{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7f62147d-8be0-4d44-9eef-1d36990ddd48",
          "code": "QD01AC90",
          "comments": "VATC|ANTIFUNGALS FOR DERMATOLOGICAL USE|ANTIFUNGALS FOR TOPICAL USE|Imidazole and triazole derivatives|enilconazole",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD01AC90&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "3d2552f6-ca8b-4f26-8494-c0613f385902",
          "code": "35554-44-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=35554-44-0",
          "code_system": "CAS",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59",
            "43cb03b3-3584-4467-9363-e451ab05f103"
          ]
        },
        {
          "uuid": "c44cd492-1e03-4676-aead-3923106ecd50",
          "code": "C81505",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "39d55ed2-cf8e-44f4-beba-c9357734db40",
          "code": "C017435",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67017435",
          "code_system": "MESH",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "f75b2e77-c2a6-4fc8-bac9-66bbae901814",
          "code": "ENILCONAZOLE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Enilconazole",
          "code_system": "WIKIPEDIA",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "fe45ccf0-ba51-4bb6-9945-f8887256aab3",
          "code": "111901",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2562",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "03e062b0-981f-40f6-ad81-6f354f8475ea",
          "code": "4921",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4921",
          "code_system": "INN",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "1e794ee8-1b3f-4bf3-99ae-a2f019f79724",
          "code": "252-615-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.047.817",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "28925be8-5672-4189-8ad8-f9c114b07eb3",
          "code": "1442172",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1442172/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "3bb5e2a2-eda9-423b-93ca-6e3041fd09a5",
          "code": "m4907",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4907?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "317af55c-65d3-4254-b69b-e85de3470f1d",
          "code": "51004-46-7",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51004-46-7",
          "code_system": "CAS",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59",
            "55efcf85-18db-4d68-a1db-1dc2fb9a6619"
          ]
        },
        {
          "uuid": "0394ea5a-ea4a-4442-9466-a3860bc410cf",
          "code": "73790-28-0",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=73790-28-0",
          "code_system": "CAS",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59",
            "c45d7d3f-3c0d-46a0-9d10-81032c2347ab"
          ]
        },
        {
          "uuid": "7d2f63f3-2e4a-4dff-8378-6bcedf87ee51",
          "code": "1135441-05-2",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1135441-05-2",
          "code_system": "CAS",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59",
            "60976377-5be7-430b-ad38-26a3ef642102"
          ]
        },
        {
          "uuid": "7d061527-6ff6-4334-a64b-5761bd56a216",
          "code": "SUB183414",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "4811290c-f488-4b89-9cb9-efc777665aa2",
          "code": "CHEMBL356918",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL356918",
          "code_system": "ChEMBL",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "f52ceef2-f62f-4f2a-86ff-fe94f0a87009",
          "code": "37175",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/37175",
          "code_system": "PUBCHEM",
          "references": [
            "6b4fba6b-d74a-4149-af35-9da46f76eb59"
          ]
        },
        {
          "uuid": "278d47f3-a989-0d5d-5575-c47ea75dba46",
          "code": "6672",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6672",
          "code_system": "HSDB",
          "references": [
            "cfe86d71-059b-32a9-3294-a27085078db0"
          ]
        },
        {
          "uuid": "ae6632c9-18d6-e4f4-f365-db127e42303a",
          "code": "DTXSID8024151",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8024151",
          "code_system": "EPA CompTox",
          "references": [
