{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ffcc65bb-92f1-4d9e-bbd0-1245796a06c1",
          "code": "207972-39-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=207972-39-2",
          "code_system": "CAS",
          "references": [
            "ea01caec-cc17-4942-b5a6-3f57e15d4798",
            "fefbc458-59db-4192-8b22-9287296dcbc1"
          ]
        },
        {
          "uuid": "e292d3d3-7d78-4008-8d32-18d3f3532e9a",
          "code": "4342838",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4342838",
          "code_system": "PUBCHEM",
          "references": [
            "ea01caec-cc17-4942-b5a6-3f57e15d4798"
          ]
        },
        {
          "uuid": "2ab06276-2fa5-2b1a-f2c0-7f0835c6ca64",
          "code": "DTXSID80724999",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80724999",
          "code_system": "EPA CompTox",
          "references": [
            "ae02ba84-812e-a4d2-345d-776953bf3625"
          ]
        },
        {
          "uuid": "954dc003-51d0-450a-8311-8ca39c996dbf",
          "code": "6P1YVC1J3O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d7885445-2eb0-4cd9-a633-74f6a666488a",
          "name": "AZASAL-2100",
          "stdName": "AZASAL-2100",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b13fae5b-40c3-49e7-9542-2b4d5ead797d",
            "5c649717-d5ff-4041-bd5d-30d7e96c0bd0"
          ],
          "display_name": false
        },
        {
          "uuid": "26561be9-b014-423f-93f5-545adbc03b43",
          "name": "AZELOYL DIETHYL SALICYLATE",
          "stdName": "AZELOYL DIETHYL SALICYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9c5b511-d5ef-4df5-8b09-005a61f4433f",
            "b13fae5b-40c3-49e7-9542-2b4d5ead797d",
            "5c649717-d5ff-4041-bd5d-30d7e96c0bd0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0c1afcac-c871-4a76-8555-98c1e869705d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "deaf893e-24a7-4808-8d74-80ef6c91f13e",
          "name": "NONANEDIOIC ACID, 1,9-BIS(2-(ETHOXYCARBONYL)PHENYL) ESTER",
          "stdName": "NONANEDIOIC ACID, 1,9-BIS(2-(ETHOXYCARBONYL)PHENYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7e19a92-b7a4-41cf-a5c6-b565c9333c1c",
            "5c649717-d5ff-4041-bd5d-30d7e96c0bd0"
          ],
          "display_name": false
        },
        {
          "uuid": "02af9596-22b7-45ad-bdb6-198cc96fdf4a",
          "name": "NONANEDIOIC ACID, BIS(2-(ETHOXYCARBONYL)PHENYL) ESTER",
          "stdName": "NONANEDIOIC ACID, BIS(2-(ETHOXYCARBONYL)PHENYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7e19a92-b7a4-41cf-a5c6-b565c9333c1c",
            "5c649717-d5ff-4041-bd5d-30d7e96c0bd0"
          ],
          "display_name": false
        },
        {
          "uuid": "359773c1-c370-48ea-9094-b30e47aae8cc",
          "name": "TU-2100",
          "stdName": "TU-2100",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7e19a92-b7a4-41cf-a5c6-b565c9333c1c",
            "5c649717-d5ff-4041-bd5d-30d7e96c0bd0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b13fae5b-40c3-49e7-9542-2b4d5ead797d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5c649717-d5ff-4041-bd5d-30d7e96c0bd0",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7e19a92-b7a4-41cf-a5c6-b565c9333c1c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea01caec-cc17-4942-b5a6-3f57e15d4798",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393046000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b4fc0c6-e872-4c32-96df-a7cd8f32a574",
          "citation": "SRS import [6P1YVC1J3O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6P1YVC1J3O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393046000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9c5b511-d5ef-4df5-8b09-005a61f4433f",
          "citation": "AZELOYL DIETHYL SALICYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae02ba84-812e-a4d2-345d-776953bf3625",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=207972-39-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fefbc458-59db-4192-8b22-9287296dcbc1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9dce2cd9-5d98-4fea-a916-a0c86cfbc5f4",
          "id": "9dce2cd9-5d98-4fea-a916-a0c86cfbc5f4",
          "molfile": "\n  Marvin  01132108122D          \n\n 35 36  0  0  0  0            999 V2000\n    8.1762   -8.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4617   -8.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7472   -8.5948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0328   -8.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3183   -8.5948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0328   -7.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3183   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3183   -6.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0328   -5.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7472   -6.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7473   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4617   -7.3573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1762   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1762   -6.1199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8907   -7.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6052   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3197   -7.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0342   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7487   -7.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4631   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1776   -7.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8921   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6065   -7.3574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8921   -6.1199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6674   -5.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2993   -6.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0746   -6.0858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2179   -5.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5859   -4.7429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8106   -5.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1786   -4.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4034   -4.7770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3218   -3.6824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0972   -3.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2404   -2.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n 11  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 30  2  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 29 28  2  0  0  0  0\n 30 29  1  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  2  0  0  0  0\n 31 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)c1ccccc1OC(=O)CCCCCCCC(=O)Oc2ccccc2C(=O)OCC",
          "formula": "C27H32O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aad32dfa-75d1-416f-8130-e3bff406481f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "484.5392",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "94b66178-dbad-4156-9a78-a63046d2e7ba",
      "version": "4",
      "structure": {
        "id": "f5cbd5dc-fc5c-40a9-9381-e2b0470d1bd8",
        "molfile": "\n  Marvin  01132112452D          \n\n 35 36  0  0  0  0            999 V2000\n    7.4617   -7.3573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7473   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7472   -6.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0328   -5.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3183   -6.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3183   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0328   -7.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0328   -8.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3183   -8.5948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7472   -8.5948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4617   -8.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1762   -8.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1762   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1762   -6.1199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8907   -7.3573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6052   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3197   -7.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0342   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7487   -7.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4631   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1776   -7.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8921   -6.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6065   -7.3574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8921   -6.1199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6674   -5.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2993   -6.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0746   -6.0858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2179   -5.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5859   -4.7429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8106   -5.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1786   -4.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4034   -4.7770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3218   -3.6824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0972   -3.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2404   -2.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 29 28  2  0  0  0  0\n 30 29  1  0  0  0  0\n 25 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  2  0  0  0  0\n 31 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)c1ccccc1OC(=O)CCCCCCCC(=O)Oc2ccccc2C(=O)OCC",
        "formula": "C27H32O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "484.5392",
        "optical_activity": "NONE",
        "references": [
          "9b4fc0c6-e872-4c32-96df-a7cd8f32a574",
          "e7e19a92-b7a4-41cf-a5c6-b565c9333c1c"
        ],
        "stereo_centers": 0
      },
      "unii": "6P1YVC1J3O"
    }
  ]
}