{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c885c59d-76b0-4714-be7e-308a65fd3a50",
          "code": "A11HA05",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|VITAMINS|OTHER PLAIN VITAMIN PREPARATIONS|Other plain vitamin preparations|biotin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A11HA05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "352ccab2-e2bb-4e42-a295-a402a5eb9ec2",
          "code": "QA11HA05",
          "comments": "VATC|VITAMINS|OTHER PLAIN VITAMIN PREPARATIONS|Other plain vitamin preparations|biotin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA11HA05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "419d403e-a89b-4a57-8975-b4c90f240a57",
          "code": "58-85-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58-85-5",
          "code_system": "CAS",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c",
            "bb38ef90-18f4-4ed9-8613-92e4494d012b"
          ]
        },
        {
          "uuid": "badfce95-a1c1-45ff-bb84-c3217877a3ee",
          "code": "C309",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C309",
          "code_system": "NCI_THESAURUS",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "b8778b86-c5a5-49e6-a9d8-c93ad18980d6",
          "code": "D001710",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001710",
          "code_system": "MESH",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "7266edd8-9c2b-470e-8824-b74c34226561",
          "code": "NBK548710",
          "comments": "LiverTox|HDS: Nutritional Sup|Vitamins|Vitamin B",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548710/",
          "code_system": "LIVERTOX",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "6cc52507-b4c1-4ded-aba5-c46de6cb8092",
          "code": "BIOTIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Biotin",
          "code_system": "WIKIPEDIA",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "ae52a313-9d02-475b-9861-02e5669c4a3d",
          "code": "SUB05841MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "479dea58-eee6-46dd-a5c3-f049e09133e0",
          "code": "1203",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1203",
          "code_system": "INN",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "6bec2359-c45b-49d3-bab1-ee548ea5ec3f",
          "code": "m2506",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2506?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "f7bdf6a7-f823-4884-9635-a1e78c224b61",
          "code": "314583",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/314583/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "9e289ea3-d066-4fd5-8252-b317b0196edf",
          "code": "1588",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1588/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "c3b59715-0a35-4e85-b3e9-b1da1807b6a1",
          "code": "DB00121",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00121",
          "code_system": "DRUG BANK",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "075b6e8b-565c-4937-af18-e00a9db87857",
          "code": "SUB32335",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "6488d0e7-009b-4faa-adb2-446d90aa1694",
          "code": "CHEMBL857",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL857",
          "code_system": "ChEMBL",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "2ae10cf7-9122-4df2-ba2e-b9f61cf86021",
          "code": "200-399-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.363",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "b522cac2-9b35-40ba-94a3-ee1cb206f8d5",
          "code": "171548",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/171548",
          "code_system": "PUBCHEM",
          "references": [
            "153fe3c6-0b31-4af3-857f-1a725ffe3a7c"
          ]
        },
        {
          "uuid": "21aa4cfb-30a1-1d49-f865-2d124932dfe3",
          "code": "346",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/346",
          "code_system": "HSDB",
          "references": [
            "57057538-4318-b05f-36db-faabf6463033"
          ]
        },
        {
          "uuid": "2cf459a3-dac1-d690-4598-024da436988a",
          "code": "DTXSID7022679",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7022679",
          "code_system": "EPA CompTox",
          "references": [
            "3e595503-89a3-7324-b97a-73b89aa99614"
          ]
        },
        {
          "uuid": "cdf86d34-c40c-fea5-5033-acdc93ed5296",
          "code": "C45812",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Vitamin[C944]|Water-Soluble Vitamin[C1551]|B Vitamin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45812",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "bd574047-c45e-9f4a-b684-c4753228f2e2",