            "c7733709-56e2-2dbd-9ae4-6c17f516c619"
          ]
        },
        {
          "uuid": "24e8f119-2844-2cb2-41d2-1bcaef9ba4d4",
          "code": "C514",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antifungal Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C514",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9aa4c3c2-fc66-ed89-3f63-e278cd6221cf"
          ]
        },
        {
          "uuid": "d535945a-4c89-45d5-b0ab-1f1a61b89df7",
          "code": "6K0NOF3XQ6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "80e0c353-0a3e-afa5-148c-1f1859fea389",
          "code": "3177",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3177",
          "code_system": "DRUG CENTRAL",
          "references": [
            "9aa4c3c2-fc66-ed89-3f63-e278cd6221cf"
          ]
        },
        {
          "uuid": "309939e5-8930-2827-96ca-702a5b015262",
          "code": "81927",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81927",
          "code_system": "CHEBI",
          "references": [
            "9aa4c3c2-fc66-ed89-3f63-e278cd6221cf"
          ]
        },
        {
          "uuid": "6948607f-b648-711c-248c-63d835779a8d",
          "code": "3177",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3177",
          "code_system": "CHEBI",
          "references": [
            "9aa4c3c2-fc66-ed89-3f63-e278cd6221cf"
          ]
        },
        {
          "uuid": "d7d8f369-8421-b5bf-b80d-e6c92c7ac2ab",
          "code": "100000169713",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2ed2eb28-e109-db05-236b-9f5c5800a4d3"
          ]
        },
        {
          "uuid": "f4f6d01b-c623-0bc6-89f0-2ec54c311abf",
          "code": "6K0NOF3XQ6",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6K0NOF3XQ6",
          "code_system": "DAILYMED",
          "references": [
            "f54427ee-6755-9c6a-02b2-638e0ad5e6e6"
          ]
        },
        {
          "uuid": "ba8c8c1b-f2a7-4466-0a98-50c35f861fa3",
          "code": "imazalil",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/imazalil.html",
          "code_system": "ALANWOOD",
          "references": [
            "337e0587-999c-e9c0-835f-6c4d694d544f"
          ]
        },
        {
          "uuid": "60cd2cd5-4ad9-c955-b3b0-56e30e342637",
          "code": "759313",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759313",
          "code_system": "NSC",
          "references": [
            "1e2e8b13-0312-b753-ad1e-0001af5da4fe"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7edfa49b-af07-43b1-9fdb-36d1e69dfc2e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "96cac392-cde7-4207-94d6-e21e74a62fae",
            "refuuid": "3e8bd95c-8248-41eb-ab79-dc2a44b910ff",
            "name": "ENILCONAZOLE",
            "unii": "6K0NOF3XQ6",
            "linking_id": "6K0NOF3XQ6",
            "ref_pname": "ENILCONAZOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6bfc5419-4633-4669-8531-7405d9797f25",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "c44114ca-6b92-4993-b424-f8c62ddfbf3c",
            "refuuid": "223147c2-7643-450a-8c7f-934b77c982b2",
            "name": "ENILCONAZOLE, (R)-",
            "unii": "K002UP533G",
            "linking_id": "K002UP533G",
            "ref_pname": "ENILCONAZOLE, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9b1ab9d5-febf-48f9-9133-375e245bef10",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "f3a37797-e4ca-4ba8-9a82-29bbed5fd082",
            "refuuid": "51000e1f-789b-49f0-bbcc-7e03d6ab5bd4",
            "name": "ENILCONAZOLE, (S)-",
            "unii": "8C2D57DP4H",
            "linking_id": "8C2D57DP4H",
            "ref_pname": "ENILCONAZOLE, (S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "72496fcd-895e-4078-a3d3-07d8d06c156e",
          "name": "(R,S)-1-(2-(2,4-DICHLOROPHENYL)-2-(2-PROPENYLOXY)ETHYL)-1H-IMIDAZOLE",
          "stdName": "(R,S)-1-(2-(2,4-DICHLOROPHENYL)-2-(2-PROPENYLOXY)ETHYL)-1H-IMIDAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "fb9b73d8-1ce8-4f63-b6e7-37fece929a4e",
          "name": "(RS)-1-(.BETA.-ALLYLOXY-2,4-DICHLOROPHENETHYL)IMIDAZOLE",
          "stdName": "(RS)-1-(.BETA.-ALLYLOXY-2,4-DICHLOROPHENETHYL)IMIDAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f28b3e16-7da2-451d-b382-714163b0b15e",
            "6050ac11-4678-4f92-98cb-aa46e012f75c"
