{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9db5a8e7-310d-4e3e-b570-4dd026cb3d84",
          "code": "3258-84-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3258-84-2",
          "code_system": "CAS",
          "references": [
            "5450760d-e2b8-4a91-8f46-7c3230dcf7d4",
            "3cf5df7c-79a7-4095-a47f-93d213bce1ab"
          ]
        },
        {
          "uuid": "cd3ceb6e-bac0-452c-87d1-176eda99926c",
          "code": "9821",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Opiates",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "5450760d-e2b8-4a91-8f46-7c3230dcf7d4"
          ]
        },
        {
          "uuid": "753f3256-60e2-44e0-9b90-fdd338c99a3a",
          "code": "SUB180510",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5450760d-e2b8-4a91-8f46-7c3230dcf7d4"
          ]
        },
        {
          "uuid": "5054cded-e8c0-4f09-944e-70bef997356e",
          "code": "ACETYLFENTANYL",
          "type": "PRIMARY",
          "url": "https://www.revolvy.com/topic/Acetylfentanyl&item_type=topic",
          "code_system": "WEB RESOURCE",
          "references": [
            "5450760d-e2b8-4a91-8f46-7c3230dcf7d4"
          ]
        },
        {
          "uuid": "b806d8e2-ebab-4d40-8ac7-1681e25d88eb",
          "code": "527015",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/527015",
          "code_system": "PUBCHEM",
          "references": [
            "5450760d-e2b8-4a91-8f46-7c3230dcf7d4"
          ]
        },
        {
          "uuid": "ff5d4bf5-cfb0-4040-8522-7f4485869cb7",
          "code": "ACETYLFENTANYL",
          "comments": "Acetylfentanyl was discovered at the same time as fentanyl itself and had only rarely been encountered on the illicit market in the late 1980s. However, in 2013, Canadian police seized 3 kilograms of acetylfentanyl. As a μ-opioid receptor agonist, acetylfentanyl may serve as a direct substitute for heroin or other opioids. Side effects of fentanyl analogs are similar to those of fentanyl itself, which include itching, nausea and potentially serious respiratory depression, which can be life-threatening.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Acetylfentanyl",
          "code_system": "WIKIPEDIA",
          "references": [
            "5450760d-e2b8-4a91-8f46-7c3230dcf7d4"
          ]
        },
        {
          "uuid": "67110fb9-46cc-15aa-cb3f-c36e639095f6",
          "code": "DTXSID80186275",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80186275",
          "code_system": "EPA CompTox",
          "references": [
            "0d09aae3-6f21-243a-0040-205bcb6fdaa3"
          ]
        },
        {
          "uuid": "d141c554-9bc1-49ec-bc64-ce83caf57a6d",
          "code": "List_of_fentanyl_analogues",
          "comments": "WIKIPEDIA|FENTANYL ANALOGUES",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_fentanyl_analogues",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "899aed69-4dfd-4933-bfeb-6a6cea9b8897",
          "code": "6DZ28538KS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1d3c6620-a641-207a-789c-4f25462cd36e",
          "code": "Designer-drugs-Acetylfentanyl",
          "comments": "Wikipedia|List of designer drugs|Sedatives|Opioids",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "1a44cc56-1914-8ef1-3c02-ba4177a6c3ca"
          ]
        },
        {
          "uuid": "2ba05326-4bc7-ef57-f827-da1b7427c3e0",
          "code": "1269979",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1269979",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "1a44cc56-1914-8ef1-3c02-ba4177a6c3ca"
          ]
        },
        {
          "uuid": "c15377ec-287f-d252-211e-ebe88b085f53",
          "code": "100000166398",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9c5c2544-99a2-0b66-d627-d91c69577cc7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "00c8f5cf-07cd-4765-b519-146472a206a9",
          "amount": {
            "uuid": "1f925fc6-4f80-4111-865f-6e3d2002720a"
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "related_substance": {
            "uuid": "a5ed428a-ff41-405b-a1df-69ad50e72e9d",
            "refuuid": "e0319997-2726-4317-810a-0ec13ff9b4e1",
            "name": "FENTANYL",
            "unii": "UF599785JZ",
            "linking_id": "UF599785JZ",
