{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f50d41cb-5de6-481d-bba3-2c71d70f4c5f",
          "code": "45127-11-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=45127-11-5",
          "code_system": "CAS",
          "references": [
            "8e1b719d-6d69-4836-8e41-8a51b68f1d3d",
            "415c1db3-fd82-4f3b-8b05-7b034c5d19e8"
          ]
        },
        {
          "uuid": "255fa12a-9458-444f-8d2b-6f02f315bffe",
          "code": "65626",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65626",
          "code_system": "PUBCHEM",
          "references": [
            "8e1b719d-6d69-4836-8e41-8a51b68f1d3d"
          ]
        },
        {
          "uuid": "0812287b-eff4-31c2-2cd7-215f23c51b74",
          "code": "DTXSID40196395",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40196395",
          "code_system": "EPA CompTox",
          "references": [
            "b744183d-fbae-5bed-67f3-bc373e691bf6"
          ]
        },
        {
          "uuid": "04ba27a3-0e37-4fbd-962f-d85111cc8791",
          "code": "6Q2L2H0POF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bdb26c48-b9d3-c28f-7d45-c1eff1ef6085",
          "code": "1392829",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1392829",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "012f4fdd-9cc2-ff2b-aaca-d0f3686d2a4f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b30a16a1-a9d5-48c8-81ab-d82c9920d773",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "3a6c2e68-4686-42e4-bc54-f6b9d7b8834e",
            "refuuid": "d979f10d-0b89-470b-b5f3-38f3c1d6158b",
            "name": "DIMESNA",
            "unii": "230R951Y4D",
            "linking_id": "230R951Y4D",
            "ref_pname": "DIMESNA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ea8105d8-ff46-4eb5-8840-6c9906778950",
          "amount": {
            "uuid": "1d650abe-a106-4e1d-ae49-8397e42f993d",
            "units": "PERCENT PEAK AREA",
            "high_limit": 3
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "86084557-b21f-358e-fa77-1a75faa31e38"
          ],
          "related_substance": {
            "uuid": "0c16b384-0d46-422f-8e1d-c31ca32e2537",
            "refuuid": "fc045eea-5a66-44fd-89a9-9c2fa3b433af",
            "name": "MESNA",
            "unii": "NR7O1405Q9",
            "linking_id": "NR7O1405Q9",
            "ref_pname": "MESNA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "60697d05-a250-46a1-9157-344c000586d3",
          "amount": {
            "uuid": "9429ebcf-65d0-4f9e-8208-65a2ce460f3d",
            "units": "PERCENT PEAK AREA",
            "high_limit": 3
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "769b1815-1534-02f3-ad58-5360954de405"
          ],
          "related_substance": {
            "uuid": "cc43884f-3558-4656-ab75-9fbcf512c6c9",
            "refuuid": "fc045eea-5a66-44fd-89a9-9c2fa3b433af",
            "name": "MESNA",
            "unii": "NR7O1405Q9",
            "linking_id": "NR7O1405Q9",
            "ref_pname": "MESNA",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f34a3012-fc5f-4e40-9b13-bd5d35cc8df0",
          "name": ".OMEGA.,.OMEGA.'-ETHANEDISULFIDEDISULFONIC ACID",
          "stdName": ".OMEGA.,.OMEGA.'-ETHANEDISULFIDEDISULFONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15846b00-b764-4ea2-a985-6918c4bc06e2",
            "4b9c602e-903f-49e2-a625-6a9ba2e2d326"
          ],
          "display_name": false
        },
        {
          "uuid": "cfdc3ed4-2439-41ac-9432-682436e0ebe7",
          "name": "2,2'-DITHIODIETHANESULFONIC ACID",
          "stdName": "2,2'-DITHIODIETHANESULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15846b00-b764-4ea2-a985-6918c4bc06e2",
            "4b9c602e-903f-49e2-a625-6a9ba2e2d326"
          ],
          "display_name": true
        },
        {
          "uuid": "65b8c869-c4b0-4c59-a9ea-8327a6f90f4f",
          "name": "BIS(2-SULFOETHYL)DISULFIDE",
          "stdName": "BIS(2-SULFOETHYL)DISULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15846b00-b764-4ea2-a985-6918c4bc06e2",
            "4b9c602e-903f-49e2-a625-6a9ba2e2d326"
          ],
          "display_name": false
        },
        {
          "uuid": "55059b15-d44a-427f-80db-5848aeaeb296",
          "name": "DIMESNA FREE ACID",
          "stdName": "DIMESNA FREE ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15846b00-b764-4ea2-a985-6918c4bc06e2",
            "4b9c602e-903f-49e2-a625-6a9ba2e2d326"
          ],
          "display_name": false
        },
        {
          "uuid": "9663ae8c-70b5-4c7e-b585-adfbe17834d4",
          "name": "ETHANESULFONIC ACID, 2,2'-DITHIOBIS-",
          "stdName": "ETHANESULFONIC ACID, 2,2'-DITHIOBIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15846b00-b764-4ea2-a985-6918c4bc06e2",
            "4b9c602e-903f-49e2-a625-6a9ba2e2d326"
          ],
          "display_name": false
        },
        {
          "uuid": "41b9eb39-95ec-f413-32c1-599a2f7d0c50",
          "name": "MESNA IMPURITY D [EP IMPURITY]",
          "stdName": "MESNA IMPURITY D [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86084557-b21f-358e-fa77-1a75faa31e38"
          ],
          "display_name": false
        },
        {
          "uuid": "c71a4ab5-8c02-4f14-8afc-7fe70e75f470",
          "name": "MESNA RELATED COMPOUND B",
          "stdName": "MESNA RELATED COMPOUND B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15846b00-b764-4ea2-a985-6918c4bc06e2",
            "c8a9822f-130b-42cf-81a3-cfbbfaef61fa",