          ],
          "display_name": false
        },
        {
          "uuid": "eb1cbfa0-0f4e-429a-a347-dc82dae01a1c",
          "name": "(±)-1-(.BETA.-(ALLYLOXY)-2,4-DICHLOROPHENETHYL)-IMIDAZOLE",
          "stdName": "(+/-)-1-(.BETA.-(ALLYLOXY)-2,4-DICHLOROPHENETHYL)-IMIDAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd869de9-439d-4d42-ac15-9565c2912ff8",
            "fc50f3f2-97ff-4c31-ae5c-27aaaa735079"
          ],
          "display_name": false
        },
        {
          "uuid": "44e75a05-6ae6-4445-8e0f-272bfd1ad1d6",
          "name": "1-(2-(2,4-DICHLOROPHENYL)-2-(2-PROPEN-1-YLOXY)ETHYL)-1H-IMIDAZOLE",
          "stdName": "1-(2-(2,4-DICHLOROPHENYL)-2-(2-PROPEN-1-YLOXY)ETHYL)-1H-IMIDAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f28b3e16-7da2-451d-b382-714163b0b15e",
            "87981b96-6d88-4a30-90ad-0c3000b0d984"
          ],
          "display_name": false
        },
        {
          "uuid": "44023f95-b49c-4356-b8bf-94a72f7c96a8",
          "name": "1H-IMIDAZOLE, 1-(2-(2,4-DICHLOROPHENYL)-2-(2-PROPEN-1-YLOXY)ETHYL)-",
          "stdName": "1H-IMIDAZOLE, 1-(2-(2,4-DICHLOROPHENYL)-2-(2-PROPEN-1-YLOXY)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "03d96bdc-3528-4935-81d7-2fce36d4b5cb",
          "name": "1H-IMIDAZOLE, 1-(2-(2,4-DICHLOROPHENYL)-2-(2-PROPENYLOXY)ETHYL)-, (±)-",
          "stdName": "1H-IMIDAZOLE, 1-(2-(2,4-DICHLOROPHENYL)-2-(2-PROPENYLOXY)ETHYL)-, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd869de9-439d-4d42-ac15-9565c2912ff8",
            "fc50f3f2-97ff-4c31-ae5c-27aaaa735079"
          ],
          "display_name": false
        },
        {
          "uuid": "44e4bed4-4ae5-4513-b09c-5c48f36da1db",
          "name": "AMOLDEN MP 100",
          "stdName": "AMOLDEN MP 100",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "cf5f3276-5e8b-4c52-80a7-e7d5d2e85da4",
          "name": "BROMAZIL",
          "stdName": "BROMAZIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "59c121d3-ce3d-40c8-9a7b-ba292bb3d6db",
          "name": "CGA-41333",
          "stdName": "CGA-41333",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "b4e2474c-de8e-42c9-9eb6-13100e23a0a1",
          "name": "CLINAFARM",
          "stdName": "CLINAFARM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d43baf6-0c7f-4d2c-b071-3af6a5745f62",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "a7692849-8855-485b-b6c3-f5486b4da7fc",
          "name": "DECCOSIL",
          "stdName": "DECCOSIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "e1ab185b-4de9-4b9f-928a-f2c9c503569a",
          "name": "DECCOZIL",
          "stdName": "DECCOZIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "3a4f9e32-8937-4c5f-ab0a-2ca8079c8ade",
          "name": "ENILCONAZOLE",
          "stdName": "ENILCONAZOLE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a5f850a-0895-4fe7-9af6-691ef7e77988",
            "f6688de6-54e1-4d37-8ccf-b23f91e54945",
            "92fa8eb9-47ca-4d05-84a5-d78bc12d537b",
            "4cd55c30-d331-4cec-9be5-ff5abb17c470",
            "ebe36554-4205-4fae-bb9e-f4f1f9e166ea",
            "e02fd574-9f43-404c-9de1-0177959d35bf",
            "c50b189e-be47-46f9-bfcf-95208285f1b9",
            "3f13292f-b1bf-41ad-981a-9b2abe9198f5",
            "cd869de9-439d-4d42-ac15-9565c2912ff8",
            "3730bd7d-56bb-4441-a089-fab859224e1f",
            "fc50f3f2-97ff-4c31-ae5c-27aaaa735079",
            "1cee978c-3f4f-43ad-8f03-f676fd50145e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "85144253-1b43-4fa1-8c20-6015c9db7394",
              "name_org": "INN"
            },
            {
              "uuid": "55296d9f-6703-4e5d-b0b6-9fe2465a69f1",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "19f0c554-c0d4-42d7-846c-161e2120fdd0",
          "name": "ENILCONAZOLE FOR VETERINARY USE",
          "stdName": "ENILCONAZOLE FOR VETERINARY USE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd869de9-439d-4d42-ac15-9565c2912ff8",
            "45947a70-fdab-43e1-b0cc-b2c98bae5657",
            "ee31f5d4-88fb-473c-93bc-885b9ebc2a52"
          ],
          "display_name": false
        },
        {
          "uuid": "18230f5e-6054-6a6f-eaea-fbe509196fea",
          "name": "ENILCONAZOLE FOR VETERINARY USE [EP MONOGRAPH]",
