{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fe3d917f-20c3-4087-8c34-27c4a4816332",
          "code": "32445-75-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=32445-75-3",
          "code_system": "CAS",
          "references": [
            "2a098e1d-01ea-477c-0ff4-340ea23483d9"
          ]
        },
        {
          "uuid": "f087bd9a-7313-9fd4-3513-736516ab26ff",
          "code": "445894",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/445894",
          "code_system": "PUBCHEM",
          "references": [
            "1d606dd3-0d48-0bc4-17ee-4db6d6483bfe"
          ]
        },
        {
          "uuid": "b9f6c287-f1e5-4a91-8ac9-5cd2352848ad",
          "code": "6R5AZ534G3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3e0a5662-375e-46ba-94c9-64b5470fed56",
          "name": "(2S,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol",
          "stdName": "(2S,3R,4S,5R)-5-(HYDROXYMETHYL)OXOLANE-2,3,4-TRIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a098e1d-01ea-477c-0ff4-340ea23483d9"
          ],
          "display_name": false
        },
        {
          "uuid": "31c960ec-4159-4636-cdb7-b4bb6819ad80",
          "name": "Ribofuranose, α-D-",
          "stdName": "RIBOFURANOSE, .ALPHA.-D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a098e1d-01ea-477c-0ff4-340ea23483d9"
          ],
          "display_name": false
        },
        {
          "uuid": "91a933ae-f2e1-a56b-d055-2e97f3f912b7",
          "name": "α-D-Ribofuranose",
          "stdName": ".ALPHA.-D-RIBOFURANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a098e1d-01ea-477c-0ff4-340ea23483d9"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "0042d87b-5e13-d236-9ac9-8a883fd52716",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true
        },
        {
          "uuid": "2a098e1d-01ea-477c-0ff4-340ea23483d9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d606dd3-0d48-0bc4-17ee-4db6d6483bfe",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "6fb77c92-6d62-199b-efe6-3b00cdc773ac",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        },
        {
          "uuid": "512100ad-49f9-4536-d1b5-8bb09a644680",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f8d5ace7-0e8a-b88b-cf63-8566b008f216",
          "id": "f8d5ace7-0e8a-b88b-cf63-8566b008f216",
          "molfile": "\n  Marvin  01132112542D          \n\n 10 10  0  0  1  0            999 V2000\n   14.3136   -3.6485    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   13.4962   -3.5368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8845   -3.0529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6273   -3.4117    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   16.3543   -3.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0556   -3.4561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5156   -4.2291    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   16.1113   -4.7999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7037   -4.3754    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   14.3449   -5.1183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  9  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@H]([C@H]([C@@H](O)O1)O)O)O",
          "formula": "C5H10O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d791dfb5-e175-40b2-b292-c151c540c77f"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "150.1301",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "acc97e53-31a3-47a3-8c32-8c85473e54c4",
      "version": "14",
      "structure": {
        "id": "5bcbb855-a992-a4b6-666b-3c1b63fc48e8",
        "molfile": ".alpha.-D-Galactofuranose\n  Marvin  01132104452D          \n\n 10 10  0  0  1  0            999 V2000\n   16.3543   -3.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6273   -3.4117    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.8845   -3.0529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3136   -3.6485    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.4962   -3.5368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7037   -4.3754    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.3449   -5.1183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5156   -4.2291    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.1113   -4.7999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0556   -3.4561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  1  0  0  0\n  2  8  1  0  0  0  0\n  1 10  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@H]([C@H]([C@@H](O)O1)O)O)O",
        "formula": "C5H10O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "150.1301",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2a098e1d-01ea-477c-0ff4-340ea23483d9"
        ],
        "stereo_centers": 4
      },
      "unii": "6R5AZ534G3"
    }
  ]
}