{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6455580d-9d3b-4b41-862e-d56a88530525", "code": "3351-05-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3351-05-1", "code_system": "CAS", "references": [ "cff4e979-12fd-443f-8a93-4a7e620d9174", "50f0065b-14e5-4f0a-ae9a-2dee33f977b5" ] }, { "uuid": "7ed0908d-d102-4280-811f-d5a3c7b8d68b", "code": "222-111-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.102", "code_system": "ECHA (EC/EINECS)", "references": [ "cff4e979-12fd-443f-8a93-4a7e620d9174" ] }, { "uuid": "1cc514d0-fcb0-ceb6-1d36-63f14b03c37c", "code": "DTXSID7044920", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7044920", "code_system": "EPA CompTox", "references": [ "dbd8a52a-e544-f3e1-3c19-7cb432789f89" ] }, { "uuid": "dc04cf71-1d21-48b8-83c5-7845006a236b", "code": "6BJW83X6LV", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "da17f4b3-0fd7-2c0d-c487-b57d37ac2a85", "code": "47746", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=47746", "code_system": "NSC", "references": [ "165b5898-218a-cbe9-6db3-55bba3ed75a8" ] } ], "substance_class": "chemical", "names": [ { "uuid": "8a680265-8e5f-4b4d-9872-268b441333be", "name": "1-NAPHTHALENESULFONIC ACID, 8-(PHENYLAMINO)-5-((4-((3-SULFOPHENYL)AZO)-1-NAPHTHALENYL)AZO)-, DISODIUM SALT", "stdName": "1-NAPHTHALENESULFONIC ACID, 8-(PHENYLAMINO)-5-((4-((3-SULFOPHENYL)AZO)-1-NAPHTHALENYL)AZO)-, DISODIUM SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fa2c26a0-c34e-4e36-bbad-15a0af3115fa", "5f4a837d-8d5b-485c-9e84-9249f9184650" ], "display_name": false }, { "uuid": "40268338-e15d-4c9f-bbd6-f0b32dbc80d5", "name": "1-NAPHTHALENESULFONIC ACID, 8-(PHENYLAMINO)-5-(2-(4-(2-(3-SULFOPHENYL)DIAZENYL)-1-NAPHTHALENYL)DIAZENYL)-, SODIUM SALT (1:2)", "stdName": "1-NAPHTHALENESULFONIC ACID, 8-(PHENYLAMINO)-5-(2-(4-(2-(3-SULFOPHENYL)DIAZENYL)-1-NAPHTHALENYL)DIAZENYL)-, SODIUM SALT (1:2)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fa2c26a0-c34e-4e36-bbad-15a0af3115fa", "5f4a837d-8d5b-485c-9e84-9249f9184650" ], "display_name": false }, { "uuid": "0f49f8c5-6b24-4e40-af3e-94d1f0a19933", "name": "ACID BLUE 113", "stdName": "ACID BLUE 113", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1aa78d55-7cc5-4de3-9ebf-51474e6b566d", "fa2c26a0-c34e-4e36-bbad-15a0af3115fa" ], "display_name": true }, { "uuid": "53b744e6-2f2f-4b2b-94d1-26fa62fb047f", "name": "C.I. 26360", "stdName": "C.I. 26360", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fa2c26a0-c34e-4e36-bbad-15a0af3115fa", "5f4a837d-8d5b-485c-9e84-9249f9184650" ], "display_name": false }, { "uuid": "8be62565-aad5-49db-b965-1d3108e95d97", "name": "C.I. ACID BLUE 113", "stdName": "C.I. ACID BLUE 113", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fa2c26a0-c34e-4e36-bbad-15a0af3115fa", "7c1b7d23-3bb2-44ca-90a1-9e9f9e12f23a" ], "display_name": false }, { "uuid": "3bc76e68-2e84-45f9-9cf8-bb95bb02f169", "name": "C.I. ACID BLUE 113, DISODIUM SALT", "stdName": "C.I. ACID BLUE 113, DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fa2c26a0-c34e-4e36-bbad-15a0af3115fa", "5f4a837d-8d5b-485c-9e84-9249f9184650" ], "display_name": false }, { "uuid": "35a009a2-2cec-4434-bd28-0779c4f41e94", "name": "CI 26360", "stdName": "CI 26360", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1aa78d55-7cc5-4de3-9ebf-51474e6b566d", "fa2c26a0-c34e-4e36-bbad-15a0af3115fa" ], "display_name": false }, { "uuid": "02bb6bea-be37-44e7-9689-c1c3c4f53981", "name": "CI ACID BLUE 113", "stdName": "CI ACID BLUE 113", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1aa78d55-7cc5-4de3-9ebf-51474e6b566d", "fa2c26a0-c34e-4e36-bbad-15a0af3115fa" ], "display_name": false }, { "uuid": "5cb45ef1-f20e-44d0-8905-5bcff5676c65", "name": "CI ACID BLUE 113, DISODIUM SALT", "stdName": "CI ACID BLUE 113, DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1aa78d55-7cc5-4de3-9ebf-51474e6b566d", "fa2c26a0-c34e-4e36-bbad-15a0af3115fa" ], "display_name": false }, { "uuid": "45c96a1c-47f8-4594-9afc-cbfc6c6555b8", "name": "NSC-47746", "stdName": "NSC-47746", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "61547a13-4ca4-4001-9b2a-11f67cf5512b", "fa2c26a0-c34e-4e36-bbad-15a0af3115fa" ], "display_name": false } ], "references": [ { "uuid": "1aa78d55-7cc5-4de3-9ebf-51474e6b566d", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "fa2c26a0-c34e-4e36-bbad-15a0af3115fa", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7c1b7d23-3bb2-44ca-90a1-9e9f9e12f23a", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5f4a837d-8d5b-485c-9e84-9249f9184650", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "61547a13-4ca4-4001-9b2a-11f67cf5512b", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cff4e979-12fd-443f-8a93-4a7e620d9174", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392281000, "tags": [ "NOMEN" ] }, { "uuid": "08ff26c6-911f-4606-869e-72bfce184982", "citation": "SRS import [6BJW83X6LV]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6BJW83X6LV", "doc_type": "SRS", "public_domain": true, "document_date": 1493392281000, "tags": [ "NOMEN" ] }, { "uuid": "dbd8a52a-e544-f3e1-3c19-7cb432789f89", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3351-05-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "50f0065b-14e5-4f0a-ae9a-2dee33f977b5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "165b5898-218a-cbe9-6db3-55bba3ed75a8", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d19f4bd2-e561-4c5d-b3d0-4a4eb87d7711", "id": "d19f4bd2-e561-4c5d-b3d0-4a4eb87d7711", "molfile": "\n Marvin 01132110502D \n\n 1 0 0 0 0 0 999 V2000\n 1.0185 -4.6754 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "d86b83b0-b588-4246-bbc1-0ce6de6a54ad" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "3fab2e5f-8c5a-464a-8ca1-a3594acabc52", "id": "3fab2e5f-8c5a-464a-8ca1-a3594acabc52", "molfile": "\n Marvin 01132103222D \n\n 45 50 0 0 0 0 999 V2000\n 0.3068 -4.2828 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.7117 -3.5833 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -3.9882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.1661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1290 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7117 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1290 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9635 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3684 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9635 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1906 -2.1475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6078 -2.8715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4300 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8472 -3.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6694 -3.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0867 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9088 -2.8715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3138 -2.1475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1483 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5655 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3877 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7926 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6148 -2.1475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0443 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8665 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2715 -0.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8665 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0443 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6148 -0.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3877 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7926 -3.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3877 -4.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5655 -4.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1483 -3.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5655 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6148 -3.5833 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6148 -2.7611 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.6148 -4.4054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4493 -3.5833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6694 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0867 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6694 -0.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8472 -0.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4300 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8472 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 2 0 0 0 0\n 5 2 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 9 1 0 0 0 0\n 11 12 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 45 13 2 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 40 16 2 0 0 0 0\n 17 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 35 19 2 0 0 0 0\n 20 21 2 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 30 22 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 24 29 2 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 28 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 35 1 0 0 0 0\n 31 32 2 0 0 0 0\n 31 36 1 0 0 0 0\n 32 33 1 0 0 0 0\n 34 33 2 0 0 0 0\n 35 34 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 2 0 0 0 0\n 36 39 2 0 0 0 0\n 40 41 1 0 0 0 0\n 40 45 1 0 0 0 0\n 41 42 2 0 0 0 