{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d6cde176-80f5-4668-a8e3-b7ececed92d3",
          "code": "N06BX12",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|acetylcarnitine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06BX12&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "f43566ad-2219-4e5f-8112-a983ff278e47",
          "code": "QN06BX12",
          "comments": "VATC|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|acetylcarnitine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06BX12&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "3ab3cf3d-2532-413e-8653-b97ce42f5657",
          "code": "3040-38-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3040-38-8",
          "code_system": "CAS",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3",
            "b7480316-b948-4b35-9e56-cb168551c125"
          ]
        },
        {
          "uuid": "9f83fcc0-2b4a-4ae8-bdb7-b0e424e9f102",
          "code": "C87329",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87329",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "de9e8aaa-8bc6-4c07-8aa3-556908f61521",
          "code": "D000108",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68000108",
          "code_system": "MESH",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "47604d02-e95a-401d-ba4c-4a1e2464b75c",
          "code": "ACETYLCARNITINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Acetylcarnitine",
          "code_system": "WIKIPEDIA",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "1669861c-cd7e-4cf9-beee-1db502b775b6",
          "code": "193",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/193/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "0b6519ab-a27a-4f89-a270-e930f76f2800",
          "code": "m1349",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1349?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "8ce53f18-e8dd-4797-9300-9d5b1ad6aef7",
          "code": "DB08842",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB08842",
          "code_system": "DRUG BANK",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "72e45921-0ce0-404e-b1aa-c0e6b7a234b1",
          "code": "SUB12716MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "2345e1b2-43f2-4b83-88a5-1b753db685d0",
          "code": "SUB31789",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "16375528-9273-4816-9271-08bc8d1497aa",
          "code": "CHEMBL1697733",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1697733",
          "code_system": "ChEMBL",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "97569a1e-943f-41e1-ad88-f64ae9e98ad0",
          "code": "7045767",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7045767",
          "code_system": "PUBCHEM",
          "references": [
            "c3de8987-47b9-4f36-bae0-83d4413d25c3"
          ]
        },
        {
          "uuid": "42312f61-4b18-03cd-02c1-ec797dd12056",
          "code": "7587",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7587",
          "code_system": "HSDB",
          "references": [
            "65e47016-f84e-7223-ec67-3002cf755b0d"
          ]
        },
        {
          "uuid": "46d9ad9e-89ba-2cf9-d394-ac15ddb01f38",
          "code": "329010",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of Rett syndrome",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=329010",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "a638ddd2-74d5-c974-9079-717feb96f65d",
          "code": "373112",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of Fragile X syndrome",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=373112",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "b1a38727-fc0d-9285-a6e0-2957dff0de82",
          "code": "DTXSID1040956",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1040956",
          "code_system": "EPA CompTox",
          "references": [
            "1b3ec10a-79ed-1574-bd66-700de5b49cc7"
          ]
        },
        {
          "uuid": "5a9d1cd3-5cb3-34d3-2a27-a4b8779f3c95",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "83113d73-f8bb-3f27-1b71-503d80c10c14"
          ]
        },
        {
          "uuid": "ee1e5778-724d-2c83-f44c-d7f19dcc0a8a",
          "code": "3 (Number of products:810)",
          "comments": "Dietary Supplement Label Database|chemical|Acetyl L-Carnitine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3&item=Acetyl L-Carnitine",
          "code_system": "DSLD",
          "references": [
            "83113d73-f8bb-3f27-1b71-503d80c10c14"
          ]
        },
        {
          "uuid": "01075f0c-1714-3c9c-09d4-066df41fda6c",
          "code": "64",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/64",
          "code_system": "DRUG CENTRAL",
          "references": [
            "83113d73-f8bb-3f27-1b71-503d80c10c14"
          ]
        },
        {
          "uuid": "6b5a9651-c830-4225-8e3d-dff104f16d36",
          "code": "6DH1W9VH8Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0a2c4841-50d8-8268-54bd-877def80b94f",
          "code": "73024",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:73024",
          "code_system": "CHEBI",
          "references": [
            "83113d73-f8bb-3f27-1b71-503d80c10c14"
          ]
        },
        {
          "uuid": "1b14b0ba-6003-bc3b-32d4-c737975cd40f",
