{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7b3ba815-3b28-48fa-bd70-80f6cf9f356f",
          "code": "7575-23-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7575-23-7",
          "code_system": "CAS",
          "references": [
            "6960ce42-1569-4be2-9778-e3c7b0a4d460",
            "bdae8062-154b-47ab-8aca-e6f6be1094ad"
          ]
        },
        {
          "uuid": "ad1be1e1-7484-4838-b7d3-101129a0435b",
          "code": "231-472-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.612",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6960ce42-1569-4be2-9778-e3c7b0a4d460"
          ]
        },
        {
          "uuid": "c2e4e2e9-d636-41fe-a642-9eef810d5a4a",
          "code": "82056",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82056",
          "code_system": "PUBCHEM",
          "references": [
            "6960ce42-1569-4be2-9778-e3c7b0a4d460"
          ]
        },
        {
          "uuid": "241ee679-50e4-3ff2-11d4-fb3809a81d96",
          "code": "DTXSID1044728",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1044728",
          "code_system": "EPA CompTox",
          "references": [
            "82066110-8e01-3543-fc31-a45de152b17c"
          ]
        },
        {
          "uuid": "9a3dec5c-d082-4aac-b926-46dba97571b4",
          "code": "6M5413VH6N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f6677078-bc07-8b19-9efa-ad3fc57cc252",
          "code": "134760",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:134760",
          "code_system": "CHEBI",
          "references": [
            "51ae8d19-6106-8014-bf2a-469583fa85a2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5bb61628-34b1-44ee-ba84-5fb5ee53ae17",
          "name": "3-((3-SULFANYLPROPANOYL)OXY)-2,2-BIS(((3-SULFANYLPROPANOYL)OXY)METHYL)PROPYL 3-SULFANYLPROPANOATE",
          "stdName": "3-((3-SULFANYLPROPANOYL)OXY)-2,2-BIS(((3-SULFANYLPROPANOYL)OXY)METHYL)PROPYL 3-SULFANYLPROPANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9bc96c8-0607-4a02-8b25-0e9e76f25416",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        },
        {
          "uuid": "f0adcffe-ce88-4dea-9ee1-b057e8c539d6",
          "name": "EH-316",
          "stdName": "EH-316",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        },
        {
          "uuid": "7547b09c-bb3e-4711-a326-fc9a2cef91d9",
          "name": "EH-317",
          "stdName": "EH-317",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        },
        {
          "uuid": "bc004aae-69ba-47c4-9d6d-00dc253daf9c",
          "name": "PEMP",
          "stdName": "PEMP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        },
        {
          "uuid": "92b9da07-83a7-4101-9a45-e1ee27d6a03a",
          "name": "PENTAERYTHRITYL TETRAKIS(3-MERCAPTOPROPIONATE)",
          "stdName": "PENTAERYTHRITYL TETRAKIS(3-MERCAPTOPROPIONATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a"
          ],
          "display_name": true
        },
        {
          "uuid": "61f89318-6027-493b-b58c-f091bdebd92e",
          "name": "PETMP",
          "stdName": "PETMP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        },
        {
          "uuid": "6d170f45-8668-4ee2-951a-5ec02338b9ea",
          "name": "PETP",
          "stdName": "PETP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        },
        {
          "uuid": "ce72172b-56e5-4778-8641-154a5fcab6d8",
          "name": "POS-405",
          "stdName": "POS-405",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        },
        {
          "uuid": "6fc6c42c-8677-473a-b956-32c92d8d544b",
          "name": "PROPANOIC ACID, 3-MERCAPTO-, 1,1'-(2,2-BIS((3-MERCAPTO-1-OXOPROPOXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "stdName": "PROPANOIC ACID, 3-MERCAPTO-, 1,1'-(2,2-BIS((3-MERCAPTO-1-OXOPROPOXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        },
        {
          "uuid": "d4c97760-38d3-49a3-8827-8fe7bb6af8be",
          "name": "PTMP",
          "stdName": "PTMP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        },
        {
          "uuid": "eb394ade-87a0-4572-aa77-bad44808910b",
          "name": "Q-43",
          "stdName": "Q-43",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        },
        {
          "uuid": "79856094-0d3b-4b16-9b6f-454df1c7738a",
          "name": "QX-40",
          "stdName": "QX-40",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
            "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f7ef8bb1-67b6-4b76-81aa-3e52a2564a1a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "35336c1f-84f2-4ee1-9e1f-50e2772fa6b5",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9bc96c8-0607-4a02-8b25-0e9e76f25416",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6960ce42-1569-4be2-9778-e3c7b0a4d460",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391048000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "391731ea-6489-4c36-b37c-0f01eae4aa5f",
          "citation": "SRS import [6M5413VH6N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6M5413VH6N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391048000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af1dce8f-4afe-4471-91a2-9e0da2718aea",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82066110-8e01-3543-fc31-a45de152b17c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7575-23-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "51ae8d19-6106-8014-bf2a-469583fa85a2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "bdae8062-154b-47ab-8aca-e6f6be1094ad",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7cc0c1a1-5716-4b92-b9ac-3fc595c7abe6",
          "id": "7cc0c1a1-5716-4b92-b9ac-3fc595c7abe6",
          "molfile": "\n  Marvin  01132106282D          \n\n 29 28  0  0  0  0            999 V2000\n    2.9543   -5.1013    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6736   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3818   -5.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1010   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1010   -3.8582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8092   -5.1013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5285   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2477   -5.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7163   -5.7307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0048   -6.5110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4763   -7.1398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6624   -6.9965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7602   -7.9201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2317   -8.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5202   -9.3246    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7786   -5.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5954   -5.5829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1263   -6.2143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8439   -6.9880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9386   -6.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4696   -6.6968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2863   -6.5479    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9560   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9560   -3.8545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6642   -3.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3811   -3.8557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6642   -2.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3734   -2.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3734   -1.3800    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 16  1  0  0  0  0\n 23  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 25 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "C(CS)C(=O)OCC(COC(=O)CCS)(COC(=O)CCS)COC(=O)CCS",
          "formula": "C17H28O8S4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6a38108b-4a4e-49ec-ad3d-461aa07c34bf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "488.6644",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "29c54276-f42f-4e5b-942a-3f709a9c12f5",
      "version": "4",
      "structure": {
        "id": "99db4a58-f8a4-4de6-a43b-cacb7f394176",
        "molfile": "\n  Marvin  01132108002D          \n\n 29 28  0  0  0  0            999 V2000\n    9.3811   -3.8557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6642   -3.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9560   -3.8545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9560   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2477   -5.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5285   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8092   -5.1013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1010   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1010   -3.8582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3818   -5.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6736   -4.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9543   -5.1013    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7163   -5.7307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0048   -6.5110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4763   -7.1398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6624   -6.9965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7602   -7.9201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2317   -8.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5202   -9.3246    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7786   -5.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5954   -5.5829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1263   -6.2143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8439   -6.9880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9386   -6.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4696   -6.6968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2863   -6.5479    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6642   -2.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3734   -2.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3734   -1.3800    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  5 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n  5 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n  2 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
        "smiles": "C(CS)C(=O)OCC(COC(=O)CCS)(COC(=O)CCS)COC(=O)CCS",
        "formula": "C17H28O8S4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "488.6644",
        "optical_activity": "NONE",
        "references": [
          "af1dce8f-4afe-4471-91a2-9e0da2718aea",
          "391731ea-6489-4c36-b37c-0f01eae4aa5f"
        ],
        "stereo_centers": 0
      },
      "unii": "6M5413VH6N"
    }
  ]
}