{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "917914c5-1381-449c-9179-c643bca5e9f3",
          "code": "4707-32-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4707-32-8",
          "code_system": "CAS",
          "references": [
            "ff20712b-45d4-4ca9-89c9-c304d74e6588",
            "e5b3a78b-8116-4f66-a518-e528cff66d59"
          ]
        },
        {
          "uuid": "9fc58aaa-0d78-4fbd-afb1-b13feec4e9b1",
          "code": "C28694",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28694",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ff20712b-45d4-4ca9-89c9-c304d74e6588"
          ]
        },
        {
          "uuid": "26a4e134-6d40-4a55-9064-3348e4fd6156",
          "code": "3885",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3885",
          "code_system": "PUBCHEM",
          "references": [
            "ff20712b-45d4-4ca9-89c9-c304d74e6588"
          ]
        },
        {
          "uuid": "52164a92-f892-4655-e3b0-9f5bd5aae00f",
          "code": "DTXSID90197019",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90197019",
          "code_system": "EPA CompTox",
          "references": [
            "e5b236e8-44e1-890e-5186-a72db76e9e76"
          ]
        },
        {
          "uuid": "cda5365f-416e-7b6f-068a-d5fc83960750",
          "code": "C274",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C274",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a8f988ee-ba8f-4ef9-a152-f167acc4bd96"
          ]
        },
        {
          "uuid": "60498b34-be65-4114-96ba-7d197acec939",
          "code": "6N4FA2QQ6A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9f17fe72-7c06-59af-b295-8e9850ac7b6d",
          "code": "DB11948",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11948",
          "code_system": "DRUG BANK",
          "references": [
            "a8f988ee-ba8f-4ef9-a152-f167acc4bd96"
          ]
        },
        {
          "uuid": "6d38a5d0-422d-1355-be81-811fa6d4e301",
          "code": "10429",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:10429",
          "code_system": "CHEBI",
          "references": [
            "a8f988ee-ba8f-4ef9-a152-f167acc4bd96"
          ]
        },
        {
          "uuid": "6f026e13-c218-3f05-7f96-764fac8b9d3b",
          "code": "812821",
          "comments": "ORPHAN DRUG|Designated|Treatment of Primary Sclerosing Cholangitis (PSC)",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=812821",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "a8f988ee-ba8f-4ef9-a152-f167acc4bd96"
          ]
        },
        {
          "uuid": "ee666292-8565-d6d4-cf9d-14ebcc8d0287",
          "code": "26326",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=26326",
          "code_system": "NSC",
          "references": [
            "3e87465b-351e-d63f-da53-3529e66f5cab"
          ]
        },
        {
          "uuid": "a7a8851d-9463-994f-da66-eb79dfcce6b5",
          "code": "629749",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=629749",
          "code_system": "NSC",
          "references": [
            "3e87465b-351e-d63f-da53-3529e66f5cab"
          ]
        },
        {
          "uuid": "3f53df1b-39e5-3815-888a-38dc43755e21",
          "code": "300000041388",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0129047d-15c2-39c8-7a46-80ea5c99fa59"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "184471d3-3f3d-41b4-8a8e-fe4170e32f58",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "505fe856-dc36-43ff-bc16-d5b69d444fc9",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5073448f-5668-448e-ad48-077254cf276a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b6e0b64-713f-40bf-a20d-e289ed6a5420",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1621dd0b-d49f-49ee-9e94-329c01177976",
          "citation": "http://www.medkoo.com/Anticancer-trials/ARQ-501.htm",
          "url": "http://www.medkoo.com/Anticancer-trials/ARQ-501.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e524d83-2a98-453c-b131-679b342303ca",
