{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3bec9099-652e-4430-b740-58d20cb1d7ee",
          "code": "120-78-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=120-78-5",
          "code_system": "CAS",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab",
            "29e13425-76a9-4bc0-9952-6be52ee26b68"
          ]
        },
        {
          "uuid": "47290e42-10b9-4e3a-aab3-8670d00bc4d3",
          "code": "C028000",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67028000",
          "code_system": "MESH",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "17326e7e-3517-4b45-b1ce-dc0e296418f3",
          "code": "N0000185508",
          "comments": "Established Pharmacologic Class [EPC]|Standardized Chemical Allergen [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000185508",
          "code_system": "NDF-RT",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "4c8b9cfb-f0e9-4f9a-aca6-b776053cc482",
          "code": "9202",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:339",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "e3324365-dd51-47d6-838f-3bdbb95ce479",
          "code": "1306112",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1306112/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "07d121a0-16de-42ff-8d62-f76d73540779",
          "code": "m4683",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4683?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "4ea8b421-1995-466c-9d9d-f740ef1bd967",
          "code": "SUB61034",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "32e8bc04-ea52-4f6b-8dc8-da07aecf64d3",
          "code": "N0000184306",
          "comments": "Cell-mediated Immunity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000184306",
          "code_system": "NDF-RT",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "1b32b42a-fc45-4b34-a96f-aee02888295a",
          "code": "N0000171131",
          "comments": "Allergens [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000171131",
          "code_system": "NDF-RT",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "b75ae619-1447-4062-8de9-65d9e80db7e4",
          "code": "N0000175629",
          "comments": "Increased Histamine Release [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175629",
          "code_system": "NDF-RT",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "ff134ae9-b42e-4083-9f1d-4b33e15427ef",
          "code": "204-424-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.023",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "a7e8e264-02ab-4e8a-b340-736404164de1",
          "code": "8447",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8447",
          "code_system": "PUBCHEM",
          "references": [
            "d475eff2-19d8-4aec-b969-e321fc4a4aab"
          ]
        },
        {
          "uuid": "838d22f1-95fe-8377-19bb-1f930d10bb70",
          "code": "1137",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1137",
          "code_system": "HSDB",
          "references": [
            "05b7ba40-f203-8f2d-5670-33318e6cf3c1"
          ]
        },
        {
          "uuid": "f2f6c1d6-4e4a-7bb9-aa8e-ad3459542bbb",
          "code": "DTXSID1020146",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1020146",
          "code_system": "EPA CompTox",
          "references": [
            "d19bd12a-80d1-004f-89c2-89b540d19196"
          ]
        },
        {
          "uuid": "8450dc3b-26a6-4835-979d-4ebee59a150c",
          "code": "6OK753033Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3b56a52c-af8b-4134-ee2b-85f8f8cea8b2",
          "code": "53239",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:53239",
          "code_system": "CHEBI",
          "references": [
            "a11e7b1d-e929-c8fa-c449-bbfede1a43fb"
          ]
        },
        {
          "uuid": "2af7ee4d-d17a-7c9e-8358-ca36f6548c25",
          "code": "100000134275",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "67a931a6-076a-da8d-7f83-16c9d4b008e9"
          ]
        },
        {
          "uuid": "ab54c3b3-d5b2-54c5-cff2-75bec45f0f0d",
          "code": "6OK753033Z",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6OK753033Z",
          "code_system": "DAILYMED",
          "references": [
            "18f310c4-dc80-1083-d6aa-7af36a124cb5"
          ]
        },
        {
          "uuid": "aeeecf37-a26a-ebd2-2cda-fc8ed17a47ae",
          "code": "2",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2",
          "code_system": "NSC",
          "references": [
            "e8e35af7-0c9b-8f53-df5b-c7b4fde8e5d8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "58d9d9e5-f188-49c1-aff6-67dd6b3ef908",
          "name": "2,2'-DIBENZOTHIAZYL DISULFIDE [HSDB]",
          "stdName": "2,2'-DIBENZOTHIAZYL DISULFIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "319b2e97-dbd9-476e-9acf-819e25bb1a37",
            "05beb6f3-653d-41cf-97e0-9e356ab85ed1"
          ],
          "display_name": false
        },
        {
          "uuid": "83404164-6349-49a3-8e3d-505e3b1120a4",
          "name": "2,2'-DITHIOBIS(BENZOTHIAZOLE)",
          "stdName": "2,2'-DITHIOBIS(BENZOTHIAZOLE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "319b2e97-dbd9-476e-9acf-819e25bb1a37",
            "a340faa9-7b06-4214-8e4b-2538ad3902e7"
          ],
          "display_name": false
