{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2b1b46af-72b7-4cb9-b76a-95f9566938f4",
          "code": "A06AB04",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|LAXATIVES|LAXATIVES|Contact laxatives|phenolphthalein",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A06AB04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "f4a99df5-a650-45e8-88bb-5d2a48c205c8",
          "code": "QA06AB04",
          "comments": "VATC|DRUGS FOR CONSTIPATION|DRUGS FOR CONSTIPATION|Contact laxatives|phenolphthalein",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA06AB04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "d286a131-c978-4a88-9ff8-28ad3873649d",
          "code": "77-09-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77-09-8",
          "code_system": "CAS",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757",
            "78a0344e-b1c5-4c6b-9b61-da446258c486"
          ]
        },
        {
          "uuid": "6ad267b1-e2fb-4efc-b271-166c2ebf1a1d",
          "code": "C29359",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29359",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "c51d420f-a0df-4320-8ffa-4b4bf388cf81",
          "code": "D020113",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68020113",
          "code_system": "MESH",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "bc7c2d95-281e-49ab-90d1-5bfd55f7d6a4",
          "code": "771",
          "comments": "LiverTox|Gastroinestinal|Laxative|Miscellaneous",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Phenolphthalein.htm",
          "code_system": "LIVERTOX",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "aeda29f0-0892-4e13-a53b-313f54330338",
          "code": "PHENOLPHTHALEIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phenolphthalein",
          "code_system": "WIKIPEDIA",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "96b72e72-5301-4db4-a120-af73f9a414b6",
          "code": "SUB09773MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "9777e1bd-d10f-4a63-a155-2f9826a3f695",
          "code": "81-90-3",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=81-90-3",
          "code_system": "CAS",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757",
            "8f0e3564-b539-41a7-a3ac-c1552043dfb4"
          ]
        },
        {
          "uuid": "42957a5c-837f-4348-93be-b2796b9abdf1",
          "code": "4575",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4575",
          "code_system": "INN",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "9f1da66c-ce54-4b84-bd01-ef11a9b7f57e",
          "code": "201-004-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.914",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "a47f401c-3c44-4fa3-84ed-46d272e5d58b",
          "code": "201-384-4",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.260",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "aef65f47-de52-4ef3-a852-69d5c042d843",
          "code": "155122",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/155122/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "a0bd38bb-684c-4767-b880-e9ba2d409e8f",
          "code": "m8627",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8627?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "18e70717-d1ec-4bcd-93ae-1b67b7911098",
          "code": "CHEMBL63857",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL63857",
          "code_system": "ChEMBL",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "608cd98d-730c-4de5-9c58-eee536361989",
          "code": "4764",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4764",
          "code_system": "PUBCHEM",
          "references": [
            "f1978022-4647-432b-a47c-a811b9f47757"
          ]
        },
        {
          "uuid": "e2724b12-4e54-f569-e183-64b10857e16d",
          "code": "5768-87-6",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5768-87-6",
          "code_system": "CAS",
          "references": [
            "78a0344e-b1c5-4c6b-9b61-da446258c486"
          ]
        },
        {
          "uuid": "8b17906d-4247-f958-1c1b-9c435e18fba2",
          "code": "4161",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4161",
          "code_system": "HSDB",
          "references": [
            "dfd13a42-f9d3-1959-63dc-4b8193fb1093"
          ]
        },
        {
          "uuid": "a7d058a0-1789-ad86-1ee6-46a20a79de1e",
          "code": "C45175",
          "comments": "Chemical Modifier[C1932]|Carcinogen[C347]|Chemical Carcinogen[C1743]|Organic Carcinogen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45175",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4ae64f17-9903-ad10-5c2c-fd0a98561667"
