{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b2bf3dbf-8808-43db-a7d9-c31ab4b63a9e",
          "code": "76738-62-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=76738-62-0",
          "code_system": "CAS",
          "references": [
            "af69bb7f-70db-4254-84ba-c9b98f52a084",
            "f221f2b5-55f6-4fd4-9efc-952ba0e5644a"
          ]
        },
        {
          "uuid": "44859f2f-aae4-42bf-8ee5-8654d802986a",
          "code": "C053370",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67053370",
          "code_system": "MESH",
          "references": [
            "af69bb7f-70db-4254-84ba-c9b98f52a084"
          ]
        },
        {
          "uuid": "4feb6562-2cf6-4d1f-9a62-477d6a551e1d",
          "code": "PACLOBUTRAZOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Paclobutrazol",
          "code_system": "WIKIPEDIA",
          "references": [
            "af69bb7f-70db-4254-84ba-c9b98f52a084"
          ]
        },
        {
          "uuid": "d11a1c84-afa5-426e-b43a-30f6d7c5281b",
          "code": "125601",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3208",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "af69bb7f-70db-4254-84ba-c9b98f52a084"
          ]
        },
        {
          "uuid": "08111bd7-c961-49d9-a9ac-6dd5746c9621",
          "code": "m8352",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8352?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "af69bb7f-70db-4254-84ba-c9b98f52a084"
          ]
        },
        {
          "uuid": "3c6e9edd-6964-4f55-a066-1fbe982472b2",
          "code": "73671",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73671",
          "code_system": "PUBCHEM",
          "references": [
            "af69bb7f-70db-4254-84ba-c9b98f52a084"
          ]
        },
        {
          "uuid": "bcbd5649-a8f0-4786-83cf-1e83c782e73b",
          "code": "6PLV42R3ZA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4aa47859-787b-7958-fc20-cdbf6694714b",
          "code": "paclobutrazol",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/paclobutrazol.html",
          "code_system": "ALANWOOD",
          "references": [
            "e83d77aa-221e-3f25-8aa4-ae6628ff76f1"
          ]
        },
        {
          "uuid": "cc32e4c6-4595-0728-481a-b31deea1c1dc",
          "code": "DTXSID2024242",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2024242",
          "code_system": "EPA CompTox",
          "references": [
            "b70131f3-107c-4c21-cc98-a4a82e78d992"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7729bdfc-39d1-4281-8317-278a344c3160",
          "amount": {
            "uuid": "a1fa3c2a-a479-49f9-8ec3-405e666eb142"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "6fa9de8b-b88f-4bfb-8686-5147d156fe53"
          ],
          "related_substance": {
            "uuid": "4f926d5b-6339-49da-8857-d62b5192e89f",
            "refuuid": "fbec3071-91d7-4328-a9e9-4c7d8a3d78fd",
            "name": "Paclobutrazol, (2R,3R)-",
            "unii": "P6YK8U3ETP",
            "linking_id": "P6YK8U3ETP",
            "ref_pname": "Paclobutrazol, (2R,3R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1aba376e-912c-4e67-bd47-9532fddc199e",
          "amount": {
            "uuid": "4e2c2f30-05d5-4854-812f-6d77c86c4c1a"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "2c68f3cb-8c62-4064-90bf-20d988fe71d9"
          ],
          "related_substance": {
            "uuid": "67c54a07-3d66-42a0-8543-953792898483",
            "refuuid": "abe1a170-5647-4c72-bbc2-1fb09fc12370",
            "name": "Paclobutrazol, (2S,3S)-",
            "unii": "3EF5QC8G5W",
            "linking_id": "3EF5QC8G5W",
            "ref_pname": "Paclobutrazol, (2S,3S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9b9171b1-d8bf-4aeb-875a-44cb284a7aaa",
          "name": "1H-1,2,4-TRIAZOLE-1-ETHANOL, .BETA.-((4-CHLOROPHENYL)METHYL)-.ALPHA.-(1,1-DIMETHYLETHYL)-, (.ALPHA.R,.BETA.R)-REL-",
          "stdName": "1H-1,2,4-TRIAZOLE-1-ETHANOL, .BETA.-((4-CHLOROPHENYL)METHYL)-.ALPHA.-(1,1-DIMETHYLETHYL)-, (.ALPHA.R,.BETA.R)-REL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9364a01a-0e91-43df-a21d-45e1ebce30ea",
            "a4145cdc-7024-482d-83bc-11c7501542fd"
          ],
          "display_name": false
        },
        {
          "uuid": "5e979d24-ab58-4559-8304-10a3cdadae40",
          "name": "PACLOBUTRAZOL",
          "stdName": "PACLOBUTRAZOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a298cbb3-24e2-426f-8082-7c80bf7a028a",
            "73f1372f-c68b-44da-a5e2-3c3a2bd7293e",
            "fe838e59-c2f7-4c12-a706-514646cb24e6",
            "3b0b0766-3f26-4e6a-b5e1-566c1365cd5e",
            "4dfae91c-7930-4ecd-b19e-8a5e925e2541",
            "a4145cdc-7024-482d-83bc-11c7501542fd"
          ],
          "display_name": true
        },
        {
          "uuid": "21f7fd8e-3474-4620-9ae1-235d21ba622f",
          "name": "PACLOBUTRAZOL [ISO]",
          "stdName": "PACLOBUTRAZOL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73f1372f-c68b-44da-a5e2-3c3a2bd7293e",
            "a4145cdc-7024-482d-83bc-11c7501542fd"
          ],
          "display_name": false
        },
        {
          "uuid": "a14446af-4229-422d-a8ff-131dd0575c07",
          "name": "PACLOBUTRAZOL [MI]",
          "stdName": "PACLOBUTRAZOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4dfae91c-7930-4ecd-b19e-8a5e925e2541",
            "a4145cdc-7024-482d-83bc-11c7501542fd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fe838e59-c2f7-4c12-a706-514646cb24e6",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4dfae91c-7930-4ecd-b19e-8a5e925e2541",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4145cdc-7024-482d-83bc-11c7501542fd",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73f1372f-c68b-44da-a5e2-3c3a2bd7293e",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9364a01a-0e91-43df-a21d-45e1ebce30ea",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af69bb7f-70db-4254-84ba-c9b98f52a084",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391037000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0385f2d8-72df-4b94-ac86-b7c96541ea7a",
