{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "370ada05-573c-4826-b5cb-f54b6b6eb99c", "code": "105-97-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=105-97-5", "code_system": "CAS", "references": [ "bb53c36a-7094-43b4-96be-1288bcbdc87b", "fd2c6823-37ba-4a85-8264-4b9eacb2cd85" ] }, { "uuid": "07d68fa8-be6e-4e79-bda2-f0d2d774fbd3", "code": "203-349-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.046", "code_system": "ECHA (EC/EINECS)", "references": [ "bb53c36a-7094-43b4-96be-1288bcbdc87b" ] }, { "uuid": "cedfec33-0261-4425-a6b5-5b12e07f23f5", "code": "SUB179560", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "bb53c36a-7094-43b4-96be-1288bcbdc87b" ] }, { "uuid": "5e6efcc2-0a2a-4a0d-9f4c-75d6384d7feb", "code": "7783", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7783", "code_system": "PUBCHEM", "references": [ "bb53c36a-7094-43b4-96be-1288bcbdc87b" ] }, { "uuid": "83c9bbf4-5aef-cdb4-9150-0d7c3298ba5f", "code": "DTXSID0059328", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0059328", "code_system": "EPA CompTox", "references": [ "d90a5b8f-09d4-8fe4-416b-8d1546b5ec52" ] }, { "uuid": "3120906d-4ee9-4e4f-9b25-944869a72047", "code": "6I1ML2QMT3", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "adc391c4-61a8-bc63-e4fc-2f166630d97e", "code": "2566192", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2566192/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "03aa0d8e-1e19-19f1-c1e4-72dc86e4a4b3" ] }, { "uuid": "f0d2ea49-99c5-3207-935d-88be1193bd9e", "code": "100000164926", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "3ca31466-0e63-3ce9-81d3-a38ea9cdaf7c" ] }, { "uuid": "749e0f11-3455-7586-576c-65e6fc3f4813", "code": "4445", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4445", "code_system": "NSC", "references": [ "7d10c34b-0e8b-e721-25af-3c0fad646c21" ] }, { "uuid": "241858bd-74c0-55f9-9b44-bb8e3c9f719e", "code": "6I1ML2QMT3", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6I1ML2QMT3", "code_system": "DAILYMED", "references": [ "6ac86700-965f-2aa7-dcea-02d986fb618b" ] } ], "substance_class": "chemical", "names": [ { "uuid": "9fb06474-461f-44f5-b52a-d58fb7458003", "name": "DICAPRYL ADIPATE", "stdName": "DICAPRYL ADIPATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "0d6c5c15-b2fa-4eec-abf8-30ba4cf1d11f", "508bb01f-420b-4fd0-97cd-a328aee05167", "3818fffa-1917-4041-b0a7-851d2f2fe75e", "909ec75c-ef21-405e-9bb3-b6f8bb1d72f0", "0a5d9fac-ed21-488f-b5e2-b1ca1663ec84" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "053e5f93-8c9c-41b7-af71-d88b0055e4fe", "name_org": "INCI" } ] }, { "uuid": "0f17b5ff-88a5-4719-9aa2-a412360a9e24", "name": "DIDECYL ADIPATE", "stdName": "DIDECYL ADIPATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "508bb01f-420b-4fd0-97cd-a328aee05167", "909ec75c-ef21-405e-9bb3-b6f8bb1d72f0" ], "display_name": false }, { "uuid": "a22a4418-d1ea-46d9-aeac-d185338ab54a", "name": "DIDECYL HEXANEDIOATE", "stdName": "DIDECYL HEXANEDIOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "508bb01f-420b-4fd0-97cd-a328aee05167", "909ec75c-ef21-405e-9bb3-b6f8bb1d72f0" ], "display_name": false }, { "uuid": "96340d6f-b034-49b5-8c02-94b0444efb0e", "name": "NSC-4445", "stdName": "NSC-4445", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "eefd2c6d-2819-44ae-8ccc-bde1ae1cdc08", "508bb01f-420b-4fd0-97cd-a328aee05167" ], "display_name": false } ], "references": [ { "uuid": "909ec75c-ef21-405e-9bb3-b6f8bb1d72f0", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3818fffa-1917-4041-b0a7-851d2f2fe75e", "citation": "DL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "508bb01f-420b-4fd0-97cd-a328aee05167", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0a5d9fac-ed21-488f-b5e2-b1ca1663ec84", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "eefd2c6d-2819-44ae-8ccc-bde1ae1cdc08", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bb53c36a-7094-43b4-96be-1288bcbdc87b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390466000, "tags": [ "NOMEN" ] }, { "uuid": "c1a0d408-ca97-4103-a594-35555ef7483c", "citation": "SRS import [6I1ML2QMT3]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6I1ML2QMT3", "doc_type": "SRS", "public_domain": true, "document_date": 1493390466000, "tags": [ "NOMEN" ] }, { "uuid": "0d6c5c15-b2fa-4eec-abf8-30ba4cf1d11f", "citation": "DICAPRYL ADIPATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d90a5b8f-09d4-8fe4-416b-8d1546b5ec52", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=105-97-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3ca31466-0e63-3ce9-81d3-a38ea9cdaf7c", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "fd2c6823-37ba-4a85-8264-4b9eacb2cd85", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "03aa0d8e-1e19-19f1-c1e4-72dc86e4a4b3", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "7d10c34b-0e8b-e721-25af-3c0fad646c21", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "6ac86700-965f-2aa7-dcea-02d986fb618b", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d565f20f-0858-4c9e-bae0-ff9e0f40e39f", "id": "d565f20f-0858-4c9e-bae0-ff9e0f40e39f", "molfile": "\n Marvin 01132111032D \n\n 30 29 0 0 0 0 999 V2000\n 0.0000 -5.1063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7950 -5.