0\n 43 42 1 0 0 0 0\n 44 43 2 0 0 0 0\n 45 44 1 0 0 0 0\nM CHG 2 1 -1 37 -1\nM END", "smiles": "c1ccc(cc1)Nc2ccc(c3cccc(c32)S(=O)(=O)[O-])/N=N/c4ccc(c5ccccc54)/N=N/c6cccc(c6)S(=O)(=O)[O-]", "formula": "C32H21N5O6S2", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "352cb0f5-40f1-4a47-a982-a2d83fa127a1" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "635.6724", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2b7575c0-a3ee-46df-b21f-b415593a528d", "version": "4", "structure": { "id": "ebef7038-c728-4ed9-b740-b84fde2ddfc4", "molfile": "\n Marvin 01132112122D \n\n 47 50 0 0 0 0 999 V2000\n 1.0185 -4.6754 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 11.8297 -2.8102 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 9.3877 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5655 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7926 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1483 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1483 -3.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7926 -3.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3877 -4.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5655 -4.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5655 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3877 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6148 -3.5833 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6148 -4.4054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6148 -2.7611 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 11.4493 -3.5833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6148 -2.1475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0443 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8665 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2715 -0.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8665 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0443 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6148 -0.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9088 -2.8715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3138 -2.1475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6694 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8472 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0867 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4300 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4300 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0867 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6694 -3.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8472 -3.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8472 -0.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6694 -0.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1906 -2.1475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6078 -2.8715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1290 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7117 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1290 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9635 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3684 -2.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9635 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7117 -3.5833 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -3.9882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.1661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3068 -4.2828 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 3 8 1 0 0 0 0\n 4 6 1 0 0 0 0\n 4 7 1 0 0 0 0\n 5 12 2 0 0 0 0\n 5 17 1 0 0 0 0\n 6 11 2 0 0 0 0\n 6 25 1 0 0 0 0\n 7 10 2 0 0 0 0\n 8 9 2 0 0 0 0\n 8 13 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 2 0 0 0 0\n 17 22 1 0 0 0 0\n 18 23 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 24 31 1 0 0 0 0\n 24 25 2 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\n 26 31 1 0 0 0 0\n 27 29 1 0 0 0 0\n 27 30 1 0 0 0 0\n 28 35 2 0 0 0 0\n 29 34 2 0 0 0 0\n 30 33 2 0 0 0 0\n 30 37 1 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 42 1 0 0 0 0\n 36 37 2 0 0 0 0\n 38 43 2 0 0 0 0\n 38 39 1 0 0 0 0\n 38 44 1 0 0 0 0\n 39 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 42 43 1 0 0 0 0\n 44 45 2 0 0 0 0\n 44 46 2 0 0 0 0\n 44 47 1 0 0 0 0\nM CHG 4 1 1 2 1 15 -1 47 -1\nM END", "smiles": "c1ccc(cc1)Nc2ccc(c3cccc(c32)S(=O)(=O)[O-])/N=N/c4ccc(c5ccccc54)/N=N/c6cccc(c6)S(=O)(=O)[O-].[Na+].[Na+]", "formula": "C32H21N5O6S2.2Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "681.652", "optical_activity": "NONE", "references": [ "7c1b7d23-3bb2-44ca-90a1-9e9f9e12f23a", "08ff26c6-911f-4606-869e-72bfce184982" ], "stereo_centers": 0 }, "unii": "6BJW83X6LV" } ] }