          ]
        },
        {
          "uuid": "74219dac-1892-4b23-98da-a61654cc1bfd",
          "code": "6QK969R2IF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7451091f-a8e8-bebc-7537-0e3d28573831",
          "code": "DB04824",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04824",
          "code_system": "DRUG BANK",
          "references": [
            "4ae64f17-9903-ad10-5c2c-fd0a98561667"
          ]
        },
        {
          "uuid": "dd1f99b9-d506-333e-234f-20e35f9f478d",
          "code": "2135",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2135",
          "code_system": "DRUG CENTRAL",
          "references": [
            "4ae64f17-9903-ad10-5c2c-fd0a98561667"
          ]
        },
        {
          "uuid": "4c3b2086-72b8-7e65-ee0e-59d304fe503d",
          "code": "6QK969R2IF",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6QK969R2IF",
          "code_system": "DAILYMED",
          "references": [
            "6172bbb7-ce24-4e2a-ef61-9eeec91e14e9"
          ]
        },
        {
          "uuid": "c38c91eb-62ab-2eca-62e0-77ba99caf2b8",
          "code": "100000082258",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b072043e-974a-3578-f4ef-1ffa5796bc49"
          ]
        },
        {
          "uuid": "37105149-1a4b-b581-f072-54a005aa8be9",
          "code": "DTXSID0021125",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0021125",
          "code_system": "EPA CompTox",
          "references": [
            "67eb3c40-6239-5214-335e-ead9b9c30db7"
          ]
        },
        {
          "uuid": "bdcc5c16-40e7-f995-cf87-a9794cf224ea",
          "code": "10464",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=10464",
          "code_system": "NSC",
          "references": [
            "d660066b-9496-c9eb-55af-dc7dff171947"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6b3a45e6-43f6-490d-9d9b-65b100344c90",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "250cdbd5-c4d0-4dc8-9cbb-accf06dce414",
            "refuuid": "002016d6-71e6-4086-ab5a-f4e59b80ec06",
            "name": "PHENOLPHTHALEIN",
            "unii": "6QK969R2IF",
            "linking_id": "6QK969R2IF",
            "ref_pname": "PHENOLPHTHALEIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7a212b85-ec4b-46ae-b206-a0e64b705ffd",
          "type": "SUB_CONCEPT->SUBSTANCE",
          "related_substance": {
            "uuid": "81a1b355-6fb2-4b38-8a55-9387b5385025",
            "refuuid": "66914184-ec4b-4479-a46c-5cf8621fb29a",
            "name": "PHENOLPHTHALEIN, YELLOW",
            "linking_id": "66914184-ec4b-4479-a46c-5cf8621fb29a",
            "ref_pname": "PHENOLPHTHALEIN, YELLOW",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b56edee8-9041-48db-a629-769a523102c6",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "f74e2bbb-da4a-4648-9989-32fc833c0834",
            "refuuid": "a394e469-442e-4799-ba25-cc47f0b0a23b",
            "name": "ALTERNATIVE DEFINITION for [PHENOLPHTHALEIN]",
            "unii": "YSD58V84XK",
            "linking_id": "YSD58V84XK",
            "ref_pname": "NO NAME",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d7a49031-6f19-4052-b8bd-83b375bb641f",
          "name": "1(3H)-ISOBENZOFURANONE, 3,3-BIS(4-HYDROXYPHENYL)-",
          "stdName": "1(3H)-ISOBENZOFURANONE, 3,3-BIS(4-HYDROXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30fd6bff-4658-46f7-864b-4bb862301886"
          ],
          "display_name": false
        },
        {
          "uuid": "a242ce76-0d76-4545-a3b9-31b985187123",
          "name": "3,3-BIS(P-HYDROXYPHENYL)PHTHALIDE",
          "stdName": "3,3-BIS(P-HYDROXYPHENYL)PHTHALIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30fd6bff-4658-46f7-864b-4bb862301886"
          ],
          "display_name": false
        },
        {
          "uuid": "2fe2e45f-9401-40a9-93ae-4e6b37bc51ca",
          "name": "NSC-10464",
          "stdName": "NSC-10464",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0298c0b-0602-4bc1-a322-ed98ccc9946c"
          ],
          "display_name": false
        },
        {
          "uuid": "cf2ac141-9302-4948-8ba1-48b3351a6433",
          "name": "PHENOLPHTHALEIN",
          "stdName": "PHENOLPHTHALEIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c77807cb-196b-41d9-9fc7-96222e8911ce",
            "0305e782-df8e-4b50-abfe-1049db989dc3",
            "a90f8411-dcbd-4dc0-a002-8347a0a748e6",
            "5949b4dc-8cee-4066-a07f-6e8a0461eb55",
            "66a893d4-a1f6-4ffc-b4b4-4e755b4e5134",
            "61bbfa5b-86f7-4e78-a880-ffd14a8b9c89",
            "ab7dd554-54c6-4458-a4f9-6d0e70848c9a",
