{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ed45063f-affc-45f0-81e5-8742884fe5c8", "code": "444153-01-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=444153-01-9", "code_system": "CAS", "references": [ "af95d50d-8ac3-47f8-9a0f-496f95b2b965", "a148944a-64d4-4562-9ab1-8cf4ba04d5a2" ] }, { "uuid": "47e7a903-e5ab-444c-957a-7ad45cda2aa5", "code": "22141786", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22141786", "code_system": "PUBCHEM", "references": [ "af95d50d-8ac3-47f8-9a0f-496f95b2b965" ] }, { "uuid": "3f6cab65-49c4-487b-99d7-a12e72335158", "code": "6JVL75281S", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "bc1de3b5-00c9-a9fb-ec23-67d4a8ae4343", "code": "DTXSID10196165", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10196165", "code_system": "EPA CompTox", "references": [ "7b7e4195-c810-5913-eb8b-7b601dc06d19" ] } ], "substance_class": "chemical", "names": [ { "uuid": "09299dfe-ec22-463a-bc93-63a2e8a050ce", "name": "1-PROPANAMINIUM, N,N'-(OXYDI-2,1-ETHANEDIYL)BIS(3-((3-(4-METHOXYPHENYL)-1-OXO-2-PROPEN-1-YL)AMINO)-N,N-DIMETHYL-, CHLORIDE (1:2)", "stdName": "1-PROPANAMINIUM, N,N'-(OXYDI-2,1-ETHANEDIYL)BIS(3-((3-(4-METHOXYPHENYL)-1-OXO-2-PROPEN-1-YL)AMINO)-N,N-DIMETHYL-, CHLORIDE (1:2)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ec07422f-531a-4456-834e-74bcbaae8e57", "b07682cc-575d-44d5-976a-65f02255b540" ], "display_name": false }, { "uuid": "b3ef0629-d1ba-4f34-87e1-40c1a885ae88", "name": "1-PROPANAMINIUM, N,N'-(OXYDI-2,1-ETHANEDIYL)BIS(3-((3-(4-METHOXYPHENYL)-1-OXO-2-PROPENYL)AMINO)-N,N-DIMETHYL-, DICHLORIDE", "stdName": "1-PROPANAMINIUM, N,N'-(OXYDI-2,1-ETHANEDIYL)BIS(3-((3-(4-METHOXYPHENYL)-1-OXO-2-PROPENYL)AMINO)-N,N-DIMETHYL-, DICHLORIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ec07422f-531a-4456-834e-74bcbaae8e57", "b07682cc-575d-44d5-976a-65f02255b540" ], "display_name": false }, { "uuid": "ec57c693-2e61-4d90-b1e8-daefbfd530dc", "name": "DI-METHOXYCINNAMIDOPROPYL ETHYLDIMONIUM CHLORIDE ETHER", "stdName": "DI-METHOXYCINNAMIDOPROPYL ETHYLDIMONIUM CHLORIDE ETHER", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "b07682cc-575d-44d5-976a-65f02255b540", "95236689-2ba0-4016-85be-877a2bfbbd54", "196e942b-184e-4809-986f-0ed9f19e403f" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "bf575ff6-a562-457e-a8da-32fa88035807", "name_org": "INCI" } ] }, { "uuid": "33529a24-a273-4504-9fa1-75b7a8523c49", "name": "GALAXY - BISQUAT", "stdName": "GALAXY - BISQUAT", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "b07682cc-575d-44d5-976a-65f02255b540", "196e942b-184e-4809-986f-0ed9f19e403f" ], "display_name": false } ], "references": [ { "uuid": "196e942b-184e-4809-986f-0ed9f19e403f", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b07682cc-575d-44d5-976a-65f02255b540", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ec07422f-531a-4456-834e-74bcbaae8e57", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "af95d50d-8ac3-47f8-9a0f-496f95b2b965", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391526000, "tags": [ "NOMEN" ] }, { "uuid": "341380e1-b752-4849-915e-8b29a6969600", "citation": "SRS import [6JVL75281S]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6JVL75281S", "doc_type": "SRS", "public_domain": true, "document_date": 1493391526000, "tags": [ "NOMEN" ] }, { "uuid": "95236689-2ba0-4016-85be-877a2bfbbd54", "citation": "DI-METHOXYCINNAMIDOPROPYL ETHYLDIMONIUM CHLORIDE ETHER [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c4f981f9-567e-591e-c1a2-107fc5b56227", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=444153-01-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a148944a-64d4-4562-9ab1-8cf4ba04d5a2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7b7e4195-c810-5913-eb8b-7b601dc06d19", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e8794dc7-f9e7-4a0b-b87b-3322272450c3", "id": "e8794dc7-f9e7-4a0b-b87b-3322272450c3", "molfile": "\n Marvin 01132112022D \n\n 1 0 0 0 0 0 999 V2000\n 12.7476 -8.2292 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "Cl", "formula": "ClH", "atropisomerism": "No", "charge": 0, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "81543779-face-45c1-a7a9-7467b45a5d75" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "36.4609", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "e116c9f8-7d63-4326-8bc5-7a3d9846e664", "id": "e116c9f8-7d63-4326-8bc5-7a3d9846e664", "molfile": "\n Marvin 01132111392D \n\n 43 44 0 0 0 0 999 V2000\n 0.9365 -5.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6510 -4.8362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3655 -5.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3655 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0800 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7944 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5089 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2234 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9379 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9379 -7.3112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6523 -6.0737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3668 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0813 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7957 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5102 -6.0737 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 9.0976 -5.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9226 -5.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2247 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9391 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6536 -6.4862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6536 -7.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3681 -7.