          "code": "31997-0",
          "comments": "LOINC|ACTIVE|CHEM|Bld|Biotin [Presence] in Blood",
          "type": "PRIMARY",
          "url": "https://loinc.org/31997-0/",
          "code_system": "LOINC",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "6e11eb1c-749c-cd98-3166-ffeb9fac4db2",
          "code": "34398-8",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Biotin [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/34398-8/",
          "code_system": "LOINC",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "e2b660b5-abeb-3748-a39c-f530ee92b27d",
          "code": "1980-2",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Biotin [Mass/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/1980-2/",
          "code_system": "LOINC",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "3cf19da7-10a6-4bcc-9e04-6261073d6ec0",
          "code": "6SO6U10H04",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "27ed15ba-bbda-6e14-bd26-f9d69bb61e70",
          "code": "2669 (Number of products:7171)",
          "comments": "Dietary Supplement Label Database|vitamin|Vitamin B7 (biotin)",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2669&item=Vitamin B7 (biotin)",
          "code_system": "DSLD",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "bf6fffb6-985f-0adf-aee3-f235e4bc4bb1",
          "code": "22 (Number of products:127)",
          "comments": "Dietary Supplement Label Database|Vitamin|Biotin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=22&item=Biotin",
          "code_system": "DSLD",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "5f73f033-0816-13e3-4295-20abb0bbcb86",
          "code": "760720",
          "comments": "ORPHAN DRUG|Designated|Treatment of Charcot-Marie-Tooth disease",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=760720",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "299245e6-aba2-24bb-9007-1eb5afb1db49",
          "code": "373",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/373",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "45842de2-354c-9ece-8ae7-4f307eecf642",
          "code": "1071508",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1071508",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "ded2f756-9133-8708-1db1-465e8234dff0",
          "code": "57586",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:57586",
          "code_system": "CHEBI",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "10b033a3-1833-e8c5-33d8-55848430eb2e",
          "code": "15956",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15956",
          "code_system": "CHEBI",
          "references": [
            "d12f3864-119b-89b8-08ef-daf41be5efef"
          ]
        },
        {
          "uuid": "11d30490-e0f1-87c2-877a-1c4130484f23",
          "code": "63865",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=63865",
          "code_system": "NSC",
          "references": [
            "4c0d5a15-6965-fff2-6aa0-1bc3015164b0"
          ]
        },
        {
          "uuid": "b603ff90-c00d-dfc3-7dc6-ec8955864fc8",
          "code": "100000092789",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "97ec1e7a-bbef-29db-5d52-81562b4f0fb9"
          ]
        },
        {
          "uuid": "01ab4051-91d6-9eb1-3e42-c5ba39119e67",
          "code": "6SO6U10H04",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6SO6U10H04",
          "code_system": "DAILYMED",
          "references": [
            "005cd330-adb6-0e01-abc4-caf7d94773af"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "150d6010-d9dd-4074-8dee-4d40ef7b099b",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9fdb6ab7-b8da-45a7-aff9-a452897cfcb6",
          "citation": "ACD9.0(USAN 2006)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cab6c6a0-6689-4bb0-a0a3-df8f56b182f7",
          "citation": "USP DICTIONARY ",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00e473be-3846-4954-8126-55b4889064f1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4fdd502-1879-49e9-9baa-cfbae5e42d64",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef920afc-4cac-43d7-8685-eed31264459f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bde727a7-0709-433e-8cd6-7039bacc1679",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b64b531c-6e7a-44ff-8a33-81de14636cb6",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2cc472af-f86b-49f1-a63e-150a766e4e1f",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1ca5f4a-d599-46e3-92a2-0a71b59d2f35",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9f95910-c531-4e99-91b5-c1413eb67da6",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db4bf371-c889-4483-a377-1ceeccd0b3d4",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1797a3b-6ad5-4ed5-8345-6ede2b279578",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8deda405-ba6c-4446-affa-892c145ec270",
