{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "77b149be-fce6-4d34-8178-7d479d529a53",
          "code": "6B8Q87JVZ7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6bcaaa4e-e1e1-41b0-a701-655521ace7ac",
          "code": "77842-39-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77842-39-8",
          "code_system": "CAS",
          "references": [
            "d82a9284-bd56-f276-4aeb-e1eb728c54ce"
          ]
        },
        {
          "uuid": "10c1c2cf-2027-6a03-42f3-236efd845637",
          "code": "DTXSID901300044",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901300044",
          "code_system": "EPA CompTox",
          "references": [
            "b091b626-1ca4-d03a-be15-edc01ca2c8fa"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2efb6924-f768-4cdc-ae11-f9cd6914a47f",
          "name": "4-methyl-DL-Glutamic acid, erythro-",
          "stdName": "4-METHYL-DL-GLUTAMIC ACID, ERYTHRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d82a9284-bd56-f276-4aeb-e1eb728c54ce"
          ],
          "display_name": true
        },
        {
          "uuid": "27650569-0318-69ff-e066-32b4e2cf06a8",
          "name": "D-Glutamic acid, 4-methyl-, (4S)-rel-",
          "stdName": "4-METHYL-D-GLUTAMIC ACID, (4RS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d82a9284-bd56-f276-4aeb-e1eb728c54ce"
          ],
          "display_name": false
        },
        {
          "uuid": "b5b13ef2-187d-46a4-9690-997e0251793e",
          "name": "DL-Glutamic acid, 4-methyl-, erythro-",
          "stdName": "DL-GLUTAMIC ACID, 4-METHYL-, ERYTHRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d82a9284-bd56-f276-4aeb-e1eb728c54ce"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d82a9284-bd56-f276-4aeb-e1eb728c54ce",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9972cb0e-6390-f0ec-28f4-1cfa953c5b2f",
          "citation": "PubChem",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "b091b626-1ca4-d03a-be15-edc01ca2c8fa",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3ca5207c-1932-419d-b0fa-41ae1c9f4a24",
          "id": "3ca5207c-1932-419d-b0fa-41ae1c9f4a24",
          "molfile": "\n  Marvin  07272213322D          \n\n 11 10  0  0  0  0            999 V2000\n    1.4289    0.8250    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8578    0.8250    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5723    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8578    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5723    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  1  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n  8 11  2  0  0  0  0\nM  END",
          "smiles": "C[C@H](C[C@@H](C(=O)O)N)C(=O)O",
          "formula": "C6H11NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c7bda06d-0efb-4fc1-8e41-9bba985a4b7f"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "161.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "34e98deb-14c8-452f-bb60-7d07f536ee8a",
      "version": "9",
      "structure": {
        "id": "f313366e-7787-4b07-8299-0d28328db96a",
        "molfile": "rel-(4S)-4-Methyl-D-glutamic acid\n   JSDraw207272213322D\n\n 11 10  0  0  0  0              0 V2000\n   23.8170   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1679   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4660   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8170   -9.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5190   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1150   -8.0860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4660   -5.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8700   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5190   -9.6460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2210   -8.0860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8700   -5.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  1  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n  8 11  2  0  0  0  0\nM  END",
        "smiles": "C[C@H](C[C@@H](C(=O)O)N)C(=O)O",
        "formula": "C6H11NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "161.1561",
        "optical_activity": "( + / - )",
        "references": [
          "d82a9284-bd56-f276-4aeb-e1eb728c54ce"
        ],
        "stereo_centers": 2
      },
      "unii": "6B8Q87JVZ7"
    }
  ]
}