{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "42a38a70-f373-44ed-ba66-064d590039e4",
          "code": "QP53AF01",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Organophosphorous compounds|phoxime",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AF01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "a0b9d78b-803a-463e-b64b-5d29934949ad",
          "code": "14816-18-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14816-18-3",
          "code_system": "CAS",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4",
            "e7104925-d07c-4bc6-9c17-7c7b0afbc5cf"
          ]
        },
        {
          "uuid": "95e8a495-6332-4045-aa81-1eda6779b58e",
          "code": "C80605",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80605",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "e442ed2d-6f2e-4531-a508-0636952385a2",
          "code": "C003135",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67003135",
          "code_system": "MESH",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "ac5e972a-ce6f-4f7b-beb0-866d2ce49700",
          "code": "PHOXIM",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phoxim",
          "code_system": "WIKIPEDIA",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "2c88f162-d4eb-41d6-a09e-79468e968f1c",
          "code": "SUB09797MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "c8daf7fe-ba90-4f74-b180-57f1cb9fa231",
          "code": "598800",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4471",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "f405597f-9f66-491e-b3ea-869903d675b6",
          "code": "2565",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2565",
          "code_system": "INN",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "a818a10e-6d7d-4c8f-bcfe-953c5ee18cc0",
          "code": "m8748",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8748?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "c8bbc168-d394-456a-95a6-cde80b091286",
          "code": "CHEMBL1906626",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1906626",
          "code_system": "ChEMBL",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "5687f3d5-9d04-484c-a807-75f3159c4068",
          "code": "238-887-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.337",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "215aa1dd-7a30-4a4e-bdc7-7d03f5f11acd",
          "code": "26927",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/26927",
          "code_system": "PUBCHEM",
          "references": [
            "ddb2d90d-519f-46e4-915b-271ad7a6c4e4"
          ]
        },
        {
          "uuid": "72c1cc0d-5a0c-4ef6-2c4e-76c3c4908b0b",
          "code": "DTXSID8034324",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8034324",
          "code_system": "EPA CompTox",
          "references": [
            "5aeb3023-0c29-bf74-1207-82d89f4c938e"
          ]
        },
        {
          "uuid": "50c51565-b789-c310-6a87-9f6469e47640",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a7fafca9-98f9-3d92-84a1-3a87bffa2b31"
          ]
        },
        {
          "uuid": "4e8b7371-ac49-4f5c-a0af-5b20220db5f5",
          "code": "6F5V775VPO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "08b4d461-71fc-dafd-6f23-d3bbb4384c19",
          "code": "38812",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38812",
          "code_system": "CHEBI",
          "references": [
            "a7fafca9-98f9-3d92-84a1-3a87bffa2b31"
          ]
        },
        {
          "uuid": "eec21547-32a3-0d8d-f274-1298b9a36a86",
          "code": "100000082468",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "23eb6e3e-97f6-4316-6d69-7f9fef240fb2"
          ]
        },
        {
          "uuid": "ba769c0c-2714-44e7-69fd-bc5084ca912b",
          "code": "phoxim",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/phoxim.html",
          "code_system": "ALANWOOD",
          "references": [
            "28ed2ae4-5863-7aa1-5220-dcbf91caa141"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ca9f960d-c34c-4e98-a17e-34950dc63be1",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5cf36a39-137f-405a-8acf-6947ba7f25ff",
            "refuuid": "81c7f50d-0de6-4446-bb88-1d1d94c220ff",
            "name": "PHOXIM",
            "unii": "6F5V775VPO",
            "linking_id": "6F5V775VPO",
            "ref_pname": "PHOXIM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b1cc32cb-6ec4-4e8d-9239-b7ee5e51553b",
          "name": "(E,Z)-N-((DIETHOXYPHOSPHOROTHIOYL)OXY)BENZENECARBOXIMIDOYL CYANIDE",
          "stdName": "(E,Z)-N-((DIETHOXYPHOSPHOROTHIOYL)OXY)BENZENECARBOXIMIDOYL CYANIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "7c58f4da-2c95-42cc-8572-3bc05181e284"
          ],
          "display_name": false
        },
        {
          "uuid": "6505c053-b152-483c-a1c7-81d047f16ce8",
          "name": "BAY 77488",
          "stdName": "BAY 77488",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "e3a5cf0d-b011-45ac-8155-ab603f5e9b44"
          ],
          "display_name": false
        },
        {
          "uuid": "afae0b34-13d6-4f48-a73e-1b3c887af91e",
          "name": "BAY-77488",
          "stdName": "BAY-77488",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "6b1d478a-bfd5-4514-bbfe-bfda13b74cab"
          ],
          "display_name": false
        },
        {
          "uuid": "adbfdee7-fbaa-46d5-8d40-cbc9292c2863",
          "name": "BAYER 9053",
