{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "94cacf55-7ee7-440b-8afa-35016db0f526",
          "code": "87-10-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87-10-5",
          "code_system": "CAS",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca",
            "d94eb3e4-5f50-41ca-bf54-f1b97a4ecac2"
          ]
        },
        {
          "uuid": "f15d4c64-bded-4f33-9dfd-1af2fde61e4a",
          "code": "C47768",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47768",
          "code_system": "NCI_THESAURUS",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "55820b75-5607-410e-b656-c14a3cb6923b",
          "code": "C004361",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67004361",
          "code_system": "MESH",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "f04b3500-c178-4550-9f48-0997bca0a509",
          "code": "21 CFR 700.15",
          "comments": "PART 700 ? GENERAL|Subpart B--Requirements for Specific Cosmetic Products|Sec. 700.15 Use of certain halogenated salicylanilides as ingredients in cosmetic products.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=700.15",
          "code_system": "CFR",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "305b856d-31bb-4cbc-ba6d-6b81e5aa21ca",
          "code": "21 CFR 310.502",
          "comments": "PART 310 -- NEW DRUGS|Subpart E--Requirements for Specific New Drugs or Devices|Sec. 310.502 Certain drugs accorded new drug status through rulemaking procedures.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=310.502",
          "code_system": "CFR",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "525fc8b8-825c-467a-9839-e3898306c949",
          "code": "SUB11261MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "5ba31643-07c0-4eca-8721-30a4bc866db3",
          "code": "77404",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:666",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "870c1d2a-fbea-4a46-b9bd-4ed8e9e710cc",
          "code": "1623",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1623",
          "code_system": "INN",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "9d67df6a-3be0-4233-9356-8a9a31a259e9",
          "code": "201-723-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.567",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "67d8e953-cb4c-4d2f-af96-b96589e67649",
          "code": "m11048",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11048?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "f21535d5-9aa1-468b-a9f9-199f76f54858",
          "code": "CHEMBL24944",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL24944",
          "code_system": "ChEMBL",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "83a8ba62-541c-42c8-864e-dc29659ce629",
          "code": "14868",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14868",
          "code_system": "PUBCHEM",
          "references": [
            "be8468a4-291a-4c58-bfe1-b59e2e3a7eca"
          ]
        },
        {
          "uuid": "459e98db-3404-3821-15ca-1955921f307f",
          "code": "DTXSID4026181",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4026181",
          "code_system": "EPA CompTox",
          "references": [
            "d84e1937-0bd9-bfa8-39a6-2e3de062c8eb"
          ]
        },
        {
          "uuid": "7a8bf3c5-05fa-eff9-fd01-fae32c77abee",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "790cd269-6efe-c389-3199-bb27f057855c"
          ]
        },
        {
          "uuid": "865e3446-fd5d-4627-a469-4d559f273751",
          "code": "6MCE3VTF0O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a3eec7eb-21ef-8cb1-1156-96218c59e36b",
          "code": "127105",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:127105",
          "code_system": "CHEBI",
          "references": [
            "790cd269-6efe-c389-3199-bb27f057855c"
          ]
        },
        {
          "uuid": "bc0dfb28-db4b-838e-c4f0-4956d9088d05",
          "code": "100000077533",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "784115e9-ac6c-8d76-f5bc-137423d11970"
          ]
        },
        {
          "uuid": "98dd9dc1-550f-7ed9-9ba4-599a81cd07a9",
          "code": "20526",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=20526",
          "code_system": "NSC",
          "references": [
            "748464e8-57bf-8436-b40a-e3398643d4fb"
          ]
        },
        {
          "uuid": "4ad09d67-9887-c277-a729-8b96812c22c7",
          "code": "21 CFR 216.24",
          "comments": "PART 216 -- HUMAN DRUG COMPOUNDING|Subpart B--Compounded Drug Products|Sec. 216.24 Drug products withdrawn or removed from the market for reasons of safety or effectiveness.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=216.24",
          "code_system": "CFR",
          "references": [
            "e98eae07-c290-f256-01ad-511b48123072"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "620fe5a4-4a0c-4c79-82f0-97da9c01ade9",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "73f780d3-66fe-48bf-83ce-15094950b5c2",
            "refuuid": "25f3a7ec-6ab4-4086-b978-1b8218e9d115",
            "name": "TRIBROMSALAN",
            "unii": "6MCE3VTF0O",
            "linking_id": "6MCE3VTF0O",
            "ref_pname": "TRIBROMSALAN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "49478416-2162-4b81-8914-ed54eca61581",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a4e52fdc-9bec-4f95-95e6-800a0aae324e",
            "refuuid": "4a76518d-2cc0-4af6-9bd7-357f014e145f",
            "name": "TRIBROMSALAN ZINC",
            "unii": "R83418008N",
            "linking_id": "R83418008N",
            "ref_pname": "TRIBROMSALAN ZINC",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "80e8e6f1-8fc7-4320-a189-20c4bba9595d",
          "name": "3,4',5-TRIBROMOSALICYLANILIDE",
          "stdName": "3,4',5-TRIBROMOSALICYLANILIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "686287d0-8e5a-4642-97ea-882273835628"