          "code": "57589",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:57589",
          "code_system": "CHEBI",
          "references": [
            "83113d73-f8bb-3f27-1b71-503d80c10c14"
          ]
        },
        {
          "uuid": "d562d97d-5d0d-c709-dbd5-b62728cda0f5",
          "code": "100000124222",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b3c82ce6-c9ae-a0e9-9b63-096ca0c1416e"
          ]
        },
        {
          "uuid": "9072d4a8-afde-8081-4fd2-226dcb8b0359",
          "code": "6DH1W9VH8Q",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=6DH1W9VH8Q",
          "code_system": "DAILYMED",
          "references": [
            "20804f15-7c4d-3289-6318-45eb42e3a575"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "fb154bff-1b70-4d2d-a50e-61c3025a52b6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d490f82e-6eff-4880-a3d3-a4666b91339e",
            "refuuid": "523e21ff-f2d9-4fbb-9842-1e91ad778ba6",
            "name": "LEVOCARNITINE",
            "unii": "0G389FZZ9M",
            "linking_id": "0G389FZZ9M",
            "ref_pname": "LEVOCARNITINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a1b24ee1-b133-4735-a428-6b030dfdbcb3",
          "type": "SALT/SOLVATE->SALT/SOLVATE",
          "related_substance": {
            "uuid": "f45ece8e-68ae-4695-9f98-d3f31b16b277",
            "refuuid": "a277a409-87e3-4f0d-a6f4-8b922037e540",
            "name": "LEVOCARNITINE HYDROCHLORIDE",
            "unii": "J3Y5E6IKS3",
            "linking_id": "J3Y5E6IKS3",
            "ref_pname": "LEVOCARNITINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3edd720b-739d-4eec-b376-562282726823",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "33005868-2f1a-49dc-8ed4-d21d828e0536",
            "refuuid": "9764211d-9ff0-4b0f-b3d1-796b16d05fe5",
            "name": "ACETYL-L-CARNITINE ARGINATE",
            "unii": "PIY2W03CO6",
            "linking_id": "PIY2W03CO6",
            "ref_pname": "ACETYL-L-CARNITINE ARGINATE"
          }
        },
        {
          "uuid": "b7f3f31d-c4b2-48a5-af02-83f907bb74d2",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "cd3ad1e7-195b-4176-9b80-4baf004eb3fa"
          ],
          "related_substance": {
            "uuid": "fdbc9e01-b913-481f-9f12-23a4408a22fb",
            "refuuid": "4a0ebe62-033e-434e-ae08-c48fab653f3c",
            "name": "LEVACECARNINE HYDROCHLORIDE",
            "unii": "NDW10MX58T",
            "linking_id": "NDW10MX58T",
            "ref_pname": "LEVACECARNINE HYDROCHLORIDE"
          }
        },
        {
          "uuid": "3c3e11b2-17a0-4fe0-86fb-4babc38cec95",
          "amount": {
            "uuid": "5222e017-6a68-4eb6-92a8-c06190a7eda3"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "9993beab-9220-4077-89d9-5f91751248b2",
            "refuuid": "307bc00a-0729-470c-b139-1d841dcc4a87",
            "name": "Acetyl L-carnitine taurinate",
            "unii": "S3Z3R3X6RL",
            "linking_id": "S3Z3R3X6RL",
            "ref_pname": "Acetyl L-carnitine taurinate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "08ef1746-ea66-4f02-8357-cb2b2717aa57",
          "name": "(2R)-2-(ACETYLOXY)-3-CARBOXY-N,N,N-TRIMETHYL-1-PROPANAMINIUM INNER SALT",
          "stdName": "(2R)-2-(ACETYLOXY)-3-CARBOXY-N,N,N-TRIMETHYL-1-PROPANAMINIUM INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e475b835-211d-412f-b843-0aa89733178d",
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c"
          ],
          "display_name": false
        },
        {
          "uuid": "469eec2b-b3cc-4a23-a58d-08d366410308",
          "name": "ACETYL CARNITINE",
          "stdName": "ACETYL CARNITINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "227014aa-fd08-4c0e-b39e-02881b8c4234",
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c",
            "f4295e99-7a52-4350-be4a-a2957d87f894"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8d2012bc-583b-4ba3-80b5-339a2d44eca4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f56d83b4-5901-47b4-8cb6-b3ad23e59cc0",
          "name": "ACETYL L-CARNITINE",
          "stdName": "ACETYL L-CARNITINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1310a3d4-8d93-4159-993d-37e1443f50d7",
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c"
          ],
          "display_name": false
        },
        {
          "uuid": "bac1fbd2-8136-4f6e-abe6-7da97cea1f6c",
          "name": "ACETYL-L-CARNITINE",
          "stdName": "ACETYL-L-CARNITINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cbff7bd-c168-4afc-88d5-4e5806f75d4d",
            "e475b835-211d-412f-b843-0aa89733178d",
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c",
            "1adb61e6-0253-4620-bf5c-1d903fc42a68"
          ],
          "display_name": false
        },
        {
          "uuid": "d7a11a8d-83ce-443a-a2ec-64d3c1ff8fe5",
          "name": "ACETYL-L-CARNITINE [HSDB]",
          "stdName": "ACETYL-L-CARNITINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c",
            "1adb61e6-0253-4620-bf5c-1d903fc42a68"
          ],
          "display_name": false
        },
        {
          "uuid": "df8b0de6-50a1-4136-8b69-742e5df3e6e3",
          "name": "ACETYLCARNITINE",
          "stdName": "ACETYLCARNITINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef48c544-ffc1-480e-ba1a-4bd791930130",