          "citation": "D00029",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7f4066f-cfe0-41c1-a673-9ceb005f1c45",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1cf6092-1386-4d34-b5e6-f7a1c07f127f",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7772ae08-6c44-48f7-814c-48decb2d0a82",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3f182e6-f710-4116-b243-f11874175514",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a7ad202-2f44-4a36-a689-c9752b5d9bc0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "707056bd-3482-4d97-a51b-4f0c77a9cfdb",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48e0ff1e-7975-4a7d-b7b7-d51911306e3a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "153fe3c6-0b31-4af3-857f-1a725ffe3a7c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44ba3fcf-032f-4e72-8902-3f0e785029dc",
          "citation": "SRS import [6SO6U10H04]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6SO6U10H04",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389721000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0fdc3f3-c9e7-4fdb-b6a8-cd6ad24cfc4e",
          "citation": "BIOTIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3e1f9999-2f31-48b6-b1f5-bca4d4d276dc",
          "citation": "BIOTIN [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1cad3a5c-ff62-4e5d-9de0-6f2b9b2cd0c4",
          "citation": "BIOTIN [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "07dfc6d5-77e5-443b-830d-1090e2ddb6c7",
          "citation": "BIOTIN [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a5404ea3-0626-42b7-be6d-52e311cfa36b",
          "citation": "BIOTIN [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "88f72b74-f3cd-4b10-8c6a-9841e94a23cb",
          "citation": "BIOTIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "705e13fb-d834-42eb-9c00-3c19d014cb67",
          "citation": "BIOTIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "32a250f7-3189-4d69-bc04-c0cb9047b526",
          "citation": "BIOTIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e7370f6f-d829-4c88-b470-3ac0a3c75df2",
          "citation": "BIOTIN [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2f10d4b5-2754-4087-af57-a1b76688f31c",
          "citation": "BIOTIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "007f2b9a-423c-45b1-b3a9-2adcd17d7c2f",
          "citation": "BIOTIN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fdd44e40-2f65-4ee4-bc58-1010e787f099",
          "citation": "BIOTIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4a984ba2-707b-4803-86a1-a72f66217312",
          "citation": "BIOTIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ab33feef-d4bc-41ba-95ed-40877e3f9089",
          "citation": "D-BIOTIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "57057538-4318-b05f-36db-faabf6463033",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+58-85-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e595503-89a3-7324-b97a-73b89aa99614",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58-85-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "46b9eda0-0d43-e4a4-9157-5dfd645d4a1c",
          "citation": "https://multiplesclerosisnewstoday.com/2017/05/19/progressive-multiple-sclerosis-phase-3-trial-of-high-dose-biotin-md1003-enrolling-patients/",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "97ec1e7a-bbef-29db-5d52-81562b4f0fb9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d12f3864-119b-89b8-08ef-daf41be5efef",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "bb38ef90-18f4-4ed9-8613-92e4494d012b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ecfaa1d3-9306-343b-217b-ccf0cab6237b",
          "citation": "USP42-NF37 - 555, Biotin Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "39bbaadd-5185-418d-89ab-662429ad4d2c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9520e0cb-36d7-8bb8-0d23-01e4ed376b25",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "ef381bc8-3d55-d01c-a8c1-7b9325fa0574",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "005cd330-adb6-0e01-abc4-caf7d94773af",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4c0d5a15-6965-fff2-6aa0-1bc3015164b0",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "56f7b8e5-e944-42c4-8c43-7bf29e4d6f96",
          "citation": "NBK548710",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548710/",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "8557274e-ac04-19b1-f11b-4fdd08ab3a79",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4a9ffa99-df07-4684-84f6-abd606f04562",
