{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0d34bde9-175b-4603-a34f-a1fdc656d4b4",
          "code": "N0000175080",
          "comments": "Cellular or Molecular Interactions [MoA]|Enzyme Interactions [MoA]|Enzyme Inhibitors [MoA]|Steroid Synthesis Inhibitors [MoA]|Sex Hormone Synthesis Inhibitors [MoA]|Estrogen Synthesis Inhibitors [MoA]|Aromatase Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175080",
          "code_system": "NDF-RT",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "0b8c0846-d47f-45c7-983b-35cac4e4b9fe",
          "code": "N0000175563",
          "comments": "Established Pharmacologic Class [EPC]|Aromatase Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175563",
          "code_system": "NDF-RT",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "549889ea-252e-461c-a1cf-d9472b54eaea",
          "code": "968-93-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=968-93-4",
          "code_system": "CAS",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a",
            "cd900a58-d706-4d6b-a56b-d83dc29842d5"
          ]
        },
        {
          "uuid": "26b07f50-a2a1-4c9f-be87-5ff2b5e24f39",
          "code": "C2301",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2301",
          "code_system": "NCI_THESAURUS",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "6d911823-6bdd-4649-a6de-f19060288589",
          "code": "943",
          "comments": "LiverTox|Antineoplastic|Breast Cancer|Aromatase Inhibitor: antiestrogen",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Testolactone.htm",
          "code_system": "LIVERTOX",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "5d46dc8e-47f6-4c16-941d-810830af950a",
          "code": "TESTOLACTONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Testolactone",
          "code_system": "WIKIPEDIA",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "00d90c97-0205-4ae0-9674-9ee1df7b4fe7",
          "code": "SUB10936MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "78085a65-df25-461f-9c94-072d96669f45",
          "code": "1839",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1839",
          "code_system": "INN",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "5c86005d-2c5d-4f21-b4a5-b57389fc995b",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "7eaeff11-d24d-43a5-ade5-9ee9a1453b77",
          "code": "7303",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7303",
          "code_system": "IUPHAR",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "ee226913-1d51-4b3e-9074-98d035dc114e",
          "code": "10378",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10378/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "a8448d11-1166-478b-bd91-c85fd36fb67a",
          "code": "m10593",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10593?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "6a4b68a9-8771-45e1-8fe5-9921b1131c01",
          "code": "DB00894",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00894",
          "code_system": "DRUG BANK",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "523d9dce-691f-477b-bfa8-c8c95810f621",
          "code": "CHEMBL1571",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1571",
          "code_system": "ChEMBL",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "9f7f4bf9-38ff-44a1-b156-06e4f0f9c6ee",
          "code": "13769",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13769",
          "code_system": "PUBCHEM",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "da2d858f-48b9-4a2f-9661-f3e68907c497",
          "code": "213-534-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.304",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "143bcd0d-7e84-48e3-9567-9436246b544a"
          ]
        },
        {
          "uuid": "b53ad8b2-d67d-0778-e717-ba8f2cf1aa01",
          "code": "3255",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3255",
          "code_system": "HSDB",
          "references": [
            "08d8d439-8067-66a6-7fed-7a3f65872d73"
          ]
        },
        {
          "uuid": "bb082fbb-64e8-584d-c1f3-c9a64ff297a5",
          "code": "DTXSID2023644",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2023644",
          "code_system": "EPA CompTox",
          "references": [
            "4aa8941d-13d7-2fe1-7179-da91942f1014"
          ]
        },
        {
          "uuid": "77f56078-a941-678a-ec62-bf711e2df8cc",
          "code": "C2017",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Protein Inhibitor[C129824]|Antineoplastic Enzyme Inhibitor[C129825]|Aromatase Inhibitor[C1740]|Steroidal Aromatase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2017",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6148f69b-43eb-93b1-a0b9-985451cd6725"
          ]
        },
        {
          "uuid": "2fe2f559-69ca-4ac0-9622-cd8255bb2f1e",
          "code": "6J9BLA949Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4f269e70-e491-074b-5967-f14450ea7acc",
          "code": "2606",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2606",
          "code_system": "DRUG CENTRAL",
          "references": [
            "6148f69b-43eb-93b1-a0b9-985451cd6725"
          ]
        },
        {
          "uuid": "08f6cd13-881f-23e1-22b6-f076c4455bf5",
          "code": "9460",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9460",
          "code_system": "CHEBI",
          "references": [
            "6148f69b-43eb-93b1-a0b9-985451cd6725"
          ]
        },
        {
