{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "74e4161a-4619-464d-a844-895a410134ed", "code": "74499-60-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=74499-60-8", "code_system": "CAS", "references": [ "ec5345fa-6a32-47b8-8020-2cea532b0200", "4668b703-4c9a-4fa2-88f9-8a226daff8a3" ] }, { "uuid": "7d121cfb-663a-4aee-9e4e-212eb8df6042", "code": "277-897-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.794", "code_system": "ECHA (EC/EINECS)", "references": [ "ec5345fa-6a32-47b8-8020-2cea532b0200" ] }, { "uuid": "928ccdb3-fd39-4ccd-be6f-a189922f0760", "code": "166445", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/166445", "code_system": "PUBCHEM", "references": [ "ec5345fa-6a32-47b8-8020-2cea532b0200" ] }, { "uuid": "03e4b326-71f4-1be0-56be-cdaab25307a4", "code": "DTXSID30868312", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30868312", "code_system": "EPA CompTox", "references": [ "1dede5b1-73e1-6297-1c90-bbfaa7671a59" ] }, { "uuid": "57accff2-62f3-4e86-ba9e-fdd967db422e", "code": "6ELC2PL542", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "9ae2a523-92db-4382-8b3b-16f0bcde724c", "name": "1-(1,2,3,4-TETRAHYDRO-4,4-DIMETHYL-1-NAPHTHALENYL)-1-PROPANONE", "stdName": "1-(1,2,3,4-TETRAHYDRO-4,4-DIMETHYL-1-NAPHTHALENYL)-1-PROPANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7e658840-5357-4526-9118-b36204bf0a1a" ], "display_name": true }, { "uuid": "8dec38d0-70ce-4f3b-aa48-939380f524cb", "name": "1-PROPANONE, 1-(1,2,3,4-TETRAHYDRO-4,4-DIMETHYL-1-NAPHTHALENYL)-", "stdName": "1-PROPANONE, 1-(1,2,3,4-TETRAHYDRO-4,4-DIMETHYL-1-NAPHTHALENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "22b91583-99c8-49a4-82fe-a7414bcc3646" ], "display_name": false } ], "references": [ { "uuid": "22b91583-99c8-49a4-82fe-a7414bcc3646", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7e658840-5357-4526-9118-b36204bf0a1a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ec5345fa-6a32-47b8-8020-2cea532b0200", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393565000, "tags": [ "NOMEN" ] }, { "uuid": "fc8d4443-f8e4-4b2d-9ac1-4ea4a24fdf98", "citation": "SRS import [6ELC2PL542]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6ELC2PL542", "doc_type": "SRS", "public_domain": true, "document_date": 1493393565000, "tags": [ "NOMEN" ] }, { "uuid": "1dede5b1-73e1-6297-1c90-bbfaa7671a59", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=74499-60-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4668b703-4c9a-4fa2-88f9-8a226daff8a3", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "8d7a21c9-d578-4aba-abff-6884b823a74f", "id": "8d7a21c9-d578-4aba-abff-6884b823a74f", "molfile": "\n Marvin 01132107212D \n\n 16 17 0 0 0 0 999 V2000\n 10.0460 -2.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0460 -3.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3315 -3.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6171 -3.4046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3315 -4.6420 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.6171 -5.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6171 -5.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3315 -6.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8618 -6.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8012 -6.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0460 -5.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7605 -6.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4749 -5.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4749 -5.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7604 -4.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0460 -5.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 16 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 16 11 2 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 16 15 1 0 0 0 0\nM END", "smiles": "CCC(=O)C1CCC(C)(C)c2ccccc12", "formula": "C15H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "995fcc1e-d8ca-4eda-9372-a8a65fb2d668" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "216.3193", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "91219f12-7684-4c23-b3a1-dffc5e5428ce", "version": "5", "structure": { "id": "3e19e444-e1af-4779-a755-30c28ec111c2", "molfile": "\n Marvin 01132103172D \n\n 16 17 0 0 0 0 999 V2000\n 8.6171 -5.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3315 -4.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3315 -3.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0460 -3.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0460 -2.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6171 -3.4046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0460 -5.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7604 -4.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4749 -5.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4749 -5.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7605 -6.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0460 -5.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3315 -6.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8618 -6.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8012 -6.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6171 -5.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 3 6 2 0 0 0 0\n 2 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 7 12 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 16 13 1 0 0 0 0\n 1 16 1 0 0 0 0\nM END", "smiles": "CCC(=O)C1CCC(C)(C)c2ccccc12", "formula": "C15H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "216.3193", "optical_activity": "( + / - )", "references": [ "fc8d4443-f8e4-4b2d-9ac1-4ea4a24fdf98", "22b91583-99c8-49a4-82fe-a7414bcc3646" ], "stereo_centers": 1 }, "unii": "6ELC2PL542" } ] }