          "stdName": "BAYER 9053",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7898342f-2558-4360-9f32-b97f4a37a2cb"
          ],
          "display_name": false
        },
        {
          "uuid": "023fc7d3-e055-4e27-ba88-72bddbe9ed86",
          "name": "BAYER-9053",
          "stdName": "BAYER-9053",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "6a1ada5a-d37d-40eb-a62f-0da506cf5c16"
          ],
          "display_name": false
        },
        {
          "uuid": "463dac1e-91da-4d81-94a9-cab796a1b42c",
          "name": "BAYTHION",
          "stdName": "BAYTHION",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "7c58f4da-2c95-42cc-8572-3bc05181e284"
          ],
          "display_name": false
        },
        {
          "uuid": "3802c4c1-71b9-44dd-a90f-f836ed30eccd",
          "name": "PHENYLGLYOXYLNITRILE OXIME O,O-DIETHYL PHOSPHOROTHIOATE",
          "stdName": "PHENYLGLYOXYLNITRILE OXIME O,O-DIETHYL PHOSPHOROTHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7898342f-2558-4360-9f32-b97f4a37a2cb"
          ],
          "display_name": false
        },
        {
          "uuid": "cde5ff01-0c77-4e30-af94-38069f29787c",
          "name": "PHOXIM",
          "stdName": "PHOXIM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7898342f-2558-4360-9f32-b97f4a37a2cb",
            "236a5703-3482-4a42-9f74-8f636528d313",
            "8615546b-8ebd-4b1a-81bb-c15f6acdf684",
            "91f5564c-433c-4c1d-9a7b-3e49301aa704",
            "21a1270b-ecd6-4374-a69c-927c18c3325b",
            "7ffa8918-d9ad-4d23-b489-8634318ff5bf",
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "1a7a94ff-7bc7-478d-a298-bb812ec6d70b",
            "9501df9f-511b-4469-b957-730db54e5885",
            "e68db196-3ee7-4590-a83c-a540dc6aa87e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "63002170-6dd6-4539-9166-f72df6580c1a",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "35d4155d-c97f-40f9-93cb-be5ee8d2dca3",
          "name": "PHOXIM [ISO]",
          "stdName": "PHOXIM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ffa8918-d9ad-4d23-b489-8634318ff5bf",
            "162b96c2-1b5c-402e-a0c7-014666205598"
          ],
          "display_name": false
        },
        {
          "uuid": "394d5b4c-98c9-42e3-86a9-0b7179386bdd",
          "name": "PHOXIM [MART.]",
          "stdName": "PHOXIM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a7a94ff-7bc7-478d-a298-bb812ec6d70b"
          ],
          "display_name": false
        },
        {
          "uuid": "16ccede6-96b8-4034-9b52-a52bb954f328",
          "name": "PHOXIM [MI]",
          "stdName": "PHOXIM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "21a1270b-ecd6-4374-a69c-927c18c3325b"
          ],
          "display_name": false
        },
        {
          "uuid": "66301c74-1d38-412e-ac1c-383c246ebf9f",
          "name": "PHOXIME",
          "stdName": "PHOXIME",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "47f5ed45-c958-4d1d-946d-3620ff4bc42a"
          ],
          "display_name": false
        },
        {
          "uuid": "b1837264-b978-463d-b6ee-56d61c153a83",
          "name": "SEBACIL (INSECTICIDE)",
          "stdName": "SEBACIL (INSECTICIDE)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "7c58f4da-2c95-42cc-8572-3bc05181e284"
          ],
          "display_name": false
        },
        {
          "uuid": "0ae3d01f-ccb4-499d-89d2-7ec5e6d1a7ae",
          "name": "VALEXON",
          "stdName": "VALEXON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "7c58f4da-2c95-42cc-8572-3bc05181e284"
          ],
          "display_name": false
        },
        {
          "uuid": "5868e9cb-1738-410d-a1f9-298864442e64",
          "name": "VOLATON",
          "stdName": "VOLATON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "162b96c2-1b5c-402e-a0c7-014666205598",
            "7c58f4da-2c95-42cc-8572-3bc05181e284"
          ],
          "display_name": false
        },
        {
          "uuid": "55b4cb1e-a44b-4fbb-bbf1-719a104505d6",
          "name": "phoxim [INN]",
          "stdName": "PHOXIM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91f5564c-433c-4c1d-9a7b-3e49301aa704"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7898342f-2558-4360-9f32-b97f4a37a2cb",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "91f5564c-433c-4c1d-9a7b-3e49301aa704",
          "citation": "INN Proposed List 20",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL20.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1a7a94ff-7bc7-478d-a298-bb812ec6d70b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21a1270b-ecd6-4374-a69c-927c18c3325b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "162b96c2-1b5c-402e-a0c7-014666205598",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3a5cf0d-b011-45ac-8155-ab603f5e9b44",
          "citation": "http://pubs.acs.org/doi/abs/10.1021/jf60204a038",
          "url": "http://pubs.acs.org/doi/abs/10.1021/jf60204a038",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ffa8918-d9ad-4d23-b489-8634318ff5bf",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c58f4da-2c95-42cc-8572-3bc05181e284",
          "citation": "http://en.wikipedia.org/wiki/Phoxim",
          "url": "http://en.wikipedia.org/wiki/Phoxim",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47f5ed45-c958-4d1d-946d-3620ff4bc42a",