          "citation": "http://adisinsight.springer.com/drugs/800035048",
          "url": "http://adisinsight.springer.com/drugs/800035048",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff20712b-45d4-4ca9-89c9-c304d74e6588",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390174000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eea48b3c-e1b0-419d-b735-11e3fe62bc5e",
          "citation": "SRS import [6N4FA2QQ6A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6N4FA2QQ6A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390174000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da9c41f0-2d94-472d-bcb0-9d7a2d6d24a1",
          "citation": "LAPACHONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5b236e8-44e1-890e-5186-a72db76e9e76",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4707-32-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a8f988ee-ba8f-4ef9-a152-f167acc4bd96",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4fedb130-5851-43e9-ad50-85d46ddabad0",
          "citation": "Miao, Xiu-Sheng, et al. \"Identification of the in vitro metabolites of 3, 4-dihydro-2, 2-dimethyl-2H-naphthol [1, 2-b] pyran-5, 6-dione (ARQ 501; β-lapachone) in whole blood.\" Drug metabolism and disposition 36.4 (2008): 641-648.",
          "url": "http://dmd.aspetjournals.org/content/dmd/36/4/641.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7e635f93-e698-402c-a8c7-37ddbb72d1e9",
          "citation": "USP43-NF38 – 1804, Ezetimibe Monograph",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d84c49a9-47ac-4721-9e0b-53aecba6d67e",
          "citation": "Miao, Xiu-Sheng, et al. \"Identification of the in vitro metabolites of 3, 4-dihydro-2, 2-dimethyl-2H-naphthol [1, 2-b] pyran-5, 6-dione (ARQ 501; β-lapachone) in whole blood.\" Drug metabolism and disposition 36.4 (2008): 641-648.",
          "url": "http://dmd.aspetjournals.org/content/dmd/36/4/641.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "513b31a8-a617-ab18-d828-099a5fc7d9b2",
          "citation": "Miao, Xiu-Sheng, et al. \"Identification of the in vitro metabolites of 3, 4-dihydro-2, 2-dimethyl-2H-naphthol [1, 2-b] pyran-5, 6-dione (ARQ 501; β-lapachone) in whole blood.\" Drug metabolism and disposition 36.4 (2008): 641-648.",
          "url": "http://dmd.aspetjournals.org/content/dmd/36/4/641.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e5b3a78b-8116-4f66-a518-e528cff66d59",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "048d1a7f-8e49-4172-aa0a-d018362c8076",
          "citation": "Miao, Xiu-Sheng, et al. \"Identification of the in vitro metabolites of 3, 4-dihydro-2, 2-dimethyl-2H-naphthol [1, 2-b] pyran-5, 6-dione (ARQ 501; β-lapachone) in whole blood.\" Drug metabolism and disposition 36.4 (2008): 641-648.",
          "url": "http://dmd.aspetjournals.org/content/dmd/36/4/641.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5611535b-b4fa-40a1-860b-964ffa0b02bf",
          "citation": "Miao, Xiu-Sheng, et al. \"Identification of the in vitro metabolites of 3, 4-dihydro-2, 2-dimethyl-2H-naphthol [1, 2-b] pyran-5, 6-dione (ARQ 501; β-lapachone) in whole blood.\" Drug metabolism and disposition 36.4 (2008): 641-648.",
          "url": "http://dmd.aspetjournals.org/content/dmd/36/4/641.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31b44112-dd61-4d9f-b4ad-136729a46683",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "5b2e40ad-1f78-4fda-b4d5-250175a3b097",
          "citation": "https://www.verywellhealth.com/what-is-pau-darco-89494",
          "url": "https://www.verywellhealth.com/what-is-pau-darco-89494",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "3e87465b-351e-d63f-da53-3529e66f5cab",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0129047d-15c2-39c8-7a46-80ea5c99fa59",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c86ebbe1-93cb-4fd0-8d8f-17f992a1c057",
          "id": "c86ebbe1-93cb-4fd0-8d8f-17f992a1c057",
