{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "36b5c493-2577-407a-a319-c9e5a93187b2", "code": "35783-57-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=35783-57-4", "code_system": "CAS", "references": [ "d7cedadf-02fa-42e5-a08b-6cb02c0fc7cb", "56e47db5-7d99-43de-8ca5-9eb24f82f0d2" ] }, { "uuid": "ec5c2f04-b07c-470b-b953-3bf6c5c25677", "code": "215489", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/215489", "code_system": "PUBCHEM", "references": [ "d7cedadf-02fa-42e5-a08b-6cb02c0fc7cb" ] }, { "uuid": "0df207fb-d314-bc17-96c9-6c5268cd0961", "code": "DTXSID70189311", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70189311", "code_system": "EPA CompTox", "references": [ "e2cb08d7-6dc4-280f-c8fc-9e9d7837c3c6" ] }, { "uuid": "47a984be-3e04-44c4-ba7e-ff0fcca932f7", "code": "6HVN25U29H", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "a4b52e83-d321-4f74-ac44-0716f60f228f", "name": "2-Acetylzoxazolamine", "stdName": "2-ACETYLZOXAZOLAMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b6d2364d-2077-4d4b-a43d-4d713a2b8669" ], "display_name": false }, { "uuid": "cb126feb-9e05-42d7-96a4-3fab752ff34f", "name": "2-Benzoxazoleacetamide, 5-chloro-", "stdName": "2-BENZOXAZOLEACETAMIDE, 5-CHLORO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "56e47db5-7d99-43de-8ca5-9eb24f82f0d2" ], "display_name": false }, { "uuid": "6ceff53e-fd6f-40fd-9978-73a042fbeca0", "name": "5-Chloro-2-benzoxazoleacetamide", "stdName": "5-CHLORO-2-BENZOXAZOLEACETAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "56e47db5-7d99-43de-8ca5-9eb24f82f0d2" ], "display_name": true } ], "references": [ { "uuid": "b6d2364d-2077-4d4b-a43d-4d713a2b8669", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d7cedadf-02fa-42e5-a08b-6cb02c0fc7cb", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392695000, "tags": [ "NOMEN" ] }, { "uuid": "e2cb08d7-6dc4-280f-c8fc-9e9d7837c3c6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=35783-57-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "56e47db5-7d99-43de-8ca5-9eb24f82f0d2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "694b1cb8-5eb1-43d9-9342-bf69ad790d6f", "id": "694b1cb8-5eb1-43d9-9342-bf69ad790d6f", "molfile": "\n Marvin 01132105282D \n\n 14 15 0 0 0 0 999 V2000\n 0.0000 -1.5412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8198 -1.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2242 -2.2626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2351 -0.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0330 -0.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5359 -1.4920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3338 -1.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0333 -1.6450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7493 -1.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4652 -1.6396 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7547 -0.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0388 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3338 -0.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5413 -0.1311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 14 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 13 2 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1Cl)nc(CC(=O)N)o2", "formula": "C9H7ClN2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f1a0e04f-3c34-4220-8059-328dd9c05b70" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "210.6174", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "73df2f2c-b801-4d94-b25a-e137dbc4082c", "version": "5", "structure": { "id": "3b21c521-e000-4738-b75e-d9db20850051", "molfile": "\n Marvin 01132103082D \n\n 14 15 0 0 0 0 999 V2000\n 2.0330 -0.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5359 -1.4920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3338 -1.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5413 -0.1311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3338 -0.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2351 -0.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8198 -1.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0333 -1.6450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2242 -2.2626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0388 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7493 -1.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.5412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7547 -0.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4652 -1.6396 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 4 1 0 0 0 0\n 1 6 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 8 1 0 0 0 0\n 3 5 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 10 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 9 2 0 0 0 0\n 7 12 1 0 0 0 0\n 8 11 2 0 0 0 0\n 10 13 2 0 0 0 0\n 11 14 1 0 0 0 0\n 11 13 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1Cl)nc(CC(=O)N)o2", "formula": "C9H7ClN2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "210.6174", "optical_activity": "NONE", "references": [ "b6d2364d-2077-4d4b-a43d-4d713a2b8669" ], "stereo_centers": 0 }, "unii": "6HVN25U29H" } ] }