{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9fc2335d-dfde-46d7-892c-a69cbc628bf9", "code": "928007-64-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=928007-64-1", "code_system": "CAS", "references": [ "e529b77c-2337-4a30-9f5b-43d8f72d051f", "b2946367-96ba-4fb0-8816-745cb34d66bc" ] }, { "uuid": "9b6ba1e9-6ad4-491a-b379-42091989aa57", "code": "1733675", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1733675/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "e529b77c-2337-4a30-9f5b-43d8f72d051f" ] }, { "uuid": "91c64fe1-beb2-747b-c5d2-7f534f3efece", "code": "16657387", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16657387", "code_system": "PUBCHEM", "references": [ "845582bb-a1f7-c7d4-4f44-c2b9de42e292" ] }, { "uuid": "edce312e-8c67-4ee0-b99b-2159e55e349c", "code": "6K389LE0MV", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "35ccc7e8-63c0-13df-8cf8-d27af8a22091", "code": "6K389LE0MV", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6K389LE0MV", "code_system": "DAILYMED", "references": [ "dc440153-8401-8bf8-921f-9e4838434055" ] } ], "relationships": [ { "uuid": "d0188957-9d5e-48fb-a39e-aefad521d20d", "type": "SUBSTANCE->SUB_ALTERNATE", "related_substance": { "uuid": "339bd36f-c3fa-48a7-b04d-f1da86c1ab07", "refuuid": "80d19010-7ceb-4db6-8160-f58d48f58e80", "name": "ALTERNATIVE DEFINITION for [ACETYL TETRAPEPTIDE-15]", "linking_id": "80d19010-7ceb-4db6-8160-f58d48f58e80", "ref_pname": "NO NAME" } } ], "substance_class": "chemical", "names": [ { "uuid": "d12cd074-1f89-4314-9946-1d2f9075bec4", "name": "AC-TYR-PRO-PHE-PHE-NH2", "stdName": "AC-TYR-PRO-PHE-PHE-NH2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ed434028-8f2e-477d-a77e-f7d6afd898ad", "77975886-4917-4df2-a969-4dd521c04d33" ], "display_name": false }, { "uuid": "510732b6-da3b-4d2a-94ac-0f08d1ddb39d", "name": "ACETYL TETRAPEPTIDE-15", "stdName": "ACETYL TETRAPEPTIDE-15", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "b6bd9af4-654c-40b0-ae95-54735d204cf9", "77975886-4917-4df2-a969-4dd521c04d33", "6da866e5-27e4-4002-9353-f03bcb6fc5b0" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "b89d55e3-8667-45fb-b3a5-c82d811f7df7", "name_org": "INCI" } ] }, { "uuid": "dceb3330-f77c-4113-8ae6-7402d6dd3f91", "name": "L-PHENYLALANINAMIDE, N-ACETYL-L-TYROSYL-L-PROLYL-L-PHENYLALANYL-", "stdName": "L-PHENYLALANINAMIDE, N-ACETYL-L-TYROSYL-L-PROLYL-L-PHENYLALANYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7241ebe8-7aef-4ea3-aca4-8ced5c1028c8", "77975886-4917-4df2-a969-4dd521c04d33" ], "display_name": false }, { "uuid": "74d6e39f-df47-41ec-aad1-5e451e027226", "name": "SKINASENSYL", "stdName": "SKINASENSYL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "7241ebe8-7aef-4ea3-aca4-8ced5c1028c8", "77975886-4917-4df2-a969-4dd521c04d33" ], "display_name": false } ], "references": [ { "uuid": "6da866e5-27e4-4002-9353-f03bcb6fc5b0", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "77975886-4917-4df2-a969-4dd521c04d33", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ed434028-8f2e-477d-a77e-f7d6afd898ad", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7241ebe8-7aef-4ea3-aca4-8ced5c1028c8", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e529b77c-2337-4a30-9f5b-43d8f72d051f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392872000, "tags": [ "NOMEN" ] }, { "uuid": "cec80a0b-e858-43a2-be0e-c33472cfd0ac", "citation": "SRS import [6K389LE0MV]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6K389LE0MV", "doc_type": "SRS", "public_domain": true, "document_date": 1493392872000, "tags": [ "NOMEN" ] }, { "uuid": "b6bd9af4-654c-40b0-ae95-54735d204cf9", "citation": "ACETYL TETRAPEPTIDE-15 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "845582bb-a1f7-c7d4-4f44-c2b9de42e292", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "b2946367-96ba-4fb0-8816-745cb34d66bc", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "dc440153-8401-8bf8-921f-9e4838434055", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3a4a05ca-1b31-4451-8499-68d8ca1ef086", "id": "3a4a05ca-1b31-4451-8499-68d8ca1ef086", "molfile": "\n Marvin 01132103062D \n\n 45 48 0 0 1 0 999 V2000\n 16.8656 -14.4485 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 17.6503 -14.1935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2634 -14.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0480 -14.4906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6611 -15.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4895 -15.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7049 -16.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0918 -15.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2526 -13.8964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4679 -14.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2964 -14.9583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8548 -13.5994 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 15.0264 -12.7924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8110 -12.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4241 -13.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2088 -12.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3802 -12.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7671 -11.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9826 -11.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0702 -13.8543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4571 -13.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6287 -12.4953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6726 -13.5571 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 12.4176 -14.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5927 -14.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3377 -13.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0051 -13.0722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0051 -12.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7196 -11.8347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2906 -11.8347 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.5762 -12.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8618 -11.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1473 -12.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4329 -11.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4329 -11.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7184 -10.5972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1473 -10.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8618 -11.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2906 -11.0098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0051 -10.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7196 -11.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0051 -9.7723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6941 -15.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3072 -15.8074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9095 -15.5104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 9 1 1 0 0 0\n 1 43 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 8 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 20 1 1 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 19 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 2 0 0 0 0\n 23 21 1 6 0 0 0\n 23 24 1 0 0 0 0\n 23 27 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 30 28 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 39 1 6 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 38 2 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 35 2 0 0 0 0\n 38 37 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 40 42 2 0 0 0 0\n 43 44 1 0 0 0 0\n 43 45 2 0 0 0 0\nM END", "smiles": "CC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](Cc4ccccc4)C(=O)N", "formula": "C34H39N5O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f1ba7d14-b230-4ba4-bd8a-0afb1de038a2" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "613.7047", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "d9af2bb2-536c-4d7e-93ab-0862c6d2f10e", "version": "7", "structure": { "id": "491383a1-c606-4413-8787-0fdf61c96670", "molfile": "\n Marvin 01132103502D \n\n 45 48 0 0 1 0 999 V2000\n 13.4571 -13.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6726 -13.5571 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.4176 -14.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5927 -14.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3377 -13.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0051 -13.0722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0051 -12.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7196 -11.8347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2906 -11.8347 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.2906 -11.0098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0051 -10.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0051 -9.7723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7196 -11.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5762 -12.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8618 -11.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1473 -12.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4329 -11.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4329 -11.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7184 -10.5972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1473 -10.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8618 -11.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6287 -12.4953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0702 -13.8543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8548 -13.5994 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.4679 -14.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2964 -14.9583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2526 -13.8964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8656 -14.4485 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.6941 -15.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9095 -15.5104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3072 -15.8074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6503 -14.1935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2634 -14.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0480 -14.4906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6611 -15.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4895 -15.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7049 -16.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0918 -15.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0264 -12.7924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8110 -12.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4241 -13.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2088 -12.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3802 -12.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7671 -11.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9826 -11.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 6 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 6 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 9 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 18 2 0 0 0 0\n 21 20 1 0 0 0 0\n 15 21 2 0 0 0 0\n 1 22 2 0 0 0 0\n 1 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 1 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 28 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 37 36 2 0 0 0 0\n 38 37 1 0 0 0 0\n 33 38 2 0 0 0 0\n 24 39 1 1 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 42 43 1 0 0 0 0\n 44 43 2 0 0 0 0\n 45 44 1 0 0 0 0\n 40 45 2 0 0 0 0\nM END", "smiles": "CC(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](Cc4ccccc4)C(=O)N", "formula": "C34H39N5O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "613.7047", "optical_activity": "UNSPECIFIED", "references": [ "7241ebe8-7aef-4ea3-aca4-8ced5c1028c8", "cec80a0b-e858-43a2-be0e-c33472cfd0ac" ], "stereo_centers": 4 }, "unii": "6K389LE0MV" } ] }