          "molfile": "\n  Marvin  01132110212D          \n\n 18 20  0  0  0  0            999 V2000\n    3.6700   -4.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2569   -3.9020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8379   -4.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9771   -3.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9866   -2.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2743   -2.2509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5541   -2.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5463   -3.4801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8383   -2.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1278   -2.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4147   -2.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4158   -1.4214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1260   -1.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8395   -1.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5558   -1.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5494   -0.1746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2755   -1.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9833   -1.0017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  8  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6 17  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 15  1  0  0  0  0\n 17 18  2  0  0  0  0\nM  END",
          "smiles": "CC1(C)CCC2=C(c3ccccc3C(=O)C2=O)O1",
          "formula": "C15H14O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fffc2b07-759f-4a1d-8b33-3bd5a70d9302"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "242.2704",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e4f263ee-c692-4140-ad9e-6e8fda2ec4ac",
      "version": "26",
      "structure": {
        "id": "1b712343-b274-48b0-8c70-42bec104e4a1",
        "molfile": "\n  Marvin  01132101362D          \n\n 18 20  0  0  0  0            999 V2000\n    1.4158   -1.4214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4147   -2.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1278   -2.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1260   -1.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8395   -1.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8383   -2.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2755   -1.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5558   -1.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5494   -0.1746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9833   -1.0017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2743   -2.2509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5541   -2.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5463   -3.4801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2569   -3.9020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9771   -3.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9866   -2.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6700   -4.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8379   -4.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  7  8  1  0  0  0  0\n  5  4  2  0  0  0  0\n  8  9  2  0  0  0  0\n  4  1  1  0  0  0  0\n  7 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n  5  6  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  6  2  0  0  0  0\n  1  2  2  0  0  0  0\n  5  8  1  0  0  0  0\n 11 16  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  6 12  1  0  0  0  0\n 14 17  1  0  0  0  0\n 11  7  1  0  0  0  0\n 14 18  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)CCC2=C(c3ccccc3C(=O)C2=O)O1",
        "formula": "C15H14O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "242.2704",
        "optical_activity": "NONE",
        "references": [
          "0b6e0b64-713f-40bf-a20d-e289ed6a5420",
          "eea48b3c-e1b0-419d-b735-11e3fe62bc5e"
        ],
        "stereo_centers": 0
      },
      "unii": "6N4FA2QQ6A",
      "relationships": [
