{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "60a30452-29f3-4996-a5c4-38c8899530fb",
          "code": "58193-61-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58193-61-6",
          "code_system": "CAS",
          "references": [
            "f6114323-3d87-4bf5-838d-c9e918dbb266",
            "46809779-c38f-4e5c-afd6-c3a6586ee635"
          ]
        },
        {
          "uuid": "7e42bcd0-03eb-4213-86a0-75824bbb2807",
          "code": "m10913",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10913?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f6114323-3d87-4bf5-838d-c9e918dbb266"
          ]
        },
        {
          "uuid": "46ae687b-6a63-4c40-b3ed-27166be84172",
          "code": "11127203",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11127203",
          "code_system": "PUBCHEM",
          "references": [
            "f6114323-3d87-4bf5-838d-c9e918dbb266"
          ]
        },
        {
          "uuid": "755688c1-09d1-4bf0-ac0b-4b9df24bbfd4",
          "code": "6OOK4CLU1Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b66c014d-b8c8-42ae-b1be-3a1f83883ce2",
          "name": "1,1,10-TRIMETHYL-TRANS-2-DECALOL, (-)-",
          "stdName": "1,1,10-TRIMETHYL-TRANS-2-DECALOL, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c58811a5-5354-4fb5-bcef-6d45128cff70",
            "40258d3f-eef2-4b2a-8a67-a86a4daa628e"
          ],
          "display_name": false
        },
        {
          "uuid": "c350e334-c333-4f97-b1bc-1dcce1e68749",
          "name": "2-NAPHTHALENOL, DECAHYDRO-1,1,4A-TRIMETHYL-, (2S,4AS,8AR)-",
          "stdName": "2-NAPHTHALENOL, DECAHYDRO-1,1,4A-TRIMETHYL-, (2S,4AS,8AR)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60e27524-0c97-44c4-9686-6c390a4f81e9",
            "c58811a5-5354-4fb5-bcef-6d45128cff70"
          ],
          "display_name": false
        },
        {
          "uuid": "068ce356-4602-476e-bce3-ce28af9122cf",
          "name": "4,4,10.BETA.-TRIMETHYL-TRANS-DECAL-3.BETA.-OL, (-)-",
          "stdName": "4,4,10.BETA.-TRIMETHYL-TRANS-DECAL-3.BETA.-OL, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c58811a5-5354-4fb5-bcef-6d45128cff70",
            "40258d3f-eef2-4b2a-8a67-a86a4daa628e"
          ],
          "display_name": true
        },
        {
          "uuid": "8215fde7-8767-4ca5-a00b-ac8c979a9329",
          "name": "TMD L-FORM [MI]",
          "stdName": "TMD L-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a65b675-4266-45c1-b884-9ce3c5c7c014",
            "c58811a5-5354-4fb5-bcef-6d45128cff70"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "40258d3f-eef2-4b2a-8a67-a86a4daa628e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c58811a5-5354-4fb5-bcef-6d45128cff70",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a65b675-4266-45c1-b884-9ce3c5c7c014",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60e27524-0c97-44c4-9686-6c390a4f81e9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6114323-3d87-4bf5-838d-c9e918dbb266",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392810000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b9c3aae-d5b9-4bb5-8ba1-06c4728170ee",
          "citation": "SRS import [6OOK4CLU1Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6OOK4CLU1Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392810000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46809779-c38f-4e5c-afd6-c3a6586ee635",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e092b041-f62a-41ad-b46a-122b6bd33461",
          "id": "e092b041-f62a-41ad-b46a-122b6bd33461",
          "molfile": "\n  Marvin  01132111382D          \n\n 14 15  0  0  1  0            999 V2000\n    9.8584   -5.2473    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.5729   -4.8349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8584   -6.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1439   -6.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4295   -6.0723    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.4295   -6.8973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7150   -6.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0005   -6.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0005   -5.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7150   -4.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4295   -5.2473    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.1439   -4.8349    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.6136   -4.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6742   -4.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n 12  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  5 11  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)[C@@H]2CCCC[C@@]2(C)CC[C@@H]1O",
          "formula": "C13H24O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3fcb09a6-a20a-4222-b46d-449517ddbaec"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "196.3295",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a18c2496-8afd-4c5c-abd9-1195da20b94d",
      "version": "2",
      "structure": {
        "id": "be426f78-96e6-41a5-a5f4-240a0ae0d418",
        "molfile": "\n  Marvin  01132109502D          \n\n 15 16  0  0  1  0            999 V2000\n    8.4295   -6.8973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4295   -6.0723    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.7150   -6.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0005   -6.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0005   -5.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7150   -4.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4295   -5.2473    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.4295   -4.4223    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1439   -4.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8584   -5.2473    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.5729   -4.8349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8584   -6.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1439   -6.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6136   -4.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6742   -4.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 10  1  0  0  0  0\n  2 13  1  0  0  0  0\n 13 12  1  0  0  0  0\n  9 14  1  0  0  0  0\n  9 15  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)[C@]2([H])CCCC[C@@]2(C)CC[C@@H]1O",
        "formula": "C13H24O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "196.3295",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7b9c3aae-d5b9-4bb5-8ba1-06c4728170ee",
          "60e27524-0c97-44c4-9686-6c390a4f81e9"
        ],
        "stereo_centers": 3
      },
      "unii": "6OOK4CLU1Y"
    }
  ]
}