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3154 -4.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1233 -4.6765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6206 -4.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4284 -4.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9385 -3.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7464 -3.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2462 -2.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0618 -3.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5590 -2.4030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3669 -2.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6673 -3.3170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8693 -1.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6876 -1.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1847 -1.3232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9926 -1.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5026 -0.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2023 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3106 -0.9037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6861 -1.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4939 -1.6935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8720 -2.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6877 -2.4884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0631 -3.2342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8711 -3.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2491 -4.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0674 -4.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4402 -4.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2481 -4.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 12 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\nM END", "smiles": "CCCCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCCCC", "formula": "C26H50O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4c77661f-bca4-482d-98ea-8d8f6b094f01" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "426.6738", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "cd7cc2a9-b96e-49ef-b1d8-7125225cc520", "version": "9", "structure": { "id": "c4bafffd-fb82-4754-b1c7-64815bc1347e", "molfile": "\n Marvin 01132110102D \n\n 30 29 0 0 0 0 999 V2000\n 7.3669 -2.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5026 -0.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6673 -3.3170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2023 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5590 -2.4030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3106 -0.9037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9926 -1.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8693 -1.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0618 -3.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6861 -1.6573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1847 -1.3232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6876 -1.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2462 -2.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4939 -1.6935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7950 -5.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4402 -4.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0674 -4.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3154 -4.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6206 -4.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4284 -4.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9385 -3.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8720 -2.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6877 -2.4884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0631 -3.2342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8711 -3.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2491 -4.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7464 -3.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1233 -4.6765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -5.1063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2481 -4.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 7 1 0 0 0 0\n 3 1 2 0 0 0 0\n 4 2 2 0 0 0 0\n 5 1 1 0 0 0 0\n 6 2 1 0 0 0 0\n 7 11 1 0 0 0 0\n 8 1 1 0 0 0 0\n 9 5 1 0 0 0 0\n 10 6 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 8 1 0 0 0 0\n 13 9 1 0 0 0 0\n 14 10 1 0 0 0 0\n 15 18 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 26 1 0 0 0 0\n 18 28 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 27 1 0 0 0 0\n 22 14 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 13 1 0 0 0 0\n 28 19 1 0 0 0 0\n 29 15 1 0 0 0 0\n 30 16 1 0 0 0 0\nM END", "smiles": "CCCCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCCCC", "formula": "C26H50O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "426.6738", "optical_activity": "NONE", "references": [ "c1a0d408-ca97-4103-a594-35555ef7483c", "909ec75c-ef21-405e-9bb3-b6f8bb1d72f0" ], "stereo_centers": 0 }, "unii": "6I1ML2QMT3" } ] }