          "stdName": "ENILCONAZOLE FOR VETERINARY USE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9e12647-6e95-76c5-6fb7-0d3654f34377"
          ],
          "display_name": false
        },
        {
          "uuid": "d9437849-6b96-4690-97e7-c1a9a1e7acdd",
          "name": "ENILCONAZOLE [HSDB]",
          "stdName": "ENILCONAZOLE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd869de9-439d-4d42-ac15-9565c2912ff8",
            "4cd55c30-d331-4cec-9be5-ff5abb17c470"
          ],
          "display_name": false
        },
        {
          "uuid": "30a98aae-641a-47ea-9108-f780f4ae212b",
          "name": "ENILCONAZOLE [MART.]",
          "stdName": "ENILCONAZOLE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c50b189e-be47-46f9-bfcf-95208285f1b9"
          ],
          "display_name": false
        },
        {
          "uuid": "bfb61b17-896b-4f51-a815-a10b59d0fb0f",
          "name": "ENILCONAZOLE [MI]",
          "stdName": "ENILCONAZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd869de9-439d-4d42-ac15-9565c2912ff8",
            "92fa8eb9-47ca-4d05-84a5-d78bc12d537b"
          ],
          "display_name": false
        },
        {
          "uuid": "2d5d94e1-f07a-4c67-a119-eeb851b59442",
          "name": "ENILCONAZOLE [USAN]",
          "stdName": "ENILCONAZOLE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a5f850a-0895-4fe7-9af6-691ef7e77988"
          ],
          "display_name": false
        },
        {
          "uuid": "a943c29b-4bab-497f-9526-a1becc9fc2d0",
          "name": "FLOPRO IMZ",
          "stdName": "FLOPRO IMZ",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "051fa5e6-9e1d-4f6b-9899-673f80feb050",
          "name": "FLORASAN",
          "stdName": "FLORASAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "70ec3e9a-16dc-4adf-8453-fca4e6acb4aa",
          "name": "FRESHGARD",
          "stdName": "FRESHGARD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "8f9d5457-81ac-48ff-8522-681ca4b58ceb",
          "name": "FUNGAFLOR",
          "stdName": "FUNGAFLOR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "b3ee9492-983f-45f6-bbfc-813e61ff80e7",
          "name": "FUNGAZIL",
          "stdName": "FUNGAZIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "b37fe4d5-8616-4537-8d5f-b242871d0eb1",
          "name": "IMAVEROL",
          "stdName": "IMAVEROL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d43baf6-0c7f-4d2c-b071-3af6a5745f62",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "5c235f8c-61e1-4a7a-826b-c91a6dd03ee0",
          "name": "IMAZALIL",
          "stdName": "IMAZALIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd869de9-439d-4d42-ac15-9565c2912ff8",
            "69b769c0-8916-483a-8fe0-fe7e0dfc9372",
            "a5434d31-2d37-4547-8506-e30e41926029"
          ],
          "display_name": false
        },
        {
          "uuid": "c0194c1e-40e8-46b5-b3ec-88f6765a6f04",
          "name": "IMAZALIL [ISO]",
          "stdName": "IMAZALIL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd869de9-439d-4d42-ac15-9565c2912ff8",
            "69b769c0-8916-483a-8fe0-fe7e0dfc9372"
          ],
          "display_name": false
        },
        {
          "uuid": "2ae1c125-106b-401f-9e65-cb59f697f6a8",
          "name": "MAGNATE",
          "stdName": "MAGNATE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "fb52a734-f37f-7cd4-8ec6-a008f3ce4ed0",
          "name": "NSC-759313",
          "stdName": "NSC-759313",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e2e8b13-0312-b753-ad1e-0001af5da4fe"
          ],
          "display_name": false
        },
        {
          "uuid": "0ab2eefb-c3d5-413e-b319-d8e66b770bda",
          "name": "NUZONE",
          "stdName": "NUZONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "1caccfe3-4e91-4ebb-a3b3-74ef361ff3b2",
          "name": "R 23,979",
          "stdName": "R 23,979",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd869de9-439d-4d42-ac15-9565c2912ff8",
            "fc50f3f2-97ff-4c31-ae5c-27aaaa735079"
          ],
          "display_name": false
        },
        {
          "uuid": "30504c80-0839-44ba-a64e-6b5da4d3de62",
          "name": "R-23979",
          "stdName": "R-23979",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b54533d-3001-41e9-b31d-f14eeda98c88",
            "cd869de9-439d-4d42-ac15-9565c2912ff8"
          ],
