{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d30cc709-1c67-4c5b-a608-bd7402345b5d",
          "code": "7446-26-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7446-26-6",
          "code_system": "CAS",
          "references": [
            "e0b768d1-69a3-4704-a821-9f3769d87009",
            "b9d5ac20-ef54-4ef0-b087-762a412bc0c5"
          ]
        },
        {
          "uuid": "f6c16395-9adf-4f30-8b30-9cb45edba38a",
          "code": "ZINC PYROPHOSPHATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zinc_pyrophosphate",
          "code_system": "WIKIPEDIA",
          "references": [
            "e0b768d1-69a3-4704-a821-9f3769d87009"
          ]
        },
        {
          "uuid": "a0d29080-a324-4b07-947e-5ffe71f363bd",
          "code": "m11624",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11624?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e0b768d1-69a3-4704-a821-9f3769d87009"
          ]
        },
        {
          "uuid": "7bf12b52-b12a-4c67-aea2-e61f93b88d9e",
          "code": "62641",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62641",
          "code_system": "PUBCHEM",
          "references": [
            "e0b768d1-69a3-4704-a821-9f3769d87009"
          ]
        },
        {
          "uuid": "cf39eb1e-0f45-4f35-b116-efcfedf1e9d8",
          "code": "231-203-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.367",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e0b768d1-69a3-4704-a821-9f3769d87009"
          ]
        },
        {
          "uuid": "1386dff5-556f-03a1-4890-d2d98c18fd4d",
          "code": "DTXSID0064705",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0064705",
          "code_system": "EPA CompTox",
          "references": [
            "14712b24-90fa-afea-e719-6b8cf73ff526"
          ]
        },
        {
          "uuid": "8d2bf50f-167f-4b32-a417-11481f5220b4",
          "code": "6ERT96A621",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "1876668b-8324-441f-9219-4c2b763c02d0",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "43d869f7-cad2-4a44-b9ec-54b48e96d874",
            "refuuid": "029170db-4e11-45b3-bc18-f9a60e80427a",
            "name": "PYROPHOSPHORIC ACID",
            "unii": "4E862E7GRQ",
            "linking_id": "4E862E7GRQ",
            "ref_pname": "PYROPHOSPHORIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "832e5bae-f197-4324-ab54-8227bc8c4472",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "1ef757da-95a3-4d2d-a0b5-3e20acdb419d",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0d978259-5db1-4539-9a8a-7a2dcff88344",
          "name": "DIPHOSPHORIC ACID, ZINC SALT (1:2)",
          "stdName": "DIPHOSPHORIC ACID, ZINC SALT (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfc2bd09-0184-456e-9477-b57a4b456a6b",
            "13458ee7-fdaa-4803-8bcf-367f53e18bac"
          ],
          "display_name": false
        },
        {
          "uuid": "3f4b40f7-4fb9-42f3-884b-f1cc764b399b",
          "name": "ZINC PYROPHOSPHATE",
          "stdName": "ZINC PYROPHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfc2bd09-0184-456e-9477-b57a4b456a6b",
            "af6c58a2-3fb7-40af-aea3-1cb5f8d886b7",
            "2138f774-3ce1-49c4-b382-b2ee846b9f65",
            "f1f1dcc5-6103-4c44-9a75-c8d9b29fe97b"
          ],
          "display_name": true
        },
        {
          "uuid": "63010c32-2c0a-4631-b2e5-221286a18b8a",
          "name": "ZINC PYROPHOSPHATE [MI]",
          "stdName": "ZINC PYROPHOSPHATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfc2bd09-0184-456e-9477-b57a4b456a6b",
            "2138f774-3ce1-49c4-b382-b2ee846b9f65"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f1f1dcc5-6103-4c44-9a75-c8d9b29fe97b",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2138f774-3ce1-49c4-b382-b2ee846b9f65",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfc2bd09-0184-456e-9477-b57a4b456a6b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13458ee7-fdaa-4803-8bcf-367f53e18bac",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0b768d1-69a3-4704-a821-9f3769d87009",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391768000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a11de7f8-4c1e-4916-91f5-51a2b5300083",
          "citation": "SRS import [6ERT96A621]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6ERT96A621",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391768000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5846859-c158-4008-b8d5-c43bbd9c4922",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af6c58a2-3fb7-40af-aea3-1cb5f8d886b7",
          "citation": "ZINC PYROPHOSPHATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "14712b24-90fa-afea-e719-6b8cf73ff526",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7446-26-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b9d5ac20-ef54-4ef0-b087-762a412bc0c5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "adb86dbe-e697-4697-8d70-7621b4b57b7b",
          "id": "adb86dbe-e697-4697-8d70-7621b4b57b7b",
          "molfile": "\n  Marvin  01132109012D          \n\n  1  0  0  0  0  0            999 V2000\n    2.8701   -1.7798    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "4afbb323-3dd3-4071-b97c-e51dc664c66b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "5e4a49c3-8adf-4acd-a995-fe2996ca0982",
          "id": "5e4a49c3-8adf-4acd-a995-fe2996ca0982",
          "molfile": "\n  Marvin  01132104532D          \n\n  9  8  0  0  0  0            999 V2000\n    7.9054   -5.5182    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.9054   -4.6889    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7353   -4.6889    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.9054   -3.8639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0805   -4.6889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2555   -4.7042    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4309   -4.7042    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2555   -5.5290    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2555   -3.8792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  2  0  0  0  0\nM  CHG  4   1  -1   3  -1   7  -1   8  -1\nM  END",
          "smiles": "O=P([O-])([O-])OP(=O)([O-])[O-]",
          "formula": "O7P2",
          "atropisomerism": "No",
          "charge": -4,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "65298e94-c9f1-46bf-b478-0ffa05d7effb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "173.9434",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fda22bd8-fae0-4dd9-adc0-3e212f297af4",
      "version": "3",
      "structure": {
        "id": "566bc231-cf8c-4054-a6df-2cb6ca81de6e",
        "molfile": "\n  Marvin  01132104292D          \n\n 11  8  0  0  0  0            999 V2000\n    6.2555   -4.7042    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0805   -4.6889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9054   -4.6889    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9054   -3.8639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9054   -5.5182    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.7353   -4.6889    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2555   -3.8792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4309   -4.7042    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2555   -5.5290    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.8701   -1.7798    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    2.8701   -1.7798    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  1  7  2  0  0  0  0\n  1  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  1  2  1  0  0  0  0\nM  CHG  6   5  -1   6  -1   8  -1   9  -1  10   2  11   2\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  10  11\nM  SPA   1  1  10\nM  SDI   1  4    2.4501   -2.1998    2.4501   -1.3598\nM  SDI   1  4    3.2901   -1.3598    3.2901   -2.1998\nM  SMT   1 2\nM  END",
        "smiles": "O=P([O-])([O-])OP(=O)([O-])[O-].[Zn+2].[Zn+2]",
        "formula": "O7P2.2Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "304.7345",
        "optical_activity": "NONE",
        "references": [
          "f5846859-c158-4008-b8d5-c43bbd9c4922",
          "a11de7f8-4c1e-4916-91f5-51a2b5300083"
        ],
        "stereo_centers": 0
      },
      "unii": "6ERT96A621"
    }
  ]
}