            "85d2ff46-256c-4b03-a6cb-f61f5f1c9af4",
            "3909a116-b510-4b08-b1e7-012073a96d90",
            "a45b3866-c29c-437b-bb3e-e8a29eb0e386",
            "e475b835-211d-412f-b843-0aa89733178d",
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c",
            "37cb3fbd-6c26-4fc6-a303-4110fb9d8dfa",
            "7eb4b4c8-693f-4277-b84f-bf9430042db8"
          ],
          "display_name": true
        },
        {
          "uuid": "4e7f8d11-f59c-44c5-bef3-ad6a1db2fd5c",
          "name": "ACETYLCARNITINE [MI]",
          "stdName": "ACETYLCARNITINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85d2ff46-256c-4b03-a6cb-f61f5f1c9af4",
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c"
          ],
          "display_name": false
        },
        {
          "uuid": "987b24c7-00c2-42a4-b8da-4d63fa060ebf",
          "name": "ACETYLCARNITINE [VANDF]",
          "stdName": "ACETYLCARNITINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3909a116-b510-4b08-b1e7-012073a96d90",
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c"
          ],
          "display_name": false
        },
        {
          "uuid": "97d0041a-b3c4-47bb-ae60-68dae827b334",
          "name": "ACETYLCARNITINE, L-",
          "stdName": "ACETYLCARNITINE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e475b835-211d-412f-b843-0aa89733178d"
          ],
          "display_name": false
        },
        {
          "uuid": "64467d40-712e-4fcf-9e42-d629351621fa",
          "name": "ALCAR",
          "stdName": "ALCAR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e475b835-211d-412f-b843-0aa89733178d",
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c"
          ],
          "display_name": false
        },
        {
          "uuid": "461d2fd2-9670-bb05-d384-c31cbd2d34d6",
          "name": "Acetylcarnitine [WHO-DD]",
          "stdName": "ACETYLCARNITINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c6c457f-3098-3e8e-3a7e-687e3653427d"
          ],
          "display_name": false
        },
        {
          "uuid": "5b7c7aa7-9f98-46fe-a21d-ad5bd1caca98",
          "name": "L-(3-CARBOXY-2-HYDROXYPROPYL)TRIMETHYLAMMONIUM HYDROXIDE INNER SALT ACETATE",
          "stdName": "L-(3-CARBOXY-2-HYDROXYPROPYL)TRIMETHYLAMMONIUM HYDROXIDE INNER SALT ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c",
            "79943514-f058-4309-8437-28be5c421665"
          ],
          "display_name": false
        },
        {
          "uuid": "008ddf43-cc29-8ec1-40a3-3932957505ec",
          "name": "L-ACETYL CARNITINE",
          "stdName": "L-ACETYL CARNITINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca41ad9e-f035-ba20-c77b-1f691ff57b88"
          ],
          "display_name": false
        },
        {
          "uuid": "37556015-47d4-c6ae-a73f-5bb6938c7c69",
          "name": "L-ACETYLCARNITINE",
          "stdName": "L-ACETYLCARNITINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca41ad9e-f035-ba20-c77b-1f691ff57b88"
          ],
          "display_name": false
        },
        {
          "uuid": "a01ea4bc-793c-41f6-ab53-0bd7be050400",
          "name": "LEVOCARNITINE ACETYL",
          "stdName": "LEVOCARNITINE ACETYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c",
            "1a8b6041-3049-401f-9caa-0074dbfaea61"
          ],
          "display_name": false
        },
        {
          "uuid": "06bd4f67-aacc-430c-9e9d-652e380d05b8",
          "name": "ORISTAR ACC",
          "stdName": "ORISTAR ACC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c",
            "1a8b6041-3049-401f-9caa-0074dbfaea61"
          ],
          "display_name": false
        },
        {
          "uuid": "27b8b73d-378e-4ff8-a8e7-509f1450ce2b",
          "name": "VITAMIN BT, ACETATE",
          "stdName": "VITAMIN BT, ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c",
            "1a8b6041-3049-401f-9caa-0074dbfaea61"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cd3ad1e7-195b-4176-9b80-4baf004eb3fa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e475b835-211d-412f-b843-0aa89733178d",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "037ddd1a-fd6a-47ff-b06a-3f0c9b404b7c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79943514-f058-4309-8437-28be5c421665",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85d2ff46-256c-4b03-a6cb-f61f5f1c9af4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a8b6041-3049-401f-9caa-0074dbfaea61",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1adb61e6-0253-4620-bf5c-1d903fc42a68",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a45b3866-c29c-437b-bb3e-e8a29eb0e386",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3909a116-b510-4b08-b1e7-012073a96d90",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "227014aa-fd08-4c0e-b39e-02881b8c4234",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1310a3d4-8d93-4159-993d-37e1443f50d7",
          "citation": "NCT00225160",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3de8987-47b9-4f36-bae0-83d4413d25c3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389683000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15966b53-2996-4c10-aafd-b8e1eff90e36",