          "display_name": false
        },
        {
          "uuid": "939e6551-4d64-402a-b63f-2d7c3a258282",
          "name": "enilconazole [INN]",
          "stdName": "ENILCONAZOLE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cee978c-3f4f-43ad-8f03-f676fd50145e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fc50f3f2-97ff-4c31-ae5c-27aaaa735079",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "69b769c0-8916-483a-8fe0-fe7e0dfc9372",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd869de9-439d-4d42-ac15-9565c2912ff8",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b54533d-3001-41e9-b31d-f14eeda98c88",
          "citation": "USP DICTIONARY 2014",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f28b3e16-7da2-451d-b382-714163b0b15e",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6050ac11-4678-4f92-98cb-aa46e012f75c",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87981b96-6d88-4a30-90ad-0c3000b0d984",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cee978c-3f4f-43ad-8f03-f676fd50145e",
          "citation": "INN Proposed List 45",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL45.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3a5f850a-0895-4fe7-9af6-691ef7e77988",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee31f5d4-88fb-473c-93bc-885b9ebc2a52",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c50b189e-be47-46f9-bfcf-95208285f1b9",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92fa8eb9-47ca-4d05-84a5-d78bc12d537b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cd55c30-d331-4cec-9be5-ff5abb17c470",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d43baf6-0c7f-4d2c-b071-3af6a5745f62",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6cbf4d1-b437-49a4-82ae-bc781a2ce93f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b4fba6b-d74a-4149-af35-9da46f76eb59",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389654000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "537240ad-4a77-436a-8eff-5c5f0fd44038",
          "citation": "SRS import [6K0NOF3XQ6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6K0NOF3XQ6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389654000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ebe36554-4205-4fae-bb9e-f4f1f9e166ea",
          "citation": "ENILCONAZOLE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f6688de6-54e1-4d37-8ccf-b23f91e54945",
          "citation": "ENILCONAZOLE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "45947a70-fdab-43e1-b0cc-b2c98bae5657",
          "citation": "ENILCONAZOLE FOR VETERINARY USE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3f13292f-b1bf-41ad-981a-9b2abe9198f5",
          "citation": "ENILCONAZOLE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3730bd7d-56bb-4441-a089-fab859224e1f",
          "citation": "ENILCONAZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e02fd574-9f43-404c-9de1-0177959d35bf",
          "citation": "ENILCONAZOLE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a5434d31-2d37-4547-8506-e30e41926029",
          "citation": "IMAZALIL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cfe86d71-059b-32a9-3294-a27085078db0",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+35554-44-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c7733709-56e2-2dbd-9ae4-6c17f516c619",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=35554-44-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2ed2eb28-e109-db05-236b-9f5c5800a4d3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "9aa4c3c2-fc66-ed89-3f63-e278cd6221cf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "43cb03b3-3584-4467-9363-e451ab05f103",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "55efcf85-18db-4d68-a1db-1dc2fb9a6619",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c45d7d3f-3c0d-46a0-9d10-81032c2347ab",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "60976377-5be7-430b-ad38-26a3ef642102",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "337e0587-999c-e9c0-835f-6c4d694d544f",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "1e2e8b13-0312-b753-ad1e-0001af5da4fe",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c9e12647-6e95-76c5-6fb7-0d3654f34377",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "f54427ee-6755-9c6a-02b2-638e0ad5e6e6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4c5f5535-0076-4dd7-9237-f3b807cd8993",
