1e5-d7eb31204fd5", "citation": "SRS import [6TK1G07BHZ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6TK1G07BHZ", "doc_type": "SRS", "public_domain": true, "document_date": 1493390172000, "tags": [ "NOMEN" ] }, { "uuid": "dbde522a-e87d-494e-b200-6519c733de46", "citation": "POSACONAZOLE [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "4b6be5c9-5e22-4d5c-a5b8-0fae3e67350e", "citation": "POSACONAZOLE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "9723fe80-f68b-483d-af1e-53874c0793db", "citation": "POSACONAZOLE [ORANGE BOOK]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2461ac66-3b48-4e86-b505-fe5cceadf0d5", "citation": "POSACONAZOLE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f8912262-74e0-4bca-98d5-152ac587a5ed", "citation": "POSACONAZOLE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "dddc1c73-d143-434c-8c1d-94c18cb17dfa", "citation": "POSACONAZOLE [EMA EPAR]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "372c8547-1590-4a8a-aaf3-c74ea0a63658", "citation": "POSACONAZOLE [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c51ff7c8-b321-4247-a3af-1eafb7631c2a", "citation": "POSACONAZOLE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3617839b-c3fa-4a14-b2a1-60694ed48671", "citation": "POSACONAZOLE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3775b51d-34d4-ff75-fd53-8bac5f9838f9", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "4711738b-6b27-b280-465b-7e91036a43a4", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+171228-49-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0e3e046f-d7e0-10fe-ed89-aa57617c9074", "citation": "JAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8d864d02-f52d-e21d-2160-f3e9c97317f1", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=171228-49-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ac49385f-d737-9d6d-6a39-a5b6a96a6f9e", "citation": "GREEN BOOK", "doc_type": "SRS", "public_domain": true }, { "uuid": "20d68bbe-8ebc-1c68-6483-1034f5267f5b", "citation": "Drug Information Handbook, 2016-2017 - 25th edition; Lexicomp Drug Reference Handbook; ISBN13: 9781591953531", "doc_type": "BOOK", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "81908933-d12a-705c-2791-22c947598d98", "citation": "https://www.clinicalkey.com/pharmacology/monograph/2811?sec=monphar", "doc_type": "CLINICAL PHARMACOLOGY", "public_domain": true }, { "uuid": "c7191faf-239c-8b57-2642-200694adf5a9", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "180fd45a-365c-2eb8-0811-3dbca8cdb5e8", "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2006/022003lbl.pdf", "doc_type": "NDA PUBLIC REVIEW", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "84f1b83e-31d9-4a34-94d1-80fc8ac82661", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "bdcfdd4d-83fc-4b8f-6c5d-09c87b0ae7a6", "citation": "USAD COUN", "doc_type": "USANCOUN", "public_domain": true }, { "uuid": "a2bddb7c-4d04-48b6-a28f-af3e44f21316", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8daf4ff3-2d83-47e0-9bba-a05b958768a4", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "081fefb9-bbf4-415f-ad9a-7eaba8d90ba8", "citation": "CD", "doc_type": "CHEMDRAW_IUPAC_NAME", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3af76964-086d-54c7-2e8e-a8185a9d20e0", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "bdf3a0d4-a9c2-3ddb-fe30-9e69f05cbd35", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "d2e719e2-5b31-438d-b74c-29d2ed40f50d", "citation": "synzeal.com", "url": "https://www.synzeal.com/10/posaconazole-formyl-impurity", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "35df76cc-4300-4422-87b7-8668145b7105", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d845f0fa-769b-4e5b-a04e-e254c69dea2a", "citation": "Vijayalakshmi Nagappan , Stan Deresinski, Posaconazole: A Broad-Spectrum Triazole Antifungal Agent, Clinical Infectious Diseases, Volume 45, Issue 12, 15 December 2007, Pages 1610–1617, https://doi.org/10.1086/523576", "url": "https://academic.oup.com/cid/article/45/12/1610/304255", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d72255cb-94dd-4096-a634-fef2acb2b251", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8fbd2e61-0e05-4956-8f79-5c004f311173", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "28378b14-1592-449f-a554-fb7a9e262299", "citation": "synzeal.com", "url": "https://www.synzeal.com/10/posaconazole-formyl-impurity", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "4525774e-d293-4776-8a8b-d4dcb6cfabc8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4456e958-921b-4539-87c5-ce84dfc9fdb2", "id": "4456e958-921b-4539-87c5-ce84dfc9fdb2", "molfile": "\n Marvin 12012107012D \n\n 51 57 0 0 1 0 999 V2000\n 27.4598 -2.8875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1271 -3.3724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8722 -4.