{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d3092910-e5f1-40d8-b435-de0ff2d6f866",
          "code": "128596-80-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=128596-80-5",
          "code_system": "CAS",
          "references": [
            "22dc3091-37fe-4035-92b2-712c1b7a8ac2",
            "824cb4b1-0925-4f98-bb58-cd065a890ba6"
          ]
        },
        {
          "uuid": "77cb5c94-dd5f-4699-b7f5-b4ca1772485d",
          "code": "71308479",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71308479",
          "code_system": "PUBCHEM",
          "references": [
            "22dc3091-37fe-4035-92b2-712c1b7a8ac2"
          ]
        },
        {
          "uuid": "0b357343-3ff0-4e89-9254-90e68a31e9ad",
          "code": "6B0IF0U3U5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0350857b-99bb-9720-deec-cd95b0342a0c",
          "code": "766",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=766",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "132f1de5-a378-f891-c8e4-4511d86ae433"
          ]
        },
        {
          "uuid": "553ae696-24b0-480e-564a-05c7390f4962",
          "code": "1015",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=1015",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "132f1de5-a378-f891-c8e4-4511d86ae433"
          ]
        },
        {
          "uuid": "ff7c0695-6b88-ef8d-340c-1e3093dbee04",
          "code": "880",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=880",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "132f1de5-a378-f891-c8e4-4511d86ae433"
          ]
        },
        {
          "uuid": "df5fe8cb-2086-fd7c-5aa4-4bdc147d2416",
          "code": "921",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=921",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "132f1de5-a378-f891-c8e4-4511d86ae433"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6906a34d-4bde-47df-857b-0ae07eadf03d",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0b1e3bf5-8cbd-4f0d-8e70-64b24070e28c",
            "refuuid": "2928e1ab-34f4-49e0-b925-d7c585a0fc27",
            "name": "3'-SIALYLLACTOSE",
            "unii": "3J7TAL60G3",
            "linking_id": "3J7TAL60G3",
            "ref_pname": "3'-SIALYLLACTOSE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e3fe9de0-b869-4fe5-8680-3edf26996efd",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "fda3fc36-5921-4e16-8d40-8fbff3fa7f48",
            "refuuid": "2928e1ab-34f4-49e0-b925-d7c585a0fc27",
            "name": "3'-SIALYLLACTOSE",
            "unii": "3J7TAL60G3",
            "linking_id": "3J7TAL60G3",
            "ref_pname": "3'-SIALYLLACTOSE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e3ab7ae8-d08f-4c87-8eb8-bb3baa4f2b83",
          "name": "3'-SIALYLLACTOSE SODIUM",
          "stdName": "3'-SIALYLLACTOSE SODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a3e8de-5d58-4bc0-a2ca-78a364b4ec97"
          ],
          "display_name": false
        },
        {
          "uuid": "23ae29e3-dea9-4cfb-bae3-8c99edb1c57e",
          "name": "3'-SIALYLLACTOSE SODIUM SALT",
          "stdName": "3'-SIALYLLACTOSE SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0aeee613-8340-4346-8cc6-7402ded9f2bc"
          ],
          "display_name": false
        },
        {
          "uuid": "a68137ca-5d95-4b93-bc53-4dab147a393a",
          "name": "D-GLUCOSE, O-(N-ACETYL-.ALPHA.-NEURAMINOSYL)-(2->3)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-, MONOSODIUM SALT",
          "stdName": "D-GLUCOSE, O-(N-ACETYL-.ALPHA.-NEURAMINOSYL)-(2->3)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-, MONOSODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5411bec2-af12-4452-b222-c6259f7e2972"
          ],
          "display_name": false
        },
        {
          "uuid": "17b8ab4d-ba29-4d92-a160-6aa493288711",
          "name": "O-(N-ACETYL-.ALPHA.-NEURAMINOSYL)-(2->3)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-D-GLUCOSE, MONOSODIUM SALT",
          "stdName": "O-(N-ACETYL-.ALPHA.-NEURAMINOSYL)-(2->3)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-D-GLUCOSE, MONOSODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a3e8de-5d58-4bc0-a2ca-78a364b4ec97"
          ],
          "display_name": false
        },
        {
          "uuid": "3e91fddf-cc4b-4847-90fc-fc93fa83282d",
          "name": "SIALYLLACTOSE SODIUM",
          "stdName": "SIALYLLACTOSE SODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a3e8de-5d58-4bc0-a2ca-78a364b4ec97"
          ],
          "display_name": true
        },
        {
          "uuid": "e1ea54a2-38a2-451e-875a-624fa349bc61",
          "name": "SODIUM 3'-SIALYLLACTOSE",
          "stdName": "SODIUM 3'-SIALYLLACTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0aeee613-8340-4346-8cc6-7402ded9f2bc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0aeee613-8340-4346-8cc6-7402ded9f2bc",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "40a3e8de-5d58-4bc0-a2ca-78a364b4ec97",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5411bec2-af12-4452-b222-c6259f7e2972",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22dc3091-37fe-4035-92b2-712c1b7a8ac2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392455000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e44694c3-8226-4112-a361-f6be5cdb0322",