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0825 -7.3112 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 12.6700 -6.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4950 -6.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7970 -7.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5114 -7.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2259 -7.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9404 -7.3112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6548 -7.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6548 -8.5487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3693 -7.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0838 -7.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7982 -7.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7982 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5127 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2272 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9416 -6.0737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6561 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2272 -7.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5127 -7.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7944 -5.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0800 -4.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 43 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 42 2 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 15 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 26 23 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 2 0 0 0 0\n 32 30 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 41 34 2 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 40 2 0 0 0 0\n 38 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 42 43 1 0 0 0 0\nM CHG 2 15 1 23 1\nM END", "smiles": "C[N+](C)(CCCNC(=O)/C=C/c1ccc(cc1)OC)CCOCC[N+](C)(C)CCCNC(=O)/C=C/c2ccc(cc2)OC", "formula": "C34H52N4O5", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "aa1543e8-3de1-434e-8f02-e4b5d6cc989a" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "596.8018", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "94ab136a-d44c-4c8b-a196-609535f54e59", "version": "6", "structure": { "id": "35cb8b3f-0c8e-43d4-b3ba-680242b4063f", "molfile": "\n Marvin 01132102522D \n\n 45 44 0 0 0 0 999 V2000\n 12.7476 -8.2292 0.0000 Cl 0 5 0 0 0 0 0 0 0 0 0 0\n 9.3861 -6.4174 0.0000 Cl 0 5 0 0 0 0 0 0 0 0 0 0\n 3.7944 -5.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0800 -4.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3655 -5.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6510 -4.8362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9365 -5.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3655 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0800 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7944 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5089 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2234 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9379 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9379 -7.3112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6523 -6.0737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3668 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0813 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7957 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5102 -6.0737 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 9.0976 -5.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9226 -5.3592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2247 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9391 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6536 -6.4862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6536 -7.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3681 -7.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0825 -7.3112 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 13.7970 -7.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5114 -7.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2259 -7.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9404 -7.3112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6548 -7.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3693 -7.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0838 -7.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7982 -7.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.7982 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5127 -6.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2272 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2272 -7.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5127 -7.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9416 -6.0737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6561 -6.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6548 -8.5487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6700 -6.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4950 -6.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 2 0 0 0 0\n 35 34 1 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 2 0 0 0 0\n 40 35 1 0 0 0 0\n 38 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 32 43 2 0 0 0 0\n 27 44 1 0 0 0 0\n 27 45 1 0 0 0 0\n 10 3 2 0 0 0 0\nM CHG 4 1 -1 2 -1 19 1 27 1\nM END", "smiles": "C[N+](C)(CCCNC(=O)/C=C/c1ccc(cc1)OC)CCOCC[N+](C)(C)CCCNC(=O)/C=C/c2ccc(cc2)OC.[Cl-].[Cl-]", "formula": "C34H52N4O5.2Cl", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "667.7077", "optical_activity": "NONE", "references": [ "ec07422f-531a-4456-834e-74bcbaae8e57", "341380e1-b752-4849-915e-8b29a6969600" ], "stereo_centers": 0 }, "unii": "6JVL75281S" } ] }