          "uuid": "cedb66cb-286f-f87e-23b1-a17760fdb5d9",
          "code": "1645006",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1645006",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "6148f69b-43eb-93b1-a0b9-985451cd6725"
          ]
        },
        {
          "uuid": "13c8eeb9-a6e6-58f0-f05f-70886e84636c",
          "code": "100000082735",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "673ff433-b36e-4ce2-43b5-ba31421cd3a6"
          ]
        },
        {
          "uuid": "a36618e6-4840-7cbb-0332-3bdf129d6a43",
          "code": "23759",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=23759",
          "code_system": "NSC",
          "references": [
            "24487789-27b3-a114-98e1-db84b3e8f88f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "bc6157af-ae19-4914-bfeb-f65a9036b5ec",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "93089b8c-cb13-4716-bb5e-c053ddd24e24",
            "refuuid": "2dcd587d-574b-446b-99bb-4aa780593da5",
            "name": "TESTOLACTONE",
            "unii": "6J9BLA949Q",
            "linking_id": "6J9BLA949Q",
            "ref_pname": "TESTOLACTONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "233bb6a0-c24c-4946-b7f8-ffe87ca1b8b4",
          "name": "NSC-23759",
          "stdName": "NSC-23759",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4116a991-4382-4615-8e3f-390751f5b425"
          ],
          "display_name": false
        },
        {
          "uuid": "f93d4f84-3916-4f2a-8f6c-a7f8382fd025",
          "name": "SQ 9538",
          "stdName": "SQ 9538",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bcd85e4-f5bc-4a63-8b06-72618fd5d740"
          ],
          "display_name": false
        },
        {
          "uuid": "effbef99-1742-4bcc-81d8-32a266c3bfa4",
          "name": "SQ-9538",
          "stdName": "SQ-9538",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36594fed-c0cb-4e8a-8162-5ac387cdcd12"
          ],
          "display_name": false
        },
        {
          "uuid": "399cd7b3-1d95-47e2-b7ba-da538a49ad75",
          "name": "TEOLIT",
          "stdName": "TEOLIT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fb74d6b-c37f-4b94-af7a-11efc5c7295e"
          ],
          "display_name": false
        },
        {
          "uuid": "94ddec9f-9dd6-4c45-bc22-9fcd06fcac86",
          "name": "TESLAC",
          "stdName": "TESLAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ef65cd5-030b-4de0-9420-1d4d66482810",
            "72ff6bab-4618-4ef4-9e9a-6a6f52e7c7cd"
          ],
          "display_name": false
        },
        {
          "uuid": "d17cfbed-803b-4e4b-9910-264914d98ed5",
          "name": "TESTOLACTONE",
          "stdName": "TESTOLACTONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31af3e6b-a7b4-4765-899c-8ca4d2d76320",
            "b6cd4c61-54ef-47eb-8f03-8fd866e1216f",
            "5233f7b9-6b58-4f84-9d43-7f127b437c03",
            "0d1d514d-4e27-4723-8589-3bb3131aae9b",
            "5e639970-e7da-4edd-99e9-98309db09131",
            "f5499ad5-1875-4f86-b475-1b1d36e310ae",
            "9d2498fe-75fc-4201-b8ba-41f8fc4c7a4b",
            "04aee830-8470-4286-887c-76eb6e328b44",
            "6b42e08e-dea9-4805-aec4-258a476142a4",
            "fe095871-6cfa-44c1-9f7d-04436a7ed244",
            "813f4003-626b-43ff-9966-cff123275bc7",
            "22e78f63-9a51-410d-85ec-62d1b70d21f1",
            "d6906937-43cf-4b98-9cda-e2dbc1bf093c",
            "c37d7a72-917f-4d23-be47-0d4ab8267980",
            "5c03e45c-5ab0-41c4-ac3d-ce522931611d",
            "d7523172-542b-4f32-87be-7a56e2643884",
            "01384336-7e9f-4897-b785-5a93e5462e57",
            "c016dbc1-74ee-4d00-8545-9ff6d3bb7de5",
            "c40c3872-098f-41f4-9043-082a6b04cfd6"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a92230c1-7fc5-461e-a49d-586ffb09941b",
              "name_org": "INN"
            },
            {
              "uuid": "b2e87be2-6356-4670-ae68-42cd529f2880",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "4e16aa2e-69eb-46db-bf90-0716318a4117",
          "name": "TESTOLACTONE CIII",
          "stdName": "TESTOLACTONE CIII",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdfde32b-2dbf-4f22-b066-fe6703ac3c08",
            "510d170a-d3ff-4d20-92f2-90ddc5829e39"
          ],
          "display_name": false
        },
        {
          "uuid": "62ffc717-0db7-4322-af36-fffd611eea1e",
          "name": "TESTOLACTONE CIII [USP-RS]",
          "stdName": "TESTOLACTONE CIII [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "510d170a-d3ff-4d20-92f2-90ddc5829e39"
          ],
          "display_name": false
        },
        {
          "uuid": "021472b2-1914-4a58-8418-eb881541e4b4",
          "name": "TESTOLACTONE [HSDB]",
          "stdName": "TESTOLACTONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01384336-7e9f-4897-b785-5a93e5462e57"
          ],
          "display_name": false
        },
        {
          "uuid": "4d3ca652-4c9d-467f-98fa-81357b6a6e3b",
          "name": "TESTOLACTONE [MI]",
          "stdName": "TESTOLACTONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5233f7b9-6b58-4f84-9d43-7f127b437c03"
          ],
          "display_name": false
        },
        {
          "uuid": "9cdd3dff-660a-4285-92ff-bc814075b49b",
          "name": "TESTOLACTONE [ORANGE BOOK]",
          "stdName": "TESTOLACTONE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7523172-542b-4f32-87be-7a56e2643884"
          ],
          "display_name": false
        },
        {
