{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e40f81f3-5cfc-4d42-8809-d37af870c562",
          "code": "1187-00-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1187-00-4",
          "code_system": "CAS",
          "references": [
            "8e2758b0-ff3c-4b33-9f0e-fd8d9107da5b",
            "f104f262-6005-43c2-a45b-3e440c68cf92"
          ]
        },
        {
          "uuid": "9a123c01-87a6-431d-9807-efc27ef5948e",
          "code": "142775",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/142775",
          "code_system": "PUBCHEM",
          "references": [
            "8e2758b0-ff3c-4b33-9f0e-fd8d9107da5b"
          ]
        },
        {
          "uuid": "8ae38f86-2eca-eadb-e9db-219dc9c870cf",
          "code": "DB12097",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12097",
          "code_system": "DRUG BANK",
          "references": [
            "3757cae8-838d-4ec0-9830-2e81212916a1"
          ]
        },
        {
          "uuid": "8bede87f-f84f-4cbd-818d-7193e446a887",
          "code": "6STO1P091F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "62dec611-9957-0954-61e0-81827b447ade",
          "code": "37538",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=37538",
          "code_system": "NSC",
          "references": [
            "2892dda4-7756-2550-69b3-022e9279f111"
          ]
        },
        {
          "uuid": "7c7139e5-b378-d766-0308-2d0f5d388565",
          "code": "DTXSID801339484",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801339484",
          "code_system": "EPA CompTox",
          "references": [
            "ff61e2d7-1bef-eade-dfd9-7be975e7d984"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "359488a9-7cf4-4ac4-84ab-dd2109094286",
          "name": "CB-2511",
          "stdName": "CB-2511",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1ef1ada-c770-4825-a451-808c735e18c7",
            "995ea6b4-6c43-430d-bfff-a17298b2e066"
          ],
          "display_name": false
        },
        {
          "uuid": "6ec75e5a-2ab7-4e72-8fb0-37fe642783f1",
          "name": "D-MANNITOL, 1,6-DIMETHANESULFONATE",
          "stdName": "D-MANNITOL, 1,6-DIMETHANESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1ef1ada-c770-4825-a451-808c735e18c7",
            "995ea6b4-6c43-430d-bfff-a17298b2e066"
          ],
          "display_name": false
        },
        {
          "uuid": "f17655cc-15f5-439c-9ed2-2ff2a2b44747",
          "name": "MANNITOL 1,6-DIMETHANESULFONATE, D-",
          "stdName": "MANNITOL 1,6-DIMETHANESULFONATE, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1ef1ada-c770-4825-a451-808c735e18c7",
            "307e9473-39fd-4627-8072-56f3a4339ad9"
          ],
          "display_name": false
        },
        {
          "uuid": "1e2571d4-0b21-464a-b438-0cf756fe6368",
          "name": "MANNITOL 1,6-DIMETHANESULPHONATE, D-",
          "stdName": "MANNITOL 1,6-DIMETHANESULPHONATE, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7630384f-6b28-4743-8564-5b7a1abdce30"
          ],
          "display_name": false
        },
        {
          "uuid": "5ee24288-7af4-44e5-a1b2-8ddabd20de68",
          "name": "MANNITOL BUSULFAN",
          "stdName": "MANNITOL BUSULFAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1ef1ada-c770-4825-a451-808c735e18c7",
            "995ea6b4-6c43-430d-bfff-a17298b2e066"
          ],
          "display_name": true
        },
        {
          "uuid": "c76e2cb7-5476-46b0-b507-7650c221bf55",
          "name": "MANNITOL MYLERAN",
          "stdName": "MANNITOL MYLERAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1ef1ada-c770-4825-a451-808c735e18c7",
            "995ea6b4-6c43-430d-bfff-a17298b2e066"
          ],
          "display_name": false
        },
        {
          "uuid": "fab9f4ef-9179-4f42-a5f6-203c571562dd",
          "name": "MANNITOLBUSULFAN, D",
          "stdName": "MANNITOLBUSULFAN, D",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1ef1ada-c770-4825-a451-808c735e18c7",
            "307e9473-39fd-4627-8072-56f3a4339ad9"
          ],
          "display_name": false
        },
        {
          "uuid": "6df15c3d-2903-4792-be37-70aa04578918",
          "name": "MANNOGRANOL",
          "stdName": "MANNOGRANOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1ef1ada-c770-4825-a451-808c735e18c7",
            "15f66aa9-d8fd-4ac7-9cab-e6096572073f"
          ],
          "display_name": false
        },
        {
          "uuid": "e515f12c-fa1b-40c4-8683-0e046e59c1fe",
          "name": "MM",
          "stdName": "MM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1ef1ada-c770-4825-a451-808c735e18c7",
            "995ea6b4-6c43-430d-bfff-a17298b2e066"
          ],
          "display_name": false
        },
        {
          "uuid": "18721917-f95c-4669-8eec-04e95aea9c9b",
          "name": "NSC-37538",
          "stdName": "NSC-37538",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1ef1ada-c770-4825-a451-808c735e18c7",
            "995ea6b4-6c43-430d-bfff-a17298b2e066"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "307e9473-39fd-4627-8072-56f3a4339ad9",
          "citation": "Index nominum 2000: international drug directory",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c1ef1ada-c770-4825-a451-808c735e18c7",
          "citation": "INDEX NAME NOMINUM",
          "doc_type": "INDEX NAME NOMINUM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7630384f-6b28-4743-8564-5b7a1abdce30",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15f66aa9-d8fd-4ac7-9cab-e6096572073f",
