{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d90f5fb1-23c1-4d03-b931-eb530c36e2b4",
          "code": "6535-46-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6535-46-2",
          "code_system": "CAS",
          "references": [
            "9f9b6c20-cd40-4827-8a6a-aa06e4f99e35",
            "93289e9a-51b8-4a4c-9511-fe1caf07f369"
          ]
        },
        {
          "uuid": "e2452789-38af-4581-80db-98cd4e846dc8",
          "code": "229-440-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.765",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9f9b6c20-cd40-4827-8a6a-aa06e4f99e35"
          ]
        },
        {
          "uuid": "efef7bc4-8a26-e582-f1ac-78ef81290863",
          "code": "DTXSID1064403",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1064403",
          "code_system": "EPA CompTox",
          "references": [
            "4028b0be-07f1-24bd-5408-7c4c98c4415d"
          ]
        },
        {
          "uuid": "6cef41e6-e560-4c40-870b-c1402dc7f3fb",
          "code": "6S30UYY7FD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0d922710-2c40-4eb7-928f-66bb8d29f475",
          "name": "2-NAPHTHALENECARBOXAMIDE, 3-HYDROXY-N-(2-METHYLPHENYL)-4-((2,4,5-TRICHLOROPHENYL)AZO)-",
          "stdName": "2-NAPHTHALENECARBOXAMIDE, 3-HYDROXY-N-(2-METHYLPHENYL)-4-((2,4,5-TRICHLOROPHENYL)AZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2334ee9-3452-4099-a58d-43e0a036bcbd",
            "9f0a0e87-0b37-41e3-ae2b-9f055de69351"
          ],
          "display_name": false
        },
        {
          "uuid": "22379740-b8b8-471d-b9af-06ae2051cf02",
          "name": "2-NAPHTHALENECARBOXAMIDE, 3-HYDROXY-N-(2-METHYLPHENYL)-4-(2-(2,4,5-TRICHLOROPHENYL)DIAZENYL)-",
          "stdName": "2-NAPHTHALENECARBOXAMIDE, 3-HYDROXY-N-(2-METHYLPHENYL)-4-(2-(2,4,5-TRICHLOROPHENYL)DIAZENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2334ee9-3452-4099-a58d-43e0a036bcbd",
            "9f0a0e87-0b37-41e3-ae2b-9f055de69351"
          ],
          "display_name": false
        },
        {
          "uuid": "4e8d989b-bd75-4dc8-8916-78e7376f25ae",
          "name": "C.I. PIGMENT RED 112",
          "stdName": "C.I. PIGMENT RED 112",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2334ee9-3452-4099-a58d-43e0a036bcbd",
            "9f0a0e87-0b37-41e3-ae2b-9f055de69351"
          ],
          "display_name": false
        },
        {
          "uuid": "21a054fe-2020-4a91-bae1-194e7681be0d",
          "name": "CI 12370",
          "stdName": "CI 12370",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "c2334ee9-3452-4099-a58d-43e0a036bcbd",
            "2a5268ee-01b4-4166-a890-1e530b1208f9",
            "538d2439-83ac-4d7e-9956-4f53a865f671"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "05416d03-a6d5-4bb3-9590-a5dcdcf6a3b4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "0f0fad98-eacd-4b4d-9357-ec876bb29fbf",
          "name": "HYDROXY-N-(2-METHYLPHENYL)-4-((2,4,5-TRICHLOROPHENYL)AZO)-2-NAPHTHALENECARBOXAMIDE, 3-",
          "stdName": "HYDROXY-N-(2-METHYLPHENYL)-4-((2,4,5-TRICHLOROPHENYL)AZO)-2-NAPHTHALENECARBOXAMIDE, 3-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4d42c203-54cc-445f-8aae-ea293dc07db7"
          ],
          "display_name": false
        },
        {
          "uuid": "ffac2018-c164-46a0-a2c1-09a307f52845",
          "name": "LUCONYL RED 3855",
          "stdName": "LUCONYL RED 3855",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2334ee9-3452-4099-a58d-43e0a036bcbd",
            "9f0a0e87-0b37-41e3-ae2b-9f055de69351"
          ],
          "display_name": false
        },
        {
          "uuid": "4c6dbede-2597-4598-80c5-1c1df240c558",
          "name": "NAPHTHOL RED FGR",
          "stdName": "NAPHTHOL RED FGR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2334ee9-3452-4099-a58d-43e0a036bcbd",
            "9f0a0e87-0b37-41e3-ae2b-9f055de69351"
          ],
          "display_name": false
        },
        {
          "uuid": "3b881778-a5b6-4424-b85b-ca1fb9153da4",
          "name": "PERMANENT RED FGR",
          "stdName": "PERMANENT RED FGR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2334ee9-3452-4099-a58d-43e0a036bcbd",
            "9f0a0e87-0b37-41e3-ae2b-9f055de69351"
          ],
          "display_name": false
        },
        {
          "uuid": "e33f2e7d-a435-41bc-8094-fb6e3e1c5be2",
          "name": "PIGMENT RED 112",
          "stdName": "PIGMENT RED 112",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2334ee9-3452-4099-a58d-43e0a036bcbd",
            "2a5268ee-01b4-4166-a890-1e530b1208f9",
            "43c1162e-64bd-4092-a4b8-918891d05037"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "69a7a6a0-30fa-4d2b-845a-b583da58208f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "0af628ff-2e4d-4b77-a523-a21b87185019",
          "name": "UNISPERSE RED 3RS-E2",
          "stdName": "UNISPERSE RED 3RS-E2",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2334ee9-3452-4099-a58d-43e0a036bcbd",
            "9f0a0e87-0b37-41e3-ae2b-9f055de69351"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4d42c203-54cc-445f-8aae-ea293dc07db7",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2a5268ee-01b4-4166-a890-1e530b1208f9",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2334ee9-3452-4099-a58d-43e0a036bcbd",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f0a0e87-0b37-41e3-ae2b-9f055de69351",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f9b6c20-cd40-4827-8a6a-aa06e4f99e35",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390941000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e67071a-6620-48e9-b540-cf5d93cec314",
          "citation": "SRS import [6S30UYY7FD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6S30UYY7FD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390941000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d7b6728-1a75-49c1-b03e-aeee656f522c",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43c1162e-64bd-4092-a4b8-918891d05037",
          "citation": "PIGMENT RED 112 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "538d2439-83ac-4d7e-9956-4f53a865f671",