          "citation": "vatc",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b1d478a-bfd5-4514-bbfe-bfda13b74cab",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a1ada5a-d37d-40eb-a62f-0da506cf5c16",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ddb2d90d-519f-46e4-915b-271ad7a6c4e4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cfba300-78ef-4663-b7c9-1b1d02a119c8",
          "citation": "SRS import [6F5V775VPO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6F5V775VPO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "236a5703-3482-4a42-9f74-8f636528d313",
          "citation": "PHOXIM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8615546b-8ebd-4b1a-81bb-c15f6acdf684",
          "citation": "PHOXIM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9501df9f-511b-4469-b957-730db54e5885",
          "citation": "PHOXIM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e68db196-3ee7-4590-a83c-a540dc6aa87e",
          "citation": "PHOXIM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5aeb3023-0c29-bf74-1207-82d89f4c938e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14816-18-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "23eb6e3e-97f6-4316-6d69-7f9fef240fb2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a7fafca9-98f9-3d92-84a1-3a87bffa2b31",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e7104925-d07c-4bc6-9c17-7c7b0afbc5cf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "28ed2ae4-5863-7aa1-5220-dcbf91caa141",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ff3a0892-d6aa-4166-be86-95b64c8ac91d",
          "id": "ff3a0892-d6aa-4166-be86-95b64c8ac91d",
          "molfile": "\n  Marvin  01132113132D          \n\n 19 19  0  0  0  0            999 V2000\n    2.5600   -4.5705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3813   -4.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7748   -3.8177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6102   -3.7915    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4521   -3.7664    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6334   -4.6324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3662   -5.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3845   -5.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5790   -2.9652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2820   -2.5439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9925   -2.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9925   -1.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9925   -0.4714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7219   -2.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4282   -2.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1387   -2.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1387   -3.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4282   -3.7957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7219   -3.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  4  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  3  0  0  0\n 11 12  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12 13  3  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "CCOP(=S)(OCC)ON=C(C#N)c1ccccc1",
          "formula": "C12H15N2O3PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "05a13559-f326-4507-b8e6-1f3d71bf8a7f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "298.2994",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "81c7f50d-0de6-4446-bb88-1d1d94c220ff",
      "version": "8",
      "structure": {
        "id": "4c679278-3052-499d-b0cc-ca8ef4889adc",
        "molfile": "\n  Marvin  01132103592D          \n\n 19 19  0  0  0  0            999 V2000\n    4.6102   -3.7915    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5790   -2.9652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7748   -3.8177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6334   -4.6324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4521   -3.7664    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2820   -2.5439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3813   -4.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3662   -5.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9925   -2.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5600   -4.5705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3845   -5.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7219   -2.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9925   -1.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4282   -2.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7219   -3.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9925   -0.4714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1387   -2.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4282   -3.7957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1387   -3.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  6  9  2  3  0  0  0\n  7 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  2  0  0  0  0\n 13 16  3  0  0  0  0\n 14 17  2  0  0  0  0\n 15 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 19  2  0  0  0  0\nM  END",
        "smiles": "CCOP(=S)(OCC)ON=C(C#N)c1ccccc1",
        "formula": "C12H15N2O3PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "298.2994",
        "optical_activity": "NONE",
        "references": [
          "7898342f-2558-4360-9f32-b97f4a37a2cb",
          "8cfba300-78ef-4663-b7c9-1b1d02a119c8",
          "91f5564c-433c-4c1d-9a7b-3e49301aa704"
        ],
        "stereo_centers": 0
      },
      "unii": "6F5V775VPO"
    }
  ]
}