{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9a6d122f-3688-4dd7-97b5-07ae00459815",
          "code": "3982-82-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3982-82-9",
          "code_system": "CAS",
          "references": [
            "2fe367ff-b548-42e2-90cc-e61b95560653",
            "c85dbf7c-c869-4689-9aa6-2f6c6d261fd9"
          ]
        },
        {
          "uuid": "9641de8f-faf9-4232-b2ba-e0b32ebb178d",
          "code": "223-620-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.474",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2fe367ff-b548-42e2-90cc-e61b95560653"
          ]
        },
        {
          "uuid": "7b93f000-87ac-4eb6-b5f1-c34adf4d9ba2",
          "code": "19882",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19882",
          "code_system": "PUBCHEM",
          "references": [
            "2fe367ff-b548-42e2-90cc-e61b95560653"
          ]
        },
        {
          "uuid": "7539770c-710a-f2d5-ee74-727975445e5e",
          "code": "DTXSID2052073",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2052073",
          "code_system": "EPA CompTox",
          "references": [
            "84d1cab3-19f3-00b0-fec2-964a8f939c61"
          ]
        },
        {
          "uuid": "8a44a3c8-6443-49af-8778-5685e865f16a",
          "code": "6IOT4Y7V2B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0ce3e0dd-b334-4950-8954-bc725eb260d4",
          "name": "1,1,5,5-TETRAPHENYL-1,3,3,5-TETRAMETHYLTRISILOXANE",
          "stdName": "1,1,5,5-TETRAPHENYL-1,3,3,5-TETRAMETHYLTRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "616ddf8a-0012-4db8-a1c3-ce96a47a4ab0",
            "6c17967b-b685-487b-ac66-73b789570e80"
          ],
          "display_name": false
        },
        {
          "uuid": "0f1bcee6-6fec-4a1b-a280-20df6ab5f8a9",
          "name": "1,3,3,5-TETRAMETHYL-1,1,5,5-TETRAPHENYLTRISILOXANE",
          "stdName": "1,3,3,5-TETRAMETHYL-1,1,5,5-TETRAPHENYLTRISILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89cebb2b-690d-4551-9bae-52f85225d8d8"
          ],
          "display_name": true
        },
        {
          "uuid": "6637d218-9761-4f6e-bfd4-82e7d9c192bf",
          "name": "DIMETHYLBIS(METHYLDIPHENYLSILYLOXY)SILANE",
          "stdName": "DIMETHYLBIS(METHYLDIPHENYLSILYLOXY)SILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "616ddf8a-0012-4db8-a1c3-ce96a47a4ab0",
            "6c17967b-b685-487b-ac66-73b789570e80"
          ],
          "display_name": false
        },
        {
          "uuid": "f6336d2e-98a5-4547-9ab9-c4c8b74580df",
          "name": "DOW CORNING 704",
          "stdName": "DOW CORNING 704",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "616ddf8a-0012-4db8-a1c3-ce96a47a4ab0",
            "6c17967b-b685-487b-ac66-73b789570e80"
          ],
          "display_name": false
        },
        {
          "uuid": "9b3a90ba-831d-42a5-9908-b5fa33d46ece",
          "name": "HIVAC F 4",
          "stdName": "HIVAC F 4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "616ddf8a-0012-4db8-a1c3-ce96a47a4ab0",
            "6c17967b-b685-487b-ac66-73b789570e80"
          ],
          "display_name": false
        },
        {
          "uuid": "53133842-c037-42c1-86f2-74bbeb244243",
          "name": "SILICONE DC 704",
          "stdName": "SILICONE DC 704",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "616ddf8a-0012-4db8-a1c3-ce96a47a4ab0",
            "6c17967b-b685-487b-ac66-73b789570e80"
          ],
          "display_name": false
        },
        {
          "uuid": "164ce0a3-26be-49dc-a865-0901c4cc6b60",
          "name": "TETRAMETHYL TETRAPHENYL TRISILOXANE",
          "stdName": "TETRAMETHYL TETRAPHENYL TRISILOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1c2eb88d-457f-4722-b7d4-0917bfc97e3d",
            "b21f50c3-031d-4382-ba4e-2210a7b2c0c0",
            "0f2bf585-9bae-4e34-bee5-c273c52fec45",
            "616ddf8a-0012-4db8-a1c3-ce96a47a4ab0"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ac7077a9-4c41-4a6d-ae87-5b8321493ed7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cfbf2164-46d2-48c5-b762-6c9df859f010",
          "name": "TRISILOXANE, 1,3,3,5-TETRAMETHYL-1,1,5,5-TETRAPHENYL-",
          "stdName": "TRISILOXANE, 1,3,3,5-TETRAMETHYL-1,1,5,5-TETRAPHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "616ddf8a-0012-4db8-a1c3-ce96a47a4ab0",
            "6c17967b-b685-487b-ac66-73b789570e80"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "89cebb2b-690d-4551-9bae-52f85225d8d8",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6c17967b-b685-487b-ac66-73b789570e80",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "616ddf8a-0012-4db8-a1c3-ce96a47a4ab0",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f2bf585-9bae-4e34-bee5-c273c52fec45",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c2eb88d-457f-4722-b7d4-0917bfc97e3d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fe367ff-b548-42e2-90cc-e61b95560653",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391031000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3454b9e1-6be5-44ff-a9e3-7ec837ebb7d5",
          "citation": "SRS import [6IOT4Y7V2B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6IOT4Y7V2B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391031000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2dd91999-7209-46af-99a0-98267aa2752b",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b21f50c3-031d-4382-ba4e-2210a7b2c0c0",
          "citation": "TETRAMETHYL TETRAPHENYL TRISILOXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "84d1cab3-19f3-00b0-fec2-964a8f939c61",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3982-82-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c85dbf7c-c869-4689-9aa6-2f6c6d261fd9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5a043ef0-ea2a-4cc6-b3b1-0d4a5f4430c7",
          "id": "5a043ef0-ea2a-4cc6-b3b1-0d4a5f4430c7",