        {
          "uuid": "5bd35b19-2d58-4959-ba44-ff338ed43e3e",
          "amount": {
            "uuid": "5ba3996e-ee71-45d2-9636-6749c526c245"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a621d688-ed69-417e-ae38-857764e7000b",
            "refuuid": "e4f263ee-c692-4140-ad9e-6e8fda2ec4ac",
            "name": "LAPACHONE",
            "unii": "6N4FA2QQ6A",
            "linking_id": "6N4FA2QQ6A",
            "ref_pname": "LAPACHONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1846a157-8307-4633-befd-7a528c004211",
          "amount": {
            "uuid": "1246a6d1-65e3-4039-b8e7-ee098caeaa30"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "048d1a7f-8e49-4172-aa0a-d018362c8076"
          ],
          "related_substance": {
            "uuid": "42164ca7-94a2-4836-94db-672350c386c7",
            "refuuid": "13ebddcb-1a9f-4fd6-936c-6403507a9f39",
            "name": "2-(5-FORMYL-2,2-DIMETHYL-3,4-DIHYDRO-2H-PYRAN-6-YL)BENZOIC ACID",
            "unii": "JT2PE9HCP8",
            "linking_id": "JT2PE9HCP8",
            "ref_pname": "2-(5-FORMYL-2,2-DIMETHYL-3,4-DIHYDRO-2H-PYRAN-6-YL)BENZOIC ACID"
          }
        },
        {
          "uuid": "5fe25817-68ad-4673-a815-6f56a68884f4",
          "amount": {
            "uuid": "cc8c69b1-86a6-400c-b384-27169158a9ce"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "5611535b-b4fa-40a1-860b-964ffa0b02bf"
          ],
          "related_substance": {
            "uuid": "68c65f84-717b-4fe7-bbad-14c3fcc01cfc",
            "refuuid": "440a5537-9993-406b-b502-f0f1e20ab5eb",
            "name": "6-(2-Carboxyphenyl)-3,4-dihydro-2,2-dimethyl-2H-pyran-5-carboxylic acid",
            "unii": "Q52LC8LNT3",
            "linking_id": "Q52LC8LNT3",
            "ref_pname": "6-(2-Carboxyphenyl)-3,4-dihydro-2,2-dimethyl-2H-pyran-5-carboxylic acid"
          }
        },
        {
          "uuid": "96c72a35-af76-4322-8fae-041806cde1d2",
          "amount": {
            "uuid": "c8df9a6c-42aa-48e0-a94e-ecbcd389acf3"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "d84c49a9-47ac-4721-9e0b-53aecba6d67e"
          ],
          "related_substance": {
            "uuid": "ead2c139-01ab-4cb5-9ff7-24737f7651e1",
            "refuuid": "35775b08-4ac7-4b57-86d3-b4b3c576e897",
            "name": "2,2-DIMETHYL-3,4-DIHYDRO-2H,5H-PYRANO(3,2-C)CHROMEN-5-ONE",
            "unii": "SXO757LF40",
            "linking_id": "SXO757LF40",
            "ref_pname": "2,2-DIMETHYL-3,4-DIHYDRO-2H,5H-PYRANO(3,2-C)CHROMEN-5-ONE"
          }
        },
        {
          "uuid": "624b48a6-6330-45cf-9004-52edaf609d47",
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "7e635f93-e698-402c-a8c7-37ddbb72d1e9"
          ],
          "related_substance": {
            "uuid": "17a9d6a0-eb16-48ae-beaa-76eb130f57e6",
            "refuuid": "72117af8-c4a4-488f-bd0b-26f978d95830",
            "name": "2,2-DIMETHYL-3,4-DIHYDRO-2H-INDENO(1,2-B)PYRAN-5 ONE",
            "unii": "BVU5PQ5R6M",
            "linking_id": "BVU5PQ5R6M",
            "ref_pname": "2,2-DIMETHYL-3,4-DIHYDRO-2H-INDENO(1,2-B)PYRAN-5 ONE"
          }
        },
        {
          "uuid": "0cf119e8-0450-4875-a479-5611a60a69fc",
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "4fedb130-5851-43e9-ad50-85d46ddabad0"
          ],
          "related_substance": {
            "uuid": "afd11918-02b2-4f47-bd91-f1e06d8aba9e",
            "refuuid": "028df8c9-6f06-4fb1-b115-2d93f6cd1568",
            "name": "2,2-DIMETHYL-3,4-DIHYDROPYRANO(3,2-C)ISOCHROMEN-6(2H)-ONE",
            "unii": "W26Y36C65Y",
            "linking_id": "W26Y36C65Y",
            "ref_pname": "2,2-DIMETHYL-3,4-DIHYDROPYRANO(3,2-C)ISOCHROMEN-6(2H)-ONE"
          }
        },
        {
          "uuid": "a798ddd0-06ff-4054-a289-e2f927bf33c3",
          "amount": {
            "uuid": "b32ab454-e5f9-4540-bda4-d0e39f60693f"
          },
          "type": "PARENT->ACTIVE CONSTITUENT ALWAYS PRESENT",
          "references": [
            "5b2e40ad-1f78-4fda-b4d5-250175a3b097"
