{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "697f62e3-97b8-4bcb-9feb-1505ab4df8f8",
          "code": "101622-51-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=101622-51-9",
          "code_system": "CAS",
          "references": [
            "0c92e912-1acb-4500-80b1-f6965569941b",
            "334156b1-ecde-4b0d-bb0b-040f67828348"
          ]
        },
        {
          "uuid": "d2e106a3-887b-4bd0-a3fb-637fc2136715",
          "code": "4592",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4592",
          "code_system": "PUBCHEM",
          "references": [
            "0c92e912-1acb-4500-80b1-f6965569941b"
          ]
        },
        {
          "uuid": "333c7de8-2cc7-53ba-9f9b-265019e5c9f1",
          "code": "DTXSID90144068",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90144068",
          "code_system": "EPA CompTox",
          "references": [
            "69d2e170-bc9b-0786-7a5b-2872152d5b03"
          ]
        },
        {
          "uuid": "3477d7b9-6e11-0dd0-53d1-6e6b72c0e010",
          "code": "DB02116",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02116",
          "code_system": "DRUG BANK",
          "references": [
            "1da33204-a458-9f5e-a6c4-f98de6918084"
          ]
        },
        {
          "uuid": "ae952b6e-32e4-481d-aa68-051750f52aec",
          "code": "6A839B2HYS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4d7ec776-3ec3-3cfd-0a72-080b48bbb143",
          "code": "666096",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=666096",
          "code_system": "NSC",
          "references": [
            "ea1a6225-be50-6f4a-5ce8-81c8a8471d94"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "64707757-43b7-4ebe-beb5-23a6034efdec",
          "name": "ETHANOL, 2-((9-METHYL-6-((PHENYLMETHYL)AMINO)-9H-PURIN-2-YL)AMINO)-",
          "stdName": "ETHANOL, 2-((9-METHYL-6-((PHENYLMETHYL)AMINO)-9H-PURIN-2-YL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad180d95-57a2-4f1f-8aee-180d6455a08f",
            "20eab125-870a-47fc-9b8f-11580cb87baf"
          ],
          "display_name": false
        },
        {
          "uuid": "db117de7-b93c-42a8-8a57-e04c6cad4b95",
          "name": "NSC-666096",
          "stdName": "NSC-666096",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88218fb6-143c-42c5-a624-c24da1211ccb",
            "20eab125-870a-47fc-9b8f-11580cb87baf"
          ],
          "display_name": false
        },
        {
          "uuid": "253b7cbb-209a-49fe-96e6-ee3b48f2ad87",
          "name": "OLOMOUCINE",
          "stdName": "OLOMOUCINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c033f31-af65-4c21-a0e5-3f358202245d",
            "87dfd999-a5ee-4af8-a67a-6dfb03d4364c"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "87dfd999-a5ee-4af8-a67a-6dfb03d4364c",
          "citation": "CHEMID 2011 Drugportal",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3c033f31-af65-4c21-a0e5-3f358202245d",
          "citation": "DRUGPORTAL 2011",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88218fb6-143c-42c5-a624-c24da1211ccb",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20eab125-870a-47fc-9b8f-11580cb87baf",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad180d95-57a2-4f1f-8aee-180d6455a08f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c92e912-1acb-4500-80b1-f6965569941b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "488bc278-c051-405c-aba0-84d84e06210e",
          "citation": "SRS import [6A839B2HYS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=6A839B2HYS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d44ab61-6198-48e8-8309-a21472c06341",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69d2e170-bc9b-0786-7a5b-2872152d5b03",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=101622-51-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1da33204-a458-9f5e-a6c4-f98de6918084",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "334156b1-ecde-4b0d-bb0b-040f67828348",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ea1a6225-be50-6f4a-5ce8-81c8a8471d94",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8f3fbcc3-fa28-4bef-9b22-ab64731c8be0",
          "id": "8f3fbcc3-fa28-4bef-9b22-ab64731c8be0",
          "molfile": "\n  Marvin  01132107262D          \n\n 22 24  0  0  0  0            999 V2000\n    5.9341   -4.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6792   -3.9791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1641   -3.3116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6792   -2.6442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8946   -2.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1801   -2.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1801   -1.6616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -1.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -0.4241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7511   -0.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7511    0.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657    1.2259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1801    0.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1801   -0.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -2.8991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -3.7241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7511   -4.1366    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7511   -4.9616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -5.3741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -6.1991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1801   -4.1366    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8946   -3.7241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 22  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n 22  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n 15  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 21 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "Cn1cnc2c(NCc3ccccc3)nc(NCCO)nc21",
          "formula": "C15H18N6O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8b510231-e365-4df1-89df-c58bdf9064d0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "298.3436",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "041e0483-4516-44e1-8f80-bb894b9c010f",
      "version": "8",
      "structure": {
        "id": "265a18e8-0425-42a2-ad58-d44b1e019948",
        "molfile": "\n  Marvin  01132102072D          \n\n 22 24  0  0  0  0            999 V2000\n    3.4657   -5.3741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7511   -4.9616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7511   -4.1366    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6792   -2.6442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1641   -3.3116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6792   -3.9791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8946   -3.7241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1801   -4.1366    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -3.7241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -2.8991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1801   -2.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8946   -2.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1801   -1.6616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -1.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -0.4241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7511   -0.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7511    0.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657    1.2259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1801    0.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1801   -0.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9341   -4.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4657   -6.1991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n  4 12  1  0  0  0  0\n  7 12  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 15 20  2  0  0  0  0\n 14 15  1  0  0  0  0\n 13 14  1  0  0  0  0\n 11 13  1  0  0  0  0\n  6 21  1  0  0  0  0\n  3  9  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1 22  1  0  0  0  0\nM  END",
        "smiles": "Cn1cnc2c(NCc3ccccc3)nc(NCCO)nc21",
        "formula": "C15H18N6O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "298.3436",
        "optical_activity": "NONE",
        "references": [
          "8d44ab61-6198-48e8-8309-a21472c06341",
          "488bc278-c051-405c-aba0-84d84e06210e"
        ],
        "stereo_centers": 0
      },
      "unii": "6A839B2HYS"
    }
  ]
}