{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "cd8e4f20-4335-4a7a-87ad-a7ed73b75d3e", "code": "1922-67-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1922-67-4", "code_system": "CAS", "references": [ "348b07f7-c781-4e73-8902-6991060fe272", "6be018f8-f144-482b-828e-07cb58473cd5" ] }, { "uuid": "db216a89-b057-4d09-baee-bdd4620657c9", "code": "217-652-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.049", "code_system": "ECHA (EC/EINECS)", "references": [ "348b07f7-c781-4e73-8902-6991060fe272" ] }, { "uuid": "b30da238-cb64-49bb-a335-3cc0d64da713", "code": "102714", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/102714", "code_system": "PUBCHEM", "references": [ "348b07f7-c781-4e73-8902-6991060fe272" ] }, { "uuid": "79c4c0d0-6603-5fcc-1f77-126bb25f22c5", "code": "DTXSID00862781", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00862781", "code_system": "EPA CompTox", "references": [ "455798d8-3be1-e7c6-f9ae-96d52feb4c30" ] }, { "uuid": "ffdc1d1f-6ee6-4577-adda-c0a955616bd3", "code": "6P11B07H84", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "59ad75b0-b9ad-4ce0-b5fd-445ad79d4347", "name": "1H-NAPHTHO(2,3-C)PYRAN, 3,4,6,7,8,9-HEXAHYDRO-4,6,6,9,9-PENTAMETHYL-", "stdName": "1H-NAPHTHO(2,3-C)PYRAN, 3,4,6,7,8,9-HEXAHYDRO-4,6,6,9,9-PENTAMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c173a061-2c21-47fc-9971-80ecad35e2e8" ], "display_name": false }, { "uuid": "582f18c9-f369-4766-8540-29a92981a849", "name": "3,4,6,7,8,9-HEXAHYDRO-4,6,6,9,9-PENTAMETHYL-1H-NAPHTHO(2,3-C)PYRAN", "stdName": "3,4,6,7,8,9-HEXAHYDRO-4,6,6,9,9-PENTAMETHYL-1H-NAPHTHO(2,3-C)PYRAN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "201c9dec-dec9-49d8-9904-8f62ece3adcf" ], "display_name": true }, { "uuid": "b9a8e1c9-f19b-427b-a5e9-e23cc3ba7985", "name": "MUSK-89", "stdName": "MUSK-89", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "201c9dec-dec9-49d8-9904-8f62ece3adcf" ], "display_name": false } ], "references": [ { "uuid": "c173a061-2c21-47fc-9971-80ecad35e2e8", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "201c9dec-dec9-49d8-9904-8f62ece3adcf", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "348b07f7-c781-4e73-8902-6991060fe272", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392085000, "tags": [ "NOMEN" ] }, { "uuid": "677826ff-9456-43e9-aae7-7aa3d4b8c3ef", "citation": "SRS import [6P11B07H84]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6P11B07H84", "doc_type": "SRS", "public_domain": true, "document_date": 1493392085000, "tags": [ "NOMEN" ] }, { "uuid": "6be018f8-f144-482b-828e-07cb58473cd5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "455798d8-3be1-e7c6-f9ae-96d52feb4c30", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "31ef5626-94a9-4538-9352-efaa92b3fe56", "id": "31ef5626-94a9-4538-9352-efaa92b3fe56", "molfile": "\n Marvin 01132102402D \n\n 19 21 0 0 0 0 999 V2000\n 1.5380 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2554 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.9638 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6813 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6813 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9638 -1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9594 -2.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2420 -2.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5290 -2.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5380 -1.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2554 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8116 -2.8742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5336 -2.0984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8071 -3.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5245 -4.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2374 -3.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0490 -3.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5154 -4.4839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 11 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 11 6 2 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 8 17 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 12 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 12 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\nM END", "smiles": "CC1COCc2cc3c(cc12)C(C)(C)CCC3(C)C", "formula": "C18H26O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f34b0939-0f18-41b9-8a87-2b7b448b07a4" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "258.3991", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "8994b8cd-eb77-4b5f-8886-c81152b8be6f", "version": "6", "structure": { "id": "aad825d2-845a-46b3-b9d5-cebe1be2775d", "molfile": "\n Marvin 01132108522D \n\n 19 21 0 0 0 0 999 V2000\n 3.6813 -0.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9638 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2554 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2554 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9638 -1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9594 -2.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2420 -2.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5290 -2.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5380 -1.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8116 -2.8742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8071 -3.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5245 -4.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2374 -3.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0490 -3.5692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5154 -4.4839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5336 -2.0984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6813 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5380 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 18 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 19 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 9 2 0 0 0 0\n 5 6 2 0 0 0 0\n 5 18 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 13 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 16 1 0 0 0 0\n 10 17 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\nM END", "smiles": "CC1COCc2cc3c(cc12)C(C)(C)CCC3(C)C", "formula": "C18H26O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "258.3991", "optical_activity": "( + / - )", "references": [ "c173a061-2c21-47fc-9971-80ecad35e2e8", "677826ff-9456-43e9-aae7-7aa3d4b8c3ef" ], "stereo_centers": 1 }, "unii": "6P11B07H84" } ] }