          ],
          "related_substance": {
            "uuid": "92e34d4d-8ade-4c2e-8461-5a01bdd5ac83",
            "refuuid": "ffa524d1-4af1-4af5-8aeb-68b56d6423fd",
            "name": "HANDROANTHUS IMPETIGINOSUS BARK",
            "unii": "6GLA1946WX",
            "linking_id": "6GLA1946WX",
            "ref_pname": "HANDROANTHUS IMPETIGINOSUS BARK",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "9eab35ae-f8aa-4ad3-b8d0-75a818b54727",
          "name": ".BETA.-LAPACHONE",
          "stdName": ".BETA.-LAPACHONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5073448f-5668-448e-ad48-077254cf276a",
            "0b6e0b64-713f-40bf-a20d-e289ed6a5420"
          ],
          "display_name": false
        },
        {
          "uuid": "f62eb1a7-5baa-447f-bbae-d15ddd9672f1",
          "name": "2H-NAPHTHO(1,2-B)PYRAN-5,6-DIONE, 3,4-DIHYDRO-2,2-DIMETHYL-",
          "stdName": "2H-NAPHTHO(1,2-B)PYRAN-5,6-DIONE, 3,4-DIHYDRO-2,2-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5073448f-5668-448e-ad48-077254cf276a",
            "0b6e0b64-713f-40bf-a20d-e289ed6a5420"
          ],
          "display_name": false
        },
        {
          "uuid": "84b01ba5-62d7-46eb-84b8-6ac8cf6541e5",
          "name": "3,4-DIHYDRO-2,2-DIMETHYL-2H-NAPHTHO(1,2-B)PYRAN-5,6-DIONE",
          "stdName": "3,4-DIHYDRO-2,2-DIMETHYL-2H-NAPHTHO(1,2-B)PYRAN-5,6-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "184471d3-3f3d-41b4-8a8e-fe4170e32f58"
          ],
          "display_name": false
        },
        {
          "uuid": "139b3b02-48bc-4140-a96d-b3d497577bfa",
          "name": "ARQ-501",
          "stdName": "ARQ-501",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1621dd0b-d49f-49ee-9e94-329c01177976",
            "5073448f-5668-448e-ad48-077254cf276a"
          ],
          "display_name": false
        },
        {
          "uuid": "111bd23a-67e7-4141-ab37-ced3aed7ef94",
          "name": "BETA-LAP-WJ",
          "stdName": "BETA-LAP-WJ",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5073448f-5668-448e-ad48-077254cf276a",
            "505fe856-dc36-43ff-bc16-d5b69d444fc9"
          ],
          "display_name": false
        },
        {
          "uuid": "e3db4344-f01c-0e90-c7a6-d7e86f30a304",
          "name": "Beta lapachone [WHO-DD]",
          "stdName": "BETA LAPACHONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31b44112-dd61-4d9f-b4ad-136729a46683"
          ],
          "display_name": false
        },
        {
          "uuid": "c881d6dc-1b8f-478a-ab40-f19dddc7b527",
          "name": "LAPACHONE",
          "stdName": "LAPACHONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da9c41f0-2d94-472d-bcb0-9d7a2d6d24a1",
            "5073448f-5668-448e-ad48-077254cf276a",
            "505fe856-dc36-43ff-bc16-d5b69d444fc9"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "13690ed0-cf5f-4c9d-9a0e-61875f295d97",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ffbfc1bb-547f-44d1-a76a-0a38c5748002",
          "name": "MB-12066",
          "stdName": "MB-12066",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5073448f-5668-448e-ad48-077254cf276a",
            "0e524d83-2a98-453c-b131-679b342303ca"
          ],
          "display_name": false
        },
        {
          "uuid": "32582806-26a4-4e2e-bec2-dd9892c282c2",
          "name": "NSC-26326",
          "stdName": "NSC-26326",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5073448f-5668-448e-ad48-077254cf276a",
            "0b6e0b64-713f-40bf-a20d-e289ed6a5420"
          ],
          "display_name": false
        },
        {
          "uuid": "adf28077-e80d-4ed6-981a-64398da8c184",
          "name": "NSC-629749",
          "stdName": "NSC-629749",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5073448f-5668-448e-ad48-077254cf276a",
            "0b6e0b64-713f-40bf-a20d-e289ed6a5420"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "168fc5a7-34ca-442c-ac09-4d23cd13b38c"
      }
    }
  ]
}