{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8d3b2589-88f9-40ca-9b6b-41fd34152248",
          "code": "1445752-09-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1445752-09-9",
          "code_system": "CAS",
          "references": [
            "62731765-f06b-4277-ecb4-bc4bb4e3e789"
          ]
        },
        {
          "uuid": "8e79d098-cf04-462d-bc41-3db6a9b62652",
          "code": "AB-PINACA",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/AB-PINACA",
          "code_system": "WIKIPEDIA",
          "references": [
            "24a88dc8-fabe-82df-0949-bdc3fc494efd"
          ]
        },
        {
          "uuid": "ec07ec34-5198-4199-8d8f-1d63ea15aff5",
          "code": "7023",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I. |Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO."
        },
        {
          "uuid": "2edef9e9-1a9b-2ecf-091f-86c73fc1b0ae",
          "code": "71301472",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71301472",
          "code_system": "PUBCHEM",
          "references": [
            "6ff247d8-ea63-a7b2-344a-7ce5db0daecb"
          ]
        },
        {
          "uuid": "d63faea1-6bfd-4c91-9f98-55c9a61ec180",
          "code": "6J3KC3S2PA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "700a004d-35be-9081-d65b-add029c6603c",
          "code": "Designer-drugs-AB-PINACA",
          "comments": "Wikipedia|List of designer drugs|Synthetic cannabinoids|Indazole based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "c0bad0d0-0f50-bae1-f506-8bbf8537f275"
          ]
        },
        {
          "uuid": "f2890ec6-9f78-f84c-19ff-93a1a5b6bfee",
          "code": "100000173991",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d2d8d4d5-fc48-fd39-00fa-4d45afe526ce"
          ]
        },
        {
          "uuid": "da6789ef-0d75-4885-0a14-60ad28fc0eba",
          "code": "DTXSID00904034",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00904034",
          "code_system": "EPA CompTox",
          "references": [
            "c0bad0d0-0f50-bae1-f506-8bbf8537f275"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "17202076-f88e-4f62-9510-a8b5ec72b78b",
          "amount": {
            "uuid": "362017f3-536e-4d5d-93ae-2f39265979c7",
            "average": 1.2,
            "units": "NANOMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "references": [
            "3c8d12ec-8e36-4ff2-afa2-15b1675770f6"
          ],
          "related_substance": {
            "uuid": "80617a64-20b6-47b6-8240-c3bf3383fc1c",
            "refuuid": "72b773c6-8217-42c9-82c1-8f9104a414b4",
            "name": "CANNABINOID RECEPTOR 1",
            "unii": "NJ1Q2Q7LO5",
            "linking_id": "NJ1Q2Q7LO5",
            "ref_pname": "CANNABINOID RECEPTOR 1"
          }
        },
        {
          "uuid": "77dc4ab5-ab2f-4e41-a5a2-3545e4ac33f5",
          "amount": {
            "uuid": "00234e55-3bf4-44c9-8de6-0b8f9676de9c",
            "average": 2.5,
            "units": "NANOMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "references": [
            "4cbc8a9f-8ce1-405a-a811-84b6fca1ee27"
          ],
          "related_substance": {
            "uuid": "156e4bca-5b3b-42a5-94b0-01253467e275",
            "refuuid": "4da43617-82f9-4e30-b375-4d59d4f6fe58",
            "name": "CANNABINOID RECEPTOR 2",
            "unii": "SKEU5X23RI",
            "linking_id": "SKEU5X23RI",
            "ref_pname": "CANNABINOID RECEPTOR 2"
          }
        },
        {
          "uuid": "ff5d579a-d8d4-4b56-972a-33a7a46044b6",
          "type": "ACTIVE MOIETY",
          "references": [
            "24a88dc8-fabe-82df-0949-bdc3fc494efd"
          ],
          "related_substance": {
            "uuid": "2cf40ba2-1c2f-4730-ae78-7a73b30eca93",
            "refuuid": "926d32f9-42ef-4b43-bcc5-571a1c3b929a",
            "name": "AB-PINACA",
            "unii": "6J3KC3S2PA",
            "linking_id": "6J3KC3S2PA",
            "ref_pname": "AB-PINACA",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9e2b0bae-6422-4d9f-a015-98c937346d74",
          "name": "1H-INDAZOLE-3-CARBOXAMIDE, N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-PENTYL-",
          "stdName": "1H-INDAZOLE-3-CARBOXAMIDE, N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-PENTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62731765-f06b-4277-ecb4-bc4bb4e3e789"
          ],
          "display_name": false
        },
        {
          "uuid": "57670ab5-8d66-4ae4-86e7-a1842a55214c",
          "name": "AB-PINACA",
          "stdName": "AB-PINACA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aaf546eb-bb2b-ec9f-da84-f0dea5f58e71"
          ],
          "display_name": true
        },
        {
          "uuid": "12668fc0-3e53-4364-adc4-dbe264288aaf",
          "name": "N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-PENTYL-1H-INDAZOLE-3-CARBOXAMIDE",
          "stdName": "N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-PENTYL-1H-INDAZOLE-3-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62731765-f06b-4277-ecb4-bc4bb4e3e789"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "62731765-f06b-4277-ecb4-bc4bb4e3e789",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "24a88dc8-fabe-82df-0949-bdc3fc494efd",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "aaf546eb-bb2b-ec9f-da84-f0dea5f58e71",
          "citation": "https://www.deadiversion.usdoj.gov/fed_regs/rules/2017/fr0127.htm",
          "doc_type": "FEDERAL REGISTER",
          "public_domain": true
        },
        {
          "uuid": "d2d8d4d5-fc48-fd39-00fa-4d45afe526ce",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6ff247d8-ea63-a7b2-344a-7ce5db0daecb",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "3c8d12ec-8e36-4ff2-afa2-15b1675770f6",