            "40471436-a0ad-42e9-aaf2-7b036b61a9cc",
            "d179de4a-f525-462b-9b58-0153dbc17a9c",
            "840d3aca-33f1-47cc-b0b4-cb89041a1071",
            "8349e637-8d85-4d98-a508-2d093b5b0edf",
            "c5834a89-24e6-4455-9b25-3b5fb9ecd328",
            "2df25da6-4a30-4795-b32a-c21a25f8722a",
            "630a2de8-5e37-42d3-bc67-47258f2b49c1",
            "fad0a1f2-0a00-4fa0-ac43-1aef683d57ef",
            "54dd8534-2f3b-4205-8465-fb3d897a84cd",
            "afbcc4d5-402f-4905-996a-9019d30b2ed1",
            "fabb7eae-44d3-4aea-9fdc-8e53aac5dfd8",
            "43f1052e-07e3-4199-a768-912b0fa7f97d"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b2c28b7b-d3e8-48b4-8c27-8997695e5b97",
              "name_org": "INN"
            },
            {
              "uuid": "a1952217-b76c-4f46-a801-bffaaad92dd2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1f88203b-c42c-986c-ee33-81ca0f1259e5",
          "name": "PHENOLPHTHALEIN [EP MONOGRAPH]",
          "stdName": "PHENOLPHTHALEIN [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48af7306-5ecb-e843-51bf-e31a50096c84"
          ],
          "display_name": false
        },
        {
          "uuid": "18fc2c49-7c1f-4c97-b763-ae6c68dd10ad",
          "name": "PHENOLPHTHALEIN [HSDB]",
          "stdName": "PHENOLPHTHALEIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afbcc4d5-402f-4905-996a-9019d30b2ed1"
          ],
          "display_name": false
        },
        {
          "uuid": "77427857-7cd1-3f48-87a4-fd76503108c3",
          "name": "PHENOLPHTHALEIN [IARC]",
          "stdName": "PHENOLPHTHALEIN [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a227282-2d7f-88de-a675-6f0e9c2b7fcd"
          ],
          "display_name": false
        },
        {
          "uuid": "55454824-e114-4660-8a1c-221c5b5bcfc6",
          "name": "PHENOLPHTHALEIN [MART.]",
          "stdName": "PHENOLPHTHALEIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2df25da6-4a30-4795-b32a-c21a25f8722a"
          ],
          "display_name": false
        },
        {
          "uuid": "dc5a0d9e-7b60-4dc9-a1b9-c85b3547fcc3",
          "name": "PHENOLPHTHALEIN [MI]",
          "stdName": "PHENOLPHTHALEIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d179de4a-f525-462b-9b58-0153dbc17a9c"
          ],
          "display_name": false
        },
        {
          "uuid": "ded7b4cc-3d47-4ecf-8664-6309c823b452",
          "name": "PHENOLPHTHALEIN [VANDF]",
          "stdName": "PHENOLPHTHALEIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0305e782-df8e-4b50-abfe-1049db989dc3"
          ],
          "display_name": false
        },
        {
          "uuid": "9270aa18-cc27-4f2a-aa5f-c33655ac26bc",
          "name": "PHENOLPHTHALEIN, WHITE",
          "stdName": "PHENOLPHTHALEIN, WHITE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0305e782-df8e-4b50-abfe-1049db989dc3"
          ],
          "display_name": false
        },
        {
          "uuid": "b9a00406-7703-4f02-a160-8f294c4ddaeb",
          "name": "PHENOLPHTHALEIN,WHITE",
          "stdName": "PHENOLPHTHALEIN,WHITE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0305e782-df8e-4b50-abfe-1049db989dc3",
            "0757ddd1-054f-4c80-8bd1-eb190bab5f3c"
          ],
          "display_name": false
        },
        {
          "uuid": "c74b9c21-a73a-4552-9932-5e0c9d61fb5f",
          "name": "PHENOLPHTHALEIN,WHITE [VANDF]",
          "stdName": "PHENOLPHTHALEIN,WHITE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0305e782-df8e-4b50-abfe-1049db989dc3"
          ],
          "display_name": false
        },
        {
          "uuid": "d9cdce72-1f31-4f2a-a5dc-d651178773bd",
          "name": "PHENOLPHTHALIN [MI]",
          "stdName": "PHENOLPHTHALIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d179de4a-f525-462b-9b58-0153dbc17a9c"
          ],
          "display_name": false
        },
        {
          "uuid": "1ec27640-1003-4a46-bb87-4512294c5af5",
          "name": "PHENPOLPHTHALEIN [VANDF]",
          "stdName": "PHENPOLPHTHALEIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0305e782-df8e-4b50-abfe-1049db989dc3"
          ],
          "display_name": false
        },
        {
          "uuid": "cd9a6f48-508b-aa68-2351-38080ed9b6a6",
          "name": "Phenolphthalein [WHO-DD]",
          "stdName": "PHENOLPHTHALEIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93d5a150-3368-7731-671a-c43ff65011ec"
          ],
          "display_name": false
        },
        {
          "uuid": "ff5a8c1a-98ae-4055-8bbd-a03443aa460c",
          "name": "phenolphthalein [INN]",