          "citation": "CI 12370 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4028b0be-07f1-24bd-5408-7c4c98c4415d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6535-46-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "93289e9a-51b8-4a4c-9511-fe1caf07f369",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a70cc569-3089-4e87-9cb2-519ef5630bbf",
          "id": "a70cc569-3089-4e87-9cb2-519ef5630bbf",
          "molfile": "\n  Marvin  01132108402D          \n\n 32 35  0  0  0  0            999 V2000\n    9.9944   -4.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4177   -5.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2649   -5.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6605   -6.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2649   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4177   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0221   -6.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1784   -6.1357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7717   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1784   -7.5534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9326   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5121   -7.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6933   -7.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2767   -8.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4505   -8.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0273   -7.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4505   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2767   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6933   -6.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2527   -5.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4064   -5.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0062   -4.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1672   -4.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7568   -3.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9205   -3.9562    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1672   -3.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7403   -2.5182    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.0062   -3.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4064   -3.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2527   -3.9562    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.5121   -6.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9603   -5.3951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 31 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 18 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 31  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 29  2  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 26  2  0  0  0  0\n 29 28  1  0  0  0  0\n 29 30  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccccc1NC(=O)c2cc3ccccc3c(c2O)/N=N/c4cc(c(cc4Cl)Cl)Cl",
          "formula": "C24H16Cl3N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b928f5db-c544-4669-a9db-20d0118d902c"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "484.7624",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b5548fd4-c05d-4a59-a365-0c235166317b",
      "version": "5",
      "structure": {
        "id": "27d0d1c1-2456-409e-99bf-693269f93d7f",
        "molfile": "\n  Marvin  01132102112D          \n\n 32 35  0  0  0  0            999 V2000\n    6.2767   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6933   -6.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5121   -6.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9326   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7717   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1784   -6.1357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0221   -6.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4177   -5.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2649   -5.4163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6605   -6.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2649   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4177   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9944   -4.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1784   -7.5534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5121   -7.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6933   -7.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2767   -8.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4505   -8.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0273   -7.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4505   -6.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9603   -5.3951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2527   -5.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4064   -5.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0062   -4.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4064   -3.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0062   -3.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1672   -3.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7403   -2.5182    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7568   -3.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1672   -4.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9205   -3.9562    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.2527   -3.9562    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n  5 14  2  0  0  0  0\n 15  4  2  0  0  0  0\n 16 15  1  0  0  0  0\n  1 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n  1 20  1  0  0  0  0\n  3 21  1  0  0  0  0\n  2 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 29 27  1  0  0  0  0\n 30 29  2  0  0  0  0\n 24 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 25 32  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccccc1NC(=O)c2cc3ccccc3c(c2O)/N=N/c4cc(c(cc4Cl)Cl)Cl",
        "formula": "C24H16Cl3N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "484.7624",
        "optical_activity": "NONE",
        "references": [
          "2e67071a-6620-48e9-b540-cf5d93cec314",
          "1d7b6728-1a75-49c1-b03e-aeee656f522c"
        ],
        "stereo_centers": 0
      },
      "unii": "6S30UYY7FD"
    }
  ]
}