{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7feb713d-5af3-43da-9a45-5c68ebfdcfea", "code": "207122-16-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=207122-16-5", "code_system": "CAS", "references": [ "f9346cf1-803f-4ae1-a16f-bd3679895b28", "bc2845f7-545d-49ee-bd6a-5ac5608c38aa" ] }, { "uuid": "b1fcbc7f-c4ac-4e93-89ee-453ce31d4b5c", "code": "15509899", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15509899", "code_system": "PUBCHEM", "references": [ "f9346cf1-803f-4ae1-a16f-bd3679895b28" ] }, { "uuid": "b1580ad5-c2dc-8fd1-ccdf-544b60fc79c9", "code": "DTXSID8052693", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8052693", "code_system": "EPA CompTox", "references": [ "ae3be05d-23f9-af17-84e8-d4b690f1f026" ] }, { "uuid": "5bfefba5-fcee-417f-bcb5-b0938cee33f3", "code": "6M82N9DXAI", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "a41f55e8-a46c-4758-9d68-4f613e8501e0", "name": "2,2',3,4,4',5',6-HEPTABROMODIPHENYL ETHER", "stdName": "2,2',3,4,4',5',6-HEPTABROMODIPHENYL ETHER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "92990243-0be9-4e1e-9b9c-b79df2560368", "991d6628-6222-451b-bf1b-37221242e001" ], "display_name": true }, { "uuid": "69af229d-b8f6-4501-af71-e1d9592b7f57", "name": "BENZENE, 1,2,3,5-TETRABROMO-4-(2,4,5-TRIBROMOPHENOXY)-", "stdName": "BENZENE, 1,2,3,5-TETRABROMO-4-(2,4,5-TRIBROMOPHENOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "92990243-0be9-4e1e-9b9c-b79df2560368", "991d6628-6222-451b-bf1b-37221242e001" ], "display_name": false }, { "uuid": "75b6214c-fb21-458b-bf21-a0bda98bb2e3", "name": "PBDE 183", "stdName": "PBDE 183", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "92990243-0be9-4e1e-9b9c-b79df2560368", "991d6628-6222-451b-bf1b-37221242e001" ], "display_name": false } ], "references": [ { "uuid": "991d6628-6222-451b-bf1b-37221242e001", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "92990243-0be9-4e1e-9b9c-b79df2560368", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f9346cf1-803f-4ae1-a16f-bd3679895b28", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391425000, "tags": [ "NOMEN" ] }, { "uuid": "ff270fd4-52f3-4eaa-a2b1-67d318111d9e", "citation": "SRS import [6M82N9DXAI]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6M82N9DXAI", "doc_type": "SRS", "public_domain": true, "document_date": 1493391425000, "tags": [ "NOMEN" ] }, { "uuid": "68ffc439-e789-4650-a653-ac94a6fbd70e", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ae3be05d-23f9-af17-84e8-d4b690f1f026", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=207122-16-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bc2845f7-545d-49ee-bd6a-5ac5608c38aa", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9118490b-8704-40a6-80dd-10a3996fe869", "id": "9118490b-8704-40a6-80dd-10a3996fe869", "molfile": "\n Marvin 01132107312D \n\n 20 21 0 0 0 0 999 V2000\n -2.8579 -0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 1.6500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 1.6500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 -1.6500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 19 2 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 18 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 16 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 9 2 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 1 0 0 0 0\n 16 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "c1c(c(cc(c1Br)Oc2c(cc(c(c2Br)Br)Br)Br)Br)Br", "formula": "C12H3Br7O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f03eecba-0ddc-41d6-a310-dca1f7e340b7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "722.4768", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "96c6d624-750b-4882-99d4-b18582661711", "version": "3", "structure": { "id": "00592e83-7c48-4f3c-96f6-b50294dc90ad", "molfile": "\n Marvin 01132100202D \n\n 20 21 0 0 0 0 999 V2000\n 0.0000 0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 -1.6500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 -0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 1.6500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 1.6500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 2 7 2 0 0 0 0\n 1 2 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 8 13 2 0 0 0 0\n 1 8 1 0 0 0 0\n 7 14 1 0 0 0 0\n 12 15 1 0 0 0 0\n 11 16 1 0 0 0 0\n 5 17 1 0 0 0 0\n 4 18 1 0 0 0 0\n 9 19 1 0 0 0 0\n 3 20 1 0 0 0 0\nM END", "smiles": "c1c(c(cc(c1Br)Oc2c(cc(c(c2Br)Br)Br)Br)Br)Br", "formula": "C12H3Br7O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "722.4768", "optical_activity": "NONE", "references": [ "ff270fd4-52f3-4eaa-a2b1-67d318111d9e", "68ffc439-e789-4650-a653-ac94a6fbd70e" ], "stereo_centers": 0 }, "unii": "6M82N9DXAI" } ] }