          "id": "4a9ffa99-df07-4684-84f6-abd606f04562",
          "molfile": "\n  Marvin  01132103542D          \n\n 16 17  0  0  1  0            999 V2000\n    7.5231   -3.4210    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1027   -2.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3048   -2.8878    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1453   -3.7012    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.5032   -4.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7910   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0864   -4.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3742   -3.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6542   -4.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6620   -4.9739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9420   -3.7518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9743   -4.0320    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.3907   -4.7442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2780   -4.5768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8073   -5.1061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2702   -3.7518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 12  1  0  0  0  0\n  1 16  1  6  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n 12  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 13  1  6  0  0  0\n 13 14  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 14  1  0  0  0  0\nM  END",
          "smiles": "C(CCC(=O)O)C[C@H]1[C@@H]2[C@H](CS1)NC(=O)N2",
          "formula": "C10H16N2O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "65ecf99f-db17-40b8-8267-df897424bdce"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "244.3121",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1530fd56-1aaa-4e85-bca7-5e4d4fe1d8bf",
      "version": "37",
      "structure": {
        "id": "cd8ee6b0-d192-425d-b981-a1f4afc8e8e5",
        "molfile": "\n  Marvin  01132110372D          \n\n 18 19  0  0  1  0            999 V2000\n    8.2895   -4.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4011   -4.7510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2817   -3.7573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9840   -4.0376    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.5337   -3.4259    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3138   -2.8918    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1540   -3.7066    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1126   -2.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8197   -5.1135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6579   -4.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6657   -4.9810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9449   -3.7573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3791   -3.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5108   -4.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0921   -4.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7978   -3.7222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1145   -2.8411    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4347   -4.5873    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  8  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  1  2  0  0  0  0\n 10 13  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 15  1  0  0  0  0\n  7 14  1  6  0  0  0\n 15 16  1  0  0  0  0\n 16 14  1  0  0  0  0\n  5 17  1  1  0  0  0\n  4 18  1  1  0  0  0\n  4  5  1  0  0  0  0\n  7  6  1  0  0  0  0\nM  END",
        "smiles": "C(CCC(=O)O)C[C@H]1[C@]2([H])[C@]([H])(CS1)NC(=O)N2",
        "formula": "C10H16N2O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "244.3121",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "44ba3fcf-032f-4e72-8902-3f0e785029dc",
          "150d6010-d9dd-4074-8dee-4d40ef7b099b",
          "bde727a7-0709-433e-8cd6-7039bacc1679"
        ],
        "stereo_centers": 3
      },
      "unii": "6SO6U10H04",
      "relationships": [
        {
          "uuid": "688fe428-e642-47b8-956f-201433bee6c0",
          "amount": {
            "uuid": "5fa6bf68-e895-4c89-902a-05817deacb70"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2bfe9425-4294-48b4-bda7-f432a240646e",
            "refuuid": "1530fd56-1aaa-4e85-bca7-5e4d4fe1d8bf",
            "name": "BIOTIN",
            "unii": "6SO6U10H04",
            "linking_id": "6SO6U10H04",
            "ref_pname": "BIOTIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f530eafa-0b7b-44f9-b3e0-251f93cbb8d8",
          "amount": {