          "uuid": "3d219f67-2ee0-4811-be34-3aca28fdb076",
          "name": "TESTOLACTONE [USAN]",
          "stdName": "TESTOLACTONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c03e45c-5ab0-41c4-ac3d-ce522931611d"
          ],
          "display_name": false
        },
        {
          "uuid": "d46a0793-7e20-48ef-6b7d-6f5ac4218ab3",
          "name": "TESTOLACTONE [USP IMPURITY]",
          "stdName": "TESTOLACTONE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe095871-6cfa-44c1-9f7d-04436a7ed244"
          ],
          "display_name": false
        },
        {
          "uuid": "e9888952-7283-63fd-fcb0-c12dca3aea7d",
          "name": "TESTOLACTONE [USP-RS]",
          "stdName": "TESTOLACTONE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2cf8d851-984f-f667-5b2a-4f113f962f38"
          ],
          "display_name": false
        },
        {
          "uuid": "084a1718-6670-4eca-a180-3c77e5a44ff0",
          "name": "TESTOLACTONE [VANDF]",
          "stdName": "TESTOLACTONE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31af3e6b-a7b4-4765-899c-8ca4d2d76320"
          ],
          "display_name": false
        },
        {
          "uuid": "b645b6d1-3849-37aa-38f7-6c4fe2ba0fb8",
          "name": "Testolactone [WHO-DD]",
          "stdName": "TESTOLACTONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d80e6310-1882-51d5-da22-3282428f6efe"
          ],
          "display_name": false
        },
        {
          "uuid": "90248a0a-51f2-489c-980c-567c0a785ec5",
          "name": "testolactone [INN]",
          "stdName": "TESTOLACTONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5499ad5-1875-4f86-b475-1b1d36e310ae"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0d1d514d-4e27-4723-8589-3bb3131aae9b",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f5499ad5-1875-4f86-b475-1b1d36e310ae",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5c03e45c-5ab0-41c4-ac3d-ce522931611d",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe095871-6cfa-44c1-9f7d-04436a7ed244",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7523172-542b-4f32-87be-7a56e2643884",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c016dbc1-74ee-4d00-8545-9ff6d3bb7de5",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5233f7b9-6b58-4f84-9d43-7f127b437c03",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ef65cd5-030b-4de0-9420-1d4d66482810",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72ff6bab-4618-4ef4-9e9a-6a6f52e7c7cd",
          "citation": "D00153",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01384336-7e9f-4897-b785-5a93e5462e57",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fb74d6b-c37f-4b94-af7a-11efc5c7295e",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22e78f63-9a51-410d-85ec-62d1b70d21f1",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31af3e6b-a7b4-4765-899c-8ca4d2d76320",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "510d170a-d3ff-4d20-92f2-90ddc5829e39",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4116a991-4382-4615-8e3f-390751f5b425",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bcd85e4-f5bc-4a63-8b06-72618fd5d740",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36594fed-c0cb-4e8a-8162-5ac387cdcd12",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "143bcd0d-7e84-48e3-9567-9436246b544a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389705000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83315942-2050-49f7-bd2a-2d0d0da14fbb",
          "citation": "SRS import [6J9BLA949Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6J9BLA949Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389705000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c37d7a72-917f-4d23-be47-0d4ab8267980",
          "citation": "TESTOLACTONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6b42e08e-dea9-4805-aec4-258a476142a4",
          "citation": "TESTOLACTONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d2498fe-75fc-4201-b8ba-41f8fc4c7a4b",
          "citation": "TESTOLACTONE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b6cd4c61-54ef-47eb-8f03-8fd866e1216f",
          "citation": "TESTOLACTONE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "04aee830-8470-4286-887c-76eb6e328b44",
          "citation": "TESTOLACTONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5e639970-e7da-4edd-99e9-98309db09131",
          "citation": "TESTOLACTONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c40c3872-098f-41f4-9043-082a6b04cfd6",
          "citation": "TESTOLACTONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "813f4003-626b-43ff-9966-cff123275bc7",
          "citation": "TESTOLACTONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d6906937-43cf-4b98-9cda-e2dbc1bf093c",
          "citation": "TESTOLACTONE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cdfde32b-2dbf-4f22-b066-fe6703ac3c08",
          "citation": "TESTOLACTONE CIII [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "08d8d439-8067-66a6-7fed-7a3f65872d73",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+968-93-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4aa8941d-13d7-2fe1-7179-da91942f1014",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=968-93-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "673ff433-b36e-4ce2-43b5-ba31421cd3a6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6148f69b-43eb-93b1-a0b9-985451cd6725",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cd900a58-d706-4d6b-a56b-d83dc29842d5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2cf8d851-984f-f667-5b2a-4f113f962f38",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "24487789-27b3-a114-98e1-db84b3e8f88f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9eeb60a8-8a7f-ee02-354e-56177215f4eb",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d80e6310-1882-51d5-da22-3282428f6efe",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "33f3fc71-368c-46a8-8a43-4bc2fea6d521",
