{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "078d7b3d-5b9a-401f-9f16-ce7677b2c9d2", "code": "78859-33-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=78859-33-3", "code_system": "CAS", "references": [ "86229e89-ea50-41b9-b82c-5cc17fa87b93", "cd7af94e-8b9d-4f15-9fa8-6ccf6c5a1416" ] }, { "uuid": "6e777d48-39b8-4398-9bf7-e1635d209f92", "code": "13023332", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13023332", "code_system": "PUBCHEM", "references": [ "86229e89-ea50-41b9-b82c-5cc17fa87b93" ] }, { "uuid": "a86a8b1f-48f1-6b62-5394-421aefc806ac", "code": "DB07543", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB07543", "code_system": "DRUG BANK", "references": [ "170fc457-c241-1eb5-1c1e-e5c85b451e00" ] }, { "uuid": "44e541f2-7341-4756-aed8-d5f14759dd96", "code": "6Q9080LN3O", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "fb8b3fe0-7359-4db7-8c18-9afe4ee33a1f", "type": "RACEMATE->ENANTIOMER", "related_substance": { "uuid": "c75c4f3e-21db-451e-950d-fe161f7d020e", "refuuid": "5327c59b-0c8a-4035-bc14-be721b2d3be3", "name": "CARAZOLOL", "unii": "29PW75S82A", "linking_id": "29PW75S82A", "ref_pname": "CARAZOLOL", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "cbf9e7e3-ec41-4ef5-aefe-00350a5102ba", "name": "(-)-CARAZOLOL", "stdName": "(-)-CARAZOLOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7a242530-7cce-42b4-8d11-49ac46686da9", "91a655b2-8789-4727-8ce6-03bb4e9969d3" ], "display_name": false }, { "uuid": "1aef5818-3cde-4e95-8607-3eae49813f8e", "name": "2-PROPANOL, 1-(9H-CARBAZOL-4-YLOXY)-3-((1-METHYLETHYL)AMINO)-, (2S)-", "stdName": "2-PROPANOL, 1-(9H-CARBAZOL-4-YLOXY)-3-((1-METHYLETHYL)AMINO)-, (2S)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7a242530-7cce-42b4-8d11-49ac46686da9", "91a655b2-8789-4727-8ce6-03bb4e9969d3" ], "display_name": false }, { "uuid": "5498426e-5823-4c6d-9b2a-5d095e466388", "name": "CARAZOLOL, (S)-", "stdName": "CARAZOLOL, (S)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "566750a4-ac6e-40db-99c2-85bf4138271d", "91a655b2-8789-4727-8ce6-03bb4e9969d3" ], "display_name": true } ], "references": [ { "uuid": "566750a4-ac6e-40db-99c2-85bf4138271d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "91a655b2-8789-4727-8ce6-03bb4e9969d3", "citation": "INN", "doc_type": "INN", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7a242530-7cce-42b4-8d11-49ac46686da9", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "86229e89-ea50-41b9-b82c-5cc17fa87b93", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393059000, "tags": [ "NOMEN" ] }, { "uuid": "d13c4f31-3fd6-4cb8-b07f-f32ffd3a7233", "citation": "SRS import [6Q9080LN3O]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6Q9080LN3O", "doc_type": "SRS", "public_domain": true, "document_date": 1493393059000, "tags": [ "NOMEN" ] }, { "uuid": "170fc457-c241-1eb5-1c1e-e5c85b451e00", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "cd7af94e-8b9d-4f15-9fa8-6ccf6c5a1416", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3ac11df7-a345-43e7-b32f-a0f8992f1635", "id": "3ac11df7-a345-43e7-b32f-a0f8992f1635", "molfile": "\n Marvin 01132103072D \n\n 22 24 0 0 1 0 999 V2000\n 8.5317 -5.5006 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.5317 -4.6762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1285 -5.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8510 -5.6046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5657 -6.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5657 -6.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2764 -5.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8169 -5.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2399 -5.3134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2399 -4.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9534 -4.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9534 -3.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2387 -2.8410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5257 -3.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8111 -2.8413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0942 -3.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3819 -2.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6714 -3.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6714 -4.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3852 -4.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0942 -4.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5257 -4.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 8 1 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 22 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 22 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 21 2 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "CC(C)NC[C@@H](COc1cccc2c1c3ccccc3[nH]2)O", "formula": "C18H22N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0b11ca04-397e-4c68-b02b-3fa2cf47762f" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "298.3802", "optical_activity": "UNSPECIFIED", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "61a29ffd-b0e0-4020-b8e1-997652afeab3", "version": "3", "structure": { "id": "4a9c7180-5ddf-4e1f-a108-32268c52852b", "molfile": "\n Marvin 01132103542D \n\n 22 24 0 0 1 0 999 V2000\n 3.6714 -3.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6714 -4.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3852 -4.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0942 -4.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0942 -3.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8111 -2.8413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5257 -3.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2387 -2.8410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9534 -3.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9534 -4.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2399 -4.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2399 -5.3134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8169 -5.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5317 -5.5006 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.1285 -5.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8510 -5.6046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5657 -6.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5657 -6.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2764 -5.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5317 -4.6762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5257 -4.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3819 -2.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 14 20 1 1 0 0 0\n 21 11 1 0 0 0 0\n 4 21 1 0 0 0 0\n 7 21 2 0 0 0 0\n 5 22 2 0 0 0 0\n 22 1 1 0 0 0 0\nM END", "smiles": "CC(C)NC[C@@H](COc1cccc2c1c3ccccc3[nH]2)O", "formula": "C18H22N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "298.3802", "optical_activity": "UNSPECIFIED", "references": [ "566750a4-ac6e-40db-99c2-85bf4138271d", "d13c4f31-3fd6-4cb8-b07f-f32ffd3a7233" ], "stereo_centers": 1 }, "unii": "6Q9080LN3O" } ] }