          "stdName": "PHENOLPHTHALEIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43f1052e-07e3-4199-a768-912b0fa7f97d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8f0e3564-b539-41a7-a3ac-c1552043dfb4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8574af58-b49f-4f89-92a0-65a525c487e5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "78a0344e-b1c5-4c6b-9b61-da446258c486",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c77807cb-196b-41d9-9fc7-96222e8911ce",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "30fd6bff-4658-46f7-864b-4bb862301886",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43f1052e-07e3-4199-a768-912b0fa7f97d",
          "citation": "INN Proposed List 41",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL41.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "61bbfa5b-86f7-4e78-a880-ffd14a8b9c89",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2df25da6-4a30-4795-b32a-c21a25f8722a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d179de4a-f525-462b-9b58-0153dbc17a9c",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab7dd554-54c6-4458-a4f9-6d0e70848c9a",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0305e782-df8e-4b50-abfe-1049db989dc3",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "840d3aca-33f1-47cc-b0b4-cb89041a1071",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8349e637-8d85-4d98-a508-2d093b5b0edf",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "afbcc4d5-402f-4905-996a-9019d30b2ed1",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0298c0b-0602-4bc1-a322-ed98ccc9946c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1978022-4647-432b-a47c-a811b9f47757",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff7cbe8b-cd4c-4203-94c8-76e85f18f8de",
          "citation": "SRS import [6QK969R2IF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6QK969R2IF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389681000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66a893d4-a1f6-4ffc-b4b4-4e755b4e5134",
          "citation": "PHENOLPHTHALEIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a90f8411-dcbd-4dc0-a002-8347a0a748e6",
          "citation": "PHENOLPHTHALEIN [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "630a2de8-5e37-42d3-bc67-47258f2b49c1",
          "citation": "PHENOLPHTHALEIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40471436-a0ad-42e9-aaf2-7b036b61a9cc",
          "citation": "PHENOLPHTHALEIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5949b4dc-8cee-4066-a07f-6e8a0461eb55",
          "citation": "PHENOLPHTHALEIN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fabb7eae-44d3-4aea-9fdc-8e53aac5dfd8",
          "citation": "PHENOLPHTHALEIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c5834a89-24e6-4455-9b25-3b5fb9ecd328",
          "citation": "PHENOLPHTHALEIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fad0a1f2-0a00-4fa0-ac43-1aef683d57ef",
          "citation": "PHENOLPHTHALEIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0757ddd1-054f-4c80-8bd1-eb190bab5f3c",
          "citation": "PHENOLPHTHALEIN,WHITE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "591d4e07-4c82-4dbd-bbd7-b033a689d78f",
          "citation": "PHENPOLPHTHALEIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "54dd8534-2f3b-4205-8465-fb3d897a84cd",
          "citation": "PHENOLPHTHALEIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dfd13a42-f9d3-1959-63dc-4b8193fb1093",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+77-09-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "19da036d-1ce0-d777-4924-4a4fe102e9a1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=81-90-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b072043e-974a-3578-f4ef-1ffa5796bc49",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "4a227282-2d7f-88de-a675-6f0e9c2b7fcd",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "4ae64f17-9903-ad10-5c2c-fd0a98561667",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "48af7306-5ecb-e843-51bf-e31a50096c84",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "d660066b-9496-c9eb-55af-dc7dff171947",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6172bbb7-ce24-4e2a-ef61-9eeec91e14e9",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "93d5a150-3368-7731-671a-c43ff65011ec",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "67eb3c40-6239-5214-335e-ead9b9c30db7",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ec1ce2b6-3938-44da-b578-447010d8c9c4",
          "id": "ec1ce2b6-3938-44da-b578-447010d8c9c4",