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0473 -4.1570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7923 -3.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.0077 -3.1175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1742 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1742 -1.6500 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 27.4598 -2.0625 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 26.7452 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.0308 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8886 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5624 -4.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8979 -5.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4130 -6.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.5925 -6.1592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2570 -5.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7419 -4.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1076 -6.8267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4431 -7.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9582 -8.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.1378 -8.1616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8022 -7.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2871 -6.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6527 -8.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9883 -9.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5035 -10.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6829 -10.1639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3473 -9.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8323 -8.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1980 -10.8312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3776 -10.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4802 -12.6821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1476 -12.1971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8927 -11.4125 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 20.0677 -11.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8127 -12.1971 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 19.2607 -12.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5156 -13.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9636 -14.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1566 -14.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9017 -13.2518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4537 -12.6387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6046 -14.6495 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3226 -13.7664 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0057 -12.0256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7508 -11.2409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9662 -10.9861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9662 -10.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7508 -9.9062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2357 -10.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 5 1 0 0 0 0\n 9 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 13 1 0 0 0 0\n 5 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 12 1 6 0 0 0\n 9 10 1 1 0 0 0\n 10 11 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 19 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 24 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 25 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 30 2 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 28 31 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 35 32 1 6 0 0 0\n 33 34 1 0 0 0 0\n 33 37 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 1 0 0 0\n 37 46 1 6 0 0 0\n 38 39 1 0 0 0 0\n 38 43 2 0 0 0 0\n 39 40 2 0 0 0 0\n 39 45 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 41 44 1 0 0 0 0\n 42 43 1 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 1 0 0 0 0\n 47 51 1 0 0 0 0\n 48 49 2 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 2 0 0 0 0\nM END", "smiles": "CC[C@@H]([C@H](C)O)n1c(=O)n(cn1)-c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5C[C@](Cn6cncn6)(c7ccc(cc7F)F)OC5", "formula": "C37H42F2N8O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "31b04e3d-2742-4083-9c23-1b1388184170" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "700.7788", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "dd4c4e3a-4cc1-406c-8ad4-d5d455c35c94", "version": "444", "structure": { "id": "1eb3882e-68ad-4dfd-b686-64af2d3a3714", "molfile": "\n JSDraw212012107012D\n\n 51 57 0 0 1 0 0 V2000\n 51.9242 -5.4600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 53.1860 -6.3770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 52.7041 -7.8606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 51.1442 -7.8606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 50.6621 -6.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 49.1784 -5.8949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 53.2752 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 53.2752 -3.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 51.9242 -3.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 50.5731 -3.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 49.2221 -3.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 54.6260 -3.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 50.2273 -9.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 50.8617 -10.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 49.9448 -11.8098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 48.3933 -11.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 47.7589 -10.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 48.6758 -8.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 47.4764 -12.9088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 48.1109 -14.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 47.1939 -15.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 45.6426 -15.4330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 45.0080 -14.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 45.9249 -12.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 44.7254 -16.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 45.3600 -18.1202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 44.4432 -19.3823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 42.8916 -19.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 42.2570 -17.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 43.1740 -16.5320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.9747 -20.4810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 40.4234 -20.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.7265 -23.9808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 39.9884 -23.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.5065 -21.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.9465 -21.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.4643 -23.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.4205 -24.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.9025 -25.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.8587 -26.8662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3327 -26.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.8507 -25.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8945 -23.8987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2889 -27.7010 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 38.4284 -26.0311 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 35.9383 -22.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4563 -21.2557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 33.9727 -20.7738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 33.9727 -19.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 35.4563 -18.7318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 36.3732 -19.