          "id": "4c5f5535-0076-4dd7-9237-f3b807cd8993",
          "molfile": "\n  Marvin  01132103592D          \n\n 19 20  0  0  0  0            999 V2000\n    3.6208   -2.4249    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.3416   -2.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3375   -3.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0583   -4.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7708   -3.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4916   -4.0875    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.4916   -4.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7791   -5.3291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7750   -6.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9917   -6.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5084   -5.7458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9958   -5.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2041   -3.6750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9167   -4.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6375   -3.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3500   -4.0874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7667   -2.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4916   -2.4208    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.0542   -2.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 19  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n 17  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n 13  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 12  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\nM  END",
          "smiles": "C=CCOC(Cn1ccnc1)c2ccc(cc2Cl)Cl",
          "formula": "C14H14Cl2N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "092c8d35-89e7-4f0d-808e-d3770eb2e688"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "297.1802",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3e8bd95c-8248-41eb-ab79-dc2a44b910ff",
      "version": "16",
      "structure": {
        "id": "70fb2059-c0a6-430e-9584-87ef11e793fc",
        "molfile": "\n  Marvin  01132105512D          \n\n 19 20  0  0  0  0            999 V2000\n    5.7708   -3.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7667   -2.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7791   -5.3291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5084   -5.7458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4916   -4.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9958   -5.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0542   -2.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0583   -4.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4916   -4.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9917   -6.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7750   -6.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3416   -2.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6375   -3.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4916   -2.4208    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.3500   -4.0874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3375   -3.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2041   -3.6750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6208   -2.4249    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9167   -4.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  9  1  0  0  0  0\n  4  6  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11  3  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13 19  1  0  0  0  0\n 14  2  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16  8  2  0  0  0  0\n 17  5  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 17  1  0  0  0  0\n 12  7  2  0  0  0  0\n 10  4  1  0  0  0  0\nM  END",
        "smiles": "C=CCOC(Cn1ccnc1)c2ccc(cc2Cl)Cl",
        "formula": "C14H14Cl2N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "297.1802",
        "optical_activity": "( + / - )",
        "references": [
          "537240ad-4a77-436a-8eff-5c5f0fd44038",
          "fc50f3f2-97ff-4c31-ae5c-27aaaa735079",
          "1cee978c-3f4f-43ad-8f03-f676fd50145e"
        ],
        "stereo_centers": 1
      },
      "unii": "6K0NOF3XQ6"
    }
  ]
}