{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a92af1c1-2719-4acd-a467-858e4bcd2b1b",
          "code": "58096-46-1",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58096-46-1",
          "code_system": "CAS",
          "references": [
            "8b642424-107c-4a03-b19c-f7de4880e87d",
            "c04d5170-0039-4d23-b7d8-5dcd55a0ffb4"
          ]
        },
        {
          "uuid": "a7c14eb5-980f-476e-8ba8-d716d49164e7",
          "code": "261-117-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.543",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8b642424-107c-4a03-b19c-f7de4880e87d"
          ]
        },
        {
          "uuid": "24ac6bf1-4389-420e-8c78-8b4ee488c531",
          "code": "119057414",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119057414",
          "code_system": "PUBCHEM",
          "references": [
            "8b642424-107c-4a03-b19c-f7de4880e87d"
          ]
        },
        {
          "uuid": "3ea63114-d49e-4c45-b45a-0962dfb5082c",
          "code": "6CS460KB0F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "50510497-b3ab-1277-920c-416b32f35814",
          "code": "DTXSID50866673",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50866673",
          "code_system": "EPA CompTox",
          "references": [
            "36cebba6-d502-388b-9ebc-5aae0b2f626e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "af8faab4-dd15-485e-ae55-8c483b854088",
          "name": ".BETA.-CARYOPHYLLENE ALCOHOL FORMATE",
          "stdName": ".BETA.-CARYOPHYLLENE ALCOHOL FORMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1e879f9-1d36-4745-a9ef-8cc4e8648d84",
            "1e4c4550-7d8e-49cd-9ff5-5e5354049de5"
          ],
          "display_name": true
        },
        {
          "uuid": "56b10c6d-ca9b-4a5f-b07e-d7875d7ef707",
          "name": "CARYOPHYLLENE FORMATE",
          "stdName": "CARYOPHYLLENE FORMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e4c4550-7d8e-49cd-9ff5-5e5354049de5",
            "d380b8c4-5fdf-4eee-91f9-636c526908c4"
          ],
          "display_name": false
        },
        {
          "uuid": "8a8e3f1c-e86b-42dd-ac9c-4e32b1954e37",
          "name": "TRICYCLO(6.3.1.02,5)DODECAN-1-OL, 4,4,8-TRIMETHYL-, 1-FORMATE",
          "stdName": "TRICYCLO(6.3.1.02,5)DODECAN-1-OL, 4,4,8-TRIMETHYL-, 1-FORMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e4c4550-7d8e-49cd-9ff5-5e5354049de5",
            "400e19ba-ef52-442a-97eb-fa1dc6a2b68d"
          ],
          "display_name": false
        },
        {
          "uuid": "72396d5e-0f6f-4cb2-abd6-218e68203abc",
          "name": "TRICYCLO(6.3.1.02,5)DODECAN-1-OL, 4,4,8-TRIMETHYL-, 1-FORMATE, (1R,2S,5R,8S)-",
          "stdName": "TRICYCLO(6.3.1.02,5)DODECAN-1-OL, 4,4,8-TRIMETHYL-, 1-FORMATE, (1R,2S,5R,8S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1e879f9-1d36-4745-a9ef-8cc4e8648d84",
            "1e4c4550-7d8e-49cd-9ff5-5e5354049de5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f1e879f9-1d36-4745-a9ef-8cc4e8648d84",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1e4c4550-7d8e-49cd-9ff5-5e5354049de5",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d380b8c4-5fdf-4eee-91f9-636c526908c4",
          "citation": "http://www.thegoodscentscompany.com/data/rw1430931.html",
          "url": "http://www.thegoodscentscompany.com/data/rw1430931.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "400e19ba-ef52-442a-97eb-fa1dc6a2b68d",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b642424-107c-4a03-b19c-f7de4880e87d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392085000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cabfa5ab-56de-4ae9-88bb-619b26d7c6ea",
          "citation": "SRS import [6CS460KB0F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6CS460KB0F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392085000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c04d5170-0039-4d23-b7d8-5dcd55a0ffb4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "36cebba6-d502-388b-9ebc-5aae0b2f626e",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "449a691c-9f7c-4c9f-a8d5-04bc509bedf6",
          "id": "449a691c-9f7c-4c9f-a8d5-04bc509bedf6",
          "molfile": "\n  Marvin  01132103372D          \n\n 18 20  0  0  1  0            999 V2000\n    6.9020   -4.8530    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.3373   -4.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0584   -4.5366    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5992   -4.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8524   -4.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6480   -5.2788    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.6480   -6.1322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9020   -6.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1828   -6.2262    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.1828   -7.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3447   -6.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8787   -5.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3447   -5.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1828   -5.1503    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.8510   -5.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9834   -4.3960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3775   -4.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2503   -3.7407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  6  1  1  0  0  0  0\n  1 14  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  3  1  6  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 15  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  1  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\nM  END",
          "smiles": "C[C@@]1(C)C[C@H]2[C@H]1CC[C@]3(C)CCC[C@]2(C3)OC=O",
          "formula": "C16H26O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8e4e22f5-0e7e-4664-94fb-ae670e8a4a87"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "250.377",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "202ccc6a-151b-4349-8b56-95335c8cbe6e",
      "version": "5",
      "structure": {
        "id": "dbe8d761-1e6e-4e89-b766-85b9603e160e",
        "molfile": "\n  Marvin  01132111242D          \n\n 20 22  0  0  1  0            999 V2000\n    8.5436   -5.2788    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6480   -5.2788    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.6480   -6.1322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9020   -6.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1828   -6.2262    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1828   -7.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3447   -6.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8787   -5.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3447   -5.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1828   -5.1503    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9834   -4.3960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8510   -5.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9020   -4.8530    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6321   -4.4668    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3373   -4.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0584   -4.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5992   -4.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8524   -4.7111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3775   -4.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2503   -3.7407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12  5  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13  2  1  0  0  0  0\n 13 10  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  2 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 11 19  1  0  0  0  0\n 19 20  2  0  0  0  0\nM  END",
        "smiles": "CC1(C)C[C@@]2([H])[C@@]1([H])CC[C@]3(C)CCC[C@]2(C3)OC=O",
        "formula": "C16H26O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "250.377",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "400e19ba-ef52-442a-97eb-fa1dc6a2b68d",
          "cabfa5ab-56de-4ae9-88bb-619b26d7c6ea"
        ],
        "stereo_centers": 4
      },
      "unii": "6CS460KB0F"
    }
  ]
}