          "citation": "SRS import [6DH1W9VH8Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6DH1W9VH8Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389683000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef48c544-ffc1-480e-ba1a-4bd791930130",
          "citation": "ACETYLCARNITINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9cbff7bd-c168-4afc-88d5-4e5806f75d4d",
          "citation": "ACETYL-L-CARNITINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37cb3fbd-6c26-4fc6-a303-4110fb9d8dfa",
          "citation": "ACETYLCARNITINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7eb4b4c8-693f-4277-b84f-bf9430042db8",
          "citation": "ACETYLCARNITINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f4295e99-7a52-4350-be4a-a2957d87f894",
          "citation": "ACETYL CARNITINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "65e47016-f84e-7223-ec67-3002cf755b0d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3040-38-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "64b2977e-a84c-6519-63aa-fe611fc289f3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+3040-38-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b3ec10a-79ed-1574-bd66-700de5b49cc7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3040-38-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ca41ad9e-f035-ba20-c77b-1f691ff57b88",
          "citation": "https://clinicaltrials.gov/ct2/show/NCT01524861",
          "doc_type": "CLINICAL_TRIALS.GOV",
          "public_domain": true
        },
        {
          "uuid": "b3c82ce6-c9ae-a0e9-9b63-096ca0c1416e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "83113d73-f8bb-3f27-1b71-503d80c10c14",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b7480316-b948-4b35-9e56-cb168551c125",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "20804f15-7c4d-3289-6318-45eb42e3a575",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0c6c457f-3098-3e8e-3a7e-687e3653427d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cfb7ad71-fb0c-42f7-8005-bc33ba2d1ddd",
          "id": "cfb7ad71-fb0c-42f7-8005-bc33ba2d1ddd",
          "molfile": "\n  Marvin  01132110442D          \n\n 14 13  0  0  1  0            999 V2000\n    7.5958   -4.4639    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.3108   -4.8673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0213   -4.4548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7363   -4.8673    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.0213   -3.6298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8808   -4.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1704   -4.4685    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    5.4554   -4.8810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1704   -3.6435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4508   -4.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5958   -3.6389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5821   -2.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2971   -2.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8717   -2.4014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1 11  1  6  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  7  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\nM  CHG  2   4  -1   7   1\nM  END",
          "smiles": "CC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C",
          "formula": "C9H17NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8f37a3fb-b886-4977-83a2-6cbfdc3f1689"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "203.2359",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a03a8e7c-2b51-48fc-be24-488f16099369",
      "version": "28",
      "structure": {
        "id": "bfe218cf-fcae-408a-9d38-9f0575e3b975",
        "molfile": "\n  Marvin  01132109552D          \n\n 14 13  0  0  1  0            999 V2000\n    8.3108   -4.8673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0213   -4.4548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7363   -4.8673    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.0213   -3.6298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5958   -4.4639    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.5958   -3.6389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5821   -2.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8717   -2.4014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2971   -2.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8808   -4.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1704   -4.4685    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.4554   -4.8810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1704   -3.6435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4508   -4.0560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n  5  6  1  6  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  1  0  0  0  0\nM  CHG  2   3  -1  11   1\nM  END",
        "smiles": "CC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C",
        "formula": "C9H17NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "203.2359",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e475b835-211d-412f-b843-0aa89733178d",
          "15966b53-2996-4c10-aafd-b8e1eff90e36"
        ],
        "stereo_centers": 1
      },
      "unii": "6DH1W9VH8Q"
    }
  ]
}