          ],
          "display_name": false
        },
        {
          "uuid": "5cc58ce4-9e26-4699-9474-4cdd8b2c02e4",
          "name": "BENZAMIDE, 3,5-DIBROMO-N-(4-BROMOPHENYL)-2-HYDROXY-",
          "stdName": "BENZAMIDE, 3,5-DIBROMO-N-(4-BROMOPHENYL)-2-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "686287d0-8e5a-4642-97ea-882273835628",
            "be28294b-0dd7-45bf-9c9c-79e85e3f31cb"
          ],
          "display_name": false
        },
        {
          "uuid": "d912cfba-7ea8-4f8a-9dd8-c5f4b45238a6",
          "name": "ET-394",
          "stdName": "ET-394",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0779ea58-3877-4c49-ab57-1cff12c3732b",
            "be28294b-0dd7-45bf-9c9c-79e85e3f31cb"
          ],
          "display_name": false
        },
        {
          "uuid": "638f7810-7d36-4055-b965-91b60716d453",
          "name": "NSC-20526",
          "stdName": "NSC-20526",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6e8acb6-8f74-4d90-8bda-06bd40fd295a",
            "686287d0-8e5a-4642-97ea-882273835628"
          ],
          "display_name": false
        },
        {
          "uuid": "f7c939fe-b3eb-46f8-87d7-8203e9fa6925",
          "name": "TEMASEPT IV",
          "stdName": "TEMASEPT IV",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d67308c1-36e1-49d3-b2ca-15ac1619162c",
            "be28294b-0dd7-45bf-9c9c-79e85e3f31cb"
          ],
          "display_name": false
        },
        {
          "uuid": "036b5997-bf9e-4023-ba74-301c9ade3481",
          "name": "TRIBROMSALAN",
          "stdName": "TRIBROMSALAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7aaadac-5a30-495f-bcd8-4cf6e0e3cdb0",
            "510e4e0a-3fda-482b-8240-892cf6694134",
            "187ed5cc-8973-407e-8388-d0d4ef4889c6",
            "35db83f3-e68d-4052-a492-f920dae9a7ba",
            "95b64361-024d-4992-9123-52ce9c41d9c4",
            "be28294b-0dd7-45bf-9c9c-79e85e3f31cb",
            "6d837cc0-6d7e-4bdb-9213-60c667f66655",
            "2f3a787d-7788-47e5-a419-72b14b4e1296",
            "0dcdb319-7ccc-47a4-b365-661ed22f776b",
            "62d0fbc2-f54d-4144-83ac-369dd30236aa",
            "827a91c7-81e7-443e-84b0-49bf13577b38",
            "11530568-c35e-46ba-84ff-b600af63e7c2"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e71f38ca-3f24-42bb-bdf7-e1c02cbcbb77",
              "name_org": "INN"
            },
            {
              "uuid": "50500ed6-b81c-4bcc-8b0d-79022aea4da4",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "68145a49-e31d-4eee-bcb1-37f4c6773778",
          "name": "TRIBROMSALAN [MART.]",
          "stdName": "TRIBROMSALAN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95b64361-024d-4992-9123-52ce9c41d9c4"
          ],
          "display_name": false
        },
        {
          "uuid": "0d1b30ce-3452-4b90-8dd2-bcfca2bb0ff6",
          "name": "TRIBROMSALAN [MI]",
          "stdName": "TRIBROMSALAN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "510e4e0a-3fda-482b-8240-892cf6694134",
            "be28294b-0dd7-45bf-9c9c-79e85e3f31cb"
          ],
          "display_name": false
        },
        {
          "uuid": "b87a077d-b15c-4c15-9631-34d2e6f65e79",
          "name": "TRIBROMSALAN [USAN]",
          "stdName": "TRIBROMSALAN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62d0fbc2-f54d-4144-83ac-369dd30236aa"
          ],
          "display_name": false
        },
        {
          "uuid": "216c171b-cb26-497d-ad9a-e2a408f55a6f",
          "name": "TUASOL 100",
          "stdName": "TUASOL 100",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5696f10c-f360-44d9-b3af-c5dba8e8967f",
            "058a126e-7f92-4a5e-a0e7-fee4f55c8d43"
          ],
          "display_name": false
        },
        {
          "uuid": "56d83079-70ca-81d7-5d46-7d84cf2c1645",
          "name": "Tribromsalan [WHO-DD]",
          "stdName": "TRIBROMSALAN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c8efcc3-925d-a40c-1265-929135bfaaef"
          ],
          "display_name": false
        },
        {
          "uuid": "f268a809-4135-422a-a915-3dae3002fb95",
          "name": "WR-34912",
          "stdName": "WR-34912",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "686287d0-8e5a-4642-97ea-882273835628",
            "be28294b-0dd7-45bf-9c9c-79e85e3f31cb"
          ],
          "display_name": false
        },
        {
          "uuid": "9f8ab5ea-b1b9-4121-9054-10a0299e70f3",
          "name": "tribromsalan [INN]",
          "stdName": "TRIBROMSALAN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d837cc0-6d7e-4bdb-9213-60c667f66655"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "686287d0-8e5a-4642-97ea-882273835628",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c7aaadac-5a30-495f-bcd8-4cf6e0e3cdb0",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6e8acb6-8f74-4d90-8bda-06bd40fd295a",
          "citation": "NDA 13497,12760",
          "doc_type": "SPIDCAT",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d837cc0-6d7e-4bdb-9213-60c667f66655",
          "citation": "INN Proposed List 14",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL14.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "62d0fbc2-f54d-4144-83ac-369dd30236aa",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95b64361-024d-4992-9123-52ce9c41d9c4",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "510e4e0a-3fda-482b-8240-892cf6694134",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be28294b-0dd7-45bf-9c9c-79e85e3f31cb",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5696f10c-f360-44d9-b3af-c5dba8e8967f",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "058a126e-7f92-4a5e-a0e7-fee4f55c8d43",
          "citation": "D06218",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11530568-c35e-46ba-84ff-b600af63e7c2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0779ea58-3877-4c49-ab57-1cff12c3732b",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d67308c1-36e1-49d3-b2ca-15ac1619162c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be8468a4-291a-4c58-bfe1-b59e2e3a7eca",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87f87771-3b1e-481d-9595-5cd2f387d2de",