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 1 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 10 11 1 0 0 0 0\n 8 12 1 6 0 0 0\n 9 1 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 13 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 19 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 25 30 2 0 0 0 0\n 31 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 33 37 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 42 43 1 0 0 0 0\n 38 43 2 0 0 0 0\n 41 44 1 0 0 0 0\n 39 45 1 0 0 0 0\n 37 38 1 1 0 0 0\n 47 48 1 0 0 0 0\n 48 49 2 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 2 0 0 0 0\n 47 51 1 0 0 0 0\n 46 47 1 0 0 0 0\n 37 46 1 6 0 0 0\n 35 32 1 6 0 0 0\n 28 31 1 0 0 0 0\n 22 25 1 0 0 0 0\n 16 19 1 0 0 0 0\n 4 13 1 0 0 0 0\nM END", "smiles": "CC[C@@H]([C@H](C)O)n1c(=O)n(cn1)-c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5C[C@](Cn6cncn6)(c7ccc(cc7F)F)OC5", "formula": "C37H42F2N8O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "700.7788", "optical_activity": "( - )", "references": [ "e3d33490-6b9d-42fc-a1e5-d7eb31204fd5", "7cb3dbae-7217-48ac-9760-0ce732c19300", "7e0bfbcb-19c7-430d-818a-3fdaa726e04f" ], "stereo_centers": 4 }, "unii": "6TK1G07BHZ", "relationships": [ { "uuid": "0fabff4e-2d77-436a-9cfa-fbab76222527", "amount": { "uuid": "b1732a1c-f7cd-4276-b1b9-1d0001d0bf3a" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "7e0201fe-373e-47ed-90af-9a8859c66027", "refuuid": "dd4c4e3a-4cc1-406c-8ad4-d5d455c35c94", "name": "Posaconazole", "unii": "6TK1G07BHZ", "linking_id": "6TK1G07BHZ", "ref_pname": "Posaconazole", "substance_class": "reference" } }, { "uuid": "b066c968-132a-4cd9-bca8-d2c2144ac66a", "amount": { "uuid": "07de2e13-509e-46a2-a11e-aa3de4d02fab" }, "qualification": "FECAL; PLASMA; URINE", "type": "METABOLITE->PARENT", "interaction_type": "MINOR", "references": [ "dfd5bda7-fc7c-4ff6-9fda-958d898aab24" ], "related_substance": { "uuid": "e056ae70-e2df-42ed-8a3a-6449eed02ae7", "refuuid": "e6b1ab3b-cdfb-4753-a561-b23ed44dd4f7", "name": "2-[(1S,2S)-1-Ethyl-2-hydroxypropyl]-2,4-dihydro-4-[4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenyl]-3H-1,2,4-triazol-3-one", "unii": "4M9GW2UZ9F", "linking_id": "4M9GW2UZ9F", "ref_pname": "2-[(1S,2S)-1-Ethyl-2-hydroxypropyl]-2,4-dihydro-4-[4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenyl]-3H-1,2,4-triazol-3-one", "substance_class": "reference" } }, { "uuid": "116d3219-d0a4-4bde-a84d-448ad801dfd4", "amount": { "uuid": "e6a9f5ce-b97c-4db3-8541-250ece0288a6" }, "qualification": "FECAL; URINE", "type": "METABOLITE->PARENT", "interaction_type": "MINOR", "related_substance": { "uuid": "a054bb67-bd30-4d4f-9efb-3cc7c0423d96", "refuuid": "a3335442-787b-4430-adf5-5536614b406a", "name": "2-((2S,3S)-2-HYDROXYPENTAN-3-YL)-4-(4-(PIPERAZIN-1-YL)PHENYL)-2,4-DIHYDRO-3H-1,2,4-TRIAZOL-3-ONE", "unii": "CQ4E5T9AWX", "linking_id": "CQ4E5T9AWX", "ref_pname": "2-((2S,3S)-2-HYDROXYPENTAN-3-YL)-4-(4-(PIPERAZIN-1-YL)PHENYL)-2,4-DIHYDRO-3H-1,2,4-TRIAZOL-3-ONE", "substance_class": "reference" } }, { "uuid": "8c4382e3-c11f-47b9-9f12-bc45e92cf303", "amount": { "uuid": "aaa1c348-1b6e-4956-ba95-61133354e594" }, "qualification": "URINE", "type": "METABOLITE->PARENT", "related_substance": { "uuid": "d8b797cc-f1f0-4e5a-be22-89bb899f3711", "refuuid": "43ef0d44-59bb-47ef-b3a7-038f8bd9991a", "name": "N-(4-(1-((2S,3S)-2-HYDROXYPENTAN-3-YL)-5-OXO-1,5-DIHYDRO-4H-1,2,4-TRIAZOL-4-YL)PHENYL)ACETAMIDE", "unii": "99WS835K5B", "linking_id": "99WS835K5B", "ref_pname": "N-(4-(1-((2S,3S)-2-HYDROXYPENTAN-3-YL)-5-OXO-1,5-DIHYDRO-4H-1,2,4-TRIAZOL-4-YL)PHENYL)ACETAMIDE", "substance_class": "reference" } }, { "uuid": "a352c971-5ca9-4682-90e3-eaf5445b543f", "amount": { "uuid": "c6f510ee-a5f4-4255-ab59-ca75b1dc19f8" }, "comments": "up to 28% in plasma, 1.4% urine; major posaconazole-​glucuronide produced from human liver microsomes was mediated via UGT1A4 (In vitro, Drug Metabolism and Disposition, Volume 32, Issue 2, Pages 267-271, Journal 2004)", "qualification": "PLASMA; URINE", "type": "METABOLITE->PARENT", "interaction_type": "MAJOR", "references": [ "dfd5bda7-fc7c-4ff6-9fda-958d898aab24" ], "related_substance": { "uuid": "a5b7c65e-b841-49b0-89c7-c838fe107865", "refuuid": "8222d0de-d737-4869-bf10-9269cfe4b3af", "name": "POSACONAZOLE-GLUCURONIDE", "unii": "XW2D9U7U5H", "linking_id": "XW2D9U7U5H", "ref_pname": "POSACONAZOLE-GLUCURONIDE", "substance_class": "reference" } }, { "uuid": "78198ce5-9867-4bc6-b699-dc936e9a9c62", "amount": { "uuid": "96edaeb0-ff9d-4f64-a87d-41102ed38c10" }, "qualification": "PLASMA; URINE", "type": "METABOLITE->PARENT", "interaction_type": "MINOR", "related_substance": { "uuid": "c4bbb5e9-7a69-44eb-a865-9105f0dddc40", "refuuid": "9dbeb61c-e149-4531-a73e-7b03a553f522", "name": "POSACONAZOLE N-GLUCURONIDE", "unii": "E2P944TS6D", "linking_id": "E2P944TS6D", "ref_pname": "POSACONAZOLE N-GLUCURONIDE", "substance_class": "reference" } }, { "uuid": "acfc1e3f-56e5-4711-ac75-44abe3b118e9", "amount": { "uuid": "60269c70-cb3e-4019-a8c2-e4a7c0737a8c", "low": 98, "units": "%" }, "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "81908933-d12a-705c-2791-22c947598d98" ], "related_substance": { "uuid": "644340d5-7ca9-4a04-ae70-6944e56eb1a6", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "3fa21a84-cad3-4f32-ace1-0d4b1f940dd8", "amount": { "uuid": "594a4014-2cf5-4c27-b139-bff23e36b263", "average": 66, "units": "%", "non_numeric_value": "of the radiolabeled dose" }, "qualification": "FECAL", "type": "EXCRETED UNCHANGED", "interaction_type": "AMOUNT EXCRETED", "references": [ "180fd45a-365c-2eb8-0811-3dbca8cdb5e8" ], "related_substance": { "uuid": "ed489d07-50f7-4702-9f92-e5278fb4ab2f", "refuuid": "dd4c4e3a-4cc1-406c-8ad4-d5d455c35c94", "name": "Posaconazole", "unii": "6TK1G07BHZ", "linking_id": "6TK1G07BHZ", "ref_pname": "Posaconazole", "substance_class": "reference" } }, { "uuid": "42afa261-c8c4-4459-a92c-75c7fbe5d496", "amount": { "uuid": "44cb041f-45f9-4f70-8303-099b9fa5d591", "high": 0.2, "units": "%", "non_numeric_value": "of the radiolabeled dose" }, "qualification": "URINE", "type": "EXCRETED UNCHANGED", "interaction_type": "AMOUNT EXCRETED", "references": [ "180fd45a-365c-2eb8-0811-3dbca8cdb5e8" ], "related_substance": { "uuid": "83b70d71-7455-4523-a93b-f65be4ed24ec", "refuuid": "dd4c4e3a-4cc1-406c-8ad4-d5d455c35c94", "name": "Posaconazole", "unii": "6TK1G07BHZ", "linking_id": "6TK1G07BHZ", "ref_pname": "Posaconazole", "substance_class": "reference" } }, { "uuid": "760a1e99-1d87-477c-92b1-916da0cc83ec", "amount": { "uuid": "8cd6276b-dc75-4c50-99f7-696a93ac122a" }, "type": "IMPURITY->PARENT", "references": [ "a2bddb7c-4d04-48b6-a28f-af3e44f21316" ], "related_substance": { "uuid": "5e69f9f0-c04b-409f-bcdc-5d4fca1aa62b", "refuuid": "a73c5d2b-aad6-4015-a807-d8c83b15fd5e", "name": "POSACONAZOLE SUCCINYL ESTER", "unii": "J5YGK3NMB9", "linking_id": "J5YGK3NMB9", "ref_pname": "POSACONAZOLE SUCCINYL ESTER", "substance_class": "reference" } }, { "uuid": "0c7540d0-945b-4307-8123-20b63df862a5", "amount": { "uuid": "7ab36898-0ba3-4050-94aa-eb05d2bfdc41" }, "type": "TARGET ORGANISM->INHIBITOR", "references": [ "d845f0fa-769b-4e5b-a04e-e254c69dea2a" ], "related_substance": { "uuid": "f81b465a-8978-4e2e-bc08-a0da1bcd8a76", "refuuid": "9c5e0166-1c0b-4676-a6c4-dbb7a5cc300f", "name": "ASPERGILLUS TERREUS", "unii": "QBN8K7055X", "linking_id": "QBN8K7055X", "ref_pname": "ASPERGILLUS TERREUS", "substance_class": "reference" } }, { "uuid": "484dfdf2-4e61-4e93-9665-097610d283f8", "amount": { "uuid": "afda611f-ded9-4941-a5e6-dc02d51ccf94" }, "type": "TARGET ORGANISM->INHIBITOR", "references": [ "d845f0fa-769b-4e5b-a04e-e254c69dea2a" ], "related_substance": { "uuid": "b52f1abf-9309-4ab4-85ab-f3b2ef743a75", "refuuid": "4b3ff0c5-2b79-4d95-8082-a949411d466b", "name": "ASPERGILLUS VERSICOLOR", "unii": "044XNC6JZS", "linking_id": "044XNC6JZS", "ref_pname": "ASPERGILLUS VERSICOLOR", "substance_class": "reference" } }, { "uuid": "f0e328da-d3b8-4707-a891-086167bb991b", "amount": { "uuid": "a5d78240-ce75-4537-a351-7ae38174520d" }, "type": "TARGET ORGANISM->INHIBITOR", "references": [ "d845f0fa-769b-4e5b-a04e-e254c69dea2a" ], "related_substance": { "uuid": "64ffa610-1540-4647-a395-58982ff4692a", "refuuid": "f7f87d32-998c-4e87-a6a9-ec0c07e24266", "name": "ASPERGILLUS NIGER VAR. NIGER", "unii": "9IOA40ANG6", "linking_id": "9IOA40ANG6", "ref_pname": "ASPERGILLUS NIGER