            "uuid": "7db7def1-4e65-4771-a1e5-4d6959f9817e"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "39bbaadd-5185-418d-89ab-662429ad4d2c"
          ],
          "related_substance": {
            "uuid": "e29f5874-2d03-4459-84f0-c1c8d2ca9fad",
            "refuuid": "9469ccd7-1c78-4f0e-bfc0-753cee301889",
            "name": "BIOTIN SODIUM",
            "unii": "N7LEJ9M9EU",
            "linking_id": "N7LEJ9M9EU",
            "ref_pname": "BIOTIN SODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "03ff3e0b-9007-4016-8bbb-35dbd0be7a9f",
          "name": "(3aS,4S,6aR)-Hexahydro-2-oxo-1H-thieno[3,4-d]imidazole-4-valeric acid",
          "stdName": "(3AS,4S,6AR)-HEXAHYDRO-2-OXO-1H-THIENO(3,4-D)IMIDAZOLE-4-VALERIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cab6c6a0-6689-4bb0-a0a3-df8f56b182f7"
          ],
          "display_name": false
        },
        {
          "uuid": "bd20444e-ecd2-4719-a5fe-a276472e12a9",
          "name": "BIOEPIDERM",
          "stdName": "BIOEPIDERM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8deda405-ba6c-4446-affa-892c145ec270",
            "c1ca5f4a-d599-46e3-92a2-0a71b59d2f35"
          ],
          "display_name": false
        },
        {
          "uuid": "69f1ff4b-fc59-4569-9779-d717fa365203",
          "name": "BIOTIN",
          "stdName": "BIOTIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32a250f7-3189-4d69-bc04-c0cb9047b526",
            "88f72b74-f3cd-4b10-8c6a-9841e94a23cb",
            "a5404ea3-0626-42b7-be6d-52e311cfa36b",
            "7772ae08-6c44-48f7-814c-48decb2d0a82",
            "150d6010-d9dd-4074-8dee-4d40ef7b099b",
            "bde727a7-0709-433e-8cd6-7039bacc1679",
            "d7f4066f-cfe0-41c1-a673-9ceb005f1c45",
            "e1797a3b-6ad5-4ed5-8345-6ede2b279578",
            "ef920afc-4cac-43d7-8685-eed31264459f",
            "4a984ba2-707b-4803-86a1-a72f66217312",
            "3e1f9999-2f31-48b6-b1f5-bca4d4d276dc",
            "c1ca5f4a-d599-46e3-92a2-0a71b59d2f35",
            "1cad3a5c-ff62-4e5d-9de0-6f2b9b2cd0c4",
            "705e13fb-d834-42eb-9c00-3c19d014cb67",
            "2cc472af-f86b-49f1-a63e-150a766e4e1f",
            "a1cf6092-1386-4d34-b5e6-f7a1c07f127f",
            "e7370f6f-d829-4c88-b470-3ac0a3c75df2",
            "007f2b9a-423c-45b1-b3a9-2adcd17d7c2f",
            "07dfc6d5-77e5-443b-830d-1090e2ddb6c7",
            "b64b531c-6e7a-44ff-8a33-81de14636cb6",
            "db4bf371-c889-4483-a377-1ceeccd0b3d4",
            "2a7ad202-2f44-4a36-a689-c9752b5d9bc0",
            "f3f182e6-f710-4116-b243-f11874175514",
            "b9f95910-c531-4e99-91b5-c1413eb67da6",
            "a0fdc3f3-c9e7-4fdb-b6a8-cd6ad24cfc4e",
            "fdd44e40-2f65-4ee4-bc58-1010e787f099",
            "707056bd-3482-4d97-a51b-4f0c77a9cfdb",
            "2f10d4b5-2754-4087-af57-a1b76688f31c"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "92672abd-e773-4488-946b-b811f7ce64a8",
              "name_org": "INN"
            },
            {
              "uuid": "a6343f0a-ef28-40e4-835b-35ffc03b2878",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c6ea725c-881d-fc0f-bf1f-5c0bbcd4a770",
          "name": "BIOTIN [EP IMPURITY]",
          "stdName": "BIOTIN [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b64b531c-6e7a-44ff-8a33-81de14636cb6"
          ],
          "display_name": false
        },
        {
          "uuid": "80c874fd-8773-5b17-7333-206c083d4d70",
          "name": "BIOTIN [EP MONOGRAPH]",
          "stdName": "BIOTIN [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9520e0cb-36d7-8bb8-0d23-01e4ed376b25"
          ],
          "display_name": false
        },
        {
          "uuid": "de1f0246-b26e-4475-9f50-b81b209b8a25",
          "name": "BIOTIN [FCC]",
          "stdName": "BIOTIN [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1cf6092-1386-4d34-b5e6-f7a1c07f127f",
            "ef920afc-4cac-43d7-8685-eed31264459f"
          ],
          "display_name": false
        },
        {
          "uuid": "a1e3ce82-247e-485c-a55b-6787eb319554",
          "name": "BIOTIN [HSDB]",
          "stdName": "BIOTIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7772ae08-6c44-48f7-814c-48decb2d0a82",
            "ef920afc-4cac-43d7-8685-eed31264459f"
          ],
          "display_name": false
        },
        {
          "uuid": "c069ec61-33d3-42a8-99c3-0a722ed96273",
          "name": "BIOTIN [JAN]",
          "stdName": "BIOTIN [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef920afc-4cac-43d7-8685-eed31264459f",
            "c1ca5f4a-d599-46e3-92a2-0a71b59d2f35"
          ],
          "display_name": false
        },
        {
          "uuid": "f226ba79-97eb-4c8e-89c3-46f6469effef",