          "molfile": "\n  Marvin  01132104402D          \n\n 33 36  0  0  0  0            999 V2000\n    7.3042   -4.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3042   -6.1900    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.3042   -7.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6008   -5.4366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -5.4366    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   10.2238   -5.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -6.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7058   -6.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7058   -7.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -7.9295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1284   -7.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1284   -6.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -4.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7268   -4.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7268   -3.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -2.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1446   -3.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1446   -4.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9511   -5.5548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1186   -5.5548    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2876   -5.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1186   -4.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3750   -4.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3750   -3.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1186   -3.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8332   -3.4726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8332   -4.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1186   -6.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4138   -6.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4138   -7.6159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1186   -8.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8332   -7.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8332   -6.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n 19  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5 13  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 20 28  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 27  2  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 33  2  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 32 31  2  0  0  0  0\n 33 32  1  0  0  0  0\nM  END",
          "smiles": "C[Si](C)(O[Si](C)(c1ccccc1)c2ccccc2)O[Si](C)(c3ccccc3)c4ccccc4",
          "formula": "C28H32O2Si3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8b28aaa6-54e6-487b-ab77-4d2dfeebb206"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "484.8097",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fea8d034-6b47-4688-8dcf-5bdc49870c7c",
      "version": "4",
      "structure": {
        "id": "64ff28bc-ed8a-4671-aa7b-9bcaeacea82f",
        "molfile": "\n  Marvin  01132105152D          \n\n 33 36  0  0  0  0            999 V2000\n    5.1186   -5.5548    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    5.1186   -4.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3750   -4.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3750   -3.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1186   -3.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8332   -3.4726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8332   -4.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1186   -6.3759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4138   -6.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4138   -7.6159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1186   -8.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8332   -7.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8332   -6.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9511   -5.5548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3042   -6.1900    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.6008   -5.4366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -5.4366    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -6.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7058   -6.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7058   -7.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -7.9295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1284   -7.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1284   -6.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -4.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7268   -4.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7268   -3.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -2.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1446   -3.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1446   -4.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2238   -5.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3042   -4.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3042   -7.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2876   -5.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  2  7  1  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n  8 13  2  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 18 23  1  0  0  0  0\n 17 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\n 24 29  2  0  0  0  0\n 17 30  1  0  0  0  0\n 15 31  1  0  0  0  0\n 15 32  1  0  0  0  0\n  1 33  1  0  0  0  0\nM  END",
        "smiles": "C[Si](C)(O[Si](C)(c1ccccc1)c2ccccc2)O[Si](C)(c3ccccc3)c4ccccc4",
        "formula": "C28H32O2Si3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "484.8097",
        "optical_activity": "NONE",
        "references": [
          "2dd91999-7209-46af-99a0-98267aa2752b",
          "3454b9e1-6be5-44ff-a9e3-7ec837ebb7d5"
        ],
        "stereo_centers": 0
      },
      "unii": "6IOT4Y7V2B"
    }
  ]
}