          "citation": "SRS import [6PLV42R3ZA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6PLV42R3ZA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391037000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9c71009-e941-4229-ac46-a42cdc8b5f7d",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b0b0766-3f26-4e6a-b5e1-566c1365cd5e",
          "citation": "PACLOBUTRAZOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a298cbb3-24e2-426f-8082-7c80bf7a028a",
          "citation": "PACLOBUTRAZOL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8bd5ca56-a588-13c0-d01b-b2c077e03f70",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=76738-62-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e83d77aa-221e-3f25-8aa4-ae6628ff76f1",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "f221f2b5-55f6-4fd4-9efc-952ba0e5644a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6fa9de8b-b88f-4bfb-8686-5147d156fe53",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2c68f3cb-8c62-4064-90bf-20d988fe71d9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b70131f3-107c-4c21-cc98-a4a82e78d992",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "30354dc9-0b0a-4248-9fe3-930339a0bafc",
          "id": "30354dc9-0b0a-4248-9fe3-930339a0bafc",
          "molfile": "\n  Marvin  01132102352D          \n\n 20 21  0  0  0  0            999 V2000\n    9.2710   -7.4929    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.2710   -8.3236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9815   -7.0785    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.9815   -6.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7113   -5.8437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4166   -6.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1464   -5.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1464   -5.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8713   -4.6220    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   11.4359   -4.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7113   -5.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7000   -7.4911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4443   -8.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1215   -8.7548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7834   -8.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5229   -7.4911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5506   -7.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5506   -6.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8856   -7.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8310   -6.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 17  1  0  0  0  0\n  3  4  1  6  0  0  0\n  3 12  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 11  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 10 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 16 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 17  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)[C@@H]([C@H](Cc1ccc(cc1)Cl)n2cncn2)O",
          "formula": "C15H20ClN3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1239a2d9-d362-495d-8ec1-de9793eb394a"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "293.7923",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7c5493d9-75c5-4bb3-b4a7-3102dfc76126",
      "version": "8",
      "structure": {
        "id": "de501f16-fd46-4977-800a-4d0e25401d8b",
        "molfile": "\n  Marvin  01132111312D          \n\n 20 21  0  0  0  0            999 V2000\n   10.7000   -7.4911    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n   10.4443   -8.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1215   -8.7548    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7834   -8.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5229   -7.4911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9815   -7.0785    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2710   -7.4929    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5506   -7.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5506   -6.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8856   -7.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8310   -6.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2710   -8.3236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9815   -6.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7113   -5.8437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4166   -6.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1464   -5.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1464   -5.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4359   -4.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7113   -5.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8713   -4.6220    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  1  6  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  8  1  0  0  0  0\n  7 12  1  1  0  0  0\n 13  6  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 14  2  0  0  0  0\n 20 17  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)[C@@H]([C@H](Cc1ccc(cc1)Cl)n2cncn2)O",
        "formula": "C15H20ClN3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "293.7923",
        "optical_activity": "( + / - )",
        "references": [
          "0385f2d8-72df-4b94-ac86-b7c96541ea7a",
          "b9c71009-e941-4229-ac46-a42cdc8b5f7d"
        ],
        "stereo_centers": 2
      },
      "unii": "6PLV42R3ZA"
    }
  ]
}