            "ref_pname": "FENTANYL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4c81c1d8-5820-484e-aece-4e60d0fb4bfa",
          "comments": "ED50(mg/kg) = 0.021, LD50(mg/kg) = 9.3, Potency ratio to morphine = 15.7, Potency ratio to fentanyl = 0.29",
          "type": "ACTIVE MOIETY",
          "references": [
            "2377b27b-32ba-47aa-86b5-6362d7fec169"
          ],
          "related_substance": {
            "uuid": "1fa02be7-a3e7-4754-98cb-09287fa5d99d",
            "refuuid": "bc715dc5-0ad4-4480-bc30-95df83c6989f",
            "name": "ACETYLFENTANYL",
            "unii": "6DZ28538KS",
            "linking_id": "6DZ28538KS",
            "ref_pname": "ACETYLFENTANYL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1e714ffb-cf7c-4718-ba50-78b608d8b6ea",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "451ea36a-70ad-4ac4-9025-2ce7f9958517",
            "refuuid": "6fab326e-1345-4aaf-a962-d5bb5f508f32",
            "name": "ACETYLFENTANYL HYDROCHLORIDE",
            "unii": "G4ZVOWIHLI",
            "linking_id": "G4ZVOWIHLI",
            "ref_pname": "ACETYLFENTANYL HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6523646b-ca4a-4153-a423-a0f4f4138c6a",
          "amount": {
            "uuid": "e92ac46b-7669-4ce5-88e8-05350a1b2890",
            "average": 64,
            "high": 79,
            "low": 49,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "interaction_type": "BINDING",
          "references": [
            "340740d4-435d-4a69-a418-b83225d745d4"
          ],
          "related_substance": {
            "uuid": "062ce26f-6673-4da1-8321-0cf7cdeb18d3",
            "refuuid": "39262e4f-d963-4b83-9b34-52fd55036f0e",
            "name": "MU-TYPE OPIOID RECEPTOR",
            "unii": "1PE72K8X46",
            "linking_id": "1PE72K8X46",
            "ref_pname": "MU-TYPE OPIOID RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "27a2d540-a197-41c0-bb13-5aa339c091fd",
          "amount": {
            "uuid": "452bb9e4-c3ea-419b-bf98-5b3198367bab",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7945bc3f-c24a-40c2-810b-ee7cebd725d8"
          ],
          "related_substance": {
            "uuid": "4ef9ac47-bb18-4a45-ad03-7bb1166a7a7f",
            "refuuid": "e066c6a2-d1d7-4e56-bdc7-56370b0ee7ad",
            "name": "FENTANYL CITRATE",
            "unii": "MUN5LYG46H",
            "linking_id": "MUN5LYG46H",
            "ref_pname": "FENTANYL CITRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "635955bd-4026-4b31-9a73-5587daa953a2",
          "amount": {
            "uuid": "371535f1-5190-4adf-b40b-02b35d36daee",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "8f705609-8762-4ed1-9e25-9957fc3c57cf"
          ],
          "related_substance": {
            "uuid": "f428f322-a55b-499b-a273-872e41946cac",
            "refuuid": "e066c6a2-d1d7-4e56-bdc7-56370b0ee7ad",
            "name": "FENTANYL CITRATE",
            "unii": "MUN5LYG46H",
            "linking_id": "MUN5LYG46H",
            "ref_pname": "FENTANYL CITRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5dfea2aa-9e43-45ab-9e24-410860833fb9",
          "amount": {
            "uuid": "a33888c3-323e-4010-81c8-fb5e55dfa441"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "2af70cc7-d572-4e51-a934-c9e22f82395c",
            "refuuid": "6fab326e-1345-4aaf-a962-d5bb5f508f32",
            "name": "ACETYLFENTANYL HYDROCHLORIDE",
            "unii": "G4ZVOWIHLI",
            "linking_id": "G4ZVOWIHLI",
            "ref_pname": "ACETYLFENTANYL HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2b4b2922-0cb9-47bc-96ff-e9a3da2a47c5",
          "name": "ACETAMIDE, N-PHENYL-N-(1-(2-PHENYLETHYL)-4-PIPERIDINYL)-",
          "stdName": "ACETAMIDE, N-PHENYL-N-(1-(2-PHENYLETHYL)-4-PIPERIDINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7945bc3f-c24a-40c2-810b-ee7cebd725d8",
            "19943e36-be28-43c6-b0ce-c0c6000a3684"
          ],
          "display_name": false
        },
        {
          "uuid": "06a15bf0-eb13-44d7-855f-7c289015ea5c",
          "name": "ACETYL FENTANYL",
          "stdName": "ACETYL FENTANYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "261abf66-f463-4609-b850-22106602aec2"
          ],
          "display_name": false
        },
        {
          "uuid": "8e77b79a-5a1f-4fbf-8f05-b9fcd33d1e2e",
          "name": "ACETYLFENTANYL",
