{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "84957d13-1ec6-4061-9cbf-ee8b104396f7",
          "code": "73590-85-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=73590-85-9",
          "code_system": "CAS",
          "references": [
            "0760936a-cb14-409a-84b3-83e646ecefe1",
            "516b02ee-1fab-454b-9e2d-3ad79260ee4f"
          ]
        },
        {
          "uuid": "76bc0002-4dd3-4d24-81d8-1f7498824417",
          "code": "SUB11376MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0760936a-cb14-409a-84b3-83e646ecefe1"
          ]
        },
        {
          "uuid": "898e2bab-d5a6-4018-87a9-1c36ada0325b",
          "code": "6185",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6185",
          "code_system": "INN",
          "references": [
            "0760936a-cb14-409a-84b3-83e646ecefe1"
          ]
        },
        {
          "uuid": "e6368716-28a6-4033-a479-5665f49692e3",
          "code": "C76913",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76913",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0760936a-cb14-409a-84b3-83e646ecefe1"
          ]
        },
        {
          "uuid": "80f3ac0e-ffc4-45b8-9a50-34e712cf9600",
          "code": "CHEMBL892",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL892",
          "code_system": "ChEMBL",
          "references": [
            "0760936a-cb14-409a-84b3-83e646ecefe1"
          ]
        },
        {
          "uuid": "0ab894b7-33a8-4644-9280-e875091f8776",
          "code": "155794",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/155794",
          "code_system": "PUBCHEM",
          "references": [
            "0760936a-cb14-409a-84b3-83e646ecefe1"
          ]
        },
        {
          "uuid": "1b052d31-64e8-1ab9-ab6e-4768108b215e",
          "code": "DTXSID7057816",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7057816",
          "code_system": "EPA CompTox",
          "references": [
            "933de57e-15a4-ffc8-67e5-059814500eaa"
          ]
        },
        {
          "uuid": "971dd8d1-7070-cef9-21b6-307af6474430",
          "code": "C29723",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Anti-ulcer Agent[C29701]|Proton Pump Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29723",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d8ffc69f-3819-a3e8-a07e-6ca5913f28de"
          ]
        },
        {
          "uuid": "d4caff6f-dcb5-4846-9b88-f0f60f32867b",
          "code": "6FFV1V867C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "78ad4f17-fb4e-e2f1-a54e-d5586983e769",
          "code": "100000076658",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0117c6d7-a09d-beec-d933-85dc56b871ce"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "fb5ca90e-bf48-4ed7-8329-1f0024d28816",
          "amount": {
            "uuid": "b012ee6d-8513-475d-baae-24c072f8232f"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "59dfd19a-1d89-4422-88a3-bdbe8a5a16af",
            "refuuid": "affcef69-9547-4255-9f15-aad66f238687",
            "name": "Ufiprazole",
            "unii": "6FFV1V867C",
            "linking_id": "6FFV1V867C",
            "ref_pname": "Ufiprazole",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "07eae247-41ed-4bbf-b4e7-33d6d288ac54",
          "amount": {
            "uuid": "e60932c8-7f24-4079-9e82-aae5a291b9d0"
          },
          "type": "PARENT->METABOLITE",
          "references": [
            "26ec3b52-5643-4c37-9c67-8189b070aad8"
          ],
          "related_substance": {
            "uuid": "37a5072c-07bd-461f-9969-942511a9d640",
            "refuuid": "1c302e89-d600-499b-a517-47797efc9550",
            "name": "OMEPRAZOLE",
            "unii": "KG60484QX9",
            "linking_id": "KG60484QX9",
            "ref_pname": "OMEPRAZOLE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ffe83043-a769-01db-d0fe-1e4c60b9e7f0",
          "name": "OMEPRAZOLE IMPURITY C [EP IMPURITY]",
          "stdName": "OMEPRAZOLE IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ff8a946-743c-466c-a3f0-795a62ba61d2"
          ],
          "display_name": false
        },
        {
          "uuid": "2659f71b-13a8-15d9-d2f0-39f4bd72701e",
          "name": "OMEPRAZOLE MAGNESIUM IMPURITY C [EP IMPURITY]",
          "stdName": "OMEPRAZOLE MAGNESIUM IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ff8a946-743c-466c-a3f0-795a62ba61d2"
          ],
          "display_name": false
        },
        {
          "uuid": "e183714f-0ec0-417d-8ff8-e6881410bc3c",
          "name": "OMEPRAZOLE SULFIDE",
          "stdName": "OMEPRAZOLE SULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26ec3b52-5643-4c37-9c67-8189b070aad8"
          ],
          "display_name": false
        },
        {
          "uuid": "2868c1ef-22d8-47e4-ab75-1625ffe7236e",
          "name": "Ufiprazole",
          "stdName": "UFIPRAZOLE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e9aad10-3e6d-4023-8e6b-658eed08ca1b",
            "e632c867-eb81-4fa3-b198-3c5648a89068",
            "aa2f51c9-a868-4879-8665-9fee4348a260",
            "c7acf911-a370-46fa-933a-49196c1cec01",
            "96783924-fc63-4fb0-b202-67e78da60820"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "19af427e-6521-416a-a2e6-88a8b9359e71",
              "name_org": "INN"
            },
            {
              "uuid": "fe23b67c-3f89-4446-9c06-f84fe21d2eb0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d774f1e8-79fa-46f0-8ee0-2f51e4794ddd",
          "name": "ufiprazole [INN]",
          "stdName": "UFIPRAZOLE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e632c867-eb81-4fa3-b198-3c5648a89068"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c7acf911-a370-46fa-933a-49196c1cec01",
          "citation": "USP Dictionary 2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e632c867-eb81-4fa3-b198-3c5648a89068",
          "citation": "INN Proposed List 58",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL58.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ff8a946-743c-466c-a3f0-795a62ba61d2",