        },
        {
          "uuid": "860dc21d-d51d-480c-8151-e2c5f42d0164",
          "name": "2,2'-DITHIOBISBENZOTHIAZOLE [MI]",
          "stdName": "2,2'-DITHIOBISBENZOTHIAZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efaacbe8-f905-4e89-b0fb-1151e700d2c9",
            "319b2e97-dbd9-476e-9acf-819e25bb1a37"
          ],
          "display_name": false
        },
        {
          "uuid": "07c358a2-029e-43be-b636-9951c9159a76",
          "name": "2,2'-Dithiobisbenzothiazole",
          "stdName": "2,2'-DITHIOBISBENZOTHIAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abc23f41-bdc5-4186-b1c5-c411329064ee",
            "efaacbe8-f905-4e89-b0fb-1151e700d2c9",
            "319b2e97-dbd9-476e-9acf-819e25bb1a37",
            "f8a5610e-730b-4637-9585-18891d9aa8ad"
          ],
          "display_name": true
        },
        {
          "uuid": "bfa4467f-d14e-4bfb-a0dc-5671d5b83073",
          "name": "BENZOTHIAZOLE, 2,2'-DITHIOBIS-",
          "stdName": "BENZOTHIAZOLE, 2,2'-DITHIOBIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "319b2e97-dbd9-476e-9acf-819e25bb1a37",
            "f8a5610e-730b-4637-9585-18891d9aa8ad"
          ],
          "display_name": false
        },
        {
          "uuid": "d371b64e-e107-44e3-97d3-d645ea50287f",
          "name": "BIS(2-BENZOTHIAZYL) DISULFIDE",
          "stdName": "BIS(2-BENZOTHIAZYL) DISULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "319b2e97-dbd9-476e-9acf-819e25bb1a37",
            "a340faa9-7b06-4214-8e4b-2538ad3902e7"
          ],
          "display_name": false
        },
        {
          "uuid": "c0bf29ad-e814-45e8-b86f-87bc61e2a2b7",
          "name": "BIS(2-BENZOTHIAZYL) DISULPHIDE",
          "stdName": "BIS(2-BENZOTHIAZYL) DISULPHIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "028dab3a-d873-4a2b-a529-cd19f949c9b4"
          ],
          "display_name": false
        },
        {
          "uuid": "19ba98d1-a8bb-41f0-a7a6-7d1957afe8f9",
          "name": "DIBENZOTHIAZYL DISULFIDE",
          "stdName": "DIBENZOTHIAZYL DISULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26d39de4-5905-4e09-8a80-60dd67697014",
            "319b2e97-dbd9-476e-9acf-819e25bb1a37",
            "7a361b00-9953-4272-aa4b-0395f8932107",
            "a340faa9-7b06-4214-8e4b-2538ad3902e7"
          ],
          "display_name": false
        },
        {
          "uuid": "7d9a68c3-a40e-4ff0-a8f0-d4ac33026d9d",
          "name": "DIBENZOTHIAZYL DISULFIDE [VANDF]",
          "stdName": "DIBENZOTHIAZYL DISULFIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "319b2e97-dbd9-476e-9acf-819e25bb1a37",
            "7a361b00-9953-4272-aa4b-0395f8932107"
          ],
          "display_name": false
        },
        {
          "uuid": "d858ed6f-122c-42af-bb44-46a4479fe283",
          "name": "DIBENZOTHIAZYL DISULPHIDE",
          "stdName": "DIBENZOTHIAZYL DISULPHIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "028dab3a-d873-4a2b-a529-cd19f949c9b4"
          ],
          "display_name": false
        },
        {
          "uuid": "60e2f1a8-a4ab-4850-bc20-98afe081e8aa",
          "name": "MBTS",
          "stdName": "MBTS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "319b2e97-dbd9-476e-9acf-819e25bb1a37",
            "a340faa9-7b06-4214-8e4b-2538ad3902e7"
          ],
          "display_name": false
        },
        {
          "uuid": "7072f582-b384-4c40-a678-6ed49b4db306",
          "name": "NSC-2",
          "stdName": "NSC-2",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "803e5e06-480a-4245-8aeb-50f2990e0640",
            "319b2e97-dbd9-476e-9acf-819e25bb1a37"
          ],
          "display_name": false
        },
        {
          "uuid": "a1618faa-86cf-4b0f-a074-27e836f10efc",
          "name": "THIOFIDE",
          "stdName": "THIOFIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "319b2e97-dbd9-476e-9acf-819e25bb1a37",
            "a340faa9-7b06-4214-8e4b-2538ad3902e7"
          ],
          "display_name": false
        },
        {
          "uuid": "05851674-efef-435d-b850-b467f88d5a09",
          "name": "VULKACIT DM",
          "stdName": "VULKACIT DM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "319b2e97-dbd9-476e-9acf-819e25bb1a37",
            "a340faa9-7b06-4214-8e4b-2538ad3902e7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a340faa9-7b06-4214-8e4b-2538ad3902e7",
          "citation": "http://environmentalchemistry.com/yogi/chemicals/cn/2,2'-Benzothiazyl%A0Disulfide.html",
          "url": "http://environmentalchemistry.com/yogi/chemicals/cn/2,2'-Benzothiazyl%A0Disulfide.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "319b2e97-dbd9-476e-9acf-819e25bb1a37",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8a5610e-730b-4637-9585-18891d9aa8ad",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "028dab3a-d873-4a2b-a529-cd19f949c9b4",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efaacbe8-f905-4e89-b0fb-1151e700d2c9",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05beb6f3-653d-41cf-97e0-9e356ab85ed1",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a361b00-9953-4272-aa4b-0395f8932107",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "803e5e06-480a-4245-8aeb-50f2990e0640",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d475eff2-19d8-4aec-b969-e321fc4a4aab",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b778be4f-eb90-4d41-9d6f-cf6fb8439afa",