          "stdName": "ACETYLFENTANYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7945bc3f-c24a-40c2-810b-ee7cebd725d8",
            "19943e36-be28-43c6-b0ce-c0c6000a3684"
          ],
          "display_name": true
        },
        {
          "uuid": "161ce85c-79e2-b081-6252-1756b5d19404",
          "name": "FENTANYL CITRATE IMPURITY C [EP IMPURITY]",
          "stdName": "FENTANYL CITRATE IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f705609-8762-4ed1-9e25-9957fc3c57cf"
          ],
          "display_name": false
        },
        {
          "uuid": "bcce573d-6278-30a3-b74d-cd77c0a1435e",
          "name": "FENTANYL IMPURITY C [EP IMPURITY]",
          "stdName": "FENTANYL IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f7328dd-b477-4d85-9a2e-6869423d2cf9"
          ],
          "display_name": false
        },
        {
          "uuid": "636b6d4e-65f8-4230-9319-273487b5bd3c",
          "name": "FENTANYL RELATED COMPOUND G CI",
          "stdName": "FENTANYL RELATED COMPOUND G CI",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b418e965-d755-49c2-865f-61d95f732163",
            "7945bc3f-c24a-40c2-810b-ee7cebd725d8",
            "270d4241-64a1-4958-89c2-141e420e7eb3"
          ],
          "display_name": false
        },
        {
          "uuid": "4b66d116-e0b2-49b1-9eae-414423b528f0",
          "name": "FENTANYL RELATED COMPOUND G CI [USP-RS]",
          "stdName": "FENTANYL RELATED COMPOUND G CI [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b418e965-d755-49c2-865f-61d95f732163",
            "7945bc3f-c24a-40c2-810b-ee7cebd725d8"
          ],
          "display_name": false
        },
        {
          "uuid": "4b78382c-ba2c-7ad1-895b-c81cc19dc99b",
          "name": "FENTANYL RELATED COMPOUND G [USP IMPURITY]",
          "stdName": "FENTANYL RELATED COMPOUND G [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "261abf66-f463-4609-b850-22106602aec2",
            "7945bc3f-c24a-40c2-810b-ee7cebd725d8"
          ],
          "display_name": false
        },
        {
          "uuid": "7c97ef23-9f63-491d-acae-afa5e5005e4e",
          "name": "J125.906G",
          "stdName": "J125.906G",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2bcd2e19-5634-4f4b-b58e-1bdab918c6fc"
          ],
          "display_name": false
        },
        {
          "uuid": "e1eef1a8-72e7-4f96-b1f0-fe32d0b65c89",
          "name": "N-(1-PHENETHYLPIPERIDIN-4-YL)-N-PHENYLACETAMIDE",
          "stdName": "N-(1-PHENETHYLPIPERIDIN-4-YL)-N-PHENYLACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7945bc3f-c24a-40c2-810b-ee7cebd725d8",
            "19943e36-be28-43c6-b0ce-c0c6000a3684"
          ],
          "display_name": false
        },
        {
          "uuid": "fbd97376-ba0c-4c41-8cfd-ba1475b1d598",
          "name": "N-PHENYL-N-(1-(2-PHENYLETHYL)PIPERIDIN-4-YL)ACETAMIDE",
          "stdName": "N-PHENYL-N-(1-(2-PHENYLETHYL)PIPERIDIN-4-YL)ACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f7328dd-b477-4d85-9a2e-6869423d2cf9",
            "7945bc3f-c24a-40c2-810b-ee7cebd725d8"
          ],
          "display_name": false
        },
        {
          "uuid": "40cbf21c-ca49-459c-9ee1-7636078eab39",
          "name": "PIPERIDINE, 1-PHENETHYL-4-(N-PHENYLACETAMIDO)-",
          "stdName": "PIPERIDINE, 1-PHENETHYL-4-(N-PHENYLACETAMIDO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19943e36-be28-43c6-b0ce-c0c6000a3684"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3cf5df7c-79a7-4095-a47f-93d213bce1ab",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "261abf66-f463-4609-b850-22106602aec2",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7945bc3f-c24a-40c2-810b-ee7cebd725d8",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "19943e36-be28-43c6-b0ce-c0c6000a3684",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f7328dd-b477-4d85-9a2e-6869423d2cf9",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2bcd2e19-5634-4f4b-b58e-1bdab918c6fc",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J125.906G",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J125.906G",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b418e965-d755-49c2-865f-61d95f732163",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5450760d-e2b8-4a91-8f46-7c3230dcf7d4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391925000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2377b27b-32ba-47aa-86b5-6362d7fec169",