          "citation": "http://www.fda.gov/downloads/AnimalVeterinary/GuidanceComplianceEnforcement/PoliciesProceduresManual",
          "url": "http://www.fda.gov/downloads/AnimalVeterinary/GuidanceComplianceEnforcement/PoliciesProceduresManual",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "995ea6b4-6c43-430d-bfff-a17298b2e066",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e2758b0-ff3c-4b33-9f0e-fd8d9107da5b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391315000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f20a23b-3eb9-4431-b07c-926c5ec65354",
          "citation": "SRS import [6STO1P091F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6STO1P091F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391315000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3757cae8-838d-4ec0-9830-2e81212916a1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f104f262-6005-43c2-a45b-3e440c68cf92",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2892dda4-7756-2550-69b3-022e9279f111",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ff61e2d7-1bef-eade-dfd9-7be975e7d984",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4ea93eeb-3ead-44d6-9a52-47484ac6994f",
          "id": "4ea93eeb-3ead-44d6-9a52-47484ac6994f",
          "molfile": "\n  Marvin  01132104062D          \n\n 20 19  0  0  1  0            999 V2000\n    4.6928   -4.1427    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.6711   -4.9675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4177   -3.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1211   -4.1802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8463   -3.7865    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5714   -3.3928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2400   -4.5116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4526   -3.0615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9894   -3.7116    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.0109   -2.8870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2642   -4.1053    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.2426   -4.9301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5608   -3.6742    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.5823   -2.8496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8357   -4.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1323   -3.6368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4072   -4.0305    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3178   -4.4241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8009   -4.7555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0136   -3.3055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  9  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\n  5  8  2  0  0  0  0\n  9 10  1  6  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  6  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  2  0  0  0  0\n 17 20  2  0  0  0  0\nM  END",
          "smiles": "CS(=O)(=O)OC[C@H]([C@H]([C@@H]([C@@H](COS(=O)(=O)C)O)O)O)O",
          "formula": "C8H18O10S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a9ec5365-ea28-433e-ba31-7afb9b05a37f"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "338.355",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c334eb56-3fe9-4285-9a83-65b78918ebe6",
      "version": "5",
      "structure": {
        "id": "c84154e1-5420-4002-9a57-b95d12dd4ec4",
        "molfile": "\n  Marvin  01132110212D          \n\n 20 19  0  0  1  0            999 V2000\n    6.1211   -4.1802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4177   -3.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6928   -4.1427    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6711   -4.9675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9894   -3.7116    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.0109   -2.8870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2642   -4.1053    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.2426   -4.9301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5608   -3.6742    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.5823   -2.8496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8357   -4.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1323   -3.6368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4072   -4.0305    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3178   -4.4241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8009   -4.7555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0136   -3.3055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8463   -3.7865    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5714   -3.3928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2400   -4.5116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4526   -3.0615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  2  0  0  0  0\n 13 16  2  0  0  0  0\n 17  1  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  2  0  0  0  0\n 17 20  2  0  0  0  0\nM  END",
        "smiles": "CS(=O)(=O)OC[C@H]([C@H]([C@@H]([C@@H](COS(=O)(=O)C)O)O)O)O",
        "formula": "C8H18O10S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "338.355",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3f20a23b-3eb9-4431-b07c-926c5ec65354",
          "307e9473-39fd-4627-8072-56f3a4339ad9"
        ],
        "stereo_centers": 4
      },
      "unii": "6STO1P091F"
    }
  ]
}