          "citation": "SRS import [6OK753033Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6OK753033Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abc23f41-bdc5-4186-b1c5-c411329064ee",
          "citation": "2,2'-DITHIOBISBENZOTHIAZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "26d39de4-5905-4e09-8a80-60dd67697014",
          "citation": "DIBENZOTHIAZYL DISULFIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "05b7ba40-f203-8f2d-5670-33318e6cf3c1",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+120-78-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d19bd12a-80d1-004f-89c2-89b540d19196",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=120-78-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "67a931a6-076a-da8d-7f83-16c9d4b008e9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "29e13425-76a9-4bc0-9952-6be52ee26b68",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a11e7b1d-e929-c8fa-c449-bbfede1a43fb",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "18f310c4-dc80-1083-d6aa-7af36a124cb5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e8e35af7-0c9b-8f53-df5b-c7b4fde8e5d8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fe9885d5-df2d-410e-9e8f-b0cc1931b261",
          "id": "fe9885d5-df2d-410e-9e8f-b0cc1931b261",
          "molfile": "\n  Marvin  01132113112D          \n\n 20 23  0  0  0  0            999 V2000\n    3.6589   -1.3068    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0713   -2.0213    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8964   -2.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3812   -1.3538    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1659   -1.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8804   -1.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5949   -1.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5949   -2.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8804   -2.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1659   -2.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3812   -2.6887    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8338   -1.3068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3489   -1.9742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5643   -1.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8498   -2.1318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1354   -1.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1354   -0.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8498   -0.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5643   -0.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3490   -0.6394    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1 12  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n 11  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 20  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 19  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)nc(s2)SSc3nc4ccccc4s3",
          "formula": "C14H8N2S4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c1c42dbf-1679-4cf7-b579-0d592708606d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "332.4916",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4ae06b7b-c3d3-473d-a82e-b37b2f506674",
      "version": "9",
      "structure": {
        "id": "c9dfc01e-39ae-4748-acf7-bbc3b1c469a4",
        "molfile": "\n  Marvin  01132110252D          \n\n 20 23  0  0  0  0            999 V2000\n    2.3490   -0.6394    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8338   -1.3068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3489   -1.9742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5643   -1.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5643   -0.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8498   -0.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1354   -0.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1354   -1.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8498   -2.1318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6589   -1.3068    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0713   -2.0213    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8964   -2.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3812   -2.6887    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1659   -2.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8804   -2.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5949   -2.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5949   -1.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8804   -1.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1659   -1.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3812   -1.3538    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9  4  2  0  0  0  0\n 10  2  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 12  2  0  0  0  0\n 14 19  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)nc(s2)SSc3nc4ccccc4s3",
        "formula": "C14H8N2S4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "332.4916",
        "optical_activity": "NONE",
        "references": [
          "b778be4f-eb90-4d41-9d6f-cf6fb8439afa",
          "f8a5610e-730b-4637-9585-18891d9aa8ad"
        ],
        "stereo_centers": 0
      },
      "unii": "6OK753033Z"
    }
  ]
}