{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b3ddfff6-c637-4b14-b2e8-39e82abc1585", "code": "36631-30-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=36631-30-8", "code_system": "CAS", "references": [ "04685367-8145-4f14-8a31-1dd99477c53b", "a7f7fb42-8b3d-4a0b-9314-76cfb0f2d830" ] }, { "uuid": "03aad32e-d4b8-478f-87d8-710f427b0241", "code": "253-138-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.048.291", "code_system": "ECHA (EC/EINECS)", "references": [ "04685367-8145-4f14-8a31-1dd99477c53b" ] }, { "uuid": "4d167d93-78b5-40f8-90b5-82c7facee585", "code": "169794", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/169794", "code_system": "PUBCHEM", "references": [ "04685367-8145-4f14-8a31-1dd99477c53b" ] }, { "uuid": "c9763cd7-0242-4736-9125-38f94c14da32", "code": "1732390", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1732390/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "04685367-8145-4f14-8a31-1dd99477c53b" ] }, { "uuid": "1c5554ab-5472-f67b-5276-eba03ec3ec46", "code": "DTXSID3047180", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3047180", "code_system": "EPA CompTox", "references": [ "00ba912f-13b4-4639-38a9-9c2dc385eda4" ] }, { "uuid": "0bdc1dc6-dd20-4ffd-b344-8c9424d8cfdd", "code": "6IFP38QKFS", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ef5e51cf-e1fd-dd73-fda7-2386ce8e083d", "code": "6IFP38QKFS", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6IFP38QKFS", "code_system": "DAILYMED", "references": [ "db2ef790-dcf7-0473-2e07-562f70c52146" ] } ], "substance_class": "chemical", "names": [ { "uuid": "f123977f-2d78-499f-a3e5-5df150239c47", "name": "1,2,4-BENZENETRICARBOXYLIC ACID, 1,2,4-TRIISODECYL ESTER", "stdName": "1,2,4-BENZENETRICARBOXYLIC ACID, 1,2,4-TRIISODECYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5a7f8995-08bf-48a7-a0a9-7eacf66c6916", "bd475960-6cdc-46a9-a71e-daddce2b4268" ], "display_name": false }, { "uuid": "d645bf3b-a8fb-4f36-a977-65ffd6026bb9", "name": "DUB TMI", "stdName": "DUB TMI", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e800c8b6-e5f5-4382-a774-c78209bb3418", "5a7f8995-08bf-48a7-a0a9-7eacf66c6916" ], "display_name": false }, { "uuid": "66ed6afd-e5dd-472f-9620-11151f789285", "name": "TRIISODECYL TRIMELLITATE", "stdName": "TRIISODECYL TRIMELLITATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "f7d00855-60c3-491a-9e8b-65a3a4482d4b", "e800c8b6-e5f5-4382-a774-c78209bb3418", "ef3b041b-8743-4f93-8a97-c74c85c7eb24", "5a7f8995-08bf-48a7-a0a9-7eacf66c6916" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f49837a9-503e-44ca-8aae-a10a546e5298", "name_org": "INCI" } ] } ], "references": [ { "uuid": "f7d00855-60c3-491a-9e8b-65a3a4482d4b", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e800c8b6-e5f5-4382-a774-c78209bb3418", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5a7f8995-08bf-48a7-a0a9-7eacf66c6916", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bd475960-6cdc-46a9-a71e-daddce2b4268", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "04685367-8145-4f14-8a31-1dd99477c53b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391118000, "tags": [ "NOMEN" ] }, { "uuid": "14b9cf42-9147-4384-b442-5f914fcd992a", "citation": "SRS import [6IFP38QKFS]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6IFP38QKFS", "doc_type": "SRS", "public_domain": true, "document_date": 1493391118000, "tags": [ "NOMEN" ] }, { "uuid": "96da6fc4-0cac-496c-96d4-2e97ddd00520", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ef3b041b-8743-4f93-8a97-c74c85c7eb24", "citation": "TRIISODECYL TRIMELLITATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "00ba912f-13b4-4639-38a9-9c2dc385eda4", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=36631-30-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a7f7fb42-8b3d-4a0b-9314-76cfb0f2d830", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "db2ef790-dcf7-0473-2e07-562f70c52146", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "23a73aa8-b73e-4380-b611-f9bcb0d6c8e4", "id": "23a73aa8-b73e-4380-b611-f9bcb0d6c8e4", "molfile": "\n Marvin 01132101592D \n\n 45 45 0 0 0 0 999 V2000\n 15.0828 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3661 -4.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3661 -5.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6538 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9371 -4.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2249 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5126 -4.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7959 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0790 -4.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3669 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6547 -4.9682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6547 -5.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3669 -6.2078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9380 -6.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9380 -7.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2210 -7.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5089 -7.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7921 -7.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0799 -7.0327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7921 -8.2725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0799 -8.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3678 -8.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6510 -8.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9341 -8.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2219 -8.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5098 -8.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7929 -8.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7929 -9.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5098 -9.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0761 -9.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5089 -6.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2210 -5.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7921 -5.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7921 -4.9682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0799 -6.2078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3678 -5.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3678 -4.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6510 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6510 -3.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9341 -3.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9341 -2.4934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2219 -2.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2219 -1.2584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5098 -0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9341 -0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 12 1 0 0 0 0\n 14 15 1 0 0 0 0\n 32 14 2 0 0 0 0\n 15 16 2 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 31 2 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 33 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 43 45 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCCCOC(=O)c1ccc(c(c1)C(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C", "formula": "C39H66O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "52ab7c9d-a674-46f1-ad61-011f795c5304" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "630.9392", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "REPRESENTATIVE", "uuid": "f5b63717-014d-4adf-8f53-cfc54e688cbd", "version": "6", "structure": { "id": "b0eb90fa-bee0-4b6f-a65d-7ae308803815", "molfile": "\n Marvin 01132109102D \n\n 45 45 0 0 0 0 999 V2000\n 6.5089 -7.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5089 -6.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2210 -5.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9380 -6.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9380 -7.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2210 -7.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6547 -5.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3669 -6.2078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6547 -4.9682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3669 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0790 -4.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7959 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5126 -4.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2249 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9371 -4.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6538 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3661 -4.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0828 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3661 -5.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7921 -5.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7921 -4.9682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0799 -6.2078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3678 -5.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3678 -4.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6510 -4.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6510 -3.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9341 -3.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9341 -2.4934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2219 -2.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2219 -1.2584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5098 -0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9341 -0.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7921 -7.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0799 -7.0327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7921 -8.2725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0799 -8.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3678 -8.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6510 -8.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9341 -8.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2219 -8.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5098 -8.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7929 -8.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7929 -9.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5098 -9.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0761 -9.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 2 0 0 0 0\n 4 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 2 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 32 1 0 0 0 0\n 1 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 33 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 43 45 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCCCOC(=O)c1ccc(c(c1)C(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C", "formula": "C39H66O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "630.9392", "optical_activity": "NONE", "references": [ "14b9cf42-9147-4384-b442-5f914fcd992a", "96da6fc4-0cac-496c-96d4-2e97ddd00520" ], "stereo_centers": 0 }, "unii": "6IFP38QKFS" } ] }