{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0af3dbec-ed38-491d-802b-dce5230642eb",
          "code": "82985-35-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=82985-35-1",
          "code_system": "CAS",
          "references": [
            "b1b2c298-ac14-4ed1-a519-778b46130f63",
            "b1493d7f-7557-4f60-877b-6a83a6b668ce"
          ]
        },
        {
          "uuid": "f73aba32-c792-4593-9274-cca6f69db547",
          "code": "280-084-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.072.782",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b1b2c298-ac14-4ed1-a519-778b46130f63"
          ]
        },
        {
          "uuid": "ca146ade-caef-4932-81f8-7c0aeb7c544e",
          "code": "157882",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/157882",
          "code_system": "PUBCHEM",
          "references": [
            "b1b2c298-ac14-4ed1-a519-778b46130f63"
          ]
        },
        {
          "uuid": "4684382b-4b39-524d-da40-108d448d190c",
          "code": "DTXSID6033825",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6033825",
          "code_system": "EPA CompTox",
          "references": [
            "8e376c1a-94c0-2424-d609-12824aae52d8"
          ]
        },
        {
          "uuid": "5091c725-0489-4fd0-a3d2-c89ceb184caf",
          "code": "6H96M8992G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2f957ca9-c8a1-4fc8-814f-2289505c3257",
          "name": "1-PROPANAMINE, 3-(TRIMETHOXYSILYL)-N-(3-(TRIMETHOXYSILYL)PROPYL)-",
          "stdName": "1-PROPANAMINE, 3-(TRIMETHOXYSILYL)-N-(3-(TRIMETHOXYSILYL)PROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c89c302-1bc3-41d3-b631-829d0e267315"
          ],
          "display_name": false
        },
        {
          "uuid": "79e67c50-1dfc-471c-8f6d-d24af59e17df",
          "name": "3-(TRIMETHOXYSILYL)-N-(3-(TRIMETHOXYSILYL)PROPYL)PROPAN-1-AMINE",
          "stdName": "3-(TRIMETHOXYSILYL)-N-(3-(TRIMETHOXYSILYL)PROPYL)PROPAN-1-AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b2d6b-63d2-4682-a194-73cf440662b6"
          ],
          "display_name": true
        },
        {
          "uuid": "841cff9a-80b5-455b-8a72-1de93d3db9bb",
          "name": "BIS(.GAMMA.-TRIMETHOXYSILYLPROPYL)AMINE",
          "stdName": "BIS(.GAMMA.-TRIMETHOXYSILYLPROPYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c89c302-1bc3-41d3-b631-829d0e267315"
          ],
          "display_name": false
        },
        {
          "uuid": "b1a0f98b-742d-4d99-9aa8-90c6a98c7e33",
          "name": "BIS(3-(TRIMETHOXYSILYL)PROPYL)AMINE",
          "stdName": "BIS(3-(TRIMETHOXYSILYL)PROPYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c89c302-1bc3-41d3-b631-829d0e267315"
          ],
          "display_name": false
        },
        {
          "uuid": "41fea39e-3d37-4398-85f5-c3c4f6a0f92e",
          "name": "BIS(TRIMETHOXYSILYLPROPYL)AMINE",
          "stdName": "BIS(TRIMETHOXYSILYLPROPYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c89c302-1bc3-41d3-b631-829d0e267315"
          ],
          "display_name": false
        },
        {
          "uuid": "2df2587a-d8d2-4b10-b3ab-71bac69a633a",
          "name": "DYNASYLAN 1124",
          "stdName": "DYNASYLAN 1124",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70f72194-a247-4a14-b6af-023784f2c059"
          ],
          "display_name": false
        },
        {
          "uuid": "a824c92a-6d0f-461b-8474-ef865b2d2edf",
          "name": "J278.704K",
          "stdName": "J278.704K",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45ab946c-27bb-4c09-aefb-daf0b82e69d6"
          ],
          "display_name": false
        },
        {
          "uuid": "062a47a7-8d4a-4c73-8ee2-39ef4edc7ccc",
          "name": "N,N-BIS(3-(TRIMETHOXYSILYL)PROPYL)AMINE",
          "stdName": "N,N-BIS(3-(TRIMETHOXYSILYL)PROPYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c89c302-1bc3-41d3-b631-829d0e267315"
          ],
          "display_name": false
        },
        {
          "uuid": "08deffd0-7092-4c3c-a43d-42a89e843ac0",
          "name": "SILQUEST A-1170",
          "stdName": "SILQUEST A-1170",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70f72194-a247-4a14-b6af-023784f2c059"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "557b2d6b-63d2-4682-a194-73cf440662b6",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "70f72194-a247-4a14-b6af-023784f2c059",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45ab946c-27bb-4c09-aefb-daf0b82e69d6",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J278.704K",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J278.704K",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c89c302-1bc3-41d3-b631-829d0e267315",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1b2c298-ac14-4ed1-a519-778b46130f63",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392038000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37dc4456-d068-4400-9f3a-9ab4420bba13",
          "citation": "SRS import [6H96M8992G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6H96M8992G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392038000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e376c1a-94c0-2424-d609-12824aae52d8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=82985-35-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b1493d7f-7557-4f60-877b-6a83a6b668ce",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "78fbb9e6-7c99-7707-f458-15c536c4bc5f",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "79d1434d-1588-4465-b008-16790c4b9745",
          "id": "79d1434d-1588-4465-b008-16790c4b9745",
          "molfile": "\n  Marvin  01132106202D          \n\n 21 20  0  0  0  0            999 V2000\n    1.9547   -5.3364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2412   -4.9202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2412   -4.0952    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    2.0662   -4.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4750   -3.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3000   -3.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7162   -2.6682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5412   -2.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9574   -1.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7824   -1.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1911   -1.2337    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.9121   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9121   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4777   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4777    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6074   -0.5203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4324   -0.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2412   -3.2702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5203   -2.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4162   -4.0952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 18  1  0  0  0  0\n  3 20  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 14  1  0  0  0  0\n 11 16  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "CO[Si](CCCNCCC[Si](OC)(OC)OC)(OC)OC",
          "formula": "C12H31NO6Si2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4c72c58e-92aa-45f5-9dcf-d292138b11a2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "341.5489",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "59ae95f7-d499-433b-a0e1-598fc319928f",
      "version": "4",
      "structure": {
        "id": "082903c4-6d1c-4d6a-8131-4103bdaa54b1",
        "molfile": "\n  Marvin  01132100422D          \n\n 21 20  0  0  0  0            999 V2000\n    1.2412   -4.0952    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    2.0662   -4.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2412   -4.9202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2412   -3.2702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4162   -4.0952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4750   -3.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9547   -5.3364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5203   -2.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3000   -3.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7162   -2.6682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5412   -2.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9574   -1.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7824   -1.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1911   -1.2337    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.9121   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4777   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6074   -0.5203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9121   -2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4777    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4324   -0.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 18 21  1  0  0  0  0\nM  END",
        "smiles": "CO[Si](CCCNCCC[Si](OC)(OC)OC)(OC)OC",
        "formula": "C12H31NO6Si2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "341.5489",
        "optical_activity": "NONE",
        "references": [
          "37dc4456-d068-4400-9f3a-9ab4420bba13",
          "557b2d6b-63d2-4682-a194-73cf440662b6"
        ],
        "stereo_centers": 0
      },
      "unii": "6H96M8992G"
    }
  ]
}