          "citation": "EP 7.8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96783924-fc63-4fb0-b202-67e78da60820",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0760936a-cb14-409a-84b3-83e646ecefe1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390315000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94499eb7-3d61-48de-ab76-93346632ff6d",
          "citation": "SRS import [6FFV1V867C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6FFV1V867C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390315000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38221817-6491-4696-8fb6-2696877d3920",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa2f51c9-a868-4879-8665-9fee4348a260",
          "citation": "UFIPRAZOLE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8e9aad10-3e6d-4023-8e6b-658eed08ca1b",
          "citation": "UFIPRAZOLE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "933de57e-15a4-ffc8-67e5-059814500eaa",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=73590-85-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0117c6d7-a09d-beec-d933-85dc56b871ce",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d8ffc69f-3819-a3e8-a07e-6ca5913f28de",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "516b02ee-1fab-454b-9e2d-3ad79260ee4f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "26ec3b52-5643-4c37-9c67-8189b070aad8",
          "citation": "J Chromatogr 1983;278(2):311",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "55635590-ba4b-4378-90b8-85f0902d0886",
          "id": "55635590-ba4b-4378-90b8-85f0902d0886",
          "molfile": "\n  Marvin  01132104262D          \n\n 23 25  0  0  0  0            999 V2000\n    7.7060   -2.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9916   -3.0300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2771   -2.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2771   -1.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5626   -1.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8482   -1.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0636   -1.5375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5787   -2.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7537   -2.2050    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3412   -1.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5162   -1.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1037   -0.7760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2787   -0.7760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1338   -1.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9588   -1.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2787   -2.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1338   -2.9194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9588   -2.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1037   -2.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5162   -2.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0636   -2.8725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8482   -2.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5626   -3.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 23  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 22  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 21  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  2  0  0  0  0\n 16 17  1  0  0  0  0\n 19 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "Cc1cnc(CSc2[nH]c3ccc(cc3n2)OC)c(C)c1OC",
          "formula": "C17H19N3O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "db98471a-a252-4457-b1af-d10c982b519d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "329.4184",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "affcef69-9547-4255-9f15-aad66f238687",
      "version": "14",
      "structure": {
        "id": "f9ba0aa0-754f-425e-9977-239d81091133",
        "molfile": "\n  Marvin  01132112562D          \n\n 23 25  0  0  0  0            999 V2000\n    3.5787   -2.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0636   -2.8725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8482   -2.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8482   -1.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0636   -1.5375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5626   -3.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2771   -2.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2771   -1.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5626   -1.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7537   -2.2050    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3412   -1.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5162   -1.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1037   -2.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2787   -2.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1338   -1.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2787   -0.7760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1037   -0.7760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9588   -1.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5162   -2.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1338   -2.9194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9588   -2.9194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9916   -3.0300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7060   -2.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  1  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  4  9  2  0  0  0  0\n  3  6  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 12 17  2  0  0  0  0\n 15 18  1  0  0  0  0\n 13 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 14 20  1  0  0  0  0\n 11 12  1  0  0  0  0\n 10 11  1  0  0  0  0\n  1 10  1  0  0  0  0\n 22 23  1  0  0  0  0\n  7 22  1  0  0  0  0\nM  END",
        "smiles": "Cc1cnc(CSc2[nH]c3ccc(cc3n2)OC)c(C)c1OC",
        "formula": "C17H19N3O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "329.4184",
        "optical_activity": "NONE",
        "references": [
          "38221817-6491-4696-8fb6-2696877d3920",
          "94499eb7-3d61-48de-ab76-93346632ff6d",
          "e632c867-eb81-4fa3-b198-3c5648a89068"
        ],
        "stereo_centers": 0
      },
      "unii": "6FFV1V867C"
    }
  ]
}