{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1e7b38c8-3a45-4a78-bad9-57e0afa46f09",
          "code": "502453-61-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=502453-61-4",
          "code_system": "CAS",
          "references": [
            "e82b78c0-19bb-4c23-9c4a-10c3ed6718bd",
            "1272285d-9a87-4aa4-a03d-09a925cc7350"
          ]
        },
        {
          "uuid": "c87da849-1a50-463d-ae13-65e3d6b765cc",
          "code": "12011964",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12011964",
          "code_system": "PUBCHEM",
          "references": [
            "e82b78c0-19bb-4c23-9c4a-10c3ed6718bd"
          ]
        },
        {
          "uuid": "ce176864-5481-a7d3-4cfc-1c9c6f62ffc9",
          "code": "DTXSID50198249",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50198249",
          "code_system": "EPA CompTox",
          "references": [
            "00bcc81b-b467-1c61-802b-27cc9c87d3a8"
          ]
        },
        {
          "uuid": "5e0326bd-7f0b-4cc1-a8a7-cfd90c33d465",
          "code": "6A8OGM5UU7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "578dd1ab-c5fd-42d7-9bb2-bd5f9af73a6e",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "35be0ad0-9e84-452d-9eb1-db22ad7aedb0",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d058ba9a-fdfa-469a-9a1b-c11c4437f19a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e82b78c0-19bb-4c23-9c4a-10c3ed6718bd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d27dedb7-bedf-4045-8540-3f12b47ffae3",
          "citation": "SRS import [6A8OGM5UU7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6A8OGM5UU7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391501000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb528dda-1dc8-4966-89fb-f59b918413a4",
          "citation": "HC BLUE NO.16 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "00bcc81b-b467-1c61-802b-27cc9c87d3a8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=502453-61-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1272285d-9a87-4aa4-a03d-09a925cc7350",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "752afe21-d03f-a137-a494-985e3bda97e0",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "5d5e4294-a77f-4416-b85f-f0eba43e9da6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "58373be4-067d-4d1e-bfc9-d786488666f6",
          "id": "58373be4-067d-4d1e-bfc9-d786488666f6",
          "molfile": "\n  CDK     05282417002D\n\n 28 30  0  0  0  0  0  0  0  0999 V2000\n   32.5668   -1.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2158   -2.3400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2158   -3.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8648   -4.6799    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   29.3312   -3.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3286   -4.9508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8648   -6.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5138   -7.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5138   -8.5797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1629   -9.3597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1629  -10.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5149  -11.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5149  -13.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1629  -14.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8110  -13.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8110  -11.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4590  -10.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4590   -9.3597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1071  -11.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7551  -10.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4032  -11.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4032  -13.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7551  -14.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1071  -13.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4590  -14.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4590  -15.5995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1629  -15.5995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5138  -16.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 11 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 19 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 15 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 14 27  1  0  0  0  0\n 27 28  1  0  0  0  0\nM  CHG  1   4   1\nM  END",
          "smiles": "CCC[N+](C)(C)CCCNc1ccc(c2c1C(=O)c3ccccc3C2=O)NC",
          "formula": "C23H30N3O2",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c9b1d19a-8726-4aae-b811-b9c4a7d913cb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "380.5041",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "8e70f372-cb71-4169-9d8f-7b610b7974f5",
          "id": "8e70f372-cb71-4169-9d8f-7b610b7974f5",
          "molfile": "\n  CDK     05282417002D\n\n  1  0  0  0  0  0  0  0  0  0999 V2000\n   24.4590  -12.4796    0.0000 Br  0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[Br-]",
          "formula": "Br",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d2c963da-44a7-46a8-983c-29859202fb66"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "79.9035",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "90a9f299-34cf-4e49-8169-4935b620dc22",