          "citation": "SRS import [6B0IF0U3U5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6B0IF0U3U5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392455000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "132f1de5-a378-f891-c8e4-4511d86ae433",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "824cb4b1-0925-4f98-bb58-cd065a890ba6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b86dbebd-1632-44cd-8a26-009700510796",
          "id": "b86dbebd-1632-44cd-8a26-009700510796",
          "molfile": "\n  Marvin  01132109322D          \n\n  1  0  0  0  1  0            999 V2000\n    3.7204   -1.5620    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5e618cb1-b52d-4900-966e-e84772ce070f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "beee987b-fa74-4f09-b8e9-928154215ad7",
          "id": "beee987b-fa74-4f09-b8e9-928154215ad7",
          "molfile": "\n  Marvin  01132109522D          \n\n 43 44  0  0  1  0            999 V2000\n    5.4339   -7.2007    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.7197   -7.6154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1526   -7.6154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1526   -8.4403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4339   -6.3758    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.1526   -5.9657    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1526   -5.1408    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.4339   -4.7260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4339   -3.9011    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.7198   -3.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0057   -3.9011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1526   -3.4865    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.1526   -2.6616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8667   -3.9011    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.5806   -3.4865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4055   -3.4865    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.1791   -3.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8131   -3.2402    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.5867   -3.5220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6688   -2.4261    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.3028   -1.8981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0763   -2.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7101   -1.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2206   -2.9895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8952   -2.1443    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.2612   -2.6768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2612   -1.6164    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.4877   -1.8981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4055   -0.8023    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.7717   -0.2697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1791   -0.5205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3235    0.2939    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.2612   -4.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8952   -4.8331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4877   -4.5824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8667   -4.7260    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.5806   -5.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7198   -5.9657    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.7198   -5.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0057   -6.3758    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.0057   -7.2007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2917   -5.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2917   -5.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 38  1  0  0  0  0\n  7  6  1  6  0  0  0\n  7  8  1  0  0  0  0\n 36  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  6  0  0  0\n 12  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  6  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 36  1  0  0  0  0\n 16 15  1  1  0  0  0\n 16 17  1  0  0  0  0\n 16 26  1  0  0  0  0\n 16 33  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  6  0  0  0\n 25 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 25 26  1  1  0  0  0\n 27 25  1  0  0  0  0\n 27 28  1  6  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  6  0  0  0\n 29 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 33 34  1  0  0  0  0\n 33 35  2  0  0  0  0\n 36 37  1  1  0  0  0\n 38 39  1  1  0  0  0\n 38 40  1  0  0  0  0\n 40 41  1  1  0  0  0\n 40 42  1  0  0  0  0\n 42 43  2  0  0  0  0\nM  CHG  1  32  -1\nM  END",
          "smiles": "CC(=O)N[C@@H]1[C@H](C[C@](C(=O)O)(O[C@H]1[C@@H]([C@@H](C[O-])O)O)O[C@H]2[C@H]([C@@H](CO)O[C@H]([C@@H]2O)O[C@H]([C@@H](CO)O)[C@@H]([C@H](C=O)O)O)O)O",