VAR. NIGER", "substance_class": "reference" } }, { "uuid": "d81600a4-c519-4532-81b3-3983c9aee7d5", "amount": { "uuid": "2c99528c-e0de-44c2-98f4-dd21cbabd851" }, "type": "TARGET ORGANISM->INHIBITOR", "references": [ "d845f0fa-769b-4e5b-a04e-e254c69dea2a" ], "related_substance": { "uuid": "dee116dd-3035-41ab-804e-5bd7a4afe136", "refuuid": "756401c0-bfc8-4c13-a8e8-07a59816b27e", "name": "ASPERGILLUS FLAVUS", "unii": "3J888Y9L13", "linking_id": "3J888Y9L13", "ref_pname": "ASPERGILLUS FLAVUS", "substance_class": "reference" } }, { "uuid": "dd66510b-3bd4-4d65-811f-5c9d97ae35df", "amount": { "uuid": "ff18d8db-4772-408a-aa8a-da4f0d3f0db4" }, "type": "TARGET ORGANISM->INHIBITOR", "references": [ "d845f0fa-769b-4e5b-a04e-e254c69dea2a" ], "related_substance": { "uuid": "17f3b796-358a-4df5-b63c-f390d230e98b", "refuuid": "1d5a8172-56a6-470f-b061-ffdd0b450522", "name": "ASPERGILLUS FUMIGATUS", "unii": "X88DF51T48", "linking_id": "X88DF51T48", "ref_pname": "ASPERGILLUS FUMIGATUS", "substance_class": "reference" } }, { "uuid": "c01f548d-a887-4fab-86b6-5203652ba036", "amount": { "uuid": "0ccd8611-d40c-434a-b1c6-eb42581ec4b4" }, "type": "TARGET ORGANISM->INHIBITOR", "references": [ "d845f0fa-769b-4e5b-a04e-e254c69dea2a" ], "related_substance": { "uuid": "d92ac3ba-4358-410a-9ee5-fab91f1de6bc", "refuuid": "56f5061a-0f1c-4564-a645-812384932380", "name": "ISSATCHENKIA ORIENTALIS WHOLE", "unii": "138TJ2U1SD", "linking_id": "138TJ2U1SD", "ref_pname": "ISSATCHENKIA ORIENTALIS WHOLE", "substance_class": "reference" } }, { "uuid": "84ca0ccd-2b90-4794-9122-31e27cb82bdf", "amount": { "uuid": "638d358d-4e53-48ce-8a2e-1655604a063c" }, "type": "TARGET ORGANISM->INHIBITOR", "references": [ "d845f0fa-769b-4e5b-a04e-e254c69dea2a" ], "related_substance": { "uuid": "a82f59b5-b19f-408c-8beb-8c53bb155fb2", "refuuid": "a797251a-0801-4499-b697-18d535a38dc0", "name": "CANDIDA TROPICALIS", "unii": "Q222J2186W", "linking_id": "Q222J2186W", "ref_pname": "CANDIDA TROPICALIS", "substance_class": "reference" } }, { "uuid": "f8168b2c-78c2-4289-9623-9e176f4e6075", "amount": { "uuid": "ac16911b-d045-4fdc-902a-339bde3945e5" }, "type": "TARGET ORGANISM->INHIBITOR", "references": [ "d845f0fa-769b-4e5b-a04e-e254c69dea2a" ], "related_substance": { "uuid": "69e73bb7-c541-42c7-a8d4-ebe6df305379", "refuuid": "8325f656-5452-46d5-9015-2033def33fbc", "name": "CANDIDA PARAPSILOSIS", "unii": "0KZ676D44N", "linking_id": "0KZ676D44N", "ref_pname": "CANDIDA PARAPSILOSIS", "substance_class": "reference" } }, { "uuid": "92788a00-337f-4ee4-b232-7804490dd73b", "amount": { "uuid": "34447567-9fcb-44b0-9b22-98b01e078994" }, "type": "TARGET ORGANISM->INHIBITOR", "references": [ "d845f0fa-769b-4e5b-a04e-e254c69dea2a" ], "related_substance": { "uuid": "8b127eaf-9f99-4c82-b3d5-12bd0a22c1e9", "refuuid": "142781c3-d280-4336-896e-00e9962ceb0b", "name": "CANDIDA ALBICANS", "unii": "4D7G21HDBC", "linking_id": "4D7G21HDBC", "ref_pname": "CANDIDA ALBICANS", "substance_class": "reference" } }, { "uuid": "f5dc759c-f2f3-4770-b844-ba52456f12be", "amount": { "uuid": "ad809f48-6889-4a6b-825e-36aeb824a92a" }, "comments": "process impurity\nRaw material used for prodcution of starting material SPOE", "type": "IMPURITY->PARENT", "related_substance": { "uuid": "dcbbb27b-2c2e-47e1-bbf7-d9b2ade04be3", "refuuid": "f013f1b6-dbcd-4465-bb92-e5037a5ce243", "name": "METHYL LACTATE, (-)-", "unii": "0379G9C44S", "linking_id": "0379G9C44S", "ref_pname": "METHYL LACTATE, (-)-", "substance_class": "reference" } } ], "names": [ { "uuid": "9eeeb3e8-c81a-41e0-ac77-542bb6eaea62", "name": "(-)-Posaconazole", "stdName": "(-)-POSACONAZOLE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8daf4ff3-2d83-47e0-9bba-a05b958768a4" ], "display_name": false }, { "uuid": "142eeed4-75a7-4acc-9590-127df4e33de8", "name": "2,5-Anhydro-1,3,4-trideoxy-2-C-(2,4-difluorophenyl)-4-[[4-[4-[4-[1-[(1S,2S)-1-ethyl-2-hydroxypropyl]-1,5-dihydro-5-oxo-4H-1,2,4-triazol-4-yl]phenyl]-1-piperazinyl]phenoxy]methyl]-1-(1H-1,2,4-triazol-1-yl)-D-threo-pentitol", "stdName": "2,5-ANHYDRO-1,3,4-TRIDEOXY-2-C-(2,4-DIFLUOROPHENYL)-4-((4-(4-(4-(1-((1S,2S)-1-ETHYL-2-HYDROXYPROPYL)-1,5-DIHYDRO-5-OXO-4H-1,2,4-TRIAZOL-4-YL)PHENYL)-1-PIPERAZINYL)PHENOXY)METHYL)-1-(1H-1,2,4-TRIAZOL-1-YL)-D-THREO-PENTITOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "84f1b83e-31d9-4a34-94d1-80fc8ac82661" ], "display_name": false }, { "uuid": "38b97a26-e211-4d5b-865a-cd5abfe78da4", "name": "3H-1,2,4-Triazol-3-one, 4-[4-[4-[4-[[5-(2,4-difluorophenyl)tetrahydro-5-(1H-1,2,4-triazol-1-ylmethyl)-3-furanyl]methoxy]phenyl]-1-piperazinyl]phenyl]-2-(1-ethyl-2-hydroxypropyl)-2,4-dihydro-, [3R-[3α(1S*,2S*),5α]]-", "stdName": "3H-1,2,4-TRIAZOL-3-ONE, 4-(4-(4-(4-((5-(2,4-DIFLUOROPHENYL)TETRAHYDRO-5-(1H-1,2,4-TRIAZOL-1-YLMETHYL)-3-FURANYL)METHOXY)PHENYL)-1-PIPERAZINYL)PHENYL)-2-(1-ETHYL-2-HYDROXYPROPYL)-2,4-DIHYDRO-, (3R-(3.ALPHA.