          "citation": "FORENSIC TOXICOL (2008) 26: 1, 1-5",
          "url": "http://link.springer.com/article/10.1007%2Fs11419-007-0039-1",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7512f36-cbce-4707-8446-9cc7be4d41a5",
          "citation": "SRS import [6DZ28538KS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6DZ28538KS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391925000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef369e0d-b850-4212-992c-72de9325b298",
          "citation": "FENTANYL RELATED COMPOUND G [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "270d4241-64a1-4958-89c2-141e420e7eb3",
          "citation": "FENTANYL RELATED COMPOUND G CI [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0d09aae3-6f21-243a-0040-205bcb6fdaa3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3258-84-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9c5c2544-99a2-0b66-d627-d91c69577cc7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "340740d4-435d-4a69-a418-b83225d745d4",
          "citation": "Hassanien, Sherif H., et al. \"In vitro pharmacology of fentanyl analogs at the human mu opioid receptor and their spectroscopic analysis.\" Drug testing and analysis 12.8 (2020): 1212-1221.",
          "url": "https://onlinelibrary.wiley.com/doi/epdf/10.1002/dta.2822",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8f705609-8762-4ed1-9e25-9957fc3c57cf",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1a44cc56-1914-8ef1-3c02-ba4177a6c3ca",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fa898048-8d8f-4c2b-9088-173d8c2a87d1",
          "id": "fa898048-8d8f-4c2b-9088-173d8c2a87d1",
          "molfile": "\n  Marvin  01132112592D          \n\n 24 26  0  0  0  0            999 V2000\n   -3.5724   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579    1.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -0.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.0313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    2.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -2.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -2.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 19  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 18  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 17  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 24  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)N(c1ccccc1)C2CCN(CCc3ccccc3)CC2",
          "formula": "C21H26N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0b3dc01c-2b23-4c1f-8958-d91a50e3fe8f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "322.4447",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bc715dc5-0ad4-4480-bc30-95df83c6989f",
      "version": "24",
      "structure": {
        "id": "9a02767a-9d01-4938-bbe6-5548e7037cba",
        "molfile": "\n  Marvin  01132108002D          \n\n 24 26  0  0  0  0            999 V2000\n   -2.8579    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5724   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579    1.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -0.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.0313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    2.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5724    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8579    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -2.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -2.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8579   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  5 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 13 18  2  0  0  0  0\n 12 13  1  0  0  0  0\n  5 11  1  0  0  0  0\n  4  8  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 19 24  2  0  0  0  0\n  4 19  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N(c1ccccc1)C2CCN(CCc3ccccc3)CC2",
        "formula": "C21H26N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "322.4447",
        "optical_activity": "NONE",
        "references": [
          "b7512f36-cbce-4707-8446-9cc7be4d41a5",
          "19943e36-be28-43c6-b0ce-c0c6000a3684"
        ],
        "stereo_centers": 0
      },
      "unii": "6DZ28538KS"
    }
  ]
}