          "molfile": "\n  Marvin  01132112132D          \n\n 24 27  0  0  0  0            999 V2000\n    9.8119   -0.7246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9873   -0.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5875    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7629    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3381   -0.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7337   -1.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5583   -1.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4010   -0.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8466    0.0083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3344    0.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5468    1.4576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5640    0.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8726    0.7829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1605    0.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1605   -0.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8726   -0.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5889   -0.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9888   -1.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4010   -2.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9763   -2.8361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1517   -2.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7352   -3.5358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7477   -2.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1642   -1.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 17  8  1  0  0  0  0\n 18  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 24 18  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  2  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(=O)OC2(c3ccc(cc3)O)c4ccc(cc4)O",
          "formula": "C20H14O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3fac811c-e817-4ffd-a7b4-d6dbe8319765"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "318.3235",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "002016d6-71e6-4086-ab5a-f4e59b80ec06",
      "version": "27",
      "structure": {
        "id": "8a179400-1018-4880-97a6-c5d8203959c8",
        "molfile": "\n  Marvin  01132107102D          \n\n 24 27  0  0  0  0            999 V2000\n    6.4010   -0.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8466    0.0083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3344    0.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5889   -0.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5640    0.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9888   -1.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3381   -0.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5468    1.4576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1642   -1.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7337   -1.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7629    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4010   -2.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1517   -2.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9873   -0.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8726   -0.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5875    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9763   -2.8361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5583   -1.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7477   -2.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8119   -0.7246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7352   -3.5358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8726    0.7829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1605   -0.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1605    0.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  6  2  0  0  0  0\n 10  7  2  0  0  0  0\n 11  7  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13 17  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15  4  2  0  0  0  0\n 16 11  2  0  0  0  0\n 17 12  2  0  0  0  0\n 18 10  1  0  0  0  0\n 19  9  1  0  0  0  0\n 20 14  1  0  0  0  0\n 21 13  1  0  0  0  0\n 22  5  2  0  0  0  0\n 23 15  1  0  0  0  0\n 24 23  2  0  0  0  0\n  3  5  1  0  0  0  0\n 18 14  2  0  0  0  0\n 19 13  2  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(=O)OC2(c3ccc(cc3)O)c4ccc(cc4)O",
        "formula": "C20H14O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "318.3235",
        "optical_activity": "NONE",
        "references": [
          "c77807cb-196b-41d9-9fc7-96222e8911ce",
          "ff7cbe8b-cd4c-4203-94c8-76e85f18f8de",
          "43f1052e-07e3-4199-a768-912b0fa7f97d"
        ],
        "stereo_centers": 0
      },
      "unii": "6QK969R2IF"
    }
  ]
}