          "citation": "Banister, Samuel D., et al. \"Pharmacology of indole and indazole synthetic cannabinoid designer drugs ab-fubinaca, adb-fubinaca, ab-pinaca, adb-pinaca, 5f-ab-pinaca, 5f-adb-pinaca, adbica, and 5f-adbica.\" ACS chemical neuroscience 6.9 (2015): 1546-1559.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acschemneuro.5b00112",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "4cbc8a9f-8ce1-405a-a811-84b6fca1ee27",
          "citation": "Banister, Samuel D., et al. \"Pharmacology of indole and indazole synthetic cannabinoid designer drugs ab-fubinaca, adb-fubinaca, ab-pinaca, adb-pinaca, 5f-ab-pinaca, 5f-adb-pinaca, adbica, and 5f-adbica.\" ACS chemical neuroscience 6.9 (2015): 1546-1559.",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "c0bad0d0-0f50-bae1-f506-8bbf8537f275",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7704f61e-9b20-e686-dc56-35b821823226",
          "id": "7704f61e-9b20-e686-dc56-35b821823226",
          "molfile": "\n  Marvin  01132106112D          \n\n 24 25  0  0  1  0            999 V2000\n   16.3919   -3.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6792   -4.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6792   -5.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3904   -5.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1015   -5.0397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1015   -4.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2758   -1.2720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5673   -2.6710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0176   -2.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9184   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8527   -1.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6604   -1.6087    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   19.2099   -2.2240    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   18.9518   -3.0076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5946   -2.5606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1442   -3.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8861   -3.9595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3712   -4.6270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8862   -5.2944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1380   -6.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5546   -6.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7681   -7.4603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1848   -8.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3983   -8.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  6  1  2  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n 19  5  1  0  0  0  0\n 17  6  1  0  0  0  0\n  9  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 13  9  1  0  0  0  0\n 12 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  1  0  0  0\n 14 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "CCCCCn1c2ccccc2c(C(=O)N[C@@H](C(C)C)C(=O)N)n1",
          "formula": "C18H26N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "94b0879f-498a-4050-976a-ed13f587f649"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "330.4253",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "926d32f9-42ef-4b43-bcc5-571a1c3b929a",
      "version": "16",
      "structure": {
        "id": "8baceb4d-6c2e-5b1f-af9e-ac813a16ad62",
        "molfile": "test1.mol\n  Marvin  01132107152D          \n\n 24 25  0  0  1  0            999 V2000\n   16.3919   -3.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6792   -4.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6792   -5.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3904   -5.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1015   -5.0397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1015   -4.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2758   -1.2720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5673   -2.6710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0176   -2.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9184   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8527   -1.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6604   -1.6087    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   19.2099   -2.2240    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   18.9518   -3.0076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5946   -2.5606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1442   -3.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8861   -3.9595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3712   -4.6270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8862   -5.2944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1380   -6.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5546   -6.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7681   -7.4603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1848   -8.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3983   -8.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  1  1  0  0  0  0\n 17  6  1  0  0  0  0\n  9  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 13  9  1  0  0  0  0\n 12 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  1  0  0  0\n 14 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19  5  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
        "smiles": "CCCCCn1c2ccccc2c(C(=O)N[C@@H](C(C)C)C(=O)N)n1",
        "formula": "C18H26N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "330.4253",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "62731765-f06b-4277-ecb4-bc4bb4e3e789"
        ],
        "stereo_centers": 1
      },
      "unii": "6J3KC3S2PA"
    }
  ]
}