      "version": "10",
      "structure": {
        "id": "355a3cee-74cf-4423-adf7-7c12d61e3fe5",
        "molfile": "\n   JSDraw205282417002D\n\n 29 30  0  0  0  0              0 V2000\n   32.5668   -1.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2158   -2.3400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2158   -3.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8648   -4.6799    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   29.3312   -3.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3286   -4.9508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8648   -6.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5138   -7.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5138   -8.5797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1629   -9.3597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1629  -10.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5149  -11.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5149  -13.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1629  -14.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8110  -13.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8110  -11.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4590  -10.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4590   -9.3597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1071  -11.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7551  -10.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4032  -11.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4032  -13.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7551  -14.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1071  -13.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4590  -14.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4590  -15.5995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1629  -15.5995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5138  -16.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4590   -4.7220    0.0000 Br  0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 11 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 19 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 15 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 14 27  1  0  0  0  0\n 27 28  1  0  0  0  0\nM  CHG  2   4   1  29  -1\nM  END",
        "smiles": "CCC[N+](C)(C)CCCNc1ccc(c2c1C(=O)c3ccccc3C2=O)NC.[Br-]",
        "formula": "C23H30N3O2.Br",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "460.4076",
        "optical_activity": "NONE",
        "references": [
          "d058ba9a-fdfa-469a-9a1b-c11c4437f19a",
          "d27dedb7-bedf-4045-8540-3f12b47ffae3"
        ],
        "stereo_centers": 0
      },
      "unii": "6A8OGM5UU7",
      "relationships": [
        {
          "uuid": "3f52a0d4-e0e5-4e5b-bdfe-247791bf9c8f",
          "amount": {
            "uuid": "7ba0d15e-8e0b-480b-beda-47d14c5ef044"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "5d5e4294-a77f-4416-b85f-f0eba43e9da6"
          ],
          "related_substance": {
            "uuid": "0d841b5d-16f8-4158-a705-2be6d67a54f9",
            "refuuid": "c75469b6-5fb7-4d9e-b93a-e4e93e0ef82b",
            "name": "Dimethyl-[3-[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]propyl]-propylazanium",
            "unii": "25L4X4NE42",
            "linking_id": "25L4X4NE42",
            "ref_pname": "Dimethyl-[3-[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]propyl]-propylazanium",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "cd87db49-50a8-4b67-99df-e514ba3ba7e4",
          "name": "1-Propanaminium, 3-[[9,10-dihydro-4-(methylamino)-9,10-dioxo-1-anthracenyl]amino]-N,N-dimethyl-N-propyl-, bromide",
          "stdName": "1-PROPANAMINIUM, 3-((9,10-DIHYDRO-4-(METHYLAMINO)-9,10-DIOXO-1-ANTHRACENYL)AMINO)-N,N-DIMETHYL-N-PROPYL-, BROMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d058ba9a-fdfa-469a-9a1b-c11c4437f19a",
            "35be0ad0-9e84-452d-9eb1-db22ad7aedb0"
          ],
          "display_name": false
        },
        {
          "uuid": "177272fe-f4b4-4fdc-ab5d-7f80ab4f1f99",
          "name": "1-Propanaminium, 3-[[9,10-dihydro-4-(methylamino)-9,10-dioxo-1-anthracenyl]amino]-N,N-dimethyl-N-propyl-, bromide (1:1)",
          "stdName": "1-PROPANAMINIUM, 3-((9,10-DIHYDRO-4-(METHYLAMINO)-9,10-DIOXO-1-ANTHRACENYL)AMINO)-N,N-DIMETHYL-N-PROPYL-, BROMIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d058ba9a-fdfa-469a-9a1b-c11c4437f19a",
            "35be0ad0-9e84-452d-9eb1-db22ad7aedb0"
          ],
          "display_name": false
        },
        {
          "uuid": "580e89ab-82ef-49a8-819a-8a25d1d5272a",
          "name": "HC Blue 16",
          "stdName": "HC BLUE 16",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d5e4294-a77f-4416-b85f-f0eba43e9da6"
          ],
          "display_name": false
        },
        {
          "uuid": "65704cc3-0f13-4305-a185-2ee06f626264",
          "name": "HC Blue No. 16",
          "stdName": "HC BLUE NO. 16",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb528dda-1dc8-4966-89fb-f59b918413a4",
            "35be0ad0-9e84-452d-9eb1-db22ad7aedb0",
            "578dd1ab-c5fd-42d7-9bb2-bd5f9af73a6e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "36542f98-da24-44b8-99f9-be5c9dccaa65",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "modifications": {
        "uuid": "cfef1a65-94f5-4e44-aa7c-7c11f8fad306"
      }
    }
  ]
}