(1S*,2S*),5.ALPHA.))-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7cb3dbae-7217-48ac-9760-0ce732c19300" ], "display_name": false }, { "uuid": "29e715d6-9ed1-4234-b94e-6693eac2814f", "name": "4-[4-[4-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-[(2S,3S)-2-hydroxypentan-3-yl]-1,2,4-triazol-3-one", "stdName": "4-(4-(4-(4-(((3R,5R)-5-(2,4-DIFLUOROPHENYL)-5-(1,2,4-TRIAZOL-1-YLMETHYL)OXOLAN-3-YL)METHOXY)PHENYL)PIPERAZIN-1-YL)PHENYL)-2-((2S,3S)-2-HYDROXYPENTAN-3-YL)-1,2,4-TRIAZOL-3-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "081fefb9-bbf4-415f-ad9a-7eaba8d90ba8" ], "display_name": false }, { "uuid": "97168650-1748-4237-837a-38f5c0c9aad2", "name": "D-threo-Pentitol, 2,5-anhydro-1,3,4-trideoxy-2-C-(2,4-difluorophenyl)-4-[[4-[4-[4-[1-[(1S,2S)-1-ethyl-2-hydroxypropyl]-1,5-dihydro-5-oxo-4H-1,2,4-triazol-4-yl]phenyl]-1-piperazinyl]phenoxy]methyl]-1-(1H-1,2,4-triazol-1-yl)-", "stdName": "D-THREO-PENTITOL, 2,5-ANHYDRO-1,3,4-TRIDEOXY-2-C-(2,4-DIFLUOROPHENYL)-4-((4-(4-(4-(1-((1S,2S)-1-ETHYL-2-HYDROXYPROPYL)-1,5-DIHYDRO-5-OXO-4H-1,2,4-TRIAZOL-4-YL)PHENYL)-1-PIPERAZINYL)PHENOXY)METHYL)-1-(1H-1,2,4-TRIAZOL-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "84f1b83e-31d9-4a34-94d1-80fc8ac82661" ], "display_name": false }, { "uuid": "d69e9aef-7060-47cb-ac4f-2c84f83271d6", "name": "Noxafil", "stdName": "NOXAFIL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "72aa68ab-a232-49d8-8d9c-646c38ec617f" ], "display_name": false }, { "uuid": "03f0ef0a-0b8d-4c40-b6e7-c2b33349433e", "name": "Posaconazole", "stdName": "POSACONAZOLE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "8cf85a84-812a-452e-b8cd-91efb3b3c5d1", "4b6be5c9-5e22-4d5c-a5b8-0fae3e67350e", "3617839b-c3fa-4a14-b2a1-60694ed48671", "60bd1cbb-83c9-48e7-8cac-3f631eaad038", "b237cbf4-2390-485d-b4a2-05e875f20310", "c51ff7c8-b321-4247-a3af-1eafb7631c2a", "f8912262-74e0-4bca-98d5-152ac587a5ed", "7cb3dbae-7217-48ac-9760-0ce732c19300", "7e0bfbcb-19c7-430d-818a-3fdaa726e04f", "f7f24c9c-9ab3-4b66-ba6b-6cdb506cc619", "9723fe80-f68b-483d-af1e-53874c0793db", "dbde522a-e87d-494e-b200-6519c733de46", "8036affa-8f83-4423-97c9-df8301fd5445", "dddc1c73-d143-434c-8c1d-94c18cb17dfa", "5ca94ff7-cca5-4ad3-9174-04c2777da406", "372c8547-1590-4a8a-aaf3-c74ea0a63658", "2461ac66-3b48-4e86-b505-fe5cceadf0d5", "4bdf318a-9b5c-4f24-bf28-0566ce723647", "f87087e7-2a2a-4d1e-918d-c62da8b90a17" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "baee6fb0-a845-4d36-8c7b-130d309ef9a3", "name_org": "USAN" }, { "uuid": "2a864dba-f517-4025-9619-4090b933b449", "name_org": "INN" } ] }, { "uuid": "4565f205-c53d-434d-b951-ab691e5158d5", "name": "Posaconazole [EMA EPAR]", "stdName": "POSACONAZOLE [EMA EPAR]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b237cbf4-2390-485d-b4a2-05e875f20310" ], "display_name": false }, { "uuid": "ff0c91a2-c60c-be43-8d7a-67148ec94e0c", "name": "Posaconazole [GREEN BOOK]", "stdName": "POSACONAZOLE [GREEN BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ac49385f-d737-9d6d-6a39-a5b6a96a6f9e" ], "display_name": false }, { "uuid": "4057c5d9-5569-4be1-8d41-3763ebda24f1", "name": "Posaconazole [HSDB]", "stdName": "POSACONAZOLE [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8036affa-8f83-4423-97c9-df8301fd5445" ], "display_name": false }, { "uuid": "7b7ffb39-8625-4b83-92de-d437c51868e8", "name": "Posaconazole [INN]", "stdName": "POSACONAZOLE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7e0bfbcb-19c7-430d-818a-3fdaa726e04f" ], "display_name": false }, { "uuid": "dbdd15fc-e7e5-41b8-90ca-c4644949e7c5", "name": "Posaconazole [JAN]", "stdName": "POSACONAZOLE [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0e3e046f-d7e0-10fe-ed89-aa57617c9074" ], "display_name": false }, { "uuid": "aa73987b-9412-44e3-85d2-ec489d0af524", "name": "Posaconazole [MART.]", "stdName": "POSACONAZOLE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "60bd1cbb-83c9-48e7-8cac-3f631eaad038" ], "display_name": false }, { "uuid": "3ab1435c-48c2-4f07-bb81-55009f1edd2d", "name": "Posaconazole [MI]", "stdName": "POSACONAZOLE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8cf85a84-812a-452e-b8cd-91efb3b3c5d1" ], "display_name": false }, { "uuid": "89d2bea0-1562-4f36-9bcc-72998dceff91", "name": "Posaconazole [ORANGE BOOK]", "stdName": "POSACONAZOLE [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f87087e7-2a2a-4d1e-918d-c62da8b90a17" ], "display_name": false }, { "uuid": "8c76b398-ef1f-422d-a5e4-3899f54e6bdd", "name": "Posaconazole [USAN]", "stdName": "POSACONAZOLE [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f7f24c9c-9ab3-4b66-ba6b-6cdb506cc619" ], "display_name": false }, { "uuid": "65da4809-cd65-43b0-b6ea-93c2028fa2f3", "name": "Posaconazole [VANDF]", "stdName": "POSACONAZOLE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4bdf318a-9b5c-4f24-bf28-0566ce723647" ], "display_name": false }, { "uuid": "27e7158b-bfe1-be05-0bb6-c7039866f4e5", "name": "Posaconazole [WHO-DD]", "stdName": "POSACONAZOLE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3af76964-086d-54c7-2e8e-a8185a9d20e0" ], "display_name": false }, { "uuid": "9b0c112e-c188-47f1-8ef3-b571dce32b77", "name": "SCH-56592", "stdName": "SCH-56592", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "7cb3dbae-7217-48ac-9760-0ce732c19300" ], "display_name": false } ], "properties": [ { "uuid": "ec80062d-69be-4dca-82a5-06cf153ce974", "name": "Tmax", "value": { "uuid": "1de50841-8c33-425e-a0c3-39cbc30035d8", "high": 5, "low": 3, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "180fd45a-365c-2eb8-0811-3dbca8cdb5e8" ] }, { "uuid": "008c298d-8e75-483b-8a4e-69e81616d14c", "name": "Volume of Distribution", "value": { "uuid": "407b2566-ae47-4760-ae71-d3d88ee26c24", "average": 3.73, "units": "Liters/Kilogram" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "81908933-d12a-705c-2791-22c947598d98" ] }, { "uuid": "00ed4b58-ec94-417a-beac-59ac7f50f792", "name": "Biological Half-life", "value": { "uuid": "2e4a2fea-bc62-423a-ba33-dd6422ea2768", "average": 35, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "81908933-d12a-705c-2791-22c947598d98" ] }, { "uuid": "e1909965-2d93-4f92-8f54-3b4e7f3e602e", "name": "Volume of Distribution", "value": { "uuid": "b7b45634-455c-4de4-b334-e29e5f567789" }, "defining": false, "parameters": [ { "uuid": "ad1b9152-a2d7-46c0-b9a5-b7ce47b5d9e2", "name": "Oral", "type": "PHARMACOKINETIC", "value": { "uuid": "5e3815cd-71bb-45da-919e-dd6bab8c51ad", "average": 287, "units": "LITERS", "references": [] }, "references": [] }, { "uuid": "34274d4b-6dc9-440d-ba3a-e4228f8326ca", "name": "Injection", "type": "PHARMACOKINETIC", "value": { "uuid": "67d274db-3d6f-4b08-b500-b4e4aeefb9b3", "average": 261, "units": "LITERS", "references": [] }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "20d68bbe-8ebc-1c68-6483-1034f5267f5b" ] }, { "uuid": "e1b05e4a-702e-4858-bf5e-075fae1ae4fc", "name": "Biological Half-life", "value": { "uuid": "fc67c4c2-aab4-4d29-933c-9a91ab7e01a5" }, "defining": false, "parameters": [ { "uuid": "8c30241b-f117-4769-ae8a-9bc52b6c0da0", "name": "Elimination", "type": "PHARMACOKINETIC", "value": { "uuid": "36c8ebb0-a7c6-4bdf-b5cc-476abcc2c0fe", "average": 35, "high": 66, "low": 20, "units": "hours", "references": [], "non_numeric_value": "In Suspension" }, "references": [] }, { "uuid": "6a3dbf68-cf5f-4183-9fd6-78f33d359d6f", "name": "Elimination", "type": "PHARMACOKINETIC", "value": { "uuid": "e212dd83-f8a9-48fc-9d19-6a4b59c07909", "high": 32, "low": 26, "units": "hours", "references": [], "non_numeric_value": "In tablet form." }, "references": [] }, { "uuid": "a2010d05-6f9a-4d2a-a107-ed7fcf168806", "name": "Elimination", "type": "PHARMACOKINETIC", "value": { "uuid": "9597a076-720c-4f20-abfe-383bbabd3b13", "average": 27, "units": "hours", "references": [], "non_numeric_value": "In injection form." }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "20d68bbe-8ebc-1c68-6483-1034f5267f5b" ] } ] } ] }