          "citation": "SRS import [6MCE3VTF0O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6MCE3VTF0O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf0eb49a-f424-472b-a6f0-4f7957f49791",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "827a91c7-81e7-443e-84b0-49bf13577b38",
          "citation": "TRIBROMSALAN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "187ed5cc-8973-407e-8388-d0d4ef4889c6",
          "citation": "TRIBROMSALAN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2f3a787d-7788-47e5-a419-72b14b4e1296",
          "citation": "TRIBROMSALAN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "35db83f3-e68d-4052-a492-f920dae9a7ba",
          "citation": "TRIBROMSALAN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0dcdb319-7ccc-47a4-b365-661ed22f776b",
          "citation": "TRIBROMSALAN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d84e1937-0bd9-bfa8-39a6-2e3de062c8eb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=87-10-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "784115e9-ac6c-8d76-f5bc-137423d11970",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "790cd269-6efe-c389-3199-bb27f057855c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d94eb3e4-5f50-41ca-bf54-f1b97a4ecac2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "748464e8-57bf-8436-b40a-e3398643d4fb",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6c8efcc3-925d-a40c-1265-929135bfaaef",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e98eae07-c290-f256-01ad-511b48123072",
          "citation": "21 CFR 216.24",
          "doc_type": "CFR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8df048d4-1d67-4754-82e7-6778d53487b7",
          "id": "8df048d4-1d67-4754-82e7-6778d53487b7",
          "molfile": "\n  Marvin  01132107222D          \n\n 19 20  0  0  0  0            999 V2000\n    1.4301   -0.4371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -1.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7241   -1.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2594    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7241   -2.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4378   -2.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -3.7342    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1438   -2.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1438   -1.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8730   -1.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8653   -0.4371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5790   -1.6551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2901   -1.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2901   -0.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9987   -0.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7176   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4313    0.0000    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7254   -1.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0116   -1.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  9  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 19 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1Br)NC(=O)c2cc(cc(c2O)Br)Br",
          "formula": "C13H8Br3NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "abac88e7-dbe5-456b-a68e-11e087267834"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "449.9192",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "25f3a7ec-6ab4-4086-b978-1b8218e9d115",
      "version": "12",
      "structure": {
        "id": "e35b1a46-3707-4e24-a98d-16fa210c9bae",
        "molfile": "\n  Marvin  01132111462D          \n\n 19 20  0  0  0  0            999 V2000\n    2.1438   -1.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8730   -1.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -1.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7241   -1.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5790   -1.6551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7241   -2.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1438   -2.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4378   -2.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8653   -0.4371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2901   -1.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2594    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -0.4371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7176   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4301   -3.7342    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    6.4313    0.0000    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.0116   -1.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2901   -0.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9987   -0.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7254   -1.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  8  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  2  2  0  0  0  0\n 10  5  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13 18  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 10  2  0  0  0  0\n 17 10  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 16  1  0  0  0  0\n  6  4  2  0  0  0  0\n 19 13  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1Br)NC(=O)c2cc(cc(c2O)Br)Br",
        "formula": "C13H8Br3NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "449.9192",
        "optical_activity": "NONE",
        "references": [
          "bf0eb49a-f424-472b-a6f0-4f7957f49791",
          "87f87771-3b1e-481d-9595-5cd2f387d2de",
          "6d837cc0-6d7e-4bdb-9213-60c667f66655"
        ],
        "stereo_centers": 0
      },
      "unii": "6MCE3VTF0O"
    }
  ]
}