          "formula": "C23H38NO19",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "47595eb6-08f8-4943-b862-e60d9ba9b7dc"
          },
          "defined_stereo": 15,
          "ez_centers": 0,
          "molecular_weight": "632.5441",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 15
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "602de58e-47d1-4441-be23-cf45d892f04b",
      "version": "6",
      "structure": {
        "id": "abf08589-73a6-4928-ba3e-8bd1605a9194",
        "molfile": "\n  Marvin  01132108552D          \n\n 46 46  0  0  1  0            999 V2000\n    3.7204   -1.5620    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    5.4339   -3.9011    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4339   -4.7260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1526   -5.1408    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8667   -4.7260    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.8667   -3.9011    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1526   -3.4865    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1526   -2.6616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5806   -3.4865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4055   -3.4865    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2612   -2.6768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8952   -2.1443    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.6688   -2.4261    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.8131   -3.2402    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.1791   -3.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5867   -3.5220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3028   -1.8981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0763   -2.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7101   -1.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2206   -2.9895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3054   -1.4301    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2612   -1.6164    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.4055   -0.8023    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.1791   -0.5205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3235    0.2939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7717   -0.2697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4877   -1.8981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2612   -4.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8952   -4.8331    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.4877   -4.5824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5806   -5.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1526   -5.9657    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4339   -6.3758    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4339   -7.2007    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1526   -7.6154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1526   -8.4403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7197   -7.6154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7198   -5.9657    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.0057   -6.3758    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.2917   -5.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2917   -5.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0057   -7.2007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7198   -5.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7198   -6.7906    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7198   -3.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0057   -3.9011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  1  0  0  0  0\n  7  8  1  6  0  0  0\n  6  9  1  6  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 10  1  0  0  0  0\n 14 16  1  1  0  0  0\n 13 17  1  6  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 12 21  1  6  0  0  0\n 12 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 23 26  1  6  0  0  0\n 22 27  1  6  0  0  0\n 10 28  1  6  0  0  0\n 28 29  1  0  0  0  0\n 28 30  2  0  0  0  0\n  5 31  1  1  0  0  0\n  4 32  1  6  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  0  0  0  0\n 34 37  1  1  0  0  0\n 33 38  1  0  0  0  0\n 38 39  1  0  0  0  0\n 39 40  1  0  0  0  0\n 40 41  2  0  0  0  0\n 39 42  1  1  0  0  0\n 38 43  1  1  0  0  0\n 33 44  1  1  0  0  0\n  2 45  1  6  0  0  0\n 45 46  1  0  0  0  0\nM  CHG  2   1   1  29  -1\nM  END",
        "smiles": "CC(=O)N[C@@H]1[C@H](C[C@](C(=O)[O-])(O[C@@]1([H])[C@@H]([C@@H](CO)O)O)O[C@H]2[C@H]([C@@H](CO)O[C@H]([C@@H]2O)O[C@]([H])([C@@H](CO)O)[C@@H]([C@H](C=O)O)O)O)O.[Na+]",
        "formula": "C23H38NO19.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 15,
        "ez_centers": 0,
        "molecular_weight": "655.5338",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5411bec2-af12-4452-b222-c6259f7e2972",
          "e44694c3-8226-4112-a361-f6be5cdb0322"
        ],
        "stereo_centers": 15
      },
      "unii": "6B0IF0U3U5"
    }
  ]
}