          "name": "BIOTIN [MART.]",
          "stdName": "BIOTIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db4bf371-c889-4483-a377-1ceeccd0b3d4"
          ],
          "display_name": false
        },
        {
          "uuid": "24bcea66-40ab-43d4-a5dc-5a837d86cc7a",
          "name": "BIOTIN [MI]",
          "stdName": "BIOTIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1797a3b-6ad5-4ed5-8345-6ede2b279578",
            "ef920afc-4cac-43d7-8685-eed31264459f"
          ],
          "display_name": false
        },
        {
          "uuid": "50b332f5-7a12-4b4c-8baa-a151cac64941",
          "name": "BIOTIN [ORANGE BOOK]",
          "stdName": "BIOTIN [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9f95910-c531-4e99-91b5-c1413eb67da6"
          ],
          "display_name": false
        },
        {
          "uuid": "cefa7ec8-e598-3874-4f13-f8dc8ea1fb02",
          "name": "BIOTIN [USP MONOGRAPH]",
          "stdName": "BIOTIN [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef381bc8-3d55-d01c-a8c1-7b9325fa0574"
          ],
          "display_name": false
        },
        {
          "uuid": "adbca0db-202f-469a-b441-e107a06f631c",
          "name": "BIOTIN [USP-RS]",
          "stdName": "BIOTIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef920afc-4cac-43d7-8685-eed31264459f",
            "f3f182e6-f710-4116-b243-f11874175514"
          ],
          "display_name": false
        },
        {
          "uuid": "752bbbac-6a4d-4090-ad01-14e5ca4a60ad",
          "name": "BIOTIN [VANDF]",
          "stdName": "BIOTIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "707056bd-3482-4d97-a51b-4f0c77a9cfdb",
            "ef920afc-4cac-43d7-8685-eed31264459f"
          ],
          "display_name": false
        },
        {
          "uuid": "9a66cbc2-163b-3897-63e7-9f3d5705ef56",
          "name": "Biotin [WHO-DD]",
          "stdName": "BIOTIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8557274e-ac04-19b1-f11b-4fdd08ab3a79"
          ],
          "display_name": false
        },
        {
          "uuid": "5182970e-d452-4581-a7ad-3225ee6523dd",
          "name": "D-(+)-BIOTIN",
          "stdName": "D-(+)-BIOTIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4fdd502-1879-49e9-9baa-cfbae5e42d64",
            "ef920afc-4cac-43d7-8685-eed31264459f"
          ],
          "display_name": false
        },
        {
          "uuid": "c8e95357-a36a-439d-860b-82eccdeef358",
          "name": "D-BIOTIN",
          "stdName": "D-BIOTIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4fdd502-1879-49e9-9baa-cfbae5e42d64",
            "707056bd-3482-4d97-a51b-4f0c77a9cfdb",
            "ef920afc-4cac-43d7-8685-eed31264459f",
            "ab33feef-d4bc-41ba-95ed-40877e3f9089"
          ],
          "display_name": false
        },
        {
          "uuid": "f34e4bf0-827a-450b-9ce0-f608615b9c46",
          "name": "D-BIOTIN [VANDF]",
          "stdName": "D-BIOTIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "707056bd-3482-4d97-a51b-4f0c77a9cfdb",
            "ef920afc-4cac-43d7-8685-eed31264459f"
          ],
          "display_name": false
        },
        {
          "uuid": "b9d08be3-78a2-41ed-6c86-6c24672e5a0f",
          "name": "MD-1003",
          "stdName": "MD-1003",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46b9eda0-0d43-e4a4-9157-5dfd645d4a1c"
          ],
          "display_name": false
        },
        {
          "uuid": "008bf1a4-396d-4204-a190-9706c7fa811b",
          "name": "NSC-63865",
          "stdName": "NSC-63865",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef920afc-4cac-43d7-8685-eed31264459f",
            "48e0ff1e-7975-4a7d-b7b7-d51911306e3a"
          ],
          "display_name": false
        },
        {
          "uuid": "b7a21889-e71d-4f76-8aee-c41c882751bb",
          "name": "RITATIN",
          "stdName": "RITATIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4fdd502-1879-49e9-9baa-cfbae5e42d64",
            "ef920afc-4cac-43d7-8685-eed31264459f"
          ],
          "display_name": false
        },
        {
          "uuid": "019bdda9-b0f3-4240-8b1e-83c8d83be7f2",
          "name": "Vitamin B7",
          "stdName": "VITAMIN B7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56f7b8e5-e944-42c4-8c43-7bf29e4d6f96"
          ],
          "display_name": false
        },
        {
          "uuid": "caffeebf-8c8c-42a6-bb1e-04fc2b170f97",
          "name": "biotin [INN]",
          "stdName": "BIOTIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bde727a7-0709-433e-8cd6-7039bacc1679"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "8a482437-155e-4489-8749-db7a7e714f53"
      }
    }
  ]
}