{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c66d239b-19ca-4747-bf8a-85d6c34eca60",
          "code": "11106485",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11106485",
          "code_system": "PUBCHEM",
          "references": [
            "1239b8c9-9c2e-5dee-d5e1-f39801c3be13"
          ]
        },
        {
          "uuid": "ed751bd8-ff4b-4111-b41c-38f74fc5094f",
          "code": "546-28-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=546-28-1",
          "code_system": "CAS",
          "references": [
            "16bb8357-6547-44de-a50f-286f096a82b9",
            "819d76b5-c09a-4e37-a3ba-9cc7c9d6e335"
          ]
        },
        {
          "uuid": "4c9880fd-7d7e-d0d4-b4e1-cc49da66042e",
          "code": "208-898-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.090",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "762e1f97-71dc-051a-1f72-8fe41a0a755a"
          ]
        },
        {
          "uuid": "29112767-94f6-4864-8a80-dfd2f971d9ac",
          "code": "6QL7ERD5Q1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f44c4c78-9322-c9a2-350e-bb91746aaa62",
          "code": "DTXSID40883435",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40883435",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4d76a21c-002e-b610-d1ad-4d1e05d55bc1",
          "name": "(+)-.BETA.-CEDRENE",
          "stdName": "(+)-.BETA.-CEDRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2255f4de-94bf-2f23-943a-87941230a518"
          ],
          "display_name": false
        },
        {
          "uuid": "8f403ee8-6c99-4566-86d9-e0a172e9272c",
          "name": ".BETA.-CEDRENE",
          "stdName": ".BETA.-CEDRENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c7f972f-0311-484e-8d4d-83425cad9762"
          ],
          "display_name": true
        },
        {
          "uuid": "2ba484ea-e119-e601-0eed-47e5bc4010fe",
          "name": "1H-3A,7-METHANOAZULENE, OCTAHYDRO-3,8,8-TRIMETHYL-6-METHYLENE-, (3R,3AS,7S,8AS)-",
          "stdName": "1H-3A,7-METHANOAZULENE, OCTAHYDRO-3,8,8-TRIMETHYL-6-METHYLENE-, (3R,3AS,7S,8AS)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2255f4de-94bf-2f23-943a-87941230a518"
          ],
          "display_name": false
        },
        {
          "uuid": "fe4e0a3d-d37f-9cb5-5ddc-31dc277553f3",
          "name": "1H-3A,7-METHANOAZULENE, OCTAHYDRO-3,8,8-TRIMETHYL-6-METHYLENE-, (3R-(3.ALPHA.,3A.BETA.,7.BETA.,8A.ALPHA.))-",
          "stdName": "1H-3A,7-METHANOAZULENE, OCTAHYDRO-3,8,8-TRIMETHYL-6-METHYLENE-, (3R-(3.ALPHA.,3A.BETA.,7.BETA.,8A.ALPHA.))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2255f4de-94bf-2f23-943a-87941230a518"
          ],
          "display_name": false
        },
        {
          "uuid": "0fdbe1ff-3bb1-624f-82ec-a08ae0b139ed",
          "name": "CEDR-8(15)-ENE",
          "stdName": "CEDR-8(15)-ENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2255f4de-94bf-2f23-943a-87941230a518"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1239b8c9-9c2e-5dee-d5e1-f39801c3be13",
          "citation": "PUBCHEM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "8c7f972f-0311-484e-8d4d-83425cad9762",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "16bb8357-6547-44de-a50f-286f096a82b9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393619000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71380e0e-5862-4b2a-a588-c2e3f8d88f90",
          "citation": "ChemID 11028425",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "106beb75-b06b-bb8d-05ba-81d40e588c5f",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Cedrene",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2255f4de-94bf-2f23-943a-87941230a518",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "762e1f97-71dc-051a-1f72-8fe41a0a755a",
          "citation": "EC",
          "doc_type": "ECHA (EC/EINECS)",
          "public_domain": true
        },
        {
          "uuid": "819d76b5-c09a-4e37-a3ba-9cc7c9d6e335",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d40d9c8c-1b59-4275-8174-a9ddd5f51ad1",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4499f5ed-caa0-a573-3cd9-9413f5c11b84",
          "id": "4499f5ed-caa0-a573-3cd9-9413f5c11b84",
          "molfile": "\n  Marvin  01132103372D          \n\n 15 17  0  0  1  0            999 V2000\n   16.8045   -4.6783    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   17.2277   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1287   -3.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5074   -3.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7992   -3.8001    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   15.0560   -3.4421    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.3084   -2.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5416   -2.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3126   -3.8001    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   14.9156   -4.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9828   -4.6044    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   15.4684   -5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6434   -5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1290   -4.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3247   -4.7880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 11  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  6  1  1  0  0  0\n  9 10  1  0  0  0  0\n  9 14  1  0  0  0  0\n 11 10  1  6  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\nM  END",
          "smiles": "C=C1CC[C@]23C[C@@H]1[C@](C)(C)[C@@H]3CC[C@H]2C",
          "formula": "C15H24",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "22d36663-ff1d-41e5-95cc-edbb84b19afa"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "204.3516",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "686068ff-6be3-46a8-ab9f-466afdb2ac5d",
      "version": "13",
      "structure": {
        "id": "83e073aa-0957-4d3c-8848-534789085e05",
        "molfile": "\n  Marvin  01132106502D          \n\n 16 18  0  0  1  0            999 V2000\n   14.3126   -3.8001    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.1290   -4.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6434   -5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4684   -5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7992   -3.8001    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.0560   -3.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8045   -4.6783    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.5074   -3.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1287   -3.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9156   -4.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9828   -4.6044    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.3247   -4.7880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3084   -2.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5416   -2.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2277   -5.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0241   -3.0195    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  1 10  1  6  0  0  0\n 10 11  1  0  0  0  0\n  5 11  1  0  0  0  0\n 11  4  1  1  0  0  0\n 11  7  1  0  0  0  0\n  2 12  2  0  0  0  0\n  6 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n  7 15  1  1  0  0  0\n  5 16  1  1  0  0  0\nM  END",
        "smiles": "C=C1CC[C@]23C[C@@H]1C(C)(C)[C@]3([H])CC[C@H]2C",
        "formula": "C15H24",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "204.3516",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2255f4de-94bf-2f23-943a-87941230a518"
        ],
        "stereo_centers": 4
      },
      "unii": "6QL7ERD5Q1"
    }
  ]
}