{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2eec5266-f7ff-4053-91af-fb8a9865d721", "code": "72680-57-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=72680-57-0", "code_system": "CAS", "references": [ "d1b5881f-86b5-42ff-92ad-80a2efa03c43", "964f5ac9-bc7c-4453-88c2-bb9d5f309b2d" ] }, { "uuid": "1dfda2ba-c905-4996-a07e-ea8d2fa87488", "code": "71587264", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587264", "code_system": "PUBCHEM", "references": [ "d1b5881f-86b5-42ff-92ad-80a2efa03c43" ] }, { "uuid": "d61426e6-e2e6-8eca-fcdc-cc058a584848", "code": "DTXSID50222992", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50222992", "code_system": "EPA CompTox", "references": [ "deb7a721-9f6f-72d1-e77a-dd3afbec78bd" ] }, { "uuid": "8101788b-cd9d-46ab-afea-761065b5e9fa", "code": "6SS8XV2S5P", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "32d71cfa-0827-43f5-a956-8f756a491f38", "name": "DINONOXYNOL-4 PHOSPHATE", "stdName": "DINONOXYNOL-4 PHOSPHATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "749631a4-9060-4e6c-b7d2-b39629041505", "d8db686f-6dba-4ec6-a12d-a22a19993cca", "cb8bee40-3b28-4670-9f5d-b9039ffcfc0e" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "e8badc2b-2034-4c8e-851f-58f835c8f0ad", "name_org": "INCI" } ] }, { "uuid": "9fa8f4a4-cc96-4c03-a969-31147fe670a1", "name": "ETHANOL, 2-(2-(2-(2-(4-NONYLPHENOXY)ETHOXY)ETHOXY)ETHOXY)-, HYDROGEN PHOSPHATE", "stdName": "ETHANOL, 2-(2-(2-(2-(4-NONYLPHENOXY)ETHOXY)ETHOXY)ETHOXY)-, HYDROGEN PHOSPHATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c346f136-240b-484f-961d-d12e048f9dbd", "749631a4-9060-4e6c-b7d2-b39629041505" ], "display_name": false }, { "uuid": "1e3b2b6a-bb45-443a-8dfc-c6a227193129", "name": "NIKKOL DNPP-4", "stdName": "NIKKOL DNPP-4", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "749631a4-9060-4e6c-b7d2-b39629041505", "cb8bee40-3b28-4670-9f5d-b9039ffcfc0e" ], "display_name": false } ], "references": [ { "uuid": "cb8bee40-3b28-4670-9f5d-b9039ffcfc0e", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "749631a4-9060-4e6c-b7d2-b39629041505", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c346f136-240b-484f-961d-d12e048f9dbd", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d1b5881f-86b5-42ff-92ad-80a2efa03c43", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391504000, "tags": [ "NOMEN" ] }, { "uuid": "92030ebe-e87b-4c39-9dd4-e4c426e934b8", "citation": "SRS import [6SS8XV2S5P]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6SS8XV2S5P", "doc_type": "SRS", "public_domain": true, "document_date": 1493391504000, "tags": [ "NOMEN" ] }, { "uuid": "d8db686f-6dba-4ec6-a12d-a22a19993cca", "citation": "DINONOXYNOL-4 PHOSPHATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "deb7a721-9f6f-72d1-e77a-dd3afbec78bd", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=72680-57-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "964f5ac9-bc7c-4453-88c2-bb9d5f309b2d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7fb1c59e-651e-41da-92b0-b8a0a435ece2", "id": "7fb1c59e-651e-41da-92b0-b8a0a435ece2", "molfile": "\n Marvin 01132106382D \n\n 59 60 0 0 0 0 999 V2000\n 14.4954 -19.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4954 -19.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7810 -18.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7810 -17.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0664 -17.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0664 -16.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3520 -16.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3520 -15.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6375 -14.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6375 -14.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3520 -13.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3520 -12.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6375 -12.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6375 -11.6172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9230 -11.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9230 -10.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2085 -9.9672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2085 -9.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4941 -8.7297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4941 -7.9047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7797 -7.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7797 -6.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0651 -6.2547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0651 -5.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3507 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3507 -4.1921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0651 -3.7797 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6527 -3.0651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4777 -4.4941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7797 -3.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4941 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2085 -3.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9230 -3.7797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6375 -3.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3520 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0664 -3.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7810 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4954 -3.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2098 -3.7797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9244 -3.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6388 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3533 -3.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0678 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0678 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7823 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4967 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2112 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9257 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6401 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3547 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0691 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7836 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4981 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2125 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9270 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4967 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7823 -3.