          "id": "33f3fc71-368c-46a8-8a43-4bc2fea6d521",
          "molfile": "\n  Marvin  01132102462D          \n\n 22 25  0  0  1  0            999 V2000\n    0.8405   -8.5731    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.8405   -9.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1345   -9.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5793   -9.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3008   -9.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0146   -9.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7284   -9.8093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0146   -8.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3008   -8.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5793   -8.5731    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -0.5793   -7.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1345   -8.1619    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.1345   -7.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8405   -6.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5543   -7.3343    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.5543   -6.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2758   -6.9205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9896   -7.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7034   -6.9205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9896   -8.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2758   -8.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5543   -8.1619    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n  1  2  1  6  0  0  0\n  1 12  1  0  0  0  0\n  1 22  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n 10  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 15 17  1  0  0  0  0\n 22 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12C=CC(=O)C=C2CC[C@@H]3[C@@H]1CC[C@@]4(C)[C@H]3CCC(=O)O4",
          "formula": "C19H24O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fdcef52d-ad25-4854-aa61-706933aaf047"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "300.3928",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2dcd587d-574b-446b-99bb-4aa780593da5",
      "version": "23",
      "structure": {
        "id": "4fae8407-9df9-4527-84a9-507148e73c7a",
        "molfile": "\n  Marvin  01132104092D          \n\n 25 28  0  0  1  0            999 V2000\n   -0.5793   -8.5731    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.5793   -9.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5543   -7.3343    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.1345   -8.1619    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.8405   -8.5731    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.5543   -8.1619    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.3008   -8.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2758   -6.9205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3008   -9.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9896   -7.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1345   -7.3343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8405   -9.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0146   -8.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0146   -9.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2758   -8.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8405   -6.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1345   -9.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7034   -6.9205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7284   -9.8093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9896   -8.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5793   -7.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5543   -6.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8379   -7.7533    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1319   -8.9791    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5517   -8.9791    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3 16  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  2  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  5  1  0  0  0  0\n 13  7  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15  6  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17  2  1  0  0  0  0\n 18 10  2  0  0  0  0\n 19 14  2  0  0  0  0\n 20 15  1  0  0  0  0\n  1 21  1  1  0  0  0\n  3 22  1  1  0  0  0\n  5 23  1  1  0  0  0\n  4 24  1  6  0  0  0\n  6 25  1  6  0  0  0\n 17 12  1  0  0  0  0\n  9 14  1  0  0  0  0\n  3  6  1  0  0  0  0\n 10 20  1  0  0  0  0\nM  END",
        "smiles": "C[C@@]12C=CC(=O)C=C2CC[C@]3([H])[C@]1([H])CC[C@@]4(C)[C@@]3([H])CCC(=O)O4",
        "formula": "C19H24O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "300.3928",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "83315942-2050-49f7-bd2a-2d0d0da14fbb",
          "0d1d514d-4e27-4723-8589-3bb3131aae9b",
          "f5499ad5-1875-4f86-b475-1b1d36e310ae"
        ],
        "stereo_centers": 5
      },
      "unii": "6J9BLA949Q"
    }
  ]
}