            "5fe7f3dc-9ce4-40de-abda-3bddad8b13a8"
          ],
          "display_name": false
        },
        {
          "uuid": "86627633-f9c4-49cc-389a-2e133efec1bb",
          "name": "MESNA RELATED COMPOUND B [USP IMPURITY]",
          "stdName": "MESNA RELATED COMPOUND B [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "769b1815-1534-02f3-ad58-5360954de405"
          ],
          "display_name": false
        },
        {
          "uuid": "b0960f21-982a-4679-9cc7-b62a13c6d59b",
          "name": "MESNA RELATED COMPOUND B [USP-RS]",
          "stdName": "MESNA RELATED COMPOUND B [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15846b00-b764-4ea2-a985-6918c4bc06e2",
            "c8a9822f-130b-42cf-81a3-cfbbfaef61fa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "769b1815-1534-02f3-ad58-5360954de405",
          "citation": "USP42-NF37 - 2763, Mesna Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "86084557-b21f-358e-fa77-1a75faa31e38",
          "citation": "European Pharmacopoeia Online 9.8, Mesna Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "415c1db3-fd82-4f3b-8b05-7b034c5d19e8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4b9c602e-903f-49e2-a625-6a9ba2e2d326",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "15846b00-b764-4ea2-a985-6918c4bc06e2",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8a9822f-130b-42cf-81a3-cfbbfaef61fa",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e1b719d-6d69-4836-8e41-8a51b68f1d3d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392734000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a2aef37-64dd-437e-af65-69390207fc85",
          "citation": "SRS import [6Q2L2H0POF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6Q2L2H0POF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392734000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fe7f3dc-9ce4-40de-abda-3bddad8b13a8",
          "citation": "MESNA RELATED COMPOUND B [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b744183d-fbae-5bed-67f3-bc373e691bf6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=45127-11-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "012f4fdd-9cc2-ff2b-aaca-d0f3686d2a4f",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "85d1ad8e-3cca-4693-aded-64e4cfebcebd",
          "id": "85d1ad8e-3cca-4693-aded-64e4cfebcebd",
          "molfile": "\n  Marvin  01132106572D          \n\n 14 13  0  0  0  0            999 V2000\n    4.6565   -4.2505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2010   -4.8936    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7300   -5.5108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5683   -5.4330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8130   -4.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5936   -4.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2081   -4.0794    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9783   -4.3516    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6396   -3.8304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4071   -4.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0295   -3.5633    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5844   -4.1857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4875   -2.9409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6829   -3.0187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  2  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 11  2  0  0  0  0\nM  END",
          "smiles": "C(CS(=O)(=O)O)SSCCS(=O)(=O)O",
          "formula": "C4H10O6S4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cbce9e51-04ab-4d7d-868d-82eb9b95fb5a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "282.3831",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e0a1b4db-2cb7-445a-a0e9-8ae87dd1b69a",
      "version": "11",
      "structure": {
        "id": "d2f93ea1-2845-49fc-bac5-45aeecfd40f7",
        "molfile": "\n  Marvin  01132110542D          \n\n 14 13  0  0  0  0            999 V2000\n   10.0295   -3.5633    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4071   -4.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6396   -3.8304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9783   -4.3516    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2081   -4.0794    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5936   -4.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8130   -4.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2010   -4.8936    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6565   -4.2505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7300   -5.5108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5683   -5.4330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5844   -4.1857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4875   -2.9409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6829   -3.0187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11  8  2  0  0  0  0\n 12  1  1  0  0  0  0\n 13  1  2  0  0  0  0\n 14  1  2  0  0  0  0\nM  END",
        "smiles": "C(CS(=O)(=O)O)SSCCS(=O)(=O)O",
        "formula": "C4H10O6S4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "282.3831",
        "optical_activity": "NONE",
        "references": [
          "6a2aef37-64dd-437e-af65-69390207fc85",
          "4b9c602e-903f-49e2-a625-6a9ba2e2d326"
        ],
        "stereo_centers": 0
      },
      "unii": "6Q2L2H0POF"
    }
  ]
}