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9230 -12.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9230 -13.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 59 10 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 58 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\n 27 30 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 1 0 0 0 0\n 42 41 1 0 0 0 0\n 43 42 1 0 0 0 0\n 43 44 1 0 0 0 0\n 57 43 2 0 0 0 0\n 44 45 2 0 0 0 0\n 45 46 1 0 0 0 0\n 47 46 1 0 0 0 0\n 46 56 2 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 52 53 1 0 0 0 0\n 53 54 1 0 0 0 0\n 54 55 1 0 0 0 0\n 56 57 1 0 0 0 0\n 58 59 1 0 0 0 0\nM END", "smiles": "CCCCCCCCCc1ccc(cc1)OCCOCCOCCOCCOP(=O)(O)OCCOCCOCCOCCOc2ccc(CCCCCCCCC)cc2", "formula": "C46H79O12P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cc898ed0-9184-4425-b966-4a7956e7313b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "855.0878", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "4b9d89f5-82a3-4aba-9f46-01b801550c44", "version": "4", "structure": { "id": "aeb718a7-c7eb-4f25-a8cc-dbaa8afce7aa", "molfile": "\n Marvin 01132109042D \n\n 59 60 0 0 0 0 999 V2000\n 11.6375 -14.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6375 -14.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3520 -13.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3520 -12.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6375 -12.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6375 -11.6172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9230 -11.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9230 -10.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2085 -9.9672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2085 -9.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4941 -8.7297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4941 -7.9047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7797 -7.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7797 -6.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0651 -6.2547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0651 -5.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3507 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3507 -4.1921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9230 -12.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9230 -13.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3520 -15.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3520 -16.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0664 -16.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0664 -17.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7810 -17.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7810 -18.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4954 -19.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4954 -19.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0651 -3.7797 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4777 -4.4941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6527 -3.0651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9270 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2125 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4981 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7836 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.0691 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3547 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6401 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9257 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7823 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0678 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7797 -3.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4941 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2085 -3.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9230 -3.7797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6375 -3.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3520 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0664 -3.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7810 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4954 -3.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2098 -3.7797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9244 -3.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6388 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3533 -3.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0678 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7823 -3.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4967 -3.7797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4967 -4.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2112 -5.0171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 5 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 2 2 0 0 0 0\n 1 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 29 42 1 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 59 39 1 0 0 0 0\n 40 58 2 0 0 0 0\n 41 40 1 0 0 0 0\n 55 41 2 0 0 0 0\n 43 42 1 0 0 0 0\n 44 43 1 0 0 0 0\n 45 44 1 0 0 0 0\n 46 45 1 0 0 0 0\n 47 46 1 0 0 0 0\n 48 47 1 0 0 0 0\n 49 48 1 0 0 0 0\n 50 49 1 0 0 0 0\n 51 50 1 0 0 0 0\n 52 51 1 0 0 0 0\n 53 52 1 0 0 0 0\n 54 53 1 0 0 0 0\n 55 54 1 0 0 0 0\n 56 55 1 0 0 0 0\n 57 56 2 0 0 0 0\n 58 57 1 0 0 0 0\n 59 58 1 0 0 0 0\n 29 18 1 0 0 0 0\nM END", "smiles": "CCCCCCCCCc1ccc(cc1)OCCOCCOCCOCCOP(=O)(O)OCCOCCOCCOCCOc2ccc(CCCCCCCCC)cc2", "formula": "C46H79O12P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "855.0878", "optical_activity": "NONE", "references": [ "c346f136-240b-484f-961d-d12e048f9dbd", "92030ebe-e87b-4c39-9dd4-e4c426e934b8" ], "stereo_centers": 0 }, "unii": "6SS8XV2S5P" } ] }