{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "52db8c50-ef61-4e28-9ad3-d5a569ae645c", "code": "41484-35-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=41484-35-9", "code_system": "CAS", "references": [ "fbd1d3df-787f-4551-ad92-0258c4b97308", "b3bc4e8b-0ba0-4cb8-91b1-f4ab169082af" ] }, { "uuid": "e20fe968-3a16-47ce-8304-be1a342b4719", "code": "64883", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/64883", "code_system": "PUBCHEM", "references": [ "fbd1d3df-787f-4551-ad92-0258c4b97308" ] }, { "uuid": "4a25a6c5-be7e-46c0-99c9-18f2658ccc7d", "code": "255-392-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.340", "code_system": "ECHA (EC/EINECS)", "references": [ "fbd1d3df-787f-4551-ad92-0258c4b97308" ] }, { "uuid": "6de7d6cf-528e-13a4-a46e-71d5a5e715f9", "code": "DTXSID7028011", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7028011", "code_system": "EPA CompTox", "references": [ "def024e3-c557-ec47-97e5-e044f4d3fd88" ] }, { "uuid": "783545c9-b8db-400a-bf4e-4eb0ff4e99f7", "code": "6F5OZW34JZ", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "f3237245-3675-48e6-8274-59651c9548d4", "name": "BENZENEPROPANOIC ACID, 3,5-BIS(1,1-DIMETHYLETHYL)-4-HYDROXY- , THIODI-2,1-ETHANEDIYL ESTER", "stdName": "BENZENEPROPANOIC ACID, 3,5-BIS(1,1-DIMETHYLETHYL)-4-HYDROXY- , THIODI-2,1-ETHANEDIYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "178312f8-e76b-48b6-b3a3-93d36c7d92ff", "e90712e3-aa38-4bae-9a40-806c8c57e638" ], "display_name": false }, { "uuid": "16727a58-f259-4c9b-8c72-9255711ed8bc", "name": "FENOZAN 30", "stdName": "FENOZAN 30", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "178312f8-e76b-48b6-b3a3-93d36c7d92ff", "e90712e3-aa38-4bae-9a40-806c8c57e638" ], "display_name": false }, { "uuid": "3e032ac8-23b8-416a-83b5-c3e4e27a480b", "name": "IRGANOX 1035", "stdName": "IRGANOX 1035", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "178312f8-e76b-48b6-b3a3-93d36c7d92ff", "e90712e3-aa38-4bae-9a40-806c8c57e638" ], "display_name": false }, { "uuid": "85d5106c-6990-4a86-aa4f-946fce2290b1", "name": "THIODIETHYLENE BIS(3-(3,5-DI-TERT-BUTYL-4- HYDROXYPHENYL)PROPIONATE)", "stdName": "THIODIETHYLENE BIS(3-(3,5-DI-TERT-BUTYL-4- HYDROXYPHENYL)PROPIONATE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "178312f8-e76b-48b6-b3a3-93d36c7d92ff", "e90712e3-aa38-4bae-9a40-806c8c57e638" ], "display_name": false }, { "uuid": "946b04bc-db5c-40cb-8136-01e74dd4749d", "name": "THIOETHYLENE GLYCOL BIS(3,5-DI-TERT-BUTYL-4-HYDROXYHYDROCINNAMATE)", "stdName": "THIOETHYLENE GLYCOL BIS(3,5-DI-TERT-BUTYL-4-HYDROXYHYDROCINNAMATE)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2df75d7f-d4f3-4244-945e-b27ed77f8f6d" ], "display_name": true } ], "references": [ { "uuid": "2df75d7f-d4f3-4244-945e-b27ed77f8f6d", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "178312f8-e76b-48b6-b3a3-93d36c7d92ff", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e90712e3-aa38-4bae-9a40-806c8c57e638", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fbd1d3df-787f-4551-ad92-0258c4b97308", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391098000, "tags": [ "NOMEN" ] }, { "uuid": "a39255b5-32c1-494f-aeac-9b43d0c4b2a0", "citation": "SRS import [6F5OZW34JZ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6F5OZW34JZ", "doc_type": "SRS", "public_domain": true, "document_date": 1493391098000, "tags": [ "NOMEN" ] }, { "uuid": "c2404096-56fa-4b32-89c3-6a6ba635bcfb", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "def024e3-c557-ec47-97e5-e044f4d3fd88", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=41484-35-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b3bc4e8b-0ba0-4cb8-91b1-f4ab169082af", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "20f273d8-7829-42c3-adff-2229893475ef", "id": "20f273d8-7829-42c3-adff-2229893475ef", "molfile": "\n Marvin 01132101522D \n\n 45 46 0 0 0 0 999 V2000\n 15.3664 -4.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6465 -3.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6465 -3.0077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2285 -3.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9431 -4.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2230 -3.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5167 -4.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8067 -3.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0921 -4.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3819 -3.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3819 -3.0262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6673 -4.2676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9526 -3.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2426 -4.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5280 -3.8599 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8133 -4.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1033 -3.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3885 -4.2768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6785 -3.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6785 -3.0445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9639 -4.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2492 -3.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5401 -4.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5401 -5.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8241 -5.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1130 -5.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3945 -5.5294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1130 -4.2906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8224 -3.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3960 -3.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3207 -4.2909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4023 -3.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3960 -3.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8241 -6.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1118 -6.7716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5407 -6.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0403 -7.1533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5167 -5.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2328 -5.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9431 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6574 -5.4836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2328 -6.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5172 -6.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9463 -6.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4470 -7.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 5 2 1 0 0 0 0\n 5 6 1 0 0 0 0\n 40 5 2 0 0 0 0\n 6 7 2 0 0 0 0\n 8 7 1 0 0 0 0\n 7 38 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 19 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 23 29 2 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 25 34 1 0 0 0 0\n 26 27 1 0 0 0 0\n 28 26 2 0 0 0 0\n 29 28 1 0 0 0 0\n 28 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 32 1 0 0 0 0\n 30 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 34 37 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 39 42 1 0 0 0 0\n 40 41 1 0 0 0 0\n 42 43 1 0 0 0 0\n 42 44 1 0 0 0 0\n 42 45 1 0 0 0 0\nM END", "smiles": "CC(C)(C)c1cc(CCC(=O)OCCSCCOC(=O)CCc2cc(c(c(c2)C(C)(C)C)O)C(C)(C)C)cc(c1O)C(C)(C)C", "formula": "C38H58O6S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4b246a08-a90f-42bf-a211-c94c2b227a47" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "642.931", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "dcbcb82c-f8aa-4ebc-80a0-329fb7fe6f59", "version": "3", "structure": { "id": "a9e4c51b-6c57-4ebb-8618-429abb53d987", "molfile": "\n Marvin 01132108492D \n\n 45 46 0 0 0 0 999 V2000\n 1.1130 -4.2906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8224 -3.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5401 -4.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2492 -3.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9639 -4.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6785 -3.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6785 -3.0445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3885 -4.2768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1033 -3.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8133 -4.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5280 -3.8599 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2426 -4.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9526 -3.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6673 -4.2676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3819 -3.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0921 -4.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8067 -3.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5167 -4.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5167 -5.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2328 -5.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9431 -5.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9431 -4.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2230 -3.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6465 -3.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3664 -4.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6465 -3.0077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2285 -3.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6574 -5.4836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2328 -6.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5172 -6.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9463 -6.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4470 -7.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3819 -3.0262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5401 -5.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8241 -5.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8241 -6.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1118 -6.7716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5407 -6.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0403 -7.1533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1130 -5.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3945 -5.5294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3960 -3.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3207 -4.2909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4023 -3.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3960 -3.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 18 1 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 24 27 1 0 0 0 0\n 21 28 1 0 0 0 0\n 20 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 29 32 1 0 0 0 0\n 15 33 2 0 0 0 0\n 34 3 1 0 0 0 0\n 35 34 2 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 36 39 1 0 0 0 0\n 40 35 1 0 0 0 0\n 1 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 1 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 42 44 1 0 0 0 0\n 42 45 1 0 0 0 0\nM END", "smiles": "CC(C)(C)c1cc(CCC(=O)OCCSCCOC(=O)CCc2cc(c(c(c2)C(C)(C)C)O)C(C)(C)C)cc(c1O)C(C)(C)C", "formula": "C38H58O6S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "642.931", "optical_activity": "NONE", "references": [ "a39255b5-32c1-494f-aeac-9b43d0c4b2a0", "c2404096-56fa-4b32-89c3-6a6ba635bcfb" ], "stereo_centers": 0 }, "unii": "6F5OZW34JZ" } ] }