{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "55963e81-e4d3-4628-a3b6-6249f422f73a",
          "code": "76361-77-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=76361-77-8",
          "code_system": "CAS",
          "references": [
            "a48bd3cf-b956-4f03-b784-7c5094745e57",
            "4a72d02a-075a-44bf-b4e3-066b2c5c4917"
          ]
        },
        {
          "uuid": "5e75f2b8-b9f4-4187-9750-0338d5a1537f",
          "code": "11506817",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11506817",
          "code_system": "PUBCHEM",
          "references": [
            "a48bd3cf-b956-4f03-b784-7c5094745e57"
          ]
        },
        {
          "uuid": "81b1b5bc-a808-4a15-8046-eba1e629c6b0",
          "code": "6K2O4RQ57D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e8be6121-653f-4f24-9eec-7d085356a7f9",
          "name": "(2E,6E,8E)-N-(2-METHYLPROPYL)-2,6,8-DECATRIENAMIDE",
          "stdName": "(2E,6E,8E)-N-(2-METHYLPROPYL)-2,6,8-DECATRIENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5661e66-f546-4df9-81ad-96cdc16a1ef5"
          ],
          "display_name": false
        },
        {
          "uuid": "fbac456b-8087-49c5-ac66-18d025201294",
          "name": "(2E,6E,8E)-N-ISOBUTYL-2,6,8-DECATRIENAMIDE",
          "stdName": "(2E,6E,8E)-N-ISOBUTYL-2,6,8-DECATRIENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6867458-e3fa-4e17-86d4-9f984b7ba3a1"
          ],
          "display_name": false
        },
        {
          "uuid": "cb703a64-6c61-4c67-9a47-ba75da58d48e",
          "name": "2,6,8-DECATRIENAMIDE, N-(2-METHYLPROPYL)-, (2E,6E,8E)-",
          "stdName": "2,6,8-DECATRIENAMIDE, N-(2-METHYLPROPYL)-, (2E,6E,8E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5661e66-f546-4df9-81ad-96cdc16a1ef5"
          ],
          "display_name": false
        },
        {
          "uuid": "1dc63e1a-fbeb-47ae-815a-20b12d2138db",
          "name": "2,6,8-DECATRIENAMIDE, N-(2-METHYLPROPYL)-, (E,E,E)-",
          "stdName": "2,6,8-DECATRIENAMIDE, N-(2-METHYLPROPYL)-, (E,E,E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5661e66-f546-4df9-81ad-96cdc16a1ef5"
          ],
          "display_name": false
        },
        {
          "uuid": "66507d96-a75c-4028-8076-c9493a4c4fcd",
          "name": "ALL-TRANS-SPILANTHOL",
          "stdName": "ALL-TRANS-SPILANTHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6867458-e3fa-4e17-86d4-9f984b7ba3a1"
          ],
          "display_name": false
        },
        {
          "uuid": "be8041c0-a65c-4a59-8c38-a8a7b6985559",
          "name": "N-(2-METHYLPROPYL)-2,6,8-DECATRIENAMIDE, (2E,6E,8E)-",
          "stdName": "N-(2-METHYLPROPYL)-2,6,8-DECATRIENAMIDE, (2E,6E,8E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39a14bb9-7769-4f4d-8833-b3b6c96019bd"
          ],
          "display_name": true
        },
        {
          "uuid": "18859d78-bb25-4748-8104-4440b94375c3",
          "name": "N-ISOBUTYL-2,6,8-DECATRIENAMIDE, (E,E,E)-",
          "stdName": "N-ISOBUTYL-2,6,8-DECATRIENAMIDE, (E,E,E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "624408a4-7fe2-49df-adf9-a67651ea36b2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "624408a4-7fe2-49df-adf9-a67651ea36b2",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "39a14bb9-7769-4f4d-8833-b3b6c96019bd",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5661e66-f546-4df9-81ad-96cdc16a1ef5",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6867458-e3fa-4e17-86d4-9f984b7ba3a1",
          "citation": "http://www.chemspider.com/Chemical-Structure.9681614.html?rid=8d8672fd-7274-4979-b35d-b490df3f48ef",
          "url": "http://www.chemspider.com/Chemical-Structure.9681614.html?rid=8d8672fd-7274-4979-b35d-b490df3f48ef",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a48bd3cf-b956-4f03-b784-7c5094745e57",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392319000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3276d6de-6c64-464f-810c-11a7e9da0eac",
          "citation": "SRS import [6K2O4RQ57D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6K2O4RQ57D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392319000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3a93f12-4c97-43a5-90c1-c148ff5f0aa8",
          "citation": "stb",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a72d02a-075a-44bf-b4e3-066b2c5c4917",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b6a38bbb-ff41-4edd-9f93-f61f09ba18f1",
          "id": "b6a38bbb-ff41-4edd-9f93-f61f09ba18f1",
          "molfile": "\n  Marvin  01132109272D          \n\n 16 15  0  0  0  0            999 V2000\n   -4.6437   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9292    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2148   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5004    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7860   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0716    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3572   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3572    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0716   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7860    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7860    1.0312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5004   -0.2063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2148    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9292   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6437    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9292   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "C/C=C/C=C/CC/C=C/C(=O)NCC(C)C",
          "formula": "C14H23NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0d7320b8-6f22-4b67-a49d-9301a2e6bf62"
          },
          "defined_stereo": 0,
          "ez_centers": 3,
          "molecular_weight": "221.339",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6c4cea73-5598-43d7-8379-fc706605ee84",
      "version": "2",
      "structure": {
        "id": "759e4304-2934-437e-a62f-fe978e969519",
        "molfile": "\n  Marvin  01132106062D          \n\n 16 15  0  0  0  0            999 V2000\n    1.7860    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0716   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3572    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3572   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0716    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7860   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5004    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2148   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9292    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6437   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7860    1.0312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5004   -0.2063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2148    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9292   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6437    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9292   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  1 11  2  0  0  0  0\n  1 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 12 13  1  0  0  0  0\nM  END",
        "smiles": "C/C=C/C=C/CC/C=C/C(=O)NCC(C)C",
        "formula": "C14H23NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 3,
        "molecular_weight": "221.339",
        "optical_activity": "NONE",
        "references": [
          "3276d6de-6c64-464f-810c-11a7e9da0eac",
          "a3a93f12-4c97-43a5-90c1-c148ff5f0aa8"
        ],
        "stereo_centers": 0
      },
      "unii": "6K2O4RQ57